%!PS-Adobe-2.0 %%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software %%Title: CO_H_Pd210_resub.dvi %%Pages: 8 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%DocumentFonts: Helvetica Courier Math1 Math2 %%DocumentPaperSizes: a4 %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips CO_H_Pd210_resub.dvi -o CO_H_Pd210_resub.ps %DVIPSParameters: dpi=600, compressed %DVIPSSource: TeX output 2004.06.23:1107 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: 8r.enc % @@psencodingfile@{ % author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry", % version = "0.6", % date = "22 June 1996", % filename = "8r.enc", % email = "kb@@mail.tug.org", % address = "135 Center Hill Rd. // Plymouth, MA 02360", % codetable = "ISO/ASCII", % checksum = "119 662 4424", % docstring = "Encoding for TrueType or Type 1 fonts to be used with TeX." % @} % % Idea is to have all the characters normally included in Type 1 fonts % available for typesetting. This is effectively the characters in Adobe % Standard Encoding + ISO Latin 1 + extra characters from Lucida. % % Character code assignments were made as follows: % % (1) the Windows ANSI characters are almost all in their Windows ANSI % positions, because some Windows users cannot easily reencode the % fonts, and it makes no difference on other systems. The only Windows % ANSI characters not available are those that make no sense for % typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen % (173). quotesingle and grave are moved just because it's such an % irritation not having them in TeX positions. % % (2) Remaining characters are assigned arbitrarily to the lower part % of the range, avoiding 0, 10 and 13 in case we meet dumb software. % % (3) Y&Y Lucida Bright includes some extra text characters; in the % hopes that other PostScript fonts, perhaps created for public % consumption, will include them, they are included starting at 0x12. % % (4) Remaining positions left undefined are for use in (hopefully) % upward-compatible revisions, if someday more characters are generally % available. % % (5) hyphen appears twice for compatibility with both ASCII and Windows. % /TeXBase1Encoding [ % 0x00 (encoded characters from Adobe Standard not in Windows 3.1) /.notdef /dotaccent /fi /fl /fraction /hungarumlaut /Lslash /lslash /ogonek /ring /.notdef /breve /minus /.notdef % These are the only two remaining unencoded characters, so may as % well include them. /Zcaron /zcaron % 0x10 /caron /dotlessi % (unusual TeX characters available in, e.g., Lucida Bright) /dotlessj /ff /ffi /ffl /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef % very contentious; it's so painful not having quoteleft and quoteright % at 96 and 145 that we move the things normally found there down to here. /grave /quotesingle % 0x20 (ASCII begins) /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash % 0x30 /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question % 0x40 /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O % 0x50 /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore % 0x60 /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o % 0x70 /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef % rubout; ASCII ends % 0x80 /.notdef /.notdef /quotesinglbase /florin /quotedblbase /ellipsis /dagger /daggerdbl /circumflex /perthousand /Scaron /guilsinglleft /OE /.notdef /.notdef /.notdef % 0x90 /.notdef /.notdef /.notdef /quotedblleft /quotedblright /bullet /endash /emdash /tilde /trademark /scaron /guilsinglright /oe /.notdef /.notdef /Ydieresis % 0xA0 /.notdef % nobreakspace /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen % Y&Y (also at 45); Windows' softhyphen /registered /macron % 0xD0 /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown % 0xC0 /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis % 0xD0 /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls % 0xE0 /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis % 0xF0 /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 39158280 55380996 1000 600 600 (CO_H_Pd210_resub.dvi) @start %DVIPSBitmapFont: Fa cmsy9 9 3 /Fa 3 34 df<007FB712FCB812FEA26C16FC2F047A943C>0 D<0060153000F815F86C14 01007EEC03F06CEC07E06C6CEB0FC06C6CEB1F806C6CEB3F006C6C137E6C6C5B6C6C485A 90387E03F06D485A90381F8FC090380FDF806DB4C7FC6D5A6D5AA2497E497E90380FDF80 90381F8FC090383F07E090387E03F0496C7E48486C7E4848137E48487F4848EB1F804848 EB0FC048C7EA07E0007EEC03F048EC01F848140000601530252475A43C>2 D<187018F0A2841878A2187C183C183E84A2727E727E85727E727E727E197F007FBA12C0 BB12F0A26C19C0CCEA7F0019FC4E5A4E5A4E5A614E5A4EC7FCA2183E183C187C1878A218 F860A2187044287CA64D>33 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb cmsy5 5 2 /Fb 2 15 df0 D14 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc cmr5 5 7 /Fc 7 101 df<1360EA01E0120F12FF12F11201B3A3387FFF80A2111C7B9B1C>49 DII<903807F8029038 3FFF069038FC038E3903F000FED807C0133E485A48C7121E003E140E123C007C1406A212 7800F81400A61278007C1406A2123C003E140C7E6C6C13186C6C1338D803F013703900FC 03C090383FFF80903807FC001F1E7C9C28>67 D79 DI100 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd cmmi7 7 5 /Fd 5 101 df<48B61280000715C0481580481500263C0C06C7FC127012C0EB1C0EEA00 18A21338A2EB701EA313F013E01201141F120313C0000780A2380F800FA26C486CC7FC22 1A7D9827>25 D<010FB5FC013F148049140048B6FC2603F07EC7FC3807C01FEA0F80497E 5A123EA2003C5B127CA30078133E12F8143C0078137C14785C6C485A495A381E0F80D80F FEC8FCEA03F8211A7D9826>27 D35 D<1238127C12FEA3127C123807077A8614>58 D<15F8141FA2EC01F0A21403A215E0A21407A215C0A2140FEB1F8F90387FCF80EBF0EF38 03C03FEA0780390F001F00A2001E5B123E003C133E127C147E5A147CA214FC5AECF830A3 903801F060A2EA7803010E13C0393C1CF980381FF07F3907C01E001D297CA723>100 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe cmr6 6 9 /Fe 9 101 df<130C1338137013E0EA01C0EA038013005A120EA25AA25AA312781270A3 12F0AB1270A312781238A37EA27EA27E7E1380EA01C0EA00E013701338130C0E317AA418 >40 D<12C012707E7E7E7E7E1380EA01C0A2EA00E0A21370A313781338A3133CAB1338A3 13781370A313E0A2EA01C0A2EA038013005A120E5A5A5A12C00E317CA418>I<13E01201 120712FF12F91201B3A7487EB512C0A212217AA01E>49 DI<13FF000313C0380F03E0381C00F014F8003E13FC147CA2001E13FC120CC7 12F8A2EB01F0EB03E0EB0FC03801FF00A2380003E0EB00F01478147C143E143F12301278 12FCA2143E48137E0060137C003813F8381E03F0380FFFC00001130018227DA01E>I<49 B41320010FEBC06090393F80F0E09038FC0019D801F0130D484813074848130348481301 48C7FC481400123E127E1660127C12FC1600A7007C1560127EA2123E003F15C07E6C6CEB 01806C7E6C6CEB03006C6C1306D800FC131C90383F807890380FFFE0010190C7FC23247C A22B>67 D<49B4FC010F13E090383F01F89038F8003E48487FD803C0EB0780000715C048 48EB03E048C7EA01F04815F8003E1400007E15FCA2007C157C00FC157EA8007E15FCA300 3E15F8003F14016C15F06C6CEB03E06D13076C6CEB0FC0D801F0EB1F00D800FC137E9038 3F01F890380FFFE0010190C7FC27247CA22F>79 D97 D<140F14FFA2141F80A913FF000313CF38 07C0FF380F003F001E7F487F127C127812F8A71278127C123C003E5B6CEB3F80390FC1EF F03803FF8F3900FE0F001C247DA222>100 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmsy6 6 3 /Ff 3 15 df0 D<136013701360A20040132000E0137038F861 F0387E67E0381FFF803807FE00EA00F0EA07FE381FFF80387E67E038F861F038E0607000 40132000001300A21370136014157B9620>3 D14 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg cmmi6 6 1 /Fg 1 99 df98 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmmi9 9 8 /Fh 8 115 df18 D<013FB6128090B712C01203481680481600271F00C018C7FC001C1438EA380100701430 00601380EAE00300001470A2EB0700A25B15F0130E131EA2013E7F133C137CA213FC497F A2000180A2485A157EA2D801C013382A217E9F2C>25 D<91B6FC01031580130F013F1500 495C2701FF03FCC7FC3803F80048487F49137E485A121F49133E48C7127EA25A127EA215 FE00FE5C5AA24A5AA24A5A007C5C14074A5A6C495A4AC8FC6C137C380F81F83803FFE0C6 6CC9FC29217E9F2C>27 D<17E0D801C0EC01F0EE03F81203485A90C81201481500000E16 785A173812180038010314300030497EA217700070010F1460006091C7FCA217E0020E14 C000E01501141EEE03806C013E1307027EEB0F006C01FF5BD87801EB803E3A7E07EFC07E D87FFFEBFFFC02C75B6C01875B261FFE035B6C48C65BD803F0013EC7FC2D2280A030>33 D<123C127E12FFA4127E123C08087A8715>58 D<010FB712FEA218FC903A003FC0000317 00187C4B143CA2027F151C181892C8FCA25CA24A1303A201014A1338040613304A150016 0E13035E4A137C91B512FC5B5EECF0001638130F16305C1860011F027013E0046013C04A 140104001380133F17034A15005F017F150EA291C8121E5F49157C5F4914030001ED1FF0 B8FCA25F37337DB239>69 D100 D<3903E003E0390FF81FF8391C7C3C1C0018EB703E3938 3EE0FE38303FC0EB7F800070EB00FCEA607E157000E01400EAC0FEEA40FC1200A212015B A312035BA312075BA3120F5BA3121F5B0007C8FC1F227EA023>114 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmbx10 10 1 /Fi 1 108 df<13FFB5FCA412077EAF92380FFFE0A4923803FC0016F0ED0FE0ED1F804B C7FC157E5DEC03F8EC07E04A5A141FEC7FE04A7E8181A2ECCFFEEC0FFF496C7F806E7F6E 7F82157F6F7E6F7E82150F82B5D8F83F13F8A42D3A7EB932>107 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj cmti10 10 7 /Fj 7 117 df65 D<14F8EB07FE90381F871C90383E03FE137CEBF801120148486C5A485A120FEBC001001F 5CA2EA3F801403007F5C1300A21407485C5AA2140F5D48ECC1C0A2141F15831680143F15 87007C017F1300ECFF076C485B9038038F8E391F0F079E3907FE03FC3901F000F0222677 A42A>97 D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0F8EBE7FE 9038EF0F80390FFC07C013F89038F003E013E0D81FC013F0A21380A2123F1300A214075A 127EA2140F12FE4814E0A2141F15C05AEC3F80A215005C147E5C387801F8007C5B383C03 E0383E07C0381E1F80D80FFEC7FCEA01F01C3B77B926>I105 D110 D<147F903803FFC090380FC1F090381F00F8017E137C5B4848137E4848 133E0007143F5B120F485AA2485A157F127F90C7FCA215FF5A4814FEA2140115FC5AEC03 F8A2EC07F015E0140F007C14C0007EEB1F80003EEB3F00147E6C13F8380F83F03803FFC0 C648C7FC202677A42A>I 116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk cmr7 7 23 /Fk 23 117 df23 D<1306130C13181330136013E0EA01C0EA0380A2EA07005A120E121EA2121C123CA35AA5 12F85AAB7E1278A57EA3121C121EA2120E120F7EEA0380A2EA01C0EA00E0136013301318 130C13060F3B7AAB1A>40 D<12C012607E7E7E120E7EEA0380A2EA01C013E0120013F0A2 13701378A3133CA5133E131EAB133E133CA51378A3137013F0A213E0120113C0EA0380A2 EA0700120E120C5A5A5A5A0F3B7DAB1A>I<140EB3A2B812E0A3C7000EC8FCB3A22B2B7D A333>43 D48 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215 267BA521>I<13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4 127CC7FC15005C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA01 80390300030012065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F8 381C007C0030137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF80 91C7FC380001E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B 6C5B381F01F03807FFC0C690C7FC19277DA521>I<1438A2147814F81301A21303130713 06130C131C131813301370136013C012011380EA03005A120E120C121C5A12305A12E0B6 12E0A2C7EAF800A7497E90383FFFE0A21B277EA621>I<0018130C001F137CEBFFF85C5C 1480D819FCC7FC0018C8FCA7137F3819FFE0381F81F0381E0078001C7F0018133EC7FC80 A21580A21230127C12FCA3150012F00060133E127000305B001C5B380F03E03803FFC0C6 48C7FC19277DA521>II<1230123C003FB512E0A215C0481480A239700007000060130E140C48131C 5C5CC75A5C1301495AA249C7FC5B130E131EA3133E133CA2137CA413FCA813781B287DA6 21>I<137F3803FFE0380781F8380E007C48131E5A801278A3127C007E131EEA3F80EBE0 3C6C6C5A380FFCF03807FFC06C5BC613E0487F38079FFC380F07FEEA1E0348C67E48133F EC1F8048130FA21407A315001278140E6C5B6C5B380F80F03803FFE0C66CC7FC19277DA5 21>I<137F3801FFC03807C1E0380F0070001E1378003E7F003C133E007C131EA200FC13 1FA41580A4007C133FA2123C003E137F001E135F380F01DF3807FF9F3801FE1FD8001013 001300A2143E123C007E133CA25C5C007C5B383003C0381C0780D80FFFC7FCEA03F81927 7DA521>I<140EA2141FA34A7EA3EC6FC0A2ECEFE014C7A290380183F0A390380301F8A2 01067F1400A249137EA2011C137F01187FA24980013FB5FCA2903960000FC0A201E08049 1307A248486D7EA200038115011207D81FC0497ED8FFF890383FFFE0A22B2A7EA931>65 D<91387FC002903903FFF80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848 147E4848143E5B000F151E48C8FC48150E123EA2007E1506A2127C00FC1500A8127C007E 1506A2123EA2003F150C7E6C7E000715186D14386C6C14306C6C1460D8007CEB01C0013F EB038090390FE01E00903803FFF89038007FC0272A7DA82F>67 D 69 D<90387F80203903FFF06039078078E0380E000E4813074813030078130100701300 12F0A21560A27E1500127C127FEA3FE013FF6C13F06C13FC000313FFC61480010F13C001 0013E0EC0FF014031401EC00F8A200C01478A46C1470A26C14F06C14E06CEB01C000EFEB 078039E3E01F0038C0FFFC38801FF01D2A7DA825>83 D91 D93 D<133F3801FFE03803E1F0380F80F8381F007C143E123E007E131E141F127C12FCA2B6FC A200FCC7FCA4127C127E1403123E6C1307380F800E3807C01C3803E0783800FFE0EB3F80 181C7E9A1E>101 D<120EEA3F80A5EA0E00C7FCA7EA078012FFA2121F120FB3121FEAFF F8A20D287EA713>105 D<13C0A41201A312031207120F121FB512E0A23807C000AC1430 A73803E060A23801F0C03800FF80EB3F0014257FA31A>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl cmsy7 7 3 /Fl 3 15 df0 D<1338A50060130C00F8133E00FC137E00FE13 FE383FBBF83807FFC000011300EA007C48B4FC000713C0383FBBF838FE38FE00FC137E00 F8133E0060130C00001300A517197B9A22>3 D<137F3801FFC0000713F0380FC1F8381F 007C003C131E0038130E0078130F00707F00F01480481303A56C13070070140000785B00 38130E003C131E001F137C380FC1F86CB45A000113C06C6CC7FC19197C9A22>14 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmmi10 10 10 /Fm 10 101 df12 D18 D<013FB612E090B712F05A120717E0270F807006C7FC391E 00600E48140C003813E04813C048141CEAC0011200148001035BA213071400A25B157801 1E137CA3133E133C137C157E13FC5B1201157F1203497FA3D801C0131C2C257EA32F>25 D<027FB512C00103B612E0130F5B017F15C09026FF81FEC7FC3901FC007E48487F485A49 7F484880485AA248C7FCA2127EA2153F00FE92C7FC5AA25D157E5A5DA24A5AA24A5A007C 495A5D003C495A003E013FC8FC6C137C380F81F83803FFE0C66CC9FC2B257DA32F>27 D34 D<121C127FEAFF80A5EA7F00121C0909798817> 58 D<0103B812F05BA290260007F8C7123F4B1407F003E0020F150118005DA2141FA25D 19C0143FA24B1330A2027F1470190092C7126017E05C16014A495A160F49B6FCA25F9138 FC000F01031407A24A6DC8FCA201075C18034A130660010F160693C7FC4A150E180C011F 161C18184A1538A2013F5E18F04A4A5AA2017F15074D5A91C8123F49913803FF80B9FCA2 95C7FC3C397DB83D>69 D<147E903803FF8090390FC1C38090391F00EFC0017E137F4913 3F485A4848EB1F8012075B000F143F48481400A2485A5D007F147E90C7FCA215FE485C5A A214015D48150CA21403EDF01C16181407007C1538007E010F1330003E131F027B13706C 01E113E03A0F83C0F9C03A03FF007F80D800FCEB1F0026267DA42C>97 D99 D<163FED1FFFA3ED007F167EA216FEA216FCA21501A216F8A21503A216F0A21507A2 027E13E0903803FF8790380FC1CF90381F00EF017EEB7FC049133F485A4848131F000715 805B000F143F485A1600485A5D127F90C7127EA215FE5A485CA21401A248ECF80CA21403 161CEDF0181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0F9C0 3A03FF007F80D800FCEB1F00283B7DB92B>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fn cmsy10 10 5 /Fn 5 113 df<007FB81280B912C0A26C17803204799641>0 D<0060150600F8150F6C15 1F007E153F6C157E6C6C14FC6C6CEB01F86C6CEB03F06C6CEB07E06C6CEB0FC06C6CEB1F 80017EEB3F006D137E6D6C5A90380FC1F8903807E3F0903803F7E06DB45A6D5B6EC7FCA2 4A7E497F903803F7E0903807E3F090380FC1F890381F80FC90383F007E017E7F49EB1F80 4848EB0FC04848EB07E04848EB03F04848EB01F84848EB00FC48C8127E007E153F48151F 48150F00601506282874A841>2 D25 D<181EA4181F84A285180785727EA2 727E727E85197E85F11F80F10FC0F107F0007FBA12FCBCFCA26C19FCCCEA07F0F10FC0F1 1F80F13F00197E61614E5A4E5AA24E5A61180F96C7FCA260181EA4482C7BAA53>33 D112 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fo cmbx9 9 48 /Fo 48 120 df<147014F0EB03E0EB07C0EB0F80131FEB3F00133E137E5B485AA2485AA2 12075B120FA2485AA3485AA3127FA390C7FCA35AAF7EA37FA3123FA36C7EA36C7EA21207 7F1203A26C7EA26C7E137E133E133FEB1F80130FEB07C0EB03E0EB00F01470144B78B722 >40 D<12E07E127C7E7E7F6C7E12077F6C7E6C7EA26C7EA27F137E137FA2EB3F80A3EB1F C0A314E0A3130FA314F0AF14E0A3131FA314C0A3EB3F80A3EB7F00A2137E13FE5BA2485A A2485A485A5B120F485A90C7FC123E5A12F05A144B7BB722>I<120FEA3FC0EA7FE0EAFF F0A6EA7FE0EA3FC0EA0F000C0C7A8B19>46 D<1507ED0F80A2151F1600A25D153E157E15 7CA215FC5D14015DA214035D14075DA2140F5D141F92C7FCA25C143E147E147CA214FC5C 13015CA213035C13075CA2130F5C131F91C8FCA25B133E137E137CA213FC5B12015BA212 035B12075BA2120F5B121F90C9FCA25A123E127E127CA212FC5AA21270214B7BB72C>I< EB03FE90383FFFE090B512F848EB07FC3903FC01FE48486C7E4848EB7F8049133F001F15 C0A2003F15E049131F007F15F0A500FF15F8B1007F15F0A4003F15E06D133FA2001F15C0 A26C6CEB7F806C6CEBFF006C6C485A3901FF07FC6CEBFFF8013F13E0D903FEC7FC25327D B02C>I<147814F81303131FEA03FFB5FCA3EAFC1F1200B3B2007FB512FEA41F317AB02C> III<151F5D5DA25D5C5C5C5CA25C143D14 7D14F9EB01F114E1EB03C1EB0781130FEB1F01133E133C137813F01201EA03E0EA07C013 80EA0F00121E123E5A5AB712FEA4C700031300A80103B512FEA427317EB02C>I<000C14 0ED80FE013FE90B5FC5D5D5D5D5D92C7FC14FC14F091C8FC1380A6EB87FE9038BFFFC090 B512F09038FC0FF89038E003FE01C07F497E01001480000E6D13C0C8FCA216E0A3121FEA 7F807F487EA316C05B5CD87F801480D87C0014006C5B393F8007FE391FE01FFC0007B512 F06C14C0C691C7FCEB1FF823327CB02C>II<123C123F90B612F8A44815F016E016C0168016005D 007CC7127E00785C4A5A00F8495A48495A4A5A4A5AC7FC4AC7FC147E14FE5C13015C1303 A2495AA2130FA2131FA25C133FA4137FA96D5AA2010FC8FC25337BB12C>III65 DIIII72 D I76 DII<913803FF80027F13FC49B6FC 0107010113C0903A1FF8003FF0D93FE0EB0FF8D9FFC0EB07FE48496D7E4890C76C138049 80000717C04848ED7FE0A24848ED3FF0A2003F17F8A2007F17FC49151FA300FF17FEAB00 7F17FCA26D153FA2003F17F8A36C6CED7FF0A26C6CEDFFE0000717C06D5C6C17806C6D49 13006C6D495AD97FF0EB1FFCD91FF8EB3FF0903A07FF01FFC0010190B5C7FC6D6C13FC02 0713C037357BB342>II82 D I<003FB812F8A4D9F003EB801FD87F80ED03FC01001501007E1600007C177CA20078173C A400F8173E48171EA4C71600B3A9011FB612F0A437327DB13E>I II97 D<903807FF80013F13F090B512FC 3903FE01FE4848487EEA0FF8EA1FF0EA3FE0A2007F6D5A496C5A153000FF91C7FCA9127F 7FA2003FEC07807F6C6C130F000FEC1F00D807FE133E3903FF80FCC6EBFFF8013F13E001 0790C7FC21217DA027>99 DI<903803FF80013F13F090B512FC48EB03FE3907FC007F4848EB3F804848EB1FC0 5B003FEC0FE0127F5B16F012FF150790B6FCA301C0C8FCA4127F7F123F16F06C7E000F14 016C6CEB03E0D803FEEB0FC03A01FF807F806C6CB51200011F13FC010313E024217EA029 >II<16F890390F FC07FE90387FFF9F48B6127F3907FC0FFC380FF003001F14FED9E001133E003FECFF1C16 00A6001F5CEBF003000F5C3907FC0FF890B512E0486C1380D90FFCC7FC48C9FCA37F7F90 B512F015FE6CECFF8016E06C15F06C15F84815FC121F393F80001F48C7EA03FE48140148 1400A46C14016C6CEB03FC6C6CEB07F86C6CEB0FF0D80FFCEB7FE00003B61280C6ECFE00 010F13E028327EA12C>I105 D107 DI<2703F803FEEB03FE00FF90 3B1FFFC01FFFC0027FD9E07F7F913BF81FF0F81FF0903CF9E00FF9E00FF8260FFBC0EBFB C06CB4486CB4486C7E02001400495CA3495CB2B500E0B500E0B512E0A443217CA04A>I< 3901F803FF00FF010F13C0023F13F09138FC0FF89039F9E007FC380FFBC06CB4486C7E14 00A25BA25BB2B539E07FFFF0A42C217DA031>I<903803FF80011F13F090B512FE48EB01 FF3A07FC007FC0D80FF0EB1FE0001F15F049130F003F15F8491307007F15FCA300FF15FE A8007F15FCA26D130F003F15F8001F15F06D131F6C6CEB3FE06C6CEB7FC03A01FF01FF00 6CEBFFFE013F13F80103138027217EA02C>I<3901FC07FC00FF90387FFF8001FDB512E0 9039FFF01FF89138C007FC000F90380003FE6C4880496D1380A26F13C0A3EE7FE0A9EEFF C0A34B1380A26D4913006D495A9138C00FFC9138F03FF801FDB512E0D9FC7F1380DA0FF8 C7FC91C9FCABB512E0A42B307EA031>I<3901F81F8000FFEB7FF0ECFFF89038F9E3FC90 38FBC7FE380FFF876C1307A213FEEC03FCEC01F8EC0060491300B1B512F0A41F217EA024 >114 D<9038FFE1C0000713FF5A383F803F387E000F14075A14037EA26C6CC7FC13FCEB FFE06C13FC806CEBFF80000F14C06C14E0C6FC010F13F0EB007F140F00F0130714037EA2 6C14E06C13076CEB0FC09038C01F8090B5120000F913FC38E03FE01C217DA023>I<133C A5137CA313FCA21201A212031207001FB51280B6FCA3D807FCC7FCB0EC03C0A79038FE07 8012033901FF0F006C13FEEB3FFCEB0FF01A2F7EAE22>I119 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmr8 8 36 /Fp 36 122 df<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A 5A126009157A8714>44 D<123C127E12FFA4127E123C08087A8714>46 D48 D50 DI<000CEB 0180380FC01F90B512005C5C14F014C0D80C7EC7FC90C8FCA8EB1FC0EB7FF8380DE07C38 0F801F01001380000E130F000CEB07C0C713E0A2140315F0A4127812FCA448EB07E012E0 006014C00070130F6C14806CEB1F006C133E380780F83801FFE038007F801C2D7DAB23> 53 DI56 D<123C127E12FFA4127E 123C1200AD123C127E12FFA4127E123C081D7A9C14>58 D<4A7E4A7EA34A7EA24A7EA3EC 1BF81419A2EC30FCA2EC70FEEC607EA24A7EA349486C7EA2010380EC000FA201066D7EA3 496D7EA2011FB57EA29038180001496D7EA349147EA201E0147F4980A20001ED1F801203 000716C0D80FF0EC3FE0D8FFFC0103B5FCA2302F7EAE35>65 D67 D<90387FFFF0A201001300147EB3AD123812FE A314FE5C1278387001F86C485A381E07E03807FF80D801FCC7FC1C2E7DAC24>74 DI80 D<90383F80303901FFF0703807C07C390F000EF0001E130748130348 13011400127000F01470A315307EA26C1400127E127FEA3FE013FE381FFFE06C13FC6C13 FF00011480D8003F13E013039038003FF0EC07F81401140015FC157C12C0153CA37EA215 787E6C14706C14F06CEB01E039F78003C039E3F00F0038E07FFE38C00FF01E2F7CAD27> 83 D<13FF000713C0380F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF137F 3801FE1FEA07F0EA1FC0EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF8C 391F83C7FC390FFF03F83901FC01E01F207D9E23>97 DII<15F8141FA214011400ACEB0FE0EB7FF83801F8 1E3803E0073807C003380F8001EA1F00481300123E127EA25AA9127C127EA2003E13017E EB8003000F13073903E00EFC3A01F03CFFC038007FF090391FC0F800222F7EAD27>III<013F13F89038FF C3FE3903E1FF1E3807807C000F140C391F003E00A2003E7FA76C133EA26C6C5A00071378 380FE1F0380CFFC0D81C3FC7FC90C8FCA3121E121F380FFFF814FF6C14C04814F0391E00 07F848130048147C12F848143CA46C147C007C14F86CEB01F06CEB03E03907E01F803901 FFFE0038003FF01F2D7E9D23>III108 D<2607C07FEB07F03BFFC3FFC03FFC903AC783F0783F3C0FCE01F8E01F803B07DC00F9C0 0F01F8D9FF8013C04990387F000749137EA249137CB2486C01FEEB0FE03CFFFE0FFFE0FF FEA2371E7E9D3C>I<3807C0FE39FFC3FF809038C703E0390FDE01F0EA07F8496C7EA25B A25BB2486C487E3AFFFE1FFFC0A2221E7E9D27>II< 3807C0FE39FFC7FF809038CF03E0390FDC01F03907F800FC49137E49133E49133FED1F80 A3ED0FC0A8151F1680A2ED3F00A26D137E6D137C5D9038FC01F09038CE07E09038C7FF80 D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B7E9D27>I<380781F838FF87FEEB8E3FEA0F 9CEA07B813B0EBF01EEBE000A45BB0487EB5FCA2181E7E9D1C>114 D<3801FE183807FFB8381E01F8EA3C00481378481338A21418A27E7EB41300EA7FF06CB4 FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C131EA27EA26C133CA26C13 7838FF01F038E3FFC000C0130017207E9E1C>I<1360A413E0A312011203A21207121FB5 12F0A23803E000AF1418A714383801F03014703800F860EB3FE0EB0F80152A7FA81B>I< D807C013F800FF131FA2000F130100071300B21401A314033803E007EC0EFC3A01F81CFF C038007FF890391FE0F800221F7E9D27>I<3BFFFC3FFE07FFA23B0FE003F001F801C090 38E000F00007010114E0812603E00314C0A2913807F8012701F006781380A29039F80E7C 030000D90C3C1300A290397C181E06A2151F6D486C5AA2168C90391F600798A216D89039 0FC003F0A36D486C5AA36DC75A301E7F9C33>119 D<3AFFFC07FF80A23A0FF003FC0000 03EB01F0000114C06D485A000091C7FCEB7C06EB3E0E6D5A14B8EB0FB0EB07E013036D7E 497E1307EB067C497EEB1C1F01387FEB700F496C7E6E7ED803C07F00076D7E391FE003FC 3AFFF007FFC0A2221D7F9C25>I<3AFFFC01FFC0A23A0FE0007E000007147C1538000314 306D137000011460A26C6C5BA2EBFC01017C5BEB7E03013E90C7FCA2EB1F06A2148EEB0F 8CA2EB07D8A2EB03F0A36D5AA26D5AA2495AA2130391C8FC1278EAFC06A25B131CEA7838 EA7070EA3FE0EA0F80222B7F9C25>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fq cmr9 9 81 /Fq 81 128 df<91393FE00FE0903A01FFF83FF8903A07E01EF83C903A1F800FF07E903A 3F001FE0FE017E133F4914C0485A1738484890381F8000ACB812C0A33B03F0001F8000B3 A7486C497EB50083B5FCA32F357FB42D>11 DI15 D23 D25 D<15065D151C15181538903807F030 90383FFE609038F80FE03901E003C048486C7ED807807F390F00037848147C001EEB063C 003EEB0E3E140C48497EA2143000FC01701380146014E014C0EB0180130314005BD87C06 14005B007E5CD83E18133E1338D81F305B5BD80FE05B6C48485A6C6C485A3901F80F8026 03BFFEC7FCEB07F00006C9FC120E120C121C12185A212E7EA626>28 D<003C13F0387E01F838FF03FCA2EB83FEA2EA7F81383D80F600011306A40003130EEB00 0CA248131C00061318000E1338000C1330001C13704813E0387001C00060138017177EB3 26>34 D<017C1503D803FEED078026078780140F260F01C0141F261E00E0EC3F00003E01 F8147E003C017CEB01FE007C90397F8007FC913933FFFEF800789038307FF900F8903938 0001F00218495A16075F4C5A161F4CC7FC163E5E023813FC007801305B007C4A5AEC7003 003C01605B003E9038E007C0001EEBC00FD80F015C270787801FC8FC3903FE003FD8007C 133E90C748131F03FCEBFF809239F801E1E0913A01F003C07002039038078030DBE00F13 38DA07C0EB0018020F49131C0380140C91381F001E4A013E130E023E15065C14FC495A5C 495A13075C4948150E011F021E130C91C7121F013E161C017E6E1318017CED8038490207 13300001923803C07049913801E1E049913800FF806C48ED1F00373C7CB740>37 D<123C127EB4FCA21380A2127F123D1201A412031300A25A1206120E120C121C5A5A1260 09177AB315>39 D<14C01301EB0380EB0F00130E5B133C5B5BA2485A485AA212075B120F 90C7FC5AA2121E123EA3123C127CA55AB0127CA5123C123EA3121E121FA27E7F12077F12 03A26C7E6C7EA213787F131C7F130FEB0380EB01C01300124A79B71E>I<12C07E127012 3C121C7E120F6C7E6C7EA26C7E6C7EA27F1378137C133C133EA2131E131FA37F1480A5EB 07C0B0EB0F80A514005BA3131E133EA2133C137C137813F85BA2485A485AA2485A48C7FC 120E5A123C12705A5A124A7CB71E>I<123C127EB4FCA21380A2127F123D1201A4120313 00A25A1206120E120C121C5A5A126009177A8715>44 DI<123C 127E12FFA4127E123C08087A8715>I<1530157815F8A215F01401A215E01403A215C014 07A21580140FA215005CA2143EA2143C147CA2147814F8A25C1301A25C1303A25C1307A2 495AA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A2485AA25B12 0FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601D4B7CB726>II<13075B5B137FEA07FFB5FC13BFEA F83F1200B3B3A2497E007FB51280A319327AB126>IIII<000C14C0380FC00F 90B5128015005C5C14F014C0D80C18C7FC90C8FCA9EB0FC0EB7FF8EBF07C380FC03F9038 001F80EC0FC0120E000CEB07E0A2C713F01403A215F8A41218127E12FEA315F0140712F8 006014E01270EC0FC06C131F003C14806CEB7F00380F80FE3807FFF8000113E038003F80 1D347CB126>I<14FE903807FF80011F13E090383F00F0017C13703901F801F8EBF003EA 03E01207EA0FC0EC01F04848C7FCA248C8FCA35A127EEB07F0EB1FFC38FE381F9038700F 809038E007C039FFC003E0018013F0EC01F8130015FC1400A24814FEA5127EA4127F6C14 FCA26C1301018013F8000F14F0EBC0030007EB07E03903E00FC03901F81F806CB51200EB 3FFCEB0FE01F347DB126>I<1230123C003FB6FCA34814FEA215FC0070C7123800601430 157015E04814C01401EC0380C7EA07001406140E5C141814385CA25CA2495A1303A3495A A2130FA3131F91C7FCA25BA55BA9131C20347CB126>III<123C127E12FFA4127E123C1200 B0123C127E12FFA4127E123C08207A9F15>I<007FB812C0B912E0A26C17C0CCFCAC007F B812C0B912E0A26C17C033147C9C3C>61 D<15E0A34A7EA24A7EA34A7EA3EC0DFE140CA2 EC187FA34A6C7EA202707FEC601FA202E07FECC00FA2D901807F1507A249486C7EA30106 6D7EA2010E80010FB5FCA249800118C77EA24981163FA2496E7EA3496E7EA20001821607 487ED81FF04A7ED8FFFE49B512E0A333367DB53A>65 DIIIIIIII<017FB5FCA39038003FE0EC1FC0B3B1127EB4FCA4EC3F80 5A0060140000705B6C13FE6C485A380F03F03803FFC0C690C7FC20357DB227>IIIIIII82 D<90381FE00390387FFC0748B5FC3907F01FCF390F8003FF48C7FC003E80814880A20078 8000F880A46C80A27E92C7FC127F13C0EA3FF013FF6C13F06C13FF6C14C06C14F0C68001 3F7F01037F9038003FFF140302001380157F153FED1FC0150F12C0A21507A37EA26CEC0F 80A26C15006C5C6C143E6C147E01C05B39F1FC03F800E0B512E0011F138026C003FEC7FC 22377CB42B>I<007FB712FEA390398007F001D87C00EC003E0078161E0070160EA20060 160600E01607A3481603A6C71500B3AB4A7E011FB512FCA330337DB237>IIII89 D91 D93 D97 DII<153FEC0FFFA3EC007F81AEEB07F0EB3FFCEBFC0F3901F003BF39 07E001FF48487E48487F8148C7FCA25A127E12FEAA127E127FA27E6C6C5BA26C6C5B6C6C 4813803A03F007BFFC3900F81E3FEB3FFCD90FE0130026357DB32B>III<151F90391FC07F809039FFF8E3C03901F07FC73907E03F033A0FC01F8380 9039800F8000001F80EB00074880A66C5CEB800F000F5CEBC01F6C6C48C7FCEBF07C380E FFF8380C1FC0001CC9FCA3121EA2121F380FFFFEECFFC06C14F06C14FC4880381F000100 3EEB007F4880ED1F8048140FA56C141F007C15006C143E6C5C390FC001F83903F007E0C6 B51280D91FFCC7FC22337EA126>IIIIII<2703F01FE013FF00FF90267FF80313C0903BF1E07C0F03E0 903BF3803E1C01F02807F7003F387FD803FE1470496D486C7EA2495CA2495CB3486C496C 487EB53BC7FFFE3FFFF0A33C217EA041>I<3903F01FC000FFEB7FF09038F1E0FC9038F3 807C3907F7007EEA03FE497FA25BA25BB3486CEB7F80B538C7FFFCA326217EA02B>II<3903F03F8000FFEBFFE09038 F3C0F89038F7007ED807FE7F6C48EB1F804914C049130F16E0ED07F0A3ED03F8A9150716 F0A216E0150F16C06D131F6DEB3F80160001FF13FC9038F381F89038F1FFE0D9F07FC7FC 91C8FCAA487EB512C0A325307EA02B>I<903807F00390383FFC07EBFC0F3901F8038F38 07E001000F14DF48486CB4FC497F123F90C77E5AA25A5AA9127FA36C6C5B121F6D5B000F 5B3907E003BF3903F0073F3800F81EEB3FF8EB0FE090C7FCAAED7F8091380FFFFCA32630 7DA029>I<3803E07C38FFE1FF9038E38F809038E71FC0EA07EEEA03ECA29038FC0F8049 C7FCA35BB2487EB512E0A31A217FA01E>II<1330A51370A313F0A21201A212031207381FFFFEB5FCA23803F000AF1403 A814073801F806A23800FC0EEB7E1CEB1FF8EB07E0182F7FAD1E>IIIII<3A7FFF807FF8A33A07F8001FC00003EC0F800001EC070015066C6C5BA26D131C017E 1318A26D5BA2EC8070011F1360ECC0E0010F5BA2903807E180A214F3010390C7FC14FBEB 01FEA26D5AA31478A21430A25CA214E05CA2495A1278D8FC03C8FCA21306130EEA701CEA 7838EA1FF0EA0FC025307F9F29>I<003FB512F0A2EB000F003C14E00038EB1FC00030EB 3F800070137F1500006013FE495A13035CC6485A495AA2495A495A49C7FC153013FE485A 12035B48481370485A001F14604913E0485A387F000348130F90B5FCA21C207E9F22>I< B712F8A22502809426>II<001C1370387F01FC00FF13FEA4007F 13FC381C0070170879B226>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fr cmti9 9 54 /Fr 54 128 df11 D<923803FF80031F13F092383F 00F803F8133C4A48133E4A48137E17FE4A5A17FC17384A481300A3141F92C8FCA55C143E 011FB612E0A217C09039007E0007147C160F1780A214FC4A131F1700A301015C4A133EA3 167E0103147C5C1718EEFC1CEEF83C010715385C1778177016F0010F15F04AEBF8E01679 EE3FC0011FEC0F0093C7FC91C9FCA3133EA21238EA7E3C137CEAFE7812FC485AEA79E0EA 3FC0000FCAFC2F4582B42B>II<1560EC01E0EC03C0EC0700140E5C143C5C5C495A495A13 075C49C7FC5B131E5B137C137813F85B12015B12035B1207A25B120FA290C8FC5AA2121E 123EA3123C127CA31278A212F8A35AAF12701278A21238A2123C121CA27EA27E6C7E1201 1B4A75B71F>40 D<14301438A28080A2140F801580A2140315C0A4140115E0A81403A415 C0A31407A31580140FA315005CA3141E143EA2143C147CA25CA25C13015C13035C13075C 130F91C7FC131E133E133C5B5B485AA2485A485A48C8FC121E5A12705A5A1B4A7EB71F> I44 DI<121C127F12FFA412FE123808 08778718>I48 DI II<150E151FA2153F153EA3157E157CA215FC15F8A2140115F0 A2EC03E0A3EC07C0A2EC0F80A2EC1F00A2143EA25C147814F85C1301903803E0E0ECC1F0 EB0781EB0F83EC03E0131E133CEB7C0701F813C0EA01F0EA03E03807C00FD80F801380EA 1FFC383FFFCF48EBFF82D8F00313FF3860003FC7EA1FF8EC3F00143EA3147E147CA314FC 5CA4146020417DB127>I<010614C090380FC00F91B51280160015FC4913F015C0D91CFE C7FC91C8FC133C1338A313781370A313F0EBE0FE9038E3FF809038EF03C03901FC01E001 F87FEBF000497F485A5BC8FCA41401A4003C130300FC5CA34A5A5A00E0495AA24A5A4AC7 FC6C137E00705B387801F8383E07F0381FFFC06C90C8FCEA03F8223478B127>I55 DI<1370EA01FC1203A413F8EA00E01300B0121C127F5AA45A12 380E20779F18>58 D67 D<0107B612C04915F017FC903A003F8001FEEE007FEF1F8092C7EA0FC0EF07E05CEF03F0 147E170102FE15F8A25CA21301A25CA2130317035CA2130718F04A1407A2130F18E04A14 0F18C0011F151F18805CEF3F00133F177E91C85AA2494A5A4C5A017E4A5A4C5A01FE4A5A 047EC7FC49495A0001EC0FF8007FB612E0B7C8FC15F835337BB23A>I<92391FE0018092 38FFF8030207EBFE07913A1FF01F0F0091393F80079F9139FE0003DFD901F86DB4FCD907 F05C49481300495A4948147E49C8127C137E13FE485A48481578A2485AA248481570A248 5A94C7FC123F5BA3127F90CBFCA400FE91383FFFFCA25F9238003F8094C7FCA2007E5DA2 167EA2007F15FE7E5E6C6C1301A26C6C495A6D13076C6CEB0F786C6C133E3A00FF01FC30 90387FFFF0011F01C0C8FCD903FEC9FC313775B43B>71 D<010FB51280A216009038003F C05DA292C7FCA25CA2147EA214FEA25CA21301A25CA21303A25CA21307A25CA2130FA25C A2131FA25CA2133FA291C8FCA25BA2137EA213FEA25B1201B512F8A25C21337BB21E>73 D<902607FFC0ED7FFC4917FF81D9003F4B1300611803023BED077CA2027BED0EFC610273 151C1838DAF1F01439F071F014E118E10101ED01C36102C1EC0383EF070301031607050E 5BEC80F8171C0107ED380F6102001470A249EDE01FDC01C090C7FC130EEE0380011E017C 5C933807003E011C140EA2013C4A137E187C01385C5E017816FC6F485B1370ED3FC001F0 EC80016000011500D807F81503277FFF803E90B512C0B5EB3C01151C46337BB245>77 D<902607FF8090383FFFC0496D5BA2D9001F913803F8004A6C6D5A6060EC3BF0027B1403 60EC71F8A202F11407DAF0FC91C7FC14E0A20101017E5B170E14C0810103151EEE801CEC 801FA20107ECC03C030F1338140016E049010713781770010E14F01503011E15F0705A01 1C1301A2013C14FD03005B133816FF0178147F5F0170143FA213F070C8FC1201EA07F826 7FFF807FB5140EA23A337BB239>II<01 07B612C04915F883903A003F8001FEEE003FEF1F8092C713C0170F5C18E0147EA214FEEF 1FC05CA201011680173F4A1500177E010315FE5F4AEB03F8EE07E00107EC3FC091B6C7FC 16F802E0C9FC130FA25CA2131FA25CA2133FA291CAFCA25BA2137EA213FEA25B1201387F FFF0B5FCA233337CB234>I<0107B512FE49ECFFC017F0903A003F8007F8EE01FCEE007E 92C7127F835C1880147EA214FEEF7F005CA2010115FE5F4A13015F01034A5AEE0FC04A49 5A04FEC7FC49B512F016C09138E003E0ED01F8010F6D7E167C4A137EA2131FA25CA2013F 14FEA291C7FCA24913015E137EEF01C001FE150318805B00011607277FFFF0001400B5EC FE0EEE7E1CC9EA1FF8EE07E032357BB238>82 D<913901FC018091380FFF03023F13C791 387E07EF903A01F801FF0049487E4A7F495A4948133E131F91C7FC5B013E143CA3137E16 38A293C7FC137FA26D7E14E014FE90381FFFC06D13F86D7F01017F6D6C7E020F7F140015 3F6F7E150FA4120EA2001E5D121CA2151F003C92C7FCA2003E143E5D127E007F5C6D485A 9038C007E039F3F80FC000F0B5C8FC38E03FFC38C00FF029377AB42B>I<0003B812C05A 1880903AF800FC003F260FC001141F0180150F01005B001EEE07001403121C003C4A5BA2 00380107140E127800705CA2020F141E00F0161CC74990C7FCA2141FA25DA2143FA292C9 FCA25CA2147EA214FEA25CA21301A25CA21303A25CA21307A25C497E001FB512F05AA232 3374B237>I<3B3FFFF801FFFE485CA2D801FEC7EA1FC049EC0F80170049140EA2161E12 0349141CA2163C1207491438A21678120F491470A216F0121F495CA21501123F90C75BA2 15035A007E5DA2150712FE4892C7FCA25D150E48141E151C153C153815786C5C5D007C13 01007E495A003EEB0F806C011EC8FC380FC0FC6CB45A000113E06C6CC9FC2F3570B239> III97 D<137EEA0FFE121F5B1200A35BA21201A2 5BA21203A25BA21207A2EBC3E0EBCFF8380FDC3EEBF81F497E01E01380EA1FC0138015C0 13005AA2123EA2007E131F1580127CA2143F00FC14005AA2147EA25CA2387801F85C495A 6C485A495A6C48C7FCEA0FFCEA03F01A3578B323>I<14FCEB07FF90381F078090383E03 C0EBFC013801F8033803F0073807E00F13C0120F391F80070091C7FC48C8FCA35A127EA3 12FE5AA4007C14C0EC01E0A2EC03C06CEB0F80EC1F006C137C380F81F03803FFC0C648C7 FC1B2278A023>III<151FED 7FC0EDF0E0020113F0EC03E3A2EC07C316E0EDC1C091380FC0005DA4141F92C7FCA45C14 3E90381FFFFEA3D9007EC7FC147CA414FC5CA513015CA413035CA413075CA3130FA25CA3 131F91C8FCA35B133E1238EA7E3CA2EAFE7812FC485AEA78E0EA3FC0000FC9FC244582B4 18>I<143FECFF80903803E1E6903807C0FF90380F807FEB1F00133E017E133F49133EA2 4848137EA24848137CA215FC12074913F8A21401A2D80FC013F0A21403120715E0140714 0F141F3903E03FC00001137FEBF0FF38007FCF90381F0F801300141FA21500A25C143E12 38007E137E5C00FE5B48485A387803E0387C0F80D81FFFC7FCEA07F820317CA023>III107 D<133FEA07FF5A13FEEA007EA3137CA213FCA213F8A212 01A213F0A21203A213E0A21207A213C0A2120FA21380A2121FA21300A25AA2123EA2127E A2127C1318EAFC1C133CEAF838A21378137012F013F0EAF8E01279EA3FC0EA0F00103579 B314>I<2703C003F8137F3C0FF00FFE01FFC03C1E783C1F07C1E03C1C7CF00F8F01F03B 3C3DE0079E0026383FC001FC7FD97F805B007001005B5E137ED8F0FC90380FC00100E05F D860F8148012000001021F130360491400A200034A13076049013E130FF081800007027E EC83C0051F138049017C1403A2000F02FC1407053E130049495CEF1E0E001F01015D183C 010049EB0FF0000E6D48EB03E03A227AA03F>I<3903C007F0390FF01FFC391E787C1E39 1C7CF01F393C3DE00F26383FC01380EB7F8000781300EA707EA2D8F0FC131F00E01500EA 60F8120000015C153E5BA20003147E157C4913FCEDF8180007153C0201133801C013F0A2 000F1578EDE070018014F016E0001FECE1C015E390C7EAFF00000E143E26227AA02B>I< 14FCEB07FF90381F07C090383E03E09038FC01F0EA01F83903F000F8485A5B120F484813 FCA248C7FCA214014814F8127EA2140300FE14F05AA2EC07E0A2007CEB0FC01580141FEC 3F006C137E5C381F01F0380F83E03803FF80D800FCC7FC1E2278A027>I<011E137C9038 7F81FF9039F3C387C09039E3EF03E03901E1FE01D9C1FC13F0EBC3F8000313F0018314F8 14E0EA07871307000313C01200010F130316F01480A2011F130716E01400A249EB0FC0A2 013EEB1F80A2017EEB3F00017F133E5D5D9038FF81F09038FDC3E09038F8FF80027EC7FC 000190C8FCA25BA21203A25BA21207A25BB5FCA325307FA027>I<3903C00FC0390FF03F F0391E78F078391C7DE03C393C3FC0FC00381380EB7F00007814F8D8707E13701500EAF0 FC12E0EA60F812001201A25BA21203A25BA21207A25BA2120FA25BA2121FA290C8FC120E 1E227AA020>114 DI<1303 EB0F80A3131FA21400A25BA2133EA2137EA2137C387FFFF8A2B5FC3800F800A21201A25B A21203A25BA21207A25BA2120FA25B1460001F13F014E01300130114C01303001E1380EB 07005BEA0F1EEA07F8EA01E015307AAE19>II<01F01338D803FC 13FCEA0F1E120E121C123C0038147CEA783E0070143CA2137ED8F07C1338EA60FCC65A15 78000114705BA215F0000314E05BA2EC01C0A2EBC003158014071500EBE00EA26C6C5A38 00F878EB7FE0EB1F801E227AA023>II<13F0D803FC1307D80F1E130F000E141F121C123C0038143FD8783E 133E1270A2017E137ED8F07C137CEA60FCC65A15FC000114F85BA21401000314F013E0A2 140315E0EA07C0A20003130715C0EBE00F141F0001133F9038F07F8038007FEFEB1F8FEB 001F1500A25C003E133E007E137E147C5C007C5BEA7001495A38380780D83C1FC7FCEA0F FCEA07F020317AA025>121 D<001E13F0387F01F81303EAFF07A338FE03F0383801C015 086CB227>127 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fs cmr10 10 85 /Fs 85 128 df<1506150FA24B7EA24B7EA24B7EA2EDDFF0A29138018FF8A291380307FC A291380603FEA291380E01FF140CDA1C007F141802386D7E143002706D7E146002E06D7E 5C01016E7E5C01036E7E91C7FC496E7E1306010E6E7E130C011C6E7F131801386F7E1330 01706F7E136001E06F7E5B170F484882170748C97F17030006831701488383481880001F B9FC4818C0A24818E0A2BA12F0A23C3C7CBB45>1 D<011FB512FEA39026001FFEC8FCEC 07F8A8EC3FFE0103B512E0D91FF713FC90397F07F87F01FCEC1F80D803F8EC0FE0D807F0 6E7ED80FE06E7E001F82D83FC06E7EA2007F8201808000FF1780A7007F170001C05C003F 5EA2D81FE04A5A000F5ED807F04A5AD803F84A5AD800FCEC1F80017F027FC7FC90391FF7 FFFC0103B512E09026003FFEC8FCEC07F8A8EC1FFE011FB512FEA331397BB83C>8 D11 DIII22 DI<14FF010713C090381F83F090383F00FC017E137E49137F4848 EB3F80A24848131F16C0A7ED3F80A2ED7F00157E5D4A5AEC07E000FFEB7F80A2EC07E000 03EB01F0EC00FC157E811680151FED0FC0A216E0150716F0A3ED03F8AA16F0ECF007EBF1 F816E0ED0FC0A200079038F01F803AFFF0E03F00EC707CEC3FF0C7EA0FC0253C7EBA2A> 25 D<001C131C007F137F39FF80FF80A26D13C0A3007F137F001C131C00001300A40001 130101801380A20003130301001300485B00061306000E130E485B485B485B006013601A 197DB92A>34 D<017C166048B416F02607C3801401260F81C01403D900E04A5A001E0178 4A5A003E6D141F003C013FEC7F80007C90271BE003FFC7FC0218B512BF007891381FFC3E 00F8011CC75A020C14FC5F4C5A16035F4C5A160F5F4CC8FC021C5B00780118133E007C5D 16FC003C01385B003E90383001F0001EEB70036C01E05B903981C007C03907C3800F2601 FF005BD8007C49C9FC90C748EB07C0033EEB1FF04BEB3C3803FCEBF81C4B497E913A01F0 01E00602030103130703E0497E912607C0071480020F15011580DA1F00018013C04A010F 1300143E5C14FC5C495A13035C495A130F4A0107130149C701C013805B013E1603490203 140001FC6F5A49020113064848913800F00E0003705A49ED3C3849ED1FF06C48ED07C03A 437BBD45>37 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A12 06120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB0700130E131E5B5BA2 5B485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB2127CA67EA3121EA212 1F7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB01C0EB00E014601352 78BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378A2137C133C133E131E A2131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A25B131EA2133E133C13 7C1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD20>I<121C127FEAFF 80A213C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A12600A19798817 >44 DI<121C127FEAFF80A5EA7F00121C0909798817>I<150C15 1E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407A21580140FA21500 5CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA25C130FA291C7FC5B A2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A25B120FA290C8FC5A A2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>IIIII<1538A2157815F8A2140114031407A2140F 141F141B14331473146314C313011483EB030313071306130C131C131813301370136013 C01201EA038013005A120E120C5A123812305A12E0B712F8A3C73803F800AB4A7E0103B5 12F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC5D5D158092C7FC14FC 38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E090388003F0496C7E12066E7E C87EA28181A21680A4123E127F487EA490C71300485C12E000605C12700030495A00385C 6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1FE0213A7CB72A>II<12301238123E003FB612E0A316C05A168016000070C7 12060060140E5D151800E01438485C5D5DC712014A5A92C7FC5C140E140C141C5CA25CA2 14F0495AA21303A25C1307A2130FA3495AA3133FA5137FA96DC8FC131E233B7BB82A>I< EB03F8EB1FFF017F13C09038FC07F03901E001F848486C7E4848137C90C77E48141E000E 141F001E80A3121FA27F5D01E0131E6C6C133E01FC133C6D5B6C6C6C5AECC1E06CEBF3C0 6C01FFC7FC6C5BEB3FFF6D13C081017F13F801F07F3903E07FFE3907801FFF48486C1380 481303003E6D13C0003CEB007F007C143F0078EC0FE000F814075A1503A21501A36C15C0 12781503007C15806CEC07006C5C6C6C131ED807E0137C3903F803F0C6B55A013F1380D9 07FCC7FC233A7DB72A>II<121C127FEAFF80A5EA7F00121C C7FCB2121C127FEAFF80A5EA7F00121C092479A317>I<121C127FEAFF80A5EA7F00121C C7FCB2121C127F5A1380A4127F121D1201A412031300A25A1206A2120E5A121812385A12 60093479A317>I<007FB812F8B912FCA26C17F8CCFCAE007FB812F8B912FCA26C17F836 167B9F41>61 D<1538A3157CA315FEA34A7EA34A6C7EA202077FEC063FA2020E7FEC0C1F A2021C7FEC180FA202387FEC3007A202707FEC6003A202C07F1501A2D901807F81A249C7 7F167FA20106810107B6FCA24981010CC7121FA2496E7EA3496E7EA3496E7EA213E0707E 1201486C81D80FFC02071380B56C90B512FEA3373C7DBB3E>65 DI< 913A01FF800180020FEBE003027F13F8903A01FF807E07903A03FC000F0FD90FF0EB039F 4948EB01DFD93F80EB00FF49C8127F01FE153F12014848151F4848150FA248481507A248 5A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180A3123F7F001F160318006C7E 5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD91FE05C6D6CEB03C0D903FCEB 0F80902701FF803FC7FC9039007FFFFC020F13F002011380313D7BBA3C>IIIIIII75 DIIIII82 D I<003FB812E0A3D9C003EB001F273E0001FE130348EE01F00078160000701770A3006017 30A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C>IIII91 D<3901800180000313033907000700000E130E485B001813180038133800301330007013 7000601360A200E013E0485BA400CE13CE39FF80FF806D13C0A3007F137FA2393F803F80 390E000E001A1974B92A>II97 DIIII<147E903803FF8090380FC1E0EB1F8790383F0F F0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8A31C3B 7FBA19>IIIIIII<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E07E903B F1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2495CA3 495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000FFEB3F FCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C497EB5 00C1B51280A329257EA42E>II<3903F01FE000FFEB7FF89038F1E07E 9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016FEA316 7FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F009038F1E0 7E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>II<3807E01F00FFEB7F C09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300A45BB3 A2487EB512F0A31C257EA421>II<1318A51338A31378A313F8120112031207001FB5FCB6FCA2D801 F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220>IIIIII<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0EC3F80 0060137F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA2485A485A 0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247EA325> III126 D<001C131C007F137F39FF80FF80A5397F007F00001C131C190978B72A>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ft cmbx12 12 21 /Ft 21 122 df40 D<12F07E127E7E6C7E6C7E6C7E7F6C7E6C7E12007F137F80133F806D7EA26D7EA26D7EA2 801303A2801301A280A27F1580A4EC7FC0A615E0A2143FAE147FA215C0A6ECFF80A41500 5BA25CA213035CA213075CA2495AA2495AA2495A5C137F91C7FC13FE5B1201485A485A5B 485A485A48C8FC127E12F85A1B647ACA2C>I48 DII67 D<923807FFC092B512FE0207ECFFC0021F15F091267FFE0013FC902601FFF0EB1FFF 01070180010313C04990C76C7FD91FFC6E6C7E49486F7E49486F7E01FF8348496F7E4849 6F1380A248496F13C0A24890C96C13E0A24819F04982003F19F8A3007F19FC49177FA400 FF19FEAD007F19FC6D17FFA3003F19F8A26D5E6C19F0A26E5D6C19E0A26C6D4B13C06C19 806E5D6C6D4B13006C6D4B5A6D6C4B5A6D6C4B5A6D6C4A5B6D01C001075B6D01F0011F5B 010101FE90B5C7FC6D90B65A023F15F8020715C002004AC8FC030713C047467AC454>79 DI<903801FFE0011F13FE017F6D7E48B612E03A03FE00 7FF84848EB1FFC6D6D7E486C6D7EA26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91 B6FC1307013F13F19038FFFC01000313E0000F1380381FFE00485A5B127F5B12FF5BA35D A26D5B6C6C5B4B13F0D83FFE013EEBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB80 07D90FFCC9FC322F7DAD36>97 D100 DI103 DI<137C48B4FC4813804813C0A24813E0A56C13C0A26C13806C1300EA00 7C90C7FCAAEB7FC0EA7FFFA512037EB3AFB6FCA518467CC520>I<90397F8007FEB59038 3FFF8092B512E0028114F8913987F03FFC91388F801F000390399F000FFE6C139E14BC02 F86D7E5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>110 DI<90397FC00FF8B590B57E02C314E002CF14F89139DF C03FFC9139FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0A2EF7FF8 A4EF3FFCACEF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E495A9139DF C07FFC02CFB512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E>I<9038 7F807FB53881FFE0028313F0028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0 ED0FFC9138E007F8ED01E092C7FCA35CB3A5B612E0A5272D7DAC2E>114 D<90391FFC038090B51287000314FF120F381FF003383FC00049133F48C7121F127E00FE 140FA215077EA27F01E090C7FC13FE387FFFF014FF6C14C015F06C14FC6C800003806C15 806C7E010F14C0EB003F020313E0140000F0143FA26C141F150FA27EA26C15C06C141FA2 6DEB3F8001E0EB7F009038F803FE90B55A00FC5CD8F03F13E026E007FEC7FC232F7CAD2C >II 121 D E %EndDVIPSBitmapFont end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%BeginPaperSize: a4 a4 %%EndPaperSize %%EndSetup %%Page: 1 1 1 0 bop 960 -83 a Ft(CO)38 b(and)g(h)m(ydrogen)g(adsorption)g(on)g (Pd\(210\))1024 116 y Fs(Markus)h(Lisc)n(hk)-5 b(a,)43 b(Christian)d(Mosc)n(h,)j(and)d(Axel)g(Gro\031)461 203 y Fr(Physik-Dep)l(artment)c(T30,)f(T)-6 b(e)l(chnische)34 b(Universit\177)-39 b(at)35 b(M)q(\177)-40 b(unchen,)35 b(D-85747)g(Gar)l(ching,)g(Germany)1577 291 y Fq(\(Dated:)f(June)25 b(23,)i(2004\))383 432 y(W)-6 b(e)21 b(ha)n(v)n(e)f(studied)h(the)f (adsorption)h(of)h(CO)f(on)g(Pd\(210\))g(b)n(y)f(p)r(erforming)h (densit)n(y)f(functional)i(theory)f(\(DFT\))307 519 y(calculations)29 b(within)e(the)g(generalized)i(gradien)n(t)e(appro)n(ximation.)39 b(W)-6 b(e)27 b(\014nd)f(a)i(relativ)n(ely)g(small)f(corrugation)307 606 y(in)20 b(the)f(CO)i(adsorption)g(energies)g(with)f(the)g(t)n(w)n (o)h(bridge)f(sites)h(b)r(eing)f(energetically)i(almost)e(degenerate.) 34 b(CO)20 b(is)307 693 y(furthermore)j(kno)n(wn)h(as)h(a)f(strong)h(p) r(oison)g(in)f(heterogeneous)h(catalysis.)35 b(W)-6 b(e)24 b(ha)n(v)n(e)g(therefore)h(also)g(addressed)307 780 y(the)32 b(coadsorption)i(of)f(CO)g(with)g(atomic)g(h)n(ydrogen.)55 b(There)33 b(is)g(a)g(signi\014can)n(t)g(inhibition)g(of)h(the)e(h)n (ydrogen)307 868 y(adsorption)c(due)f(to)g(the)g(presence)h(of)g(CO)g (whic)n(h)f(is)h(analysed)g(in)f(terms)g(of)h(the)f(electronic)i (structure)e(of)h(the)307 955 y(adsorbate)e(system.)307 1121 y Fp(P)-6 b(A)n(CS)23 b(n)n(um)n(b)r(ers:)30 b(68.35.Ja,)24 b(82.20.Kh,)g(82.65.P)n(a)307 1200 y(Keyw)n(ords:)42 b(densit)n(y)31 b(functional)f(calculations,)h(c)n(hemisorption,stepp)r (ed)g(single)e(crystal)g(surfaces,)i(h)n(ydrogen,carb)r(on)307 1279 y(mono)n(xide,)23 b(palladium)436 1536 y Fo(I.)88 b(INTR)n(ODUCTION)-67 1762 y Fs(In)25 b(the)h(\014eld)f(of)g(surface)f (science,)h(the)g(study)g(of)g(the)h(in)n(terac-)-150 1857 y(tion)38 b(of)g(molecules)g(with)g(metal)g(surfaces)f(has)g (traditionally)-150 1953 y(fo)r(cused)43 b(on)f(lo)n(w-index)f(surface) h(planes.)81 b(The)43 b(exp)r(erimen-)-150 2048 y(tal)24 b(preparation)d(of)j(these)f(w)n(ell-de\014ned)h(surface)f(in)g (ultra-high)-150 2144 y(v)-5 b(acuum)24 b(\(UHV\))h(c)n(ham)n(b)r(ers)d (and)i(the)g(subsequen)n(t)f(adsorption)-150 2239 y(of)i(molecules)f (on)g(them)h(has)f(b)r(een)h(a)f(remark)-5 b(able)23 b(success)h(o)n(v)n(er)-150 2335 y(the)35 b(past)f(decades)g([1].)58 b(On)34 b(the)h(other)f(hand,)j(ho)n(w)n(ev)n(er,)d(the)-150 2430 y(surfaces)39 b(of)i(all)f(tec)n(hnologically)f(relev)-5 b(an)n(t)40 b(catalysts)g(are)f(in)-150 2526 y(fact)j(non-ideal,)j (i.e.)d(defect-ric)n(h.)79 b(F)-7 b(urthermore,)45 b(catalytic)-150 2621 y(reactions)40 b(t)n(ypically)g(o)r(ccur)g(under)h(high)g (pressures.)75 b(These)-150 2717 y(discrepancies)32 b(b)r(et)n(w)n(een) h(real-w)n(orld)e(applications)i(and)g(basic)-150 2812 y(researc)n(h)25 b(are)i(called)g(the)h(\\structure)f(and)g(pressure)g (gap".)-67 2919 y(It)d(is)g(a)f(widely)g(kno)n(wn)g(fact)h(that)g(imp)r (erfections)g(of)f(the)h(sur-)-150 3015 y(face)31 b(and)f(coadsorbates) f(can)h(signi\014can)n(tly)g(in\015uence)h(the)g(re-)-150 3110 y(activit)n(y)40 b(of)g(a)g(catalyst)f(surface.)74 b(One)40 b(w)n(a)n(y)e(to)j(bridge)e(the)-150 3206 y(structure)32 b(and)g(pressure)f(gap)g(b)r(et)n(w)n(een)h(surface)g(science)g(and) -150 3301 y(applied)40 b(heterogeneous)d(catalysis)i(is)g(to)h(carry)d (out)j(exp)r(eri-)-150 3397 y(men)n(tal)23 b(and)g(theoretical)g (studies)g(of)h(coadsorbate)d(systems)i(on)-150 3492 y(w)n(ell-de\014ned)29 b(structured)g(surfaces,)g(suc)n(h)g(as)g (vicinal)g(surfaces)-150 3588 y(of)e(the)g(lo)n(w-index)f(surface)h (planes,)f(and)h(th)n(us)g(iden)n(tify)h(the)f(ef-)-150 3683 y(fect)32 b(of)g(a)f(particular)f(defect)i(structure)f(and)g (coadsorbate)f(on)-150 3779 y(the)e(surface)f(reactivit)n(y)f([2].)-67 3886 y(In)j(order)f(to)h(con)n(tribute)g(to)g(the)g(microscopic)f (understand-)-150 3981 y(ing)18 b(of)h(the)g(molecular)e(adsorption)g (on)h(structured)h(surfaces,)g(w)n(e)-150 4077 y(ha)n(v)n(e)25 b(studied)j(the)f(adsorption)e(of)i(CO)f(and)g(the)h(coadsorption)-150 4172 y(of)e(CO)h(and)f(h)n(ydrogen)f(on)h(the)h(already)e(rather)g(op)r (en)i(Pd\(210\))-150 4268 y(surface)39 b(b)n(y)g(densit)n(y-functional) g(theory)f(calculations.)71 b(The)-150 4363 y(adsorption)29 b(of)i(carb)r(on)e(mono)n(xide,)i(CO,)f(is)g(one)h(of)f(the)h(\\pro-) -150 4459 y(tot)n(yp)r(e")21 b(systems)f(for)h(the)h(study)f(of)g (adsorption)f(on)h(metal)g(sur-)-150 4554 y(faces.)34 b(T)-7 b(ec)n(hnologically)g(,)19 b(CO)g(is)g(kno)n(wn)g(as)g(a)g (rather)f(un)n(w)n(an)n(ted)-150 4650 y(catalytic)k(p)r(oison|it)h (binds)g(rather)e(strongly)h(\()p Fn(\031)h Fs(1)9 b Fn(\000)g Fs(2)20 b(eV\))k(to)-150 4745 y(the)h(surface)g(and)g(is)g (able)f(to)h(passiv)-5 b(ate)25 b(an)g(otherwise)f(reactiv)n(e)-150 4841 y(surface)c([3].)35 b(Ho)n(w)n(ev)n(er,)21 b(coadsorption)e (studies)i(are)f(not)i(only)e(of)-150 4936 y(in)n(terest)29 b(in)g(the)g(con)n(text)g(of)f(the)i(p)r(oisoning)e(of)h(a)f(catalyst.) 40 b(In)-150 5032 y(general,)27 b(an)n(y)h(heterogeneously)e(catalyzed) i(reaction)f(requires)-150 5127 y(the)c(coadsorption)e(of)h(the)h (reactan)n(ts.)34 b(This)23 b(demonstrates)e(the)-150 5223 y(imp)r(ortance)26 b(of)g(a)g(fundamen)n(tal)h(insigh)n(t)f(in)n (to)g(the)g(in)n(teraction)-150 5318 y(b)r(et)n(w)n(een)i(t)n(w)n(o)e (adsorb)r(ed)h(sp)r(ecies.)-67 5425 y(As)38 b(far)g(as)g(the)g(in)n (teraction)g(of)g(CO)g(with)g(metal)h(surfaces)2042 1536 y(is)c(concerned,)h(the)f(binding)g(to)g(the)g(surface)f(is)h(rather)f (w)n(eak)2042 1632 y(compared)41 b(to)h(the)h(CO)f(disso)r(ciation)f (energy)g(of)h(11)p Fm(:)p Fs(23)f(eV.)2042 1727 y(This)21 b(leads)f(to)h(the)g(plausible)f(assumption)h(that)g(the)g(electronic) 2042 1823 y(structure)33 b(of)g(the)h(free)f(CO)g(molecule)g(is)g(only) g(sligh)n(tly)g(mo)r(d-)2042 1918 y(i\014ed)41 b(up)r(on)h(adsorption.) 76 b(The)41 b(simple)g(in)n(teraction)f(picture)2042 2014 y(prop)r(osed)33 b(b)n(y)g(Blyholder)g(is)g(capable)g(of)h (explaining)f(the)i(CO)2042 2109 y(adsorption)22 b(qualitativ)n(ely)g ([4{6)o(]:)35 b(Charge)22 b(donation)h(from)g(the)2042 2205 y(5)p Fm(\033)41 b Fs(orbital)c(to)h(the)g(metal)g(and)g(bac)n(k)f (donation)h(to)g(the)g(2)p Fm(\031)4046 2175 y Fl(\003)2042 2300 y Fs(orbital)h(establishes)g(a)g(metal-CO)g(b)r(ond,)k(but)e(at)f (the)g(same)2042 2396 y(time)25 b(w)n(eak)n(ens)f(the)h(carb)r(on-o)n (xygen)d(b)r(ond.)37 b(V)-7 b(ariations)24 b(in)h(the)2042 2491 y(stretc)n(hing)36 b(frequencies)g(of)h(adsorb)r(ed)f(CO)h(can)f (th)n(us)h(b)r(e)h(ex-)2042 2587 y(plained.)2125 2705 y(Molecular)27 b(CO)h(is)g(kno)n(wn)g(for)g(its)g(abilit)n(y)g(to)h(p)r (opulate)f(dif-)2042 2801 y(feren)n(t)41 b(adsorption)g(sites)g(with)i (a)e(v)n(ery)g(lo)r(cal)g(binding,)k(and)2042 2896 y(quite)31 b(a)g(few)g(theoretical)f(and)h(exp)r(erimen)n(tal)g(studies)g(on)g(CO) 2042 2992 y(adsorption)21 b(on)h(di\013eren)n(t)g(palladium)g(surfaces) g(exist)g([5)o(,)i(7)o({21)o(].)2042 3087 y(The)j(\(210\))f(surface)g (can)h(b)r(e)g(though)n(t)g(of)g(as)f(b)r(eing)h(built)h(up)f(of)2042 3183 y(small)34 b(\(100\))g(terraces)f(with)i(steps)g(running)f(along)f (the)i([001])2042 3278 y(direction)g(and)h(forming)g(op)r(en)g (\(110\)-lik)n(e)e(microfacets.)62 b(F)-7 b(or)2042 3374 y(atomic)29 b(h)n(ydrogen,)f(w)n(e)g(found)i(recen)n(tly)e(that)i(the)g (adsorption)2042 3469 y(at)20 b(the)g(steps)g(is)g(energetically)f (most)h(fa)n(v)n(orable)e([22)o(,)j(23)o(].)35 b(In)n(ter-)2042 3565 y(estingly)-7 b(,)29 b(according)f(to)h(our)g(presen)n(t)g(study)g (the)h(CO)f(adsorp-)2042 3660 y(tion)24 b(on)g(Pd\(210\))f(is)h(not)g (dominated)g(b)n(y)g(steps.)36 b(CO)24 b(is)g(kno)n(wn)2042 3756 y(to)j(adsorb)g(uprigh)n(t)g(in)h(bridge)f(p)r(ositions)g(on)g (Pd\(100\))g([8)o(,)h(11)o(].)2042 3851 y(On)e(Pd\(210\),)f(there)i (are)e(t)n(w)n(o)h(inequiv)-5 b(alen)n(t)26 b(bridge)g(p)r(ositions.) 2042 3947 y(And)g(indeed,)g(w)n(e)f(\014nd)h(a)f(relativ)n(ely)g(small) g(corrugation)e(in)j(the)2042 4042 y(CO)32 b(adsorption)f(energies)h (with)h(the)g(t)n(w)n(o)f(bridge)g(sites)g(b)r(eing)2042 4138 y(energetically)26 b(almost)h(degenerate.)2125 4256 y(Hydrogen)33 b(on)h(palladium)g(has)g(serv)n(ed)f(as)h(another)f (proto-)2042 4352 y(t)n(yp)r(e)g(system)g(for)g(the)h(in)n(teraction)e (of)h(atoms)g(and)g(molecules)2042 4447 y(with)43 b(surfaces)e([24)o ({35)n(].)81 b(A)43 b(recen)n(t)f(com)n(bined)g(exp)r(erimen-)2042 4543 y(tal)28 b(and)h(theoretical)f(study)h(demonstrated)f(that)h(on)f (Pd\(210\))2042 4638 y(h)n(ydrogen)45 b(can)h(adsorb)g(b)r(oth)h(disso) r(ciativ)n(ely)e(and)i(molecu-)2042 4734 y(larly)39 b([22)o(].)74 b(These)39 b(\014ndings)h(w)n(ere)f(rather)g(surprising)f(since)2042 4829 y(usually)28 b(H)2389 4841 y Fk(2)2456 4829 y Fs(adsorbs)g(disso)r (ciativ)n(ely)g(on)h(metal)g(surfaces)f([24)o(].)2042 4925 y(In)19 b(fact,)j(on)d(clean)g(Pd\(210\))f(there)h(is)h(no)f(H) 3389 4937 y Fk(2)3446 4925 y Fs(molecular)f(adsorp-)2042 5020 y(tion)31 b(state.)49 b(This)32 b(state)f(b)r(ecomes)h(stabilized) f(only)h(if)g(atomic)2042 5116 y(h)n(ydrogen)d(is)i(presen)n(t)g(on)f (the)i(Pd\(210\))d(surface)i(and)g(hinders)2042 5211 y(the)d(H)2247 5223 y Fk(2)2312 5211 y Fs(disso)r(ciation)f([22)o(,)g (23)o(].)2125 5330 y(Our)g(calculations)f(sho)n(w)h(that)g(CO)h(indeed) f(inhibits)i(h)n(ydro-)2042 5425 y(gen)e(adsorption)g(b)n(y)g(reducing) g(the)i(h)n(ydrogen)d(adsorption)g(en-)p eop %%Page: 2 2 2 1 bop 4043 -299 a Fs(2)-150 -83 y(ergies)28 b(signi\014can)n(tly)-7 b(.)40 b(Besides)28 b(a)h(direct)g(electrostatic)f(dip)r(ole-)-150 12 y(dip)r(ole)20 b(repulsion,)h(mainly)f(the)h(CO-induced)f(do)n (wnshift)g(of)g(the)-150 108 y(lo)r(cal)28 b Fm(d)p Fs(-band)g(cen)n (ter)g(is)g(the)h(origin)e(for)h(the)g(reduction)g(in)h(the)-150 203 y(adsorption)d(energies.)-67 301 y(This)34 b(pap)r(er)g(is)g (structured)f(as)h(follo)n(ws.)55 b(After)34 b(this)g(in)n(tro-)-150 396 y(duction,)24 b(the)e(computational)g(details)g(of)g(our)g(DFT)h (study)f(will)-150 492 y(b)r(e)h(brie\015y)g(addressed.)34 b(Then)23 b(w)n(e)g(discuss)f(the)h(CO)g(adsorption)-150 587 y(on)30 b(the)h(clean)g(Pd\(210\))e(surface)h(for)g(CO)g(co)n(v)n (erages)e(of)j Fm(\022)f Fs(=)e(1)-150 683 y(and)39 b Fm(\022)45 b Fs(=)d(1)p Fm(:)p Fs(5.)71 b(Finally)-7 b(,)42 b(w)n(e)d(address)f(the)h(coadsorption)e(of)-150 778 y(CO)24 b(and)f(atomic)h(h)n(ydrogen)e(and)i(\014nish)h(the)f(pap)r (er)f(with)i(some)-150 874 y(concluding)i(remarks.)171 1161 y Fo(I)r(I.)89 b(COMPUT)-7 b(A)g(TIONAL)29 b(DET)-7 b(AILS)-67 1376 y Fj(A)n(b)39 b(initio)45 b Fs(densit)n(y-functional)38 b(theory)f(calculations)g(w)n(ere)-150 1472 y(used)25 b(to)h(determine)f(all)g(the)h(structural,)f(electronic)g(and)g(ener-) -150 1567 y(getic)34 b(results)g(presen)n(ted)h(in)f(this)h(article.)58 b(The)34 b(Kohn-Sham)-150 1663 y(equations)41 b(w)n(ere)g(solv)n(ed)g (in)i(a)e(plane-w)n(a)n(v)n(e)f(basis)i(set)g(using)-150 1758 y(the)27 b(Vienna)g Fj(ab)i(initio)34 b Fs(sim)n(ulation)26 b(pac)n(k)-5 b(age)25 b(\(V)-9 b(ASP\))27 b([36)o(,)g(37)o(])-150 1853 y(and)40 b(emplo)n(ying)e(the)i(generalized)f(gradien)n(t)f(appro) n(ximation)-150 1949 y(\(GGA\))c(of)f(P)n(erdew)f(and)h(co-w)n(ork)n (ers)d(\(PW91\))i([38].)53 b(F)-7 b(or)33 b(an)-150 2044 y(accurate)28 b(represen)n(tation)g(of)i(the)g(o)n(xygen)e(core)g (region,)h(P)-7 b(A)e(W)-150 2140 y(pseudop)r(oten)n(tials)29 b([39)o(,)i(40)o(])f(together)f(with)h(an)f(energy)g(cuto\013)-150 2235 y(of)g(400)f(eV)h(w)n(ere)f(used.)42 b(T)-7 b(o)28 b(mo)r(del)i(the)f(surface,)g(the)g(slab)g(su-)-150 2331 y(p)r(ercell)g(approac)n(h)e(with)j(p)r(erio)r(dic)f(b)r(oundary)f (conditions)g(w)n(as)-150 2426 y(used:)36 b(The)26 b(Pd\(210\))g (surface)f(is)h(describ)r(ed)g(b)n(y)g(p)r(erio)r(dic)g(slabs)-150 2522 y(of)i(11)e(la)n(y)n(ers)g(and)h(a)g(separating)f(v)-5 b(acuum)28 b(region)e(of)i(11)1683 2507 y(\027)1683 2522 y(A.)-67 2619 y(F)-7 b(or)27 b(a)h(\(1)18 b Fn(\002)h Fs(1\))28 b(surface)f(unit)h(cell)g(of)g(Pd\(210\),)f(it)i(turns)e(out) -150 2715 y(that)41 b(a)g(Monkhorst-P)n(ac)n(k)d Fi(k)k Fs(p)r(oin)n(t)f(set)g([41)o(])h(of)f(7)27 b Fn(\002)g Fs(7)g Fn(\002)g Fs(1,)-150 2810 y(corresp)r(onding)45 b(to)h(16)g Fi(k)h Fs(p)r(oin)n(ts)g(in)g(the)g(irreducible)f(Bril-) -150 2906 y(louin)24 b(zone,)h(together)f(with)h(a)f(\014rst-order)e (Methfessel-P)n(axton)-150 3001 y(smearing)h([42)o(])h(of)f(width)i Fm(\033)h Fs(=)d(0)p Fm(:)p Fs(1)g(eV)h(is)g(su\016cien)n(t)g(in)g (order)f(to)-150 3097 y(get)34 b(con)n(v)n(erged)e(energies)h([23)o(].) 57 b(All)34 b(rep)r(orted)g(total)g(energies)-150 3192 y(w)n(ere)29 b(then)i(extrap)r(olated)f(to)g Fm(\033)h Fn(!)d Fs(0)i(eV.)h(Ho)n(w)n(ev)n(er,)e(in)i(order)-150 3288 y(to)h(\014nd)h(energy)e(minim)n(um)i(structures)f(it)h(is)f(imp)r (ortan)n(t)g(that)-150 3383 y(also)40 b(the)i(forces)e(are)g(w)n (ell-con)n(v)n(erged.)75 b(F)-7 b(or)41 b(the)h(clean)f(and)-150 3479 y(h)n(ydrogen-co)n(v)n(ered)36 b(Pd\(210\))j(surface)g(w)n(e)h(ha) n(v)n(e)f(carried)f(out)-150 3574 y(relaxation)e(calculations)h(with)h (a)g(conjugate-gradien)n(t)d(mini-)-150 3669 y(mization)21 b(sc)n(heme)f(using)g(the)i(Hellman-F)-7 b(eynman)20 b(forces)g(com-)-150 3765 y(puted)28 b(at)g(a)f(larger)f Fi(k)i Fs(p)r(oin)n(t)g(set)f(of)h(11)17 b Fn(\002)i Fs(11)e Fn(\002)h Fs(1)27 b(\(36)g Fi(k)h Fs(p)r(oin)n(ts)-150 3860 y(in)41 b(the)f(irreducible)g(zone\))g([23)o(],)k(but)d(w)n(e)f (did)g(not)g(\014nd)h(an)n(y)-150 3956 y(signi\014can)n(t)28 b(di\013erences)g(with)h(resp)r(ect)f(to)g(the)h(calculation)f(for)-150 4051 y(7)c Fn(\002)h Fs(7)f Fn(\002)h Fs(1)37 b Fi(k)h Fs(p)r(oin)n(ts.)66 b(Hence)37 b(the)h(relaxed)e(CO)h(adsorption)-150 4147 y(structures)27 b(are)f(determined)i(with)g(the)g(smaller)f Fi(k)h Fs(p)r(oin)n(t)g(set.)158 4434 y Fo(I)r(I)r(I.)90 b(RESUL)-7 b(TS)29 b(AND)g(DISCUSSION)-67 4649 y Fs(The)e(prop)r (erties)f(for)h(the)g(CO)g(molecule)g(as)f(obtained)h(b)n(y)g Fj(ab)-150 4745 y(initio)39 b Fs(DFT)34 b(calculations)d(are)h (summarized)g(in)h(T)-7 b(able)33 b(I)g(and)-150 4840 y(compared)39 b(to)h(their)h(exp)r(erimen)n(tal)e(v)-5 b(alues.)75 b(All)41 b(molecular)-150 4936 y(prop)r(erties)28 b(w)n(ere)h(computed)g(using)g(a)g(large,)f(asymmetric)h(su-)-150 5031 y(p)r(ercell)24 b(of)h(dimensions)f(10)p Fm(:)p Fs(00)12 b Fn(\002)g Fs(10)p Fm(:)p Fs(25)g Fn(\002)g Fs(10)p Fm(:)p Fs(5)o(0)1394 5016 y(\027)1394 5031 y(A.)25 b(In)g(the)f(case)-150 5127 y(of,)30 b(e.g.,)f(H)209 5139 y Fk(2)246 5127 y Fs(,)h(the)g(asymmetricit)n(y)e(of)h(the)g(sup)r (ercell)g(and)g(th)n(us)-150 5222 y(the)36 b(breaking)e(of)h(an)n(y)f (inheren)n(t)h(symmetry)g(in)h(the)f(atom)g(or)-150 5318 y(molecule)i(is)h(not)g(imp)r(ortan)n(t,)i(but)e(for)g(molecules)f(in)n (v)n(olving)-150 5413 y(atoms)e(with)i(degenerate)d(orbitals)h(suc)n(h) g(as)h(o)n(xygen,)g(the)g(ef-)2295 1369 y @beginspecial 0 @llx 0 @lly 537 @urx 537 @ury 1842 @rwi @setspecial %%BeginDocument: Fig1.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: Pd210_top+cell4.eps %%Creator: fig2dev Version 3.2 Patchlevel 3c %%CreationDate: Tue Aug 26 14:26:56 2003 %%For: agross@bloch (Axel Gross) %%BoundingBox: 0 0 537 537 %%Magnification: 1.0000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save newpath 0 537 moveto 0 0 lineto 537 0 lineto 537 537 lineto closepath clip newpath 1.0 536.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def $F2psBegin %%Page: 1 1 10 setmiterlimit 0.06299 0.06299 sc % % Fig objects follow % % Polyline % % pen to black in case this eps object doesn't set color first 0 0 0 setrgbcolor % Begin Imported EPS File: Pd210_top.eps %%BeginDocument: Pd210_top.eps % n gs 0 0 tr 15.874766 -15.874766 sc 0 -535 tr -30 -157 tr sa n 30 157 m 565 157 l 565 692 l 30 692 l cp clip n countdictstack mark /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %Creator: RasMol Version 2.7.1 %%Title: Pd210_top.ps %%BoundingBox: 30 157 565 692 %%Pages: 1 %%EndComments %%EndProlog %%BeginSetup 1 setlinecap 1 setlinejoin [] 0 setdash 1 setlinewidth 0 setgray %%EndSetup %%Page: 1 1 gsave 14 dict begin /handleerror { showpage } def /Inten { dup 4 index mul exch dup 4 index mul exch 3 index mul setrgbcolor } def /Dot { moveto 0 0 rlineto stroke } def /Wire { moveto lineto stroke } def /Label { moveto 1 -1 scale show mtrx setmatrix } def /Stick { closepath setrgbcolor fill } def /StickEnd { matrix currentmatrix 6 1 roll translate rotate 1 scale 0 0 3 2 roll 90 -90 arc setmatrix } def /Shade { closepath clip 45 rotate dup -0.81649658092 mul scale 0.2 Inten fill 0 0 0.999512 0 360 arc 0.2 Inten fill 0 0.03125 0.998045 0 360 arc 0.225806 Inten fill 0 0.0625 0.995596 0 360 arc 0.251613 Inten fill 0 0.09375 0.992157 0 360 arc 0.277419 Inten fill 0 0.125 0.987718 0 360 arc 0.303226 Inten fill 0 0.15625 0.982265 0 360 arc 0.329032 Inten fill 0 0.1875 0.975781 0 360 arc 0.354839 Inten fill 0 0.21875 0.968246 0 360 arc 0.380645 Inten fill 0 0.25 0.959635 0 360 arc 0.406452 Inten fill 0 0.28125 0.949918 0 360 arc 0.432258 Inten fill 0 0.3125 0.939061 0 360 arc 0.458065 Inten fill 0 0.34375 0.927025 0 360 arc 0.483871 Inten fill 0 0.375 0.913762 0 360 arc 0.509677 Inten fill 0 0.40625 0.899218 0 360 arc 0.535484 Inten fill 0 0.4375 0.883331 0 360 arc 0.56129 Inten fill 0 0.46875 0.866025 0 360 arc 0.587097 Inten fill 0 0.5 0.847215 0 360 arc 0.612903 Inten fill 0 0.53125 0.826797 0 360 arc 0.63871 Inten fill 0 0.5625 0.80465 0 360 arc 0.664516 Inten fill 0 0.59375 0.780625 0 360 arc 0.690323 Inten fill 0 0.625 0.754544 0 360 arc 0.716129 Inten fill 0 0.65625 0.726184 0 360 arc 0.741935 Inten fill 0 0.6875 0.695269 0 360 arc 0.767742 Inten fill 0 0.71875 0.661438 0 360 arc 0.793548 Inten fill 0 0.75 0.624218 0 360 arc 0.819355 Inten fill 0 0.78125 0.582961 0 360 arc 0.845161 Inten fill 0 0.8125 0.536736 0 360 arc 0.870968 Inten fill 0 0.84375 0.484123 0 360 arc 0.896774 Inten fill 0 0.875 0.422742 0 360 arc 0.922581 Inten fill 0 0.90625 0.347985 0 360 arc 0.948387 Inten fill 0 0.9375 0.248039 0 360 arc 0.974194 Inten fill pop pop pop } def /ClipSphere { translate 0 0 5 2 roll arc } def /ClipBox { translate rotate dup lineto dup neg dup 0 rlineto 0 exch rlineto 0 rlineto closepath clip newpath mtrx setmatrix } def /ClipEllips { translate rotate 1 scale 0 0 4 2 roll dup neg arc reversepath mtrx setmatrix } def /Sphere { gsave translate 0 0 2 index 0 360 arc Shade grestore } def 30 692 translate 0.928819 -0.928819 scale /mtrx matrix currentmatrix def newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath clip newpath 0.313725 0.313725 0.313725 47.7859 92 68 Sphere 0.313725 0.313725 0.313725 47.7859 223 68 Sphere 0.313725 0.313725 0.313725 47.7859 157 215 Sphere 0.313725 0.313725 0.313725 47.7859 92 361 Sphere 0.313725 0.313725 0.313725 47.7859 353 68 Sphere 0.313725 0.313725 0.313725 47.7859 288 215 Sphere 0.313725 0.313725 0.313725 47.7859 223 361 Sphere 0.313725 0.313725 0.313725 47.7859 157 508 Sphere 0.313725 0.313725 0.313725 47.7859 484 68 Sphere 0.313725 0.313725 0.313725 47.7859 419 215 Sphere 0.313725 0.313725 0.313725 47.7859 353 361 Sphere 0.313725 0.313725 0.313725 47.7859 288 508 Sphere 0.313725 0.313725 0.313725 47.7859 484 361 Sphere 0.313725 0.313725 0.313725 47.7859 419 508 Sphere 0.607843 0.607843 0.607843 47.7859 157 127 Sphere 0.607843 0.607843 0.607843 47.7859 92 274 Sphere 0.607843 0.607843 0.607843 47.7859 288 127 Sphere 0.607843 0.607843 0.607843 47.7859 223 274 Sphere 0.607843 0.607843 0.607843 47.7859 157 420 Sphere 0.607843 0.607843 0.607843 47.7859 419 127 Sphere 0.607843 0.607843 0.607843 47.7859 353 274 Sphere 0.607843 0.607843 0.607843 47.7859 288 420 Sphere 0.607843 0.607843 0.607843 47.7859 484 274 Sphere 0.607843 0.607843 0.607843 47.7859 419 420 Sphere 0.901961 0.901961 0.901961 47.7859 92 185 Sphere 0.901961 0.901961 0.901961 47.7859 223 185 Sphere 0.901961 0.901961 0.901961 47.7859 157 332 Sphere 0.901961 0.901961 0.901961 47.7859 92 479 Sphere 0.901961 0.901961 0.901961 47.7859 353 185 Sphere 0.901961 0.901961 0.901961 47.7859 288 332 Sphere 0.901961 0.901961 0.901961 47.7859 223 479 Sphere 0.901961 0.901961 0.901961 47.7859 484 185 Sphere 0.901961 0.901961 0.901961 47.7859 419 332 Sphere 0.901961 0.901961 0.901961 47.7859 353 479 Sphere 0.901961 0.901961 0.901961 47.7859 484 479 Sphere 0.901961 0.901961 0.901961 47.7859 92 97 Sphere 0.901961 0.901961 0.901961 47.7859 223 97 Sphere 0.901961 0.901961 0.901961 47.7859 157 244 Sphere 0.901961 0.901961 0.901961 47.7859 92 390 Sphere 0.901961 0.901961 0.901961 47.7859 353 97 Sphere 0.901961 0.901961 0.901961 47.7859 288 244 Sphere 0.901961 0.901961 0.901961 47.7859 223 390 Sphere 0.901961 0.901961 0.901961 47.7859 484 97 Sphere 0.901961 0.901961 0.901961 47.7859 419 244 Sphere 0.901961 0.901961 0.901961 47.7859 353 390 Sphere 0.901961 0.901961 0.901961 47.7859 484 390 Sphere 0.901961 0.901961 0.901961 47.7859 157 156 Sphere 0.901961 0.901961 0.901961 47.7859 92 302 Sphere 0.901961 0.901961 0.901961 47.7859 288 156 Sphere 0.901961 0.901961 0.901961 47.7859 223 302 Sphere 0.901961 0.901961 0.901961 47.7859 157 449 Sphere 0.901961 0.901961 0.901961 47.7859 419 156 Sphere 0.901961 0.901961 0.901961 47.7859 353 302 Sphere 0.901961 0.901961 0.901961 47.7859 288 449 Sphere 0.901961 0.901961 0.901961 47.7859 484 302 Sphere 0.901961 0.901961 0.901961 47.7859 419 449 Sphere 0.901961 0.901961 0.901961 47.7859 157 68 Sphere 0.901961 0.901961 0.901961 47.7859 92 215 Sphere 0.901961 0.901961 0.901961 47.7859 288 68 Sphere 0.901961 0.901961 0.901961 47.7859 223 215 Sphere 0.901961 0.901961 0.901961 47.7859 157 361 Sphere 0.901961 0.901961 0.901961 47.7859 92 508 Sphere 0.901961 0.901961 0.901961 47.7859 419 68 Sphere 0.901961 0.901961 0.901961 47.7859 353 215 Sphere 0.901961 0.901961 0.901961 47.7859 288 361 Sphere 0.901961 0.901961 0.901961 47.7859 223 508 Sphere 0.901961 0.901961 0.901961 47.7859 484 215 Sphere 0.901961 0.901961 0.901961 47.7859 419 361 Sphere 0.901961 0.901961 0.901961 47.7859 353 508 Sphere 0.901961 0.901961 0.901961 47.7859 484 508 Sphere 0.901961 0.901961 0.901961 47.7859 92 127 Sphere 0.901961 0.901961 0.901961 47.7859 223 127 Sphere 0.901961 0.901961 0.901961 47.7859 157 274 Sphere 0.901961 0.901961 0.901961 47.7859 92 420 Sphere 0.901961 0.901961 0.901961 47.7859 353 127 Sphere 0.901961 0.901961 0.901961 47.7859 288 274 Sphere 0.901961 0.901961 0.901961 47.7859 223 420 Sphere 0.901961 0.901961 0.901961 47.7859 484 127 Sphere 0.901961 0.901961 0.901961 47.7859 419 274 Sphere 0.901961 0.901961 0.901961 47.7859 353 420 Sphere 0.901961 0.901961 0.901961 47.7859 484 420 Sphere 0.901961 0.901961 0.901961 47.7859 157 185 Sphere 0.901961 0.901961 0.901961 47.7859 92 332 Sphere 0.901961 0.901961 0.901961 47.7859 288 185 Sphere 0.901961 0.901961 0.901961 47.7859 223 332 Sphere 0.901961 0.901961 0.901961 47.7859 157 479 Sphere 0.901961 0.901961 0.901961 47.7859 419 185 Sphere 0.901961 0.901961 0.901961 47.7859 353 332 Sphere 0.901961 0.901961 0.901961 47.7859 288 479 Sphere 0.901961 0.901961 0.901961 47.7859 484 332 Sphere 0.901961 0.901961 0.901961 47.7859 419 479 Sphere 0.901961 0.901961 0.901961 47.7859 157 97 Sphere 0.901961 0.901961 0.901961 47.7859 92 244 Sphere 0.901961 0.901961 0.901961 47.7859 288 97 Sphere 0.901961 0.901961 0.901961 47.7859 223 244 Sphere 0.901961 0.901961 0.901961 47.7859 157 390 Sphere 0.901961 0.901961 0.901961 47.7859 419 97 Sphere 0.901961 0.901961 0.901961 47.7859 353 244 Sphere 0.901961 0.901961 0.901961 47.7859 288 390 Sphere 0.901961 0.901961 0.901961 47.7859 484 244 Sphere 0.901961 0.901961 0.901961 47.7859 419 390 Sphere 0.607843 0.607843 0.607843 47.7859 92 156 Sphere 0.607843 0.607843 0.607843 47.7859 223 156 Sphere 0.607843 0.607843 0.607843 47.7859 157 302 Sphere 0.607843 0.607843 0.607843 47.7859 92 449 Sphere 0.607843 0.607843 0.607843 47.7859 353 156 Sphere 0.607843 0.607843 0.607843 47.7859 288 302 Sphere 0.607843 0.607843 0.607843 47.7859 223 449 Sphere 0.607843 0.607843 0.607843 47.7859 484 156 Sphere 0.607843 0.607843 0.607843 47.7859 419 302 Sphere 0.607843 0.607843 0.607843 47.7859 353 449 Sphere 0.607843 0.607843 0.607843 47.7859 484 449 Sphere 0.313725 0.313725 0.313725 47.7859 92 68 Sphere 0.313725 0.313725 0.313725 47.7859 223 68 Sphere 0.313725 0.313725 0.313725 47.7859 157 215 Sphere 0.313725 0.313725 0.313725 47.7859 92 361 Sphere 0.313725 0.313725 0.313725 47.7859 353 68 Sphere 0.313725 0.313725 0.313725 47.7859 288 215 Sphere 0.313725 0.313725 0.313725 47.7859 223 361 Sphere 0.313725 0.313725 0.313725 47.7859 157 508 Sphere 0.313725 0.313725 0.313725 47.7859 484 68 Sphere 0.313725 0.313725 0.313725 47.7859 419 215 Sphere 0.313725 0.313725 0.313725 47.7859 353 361 Sphere 0.313725 0.313725 0.313725 47.7859 288 508 Sphere 0.313725 0.313725 0.313725 47.7859 484 361 Sphere 0.313725 0.313725 0.313725 47.7859 419 508 Sphere newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath 0 setgray 1 setlinewidth stroke end grestore showpage %%Trailer %%EOF cleartomark countdictstack exch sub { end } repeat restore grestore % % End Imported PIC File: Pd210_top.eps %%EndDocument % % Polyline 7.500 slw n 3630 7335 m 4860 7335 l 4860 7935 l 3630 7935 l cp gs col7 1.00 shd ef gr gs col7 s gr % Polyline n 720 4635 m 1935 4635 l 1935 5310 l 720 5310 l cp gs col7 1.00 shd ef gr gs col7 s gr % Polyline 60.000 slw n 3195 5355 m 5175 5355 l 6165 3150 l 4185 3150 l cp gs col0 s gr 15.000 slw % Ellipse n 5220 4455 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 4246 5324 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 5715 3825 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 4680 4860 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 5163 5324 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 5175 6030 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr % Ellipse n 4635 3825 288 288 0 360 DrawEllipse gs col7 1.00 shd ef gr gs col0 s gr /Helvetica-Bold ff 480.00 scf sf 5040 4635 m gs 1 -1 sc (A) col0 sh gr /Helvetica-Bold ff 480.00 scf sf 4080 5505 m gs 1 -1 sc (B) col0 sh gr /Helvetica-Bold ff 420.00 scf sf 5535 4005 m gs 1 -1 sc (C') col0 sh gr /Helvetica-Bold ff 480.00 scf sf 4500 5040 m gs 1 -1 sc (E) col0 sh gr /Helvetica-Bold ff 480.00 scf sf 4997 5505 m gs 1 -1 sc (D) col0 sh gr /Helvetica-Bold ff 480.00 scf sf 4995 6210 m gs 1 -1 sc (C) col0 sh gr /Helvetica-Bold ff 390.00 scf sf 4405 4005 m gs 1 -1 sc (C'') col0 sh gr % Polyline 60.000 slw gs clippath 1372 5250 m 1147 5250 l 1147 5749 l 1260 5374 l 1372 5749 l cp eoclip n 1260 5265 m 1260 7605 l gs col0 s gr gr % arrowhead n 1372 5749 m 1260 5374 l 1147 5749 l 1372 5749 l cp gs 0.00 setgray ef gr col0 s % Polyline gs clippath 3615 7717 m 3615 7492 l 3116 7492 l 3491 7605 l 3116 7717 l cp eoclip n 3600 7605 m 1260 7605 l gs col0 s gr gr % arrowhead n 3116 7717 m 3491 7605 l 3116 7492 l 3116 7717 l cp gs 0.00 setgray ef gr col0 s /Helvetica-Bold ff 480.00 scf sf 3690 7785 m gs 1 -1 sc ([001]) col0 sh gr % Polyline 30.000 slw n 1215 4725 m 1395 4725 l gs col0 s gr /Helvetica-Bold ff 480.00 scf sf 765 5175 m gs 1 -1 sc ([120]) col0 sh gr $F2psEnd rs %%EndDocument @endspecial 2042 1623 a Fq(FIG.)27 b(1:)37 b(T)-6 b(op)27 b(view)g(of)g(the)g(\(210\))g(surface)h(together)f(with)g(the)g(sur-) 2042 1710 y(face)g(unit)e(cell)h(and)g(CO)f(and)h(H)f(adsorption)h (sites.)2042 1998 y Fs(fect)i(of)f(the)h(sup)r(ercell)g(symmetry)f(on)g (the)h(computed)g(binding)2042 2093 y(energy)e(can)h(b)r(ecome)h(quite) g(signi\014can)n(t)f([44)o(].)2344 2390 y Fo(A.)88 b(CO)30 b(adsorption)h(on)f(clean)g(Pd\(210\))2125 2608 y Fs(No)i(evidence)g (for)g(an)n(y)g(reconstruction)f(up)r(on)i(CO)f(adsorp-)2042 2703 y(tion)g(exists)g(exp)r(erimen)n(tally)g([8)o(],)i(so)e(that)g (the)h(relaxed)e(\(210\))2042 2799 y(la)n(y)n(er)26 b(geometry)i(as)f (giv)n(en)h(in)h(Ref.)g([23)o(])f(w)n(as)g(used.)39 b(Since)29 b(CO)2042 2894 y(induced)d(la)n(y)n(er)e(relaxations)g(migh)n(t)i(b)r (e)g(quite)g(substan)n(tial,)g(ad-)2042 2989 y(sorption)35 b(energies)f(for)i(b)r(oth)g(a)f(slab)h(\014xed)g(at)f(the)i(p)r (ositions)2042 3085 y(of)h(the)g(clean)g(\(210\))g(surface)f(and)h(a)g (fully)g(relaxed)f(slab)h(are)2042 3180 y(rep)r(orted.)2125 3280 y(P)n(ossible)29 b(CO)i(adsorption)f(sites)h(are)f(sho)n(wn)g(in)i (Fig.)f(1.)47 b(As)2042 3375 y(CO)27 b(is)h(kno)n(wn)f(to)h(o)r(ccup)n (y)f(bridge)g(sites)h(on)g(Pd\(100\))e(or)h(near-)2042 3471 y(bridge)k(sites)h(on)g(Pd\(110\),)g(it)h(is)f(exp)r(ected)g(that) g(sites)g(C)g(and)2042 3566 y(E)c(are)g(going)f(to)i(b)r(e)g(preferred) f(adsorption)f(sites:)39 b(Site)29 b(E)g(cor-)2042 3662 y(resp)r(onds)23 b(to)i(a)f(bridge)f(p)r(osition)i(on)f(the)g(\(100\))g (terrace,)g(site)g(C)2042 3757 y(to)32 b(a)g(bridge)f(p)r(osition)h(on) g(a)g(\(110\))f(facet.)51 b(The)32 b(DFT)h(results)2042 3853 y(are)k(summarized)h(in)h(T)-7 b(able)38 b(I)r(I.)71 b(The)38 b(obtained)h(adsorption)2042 3948 y(energies)33 b(con\014rm)h(this)h(assumption:)50 b(The)35 b(t)n(w)n(o)f(bridge)f (sites)2042 4044 y(E)f(and)g(C)g(are)g(the)h(most)f(fa)n(v)n(orable)e (adsorption)h(sites.)51 b(They)2042 4139 y(are)31 b(energetically)g (almost)g(degenerate)g(with)i(adsorption)d(en-)2042 4235 y(ergies)k(of)i(1.88)e(eV)i(and)f(1.86)f(eV,)i(resp)r(ectiv)n(ely)-7 b(.)60 b(The)36 b(e\013ect)2042 4559 y Fq(T)-6 b(ABLE)33 b(I:)g(Binding)g(energy)-6 b(,)35 b(b)r(ond)d(length,)j(and)e(stretc)n (hing)g(fre-)2042 4647 y(quency)18 b(for)j(the)e(CO)h(molecule.)33 b(Exp)r(erimen)n(tal)19 b(data)i(is)f(tak)n(en)f(from)2042 4734 y(Ref.)26 b([43)q(].)p 2211 4864 1705 4 v 2211 4880 V 3005 4961 a(CO)2818 5067 y Fh(E)2875 5076 y Fg(b)2932 5067 y Fq([eV])154 b Fh(d)25 b Fq([)3306 5054 y(\027)3306 5067 y(A])154 b Fh(!)28 b Fq([cm)3735 5036 y Ff(\000)p Fe(1)3817 5067 y Fq(])p 2211 5097 V 2287 5177 a(GGA-P)-6 b(A)d(W)190 b(11)p Fh(:)p Fq(78)207 b(1)p Fh(:)p Fq(14)242 b(2135)2287 5284 y(Exp.)411 b(11)p Fh(:)p Fq(24)207 b(1)p Fh(:)p Fq(13)242 b(2170)p 2211 5313 V 2211 5330 V eop %%Page: 3 3 3 2 bop 4043 -299 a Fs(3)-97 787 y @beginspecial 0 @llx 0 @lly 494 @urx 243 @ury 2324 @rwi @setspecial %%BeginDocument: Fig2.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: Fig2.eps %%Creator: fig2dev Version 3.2 Patchlevel 3c %%CreationDate: Fri Feb 20 11:03:42 2004 %%For: agross@bloch (Axel Gross) %%BoundingBox: 0 0 494 243 %%Magnification: 1.0000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save newpath 0 243 moveto 0 0 lineto 494 0 lineto 494 243 lineto closepath clip newpath -140.0 426.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def $F2psBegin %%Page: 1 1 10 setmiterlimit 0.06299 0.06299 sc % % Fig objects follow % % Polyline % % pen to black in case this eps object doesn't set color first 0 0 0 setrgbcolor % Begin Imported EPS File: Pd210_CO_C2top.eps %%BeginDocument: Pd210_CO_C2top.eps % n gs 2250 2925 tr 7.177570 -7.149533 sc 0 -535 tr -30 -157 tr sa n 30 157 m 565 157 l 565 692 l 30 692 l cp clip n countdictstack mark /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %Creator: RasMol Version 2.7.2.1 %%Title: 1.eps %%BoundingBox: 30 157 565 692 %%Pages: 1 %%EndComments %%EndProlog %%BeginSetup 1 setlinecap 1 setlinejoin [] 0 setdash 1 setlinewidth 0 setgray %%EndSetup %%Page: 1 1 gsave 14 dict begin /handleerror { showpage } def /Inten { dup 4 index mul exch dup 4 index mul exch 3 index mul setrgbcolor } def /Dot { moveto 0 0 rlineto stroke } def /Wire { moveto lineto stroke } def /Label { moveto 1 -1 scale show mtrx setmatrix } def /Stick { closepath setrgbcolor fill } def /StickEnd { matrix currentmatrix 6 1 roll translate rotate 1 scale 0 0 3 2 roll 90 -90 arc setmatrix } def /Shade { closepath clip 45 rotate dup -0.81649658092 mul scale 0.2 Inten fill 0 0 0.999512 0 360 arc 0.2 Inten fill 0 0.03125 0.998045 0 360 arc 0.225806 Inten fill 0 0.0625 0.995596 0 360 arc 0.251613 Inten fill 0 0.09375 0.992157 0 360 arc 0.277419 Inten fill 0 0.125 0.987718 0 360 arc 0.303226 Inten fill 0 0.15625 0.982265 0 360 arc 0.329032 Inten fill 0 0.1875 0.975781 0 360 arc 0.354839 Inten fill 0 0.21875 0.968246 0 360 arc 0.380645 Inten fill 0 0.25 0.959635 0 360 arc 0.406452 Inten fill 0 0.28125 0.949918 0 360 arc 0.432258 Inten fill 0 0.3125 0.939061 0 360 arc 0.458065 Inten fill 0 0.34375 0.927025 0 360 arc 0.483871 Inten fill 0 0.375 0.913762 0 360 arc 0.509677 Inten fill 0 0.40625 0.899218 0 360 arc 0.535484 Inten fill 0 0.4375 0.883331 0 360 arc 0.56129 Inten fill 0 0.46875 0.866025 0 360 arc 0.587097 Inten fill 0 0.5 0.847215 0 360 arc 0.612903 Inten fill 0 0.53125 0.826797 0 360 arc 0.63871 Inten fill 0 0.5625 0.80465 0 360 arc 0.664516 Inten fill 0 0.59375 0.780625 0 360 arc 0.690323 Inten fill 0 0.625 0.754544 0 360 arc 0.716129 Inten fill 0 0.65625 0.726184 0 360 arc 0.741935 Inten fill 0 0.6875 0.695269 0 360 arc 0.767742 Inten fill 0 0.71875 0.661438 0 360 arc 0.793548 Inten fill 0 0.75 0.624218 0 360 arc 0.819355 Inten fill 0 0.78125 0.582961 0 360 arc 0.845161 Inten fill 0 0.8125 0.536736 0 360 arc 0.870968 Inten fill 0 0.84375 0.484123 0 360 arc 0.896774 Inten fill 0 0.875 0.422742 0 360 arc 0.922581 Inten fill 0 0.90625 0.347985 0 360 arc 0.948387 Inten fill 0 0.9375 0.248039 0 360 arc 0.974194 Inten fill pop pop pop } def /ClipSphere { translate 0 0 5 2 roll arc } def /ClipBox { translate rotate dup lineto dup neg dup 0 rlineto 0 exch rlineto 0 rlineto closepath clip newpath mtrx setmatrix } def /ClipEllips { translate rotate 1 scale 0 0 4 2 roll dup neg arc reversepath mtrx setmatrix } def /Sphere { gsave translate 0 0 2 index 0 360 arc Shade grestore } def 30 692 translate 0.928819 -0.928819 scale /mtrx matrix currentmatrix def newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath clip newpath 0.313725 0.313725 0.313725 96.8376 620 406 Sphere 0.313725 0.313725 0.313725 96.8376 354 406 Sphere 0.313725 0.313725 0.313725 96.8376 487 110 Sphere 0.313725 0.313725 0.313725 96.8376 89 406 Sphere 0.313725 0.313725 0.313725 96.8376 222 110 Sphere 0.607843 0.607843 0.607843 96.8376 487 525 Sphere 0.607843 0.607843 0.607843 96.8376 620 229 Sphere 0.607843 0.607843 0.607843 96.8376 222 525 Sphere 0.607843 0.607843 0.607843 96.8376 354 229 Sphere 0.607843 0.607843 0.607843 96.8376 487 -68 Sphere 0.607843 0.607843 0.607843 96.8376 -44 525 Sphere 0.607843 0.607843 0.607843 96.8376 89 229 Sphere 0.607843 0.607843 0.607843 96.8376 222 -68 Sphere 0.901961 0.901961 0.901961 96.8376 354 644 Sphere 0.901961 0.901961 0.901961 96.8376 487 347 Sphere 0.901961 0.901961 0.901961 96.8376 620 50 Sphere 0.901961 0.901961 0.901961 96.8376 89 644 Sphere 0.901961 0.901961 0.901961 96.8376 222 347 Sphere 0.901961 0.901961 0.901961 96.8376 354 50 Sphere 0.901961 0.901961 0.901961 96.8376 -44 347 Sphere 0.901961 0.901961 0.901961 96.8376 89 50 Sphere 0.901961 0.901961 0.901961 96.8376 354 466 Sphere 0.901961 0.901961 0.901961 96.8376 487 170 Sphere 0.901961 0.901961 0.901961 96.8376 89 466 Sphere 0.901961 0.901961 0.901961 96.8376 222 170 Sphere 0.901961 0.901961 0.901961 96.8376 -44 170 Sphere 0.901961 0.901961 0.901961 96.8376 487 585 Sphere 0.901961 0.901961 0.901961 96.8376 620 288 Sphere 0.901961 0.901961 0.901961 96.8376 222 585 Sphere 0.901961 0.901961 0.901961 96.8376 354 288 Sphere 0.901961 0.901961 0.901961 96.8376 487 -9 Sphere 0.901961 0.901961 0.901961 96.8376 -44 585 Sphere 0.901961 0.901961 0.901961 96.8376 89 288 Sphere 0.901961 0.901961 0.901961 96.8376 222 -9 Sphere 0.901961 0.901961 0.901961 96.8376 487 406 Sphere 0.901961 0.901961 0.901961 96.8376 620 110 Sphere 0.901961 0.901961 0.901961 96.8376 222 406 Sphere 0.901961 0.901961 0.901961 96.8376 354 110 Sphere 0.901961 0.901961 0.901961 96.8376 -44 406 Sphere 0.901961 0.901961 0.901961 96.8376 89 110 Sphere 0.901961 0.901961 0.901961 96.8376 354 526 Sphere 0.901961 0.901961 0.901961 96.8376 487 229 Sphere 0.901961 0.901961 0.901961 96.8376 621 -68 Sphere 0.901961 0.901961 0.901961 96.8376 89 526 Sphere 0.901961 0.901961 0.901961 96.8376 223 229 Sphere 0.901961 0.901961 0.901961 96.8376 354 -68 Sphere 0.901961 0.901961 0.901961 96.8376 -44 229 Sphere 0.901961 0.901961 0.901961 96.8376 89 -68 Sphere 0.901961 0.901961 0.901961 96.8376 488 644 Sphere 0.901961 0.901961 0.901961 96.8376 621 346 Sphere 0.901961 0.901961 0.901961 96.8376 223 644 Sphere 0.901961 0.901961 0.901961 96.8376 354 346 Sphere 0.901961 0.901961 0.901961 96.8376 488 50 Sphere 0.901961 0.901961 0.901961 96.8376 -43 644 Sphere 0.901961 0.901961 0.901961 96.8376 90 346 Sphere 0.901961 0.901961 0.901961 96.8376 223 50 Sphere 0.901961 0.901961 0.901961 96.8376 487 468 Sphere 0.901961 0.901961 0.901961 96.8376 619 171 Sphere 0.901961 0.901961 0.901961 96.8376 222 468 Sphere 0.901961 0.901961 0.901961 96.8376 354 171 Sphere 0.901961 0.901961 0.901961 96.8376 -45 468 Sphere 0.901961 0.901961 0.901961 96.8376 89 171 Sphere 0.607843 0.607843 0.607843 96.8376 353 583 Sphere 0.607843 0.607843 0.607843 96.8376 486 287 Sphere 0.607843 0.607843 0.607843 96.8376 619 -11 Sphere 0.607843 0.607843 0.607843 96.8376 88 583 Sphere 0.607843 0.607843 0.607843 96.8376 221 287 Sphere 0.607843 0.607843 0.607843 96.8376 353 -11 Sphere 0.607843 0.607843 0.607843 96.8376 -45 287 Sphere 0.607843 0.607843 0.607843 96.8376 88 -11 Sphere 0.313725 0.313725 0.313725 96.8376 619 404 Sphere 0.313725 0.313725 0.313725 96.8376 353 404 Sphere 0.313725 0.313725 0.313725 96.8376 486 108 Sphere 0.313725 0.313725 0.313725 96.8376 88 404 Sphere 0.313725 0.313725 0.313725 96.8376 221 108 Sphere 1 1 1 67.2484 412 611 Sphere 1 1 1 67.2484 545 314 Sphere 1 1 1 67.2484 148 611 Sphere 1 1 1 67.2484 280 314 Sphere 1 1 1 67.2484 412 17 Sphere 1 1 1 67.2484 14 314 Sphere 1 1 1 67.2484 148 17 Sphere 0.117647 0.117647 0.117647 67.2484 410 587 Sphere 0.117647 0.117647 0.117647 67.2484 543 289 Sphere 0.117647 0.117647 0.117647 67.2484 145 587 Sphere 0.117647 0.117647 0.117647 67.2484 278 289 Sphere 0.117647 0.117647 0.117647 67.2484 410 -7 Sphere 0.117647 0.117647 0.117647 67.2484 12 289 Sphere 0.117647 0.117647 0.117647 67.2484 145 -7 Sphere newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath 0 setgray 1 setlinewidth stroke end grestore showpage %%Trailer %%EOF cleartomark countdictstack exch sub { end } repeat restore grestore % % End Imported PIC File: Pd210_CO_C2top.eps %%EndDocument % % Polyline % % pen to black in case this eps object doesn't set color first 0 0 0 setrgbcolor % Begin Imported EPS File: Pd210_CO_Btop.eps %%BeginDocument: Pd210_CO_Btop.eps % n gs 6210 2925 tr 7.177570 -7.149533 sc 0 -535 tr -30 -157 tr sa n 30 157 m 565 157 l 565 692 l 30 692 l cp clip n countdictstack mark /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %Creator: RasMol Version 2.7.2.1 %%Title: 2.eps %%BoundingBox: 30 157 565 692 %%Pages: 1 %%EndComments %%EndProlog %%BeginSetup 1 setlinecap 1 setlinejoin [] 0 setdash 1 setlinewidth 0 setgray %%EndSetup %%Page: 1 1 gsave 14 dict begin /handleerror { showpage } def /Inten { dup 4 index mul exch dup 4 index mul exch 3 index mul setrgbcolor } def /Dot { moveto 0 0 rlineto stroke } def /Wire { moveto lineto stroke } def /Label { moveto 1 -1 scale show mtrx setmatrix } def /Stick { closepath setrgbcolor fill } def /StickEnd { matrix currentmatrix 6 1 roll translate rotate 1 scale 0 0 3 2 roll 90 -90 arc setmatrix } def /Shade { closepath clip 45 rotate dup -0.81649658092 mul scale 0.2 Inten fill 0 0 0.999512 0 360 arc 0.2 Inten fill 0 0.03125 0.998045 0 360 arc 0.225806 Inten fill 0 0.0625 0.995596 0 360 arc 0.251613 Inten fill 0 0.09375 0.992157 0 360 arc 0.277419 Inten fill 0 0.125 0.987718 0 360 arc 0.303226 Inten fill 0 0.15625 0.982265 0 360 arc 0.329032 Inten fill 0 0.1875 0.975781 0 360 arc 0.354839 Inten fill 0 0.21875 0.968246 0 360 arc 0.380645 Inten fill 0 0.25 0.959635 0 360 arc 0.406452 Inten fill 0 0.28125 0.949918 0 360 arc 0.432258 Inten fill 0 0.3125 0.939061 0 360 arc 0.458065 Inten fill 0 0.34375 0.927025 0 360 arc 0.483871 Inten fill 0 0.375 0.913762 0 360 arc 0.509677 Inten fill 0 0.40625 0.899218 0 360 arc 0.535484 Inten fill 0 0.4375 0.883331 0 360 arc 0.56129 Inten fill 0 0.46875 0.866025 0 360 arc 0.587097 Inten fill 0 0.5 0.847215 0 360 arc 0.612903 Inten fill 0 0.53125 0.826797 0 360 arc 0.63871 Inten fill 0 0.5625 0.80465 0 360 arc 0.664516 Inten fill 0 0.59375 0.780625 0 360 arc 0.690323 Inten fill 0 0.625 0.754544 0 360 arc 0.716129 Inten fill 0 0.65625 0.726184 0 360 arc 0.741935 Inten fill 0 0.6875 0.695269 0 360 arc 0.767742 Inten fill 0 0.71875 0.661438 0 360 arc 0.793548 Inten fill 0 0.75 0.624218 0 360 arc 0.819355 Inten fill 0 0.78125 0.582961 0 360 arc 0.845161 Inten fill 0 0.8125 0.536736 0 360 arc 0.870968 Inten fill 0 0.84375 0.484123 0 360 arc 0.896774 Inten fill 0 0.875 0.422742 0 360 arc 0.922581 Inten fill 0 0.90625 0.347985 0 360 arc 0.948387 Inten fill 0 0.9375 0.248039 0 360 arc 0.974194 Inten fill pop pop pop } def /ClipSphere { translate 0 0 5 2 roll arc } def /ClipBox { translate rotate dup lineto dup neg dup 0 rlineto 0 exch rlineto 0 rlineto closepath clip newpath mtrx setmatrix } def /ClipEllips { translate rotate 1 scale 0 0 4 2 roll dup neg arc reversepath mtrx setmatrix } def /Sphere { gsave translate 0 0 2 index 0 360 arc Shade grestore } def 30 692 translate 0.928819 -0.928819 scale /mtrx matrix currentmatrix def newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath clip newpath 0.313725 0.313725 0.313725 96.2392 618 434 Sphere 0.313725 0.313725 0.313725 96.2392 354 434 Sphere 0.313725 0.313725 0.313725 96.2392 486 140 Sphere 0.313725 0.313725 0.313725 96.2392 90 434 Sphere 0.313725 0.313725 0.313725 96.2392 222 140 Sphere 0.607843 0.607843 0.607843 96.2392 486 552 Sphere 0.607843 0.607843 0.607843 96.2392 618 258 Sphere 0.607843 0.607843 0.607843 96.2392 222 552 Sphere 0.607843 0.607843 0.607843 96.2392 354 258 Sphere 0.607843 0.607843 0.607843 96.2392 486 -38 Sphere 0.607843 0.607843 0.607843 96.2392 -42 552 Sphere 0.607843 0.607843 0.607843 96.2392 90 258 Sphere 0.607843 0.607843 0.607843 96.2392 222 -38 Sphere 0.901961 0.901961 0.901961 96.2392 354 671 Sphere 0.901961 0.901961 0.901961 96.2392 486 375 Sphere 0.901961 0.901961 0.901961 96.2392 618 81 Sphere 0.901961 0.901961 0.901961 96.2392 90 671 Sphere 0.901961 0.901961 0.901961 96.2392 222 375 Sphere 0.901961 0.901961 0.901961 96.2392 354 81 Sphere 0.901961 0.901961 0.901961 96.2392 -42 375 Sphere 0.901961 0.901961 0.901961 96.2392 90 81 Sphere 0.901961 0.901961 0.901961 96.2392 354 493 Sphere 0.901961 0.901961 0.901961 96.2392 486 199 Sphere 0.901961 0.901961 0.901961 96.2392 90 493 Sphere 0.901961 0.901961 0.901961 96.2392 222 199 Sphere 0.901961 0.901961 0.901961 96.2392 -42 199 Sphere 0.901961 0.901961 0.901961 96.2392 486 612 Sphere 0.901961 0.901961 0.901961 96.2392 618 316 Sphere 0.901961 0.901961 0.901961 96.2392 222 612 Sphere 0.901961 0.901961 0.901961 96.2392 354 316 Sphere 0.901961 0.901961 0.901961 96.2392 486 21 Sphere 0.901961 0.901961 0.901961 96.2392 -42 612 Sphere 0.901961 0.901961 0.901961 96.2392 90 316 Sphere 0.901961 0.901961 0.901961 96.2392 222 21 Sphere 0.901961 0.901961 0.901961 96.2392 486 434 Sphere 0.901961 0.901961 0.901961 96.2392 618 140 Sphere 0.901961 0.901961 0.901961 96.2392 222 434 Sphere 0.901961 0.901961 0.901961 96.2392 354 140 Sphere 0.901961 0.901961 0.901961 96.2392 -42 434 Sphere 0.901961 0.901961 0.901961 96.2392 90 140 Sphere 0.901961 0.901961 0.901961 96.2392 354 552 Sphere 0.901961 0.901961 0.901961 96.2392 486 258 Sphere 0.901961 0.901961 0.901961 96.2392 618 -38 Sphere 0.901961 0.901961 0.901961 96.2392 90 552 Sphere 0.901961 0.901961 0.901961 96.2392 222 258 Sphere 0.901961 0.901961 0.901961 96.2392 354 -38 Sphere 0.901961 0.901961 0.901961 96.2392 -42 258 Sphere 0.901961 0.901961 0.901961 96.2392 90 -38 Sphere 0.901961 0.901961 0.901961 96.2392 486 669 Sphere 0.901961 0.901961 0.901961 96.2392 618 374 Sphere 0.901961 0.901961 0.901961 96.2392 222 669 Sphere 0.901961 0.901961 0.901961 96.2392 354 374 Sphere 0.901961 0.901961 0.901961 96.2392 486 79 Sphere 0.901961 0.901961 0.901961 96.2392 -42 669 Sphere 0.901961 0.901961 0.901961 96.2392 90 374 Sphere 0.901961 0.901961 0.901961 96.2392 222 79 Sphere 0.901961 0.901961 0.901961 96.2392 486 492 Sphere 0.901961 0.901961 0.901961 96.2392 618 198 Sphere 0.901961 0.901961 0.901961 96.2392 222 492 Sphere 0.901961 0.901961 0.901961 96.2392 354 198 Sphere 0.901961 0.901961 0.901961 96.2392 -42 492 Sphere 0.901961 0.901961 0.901961 96.2392 90 198 Sphere 0.607843 0.607843 0.607843 96.2392 354 612 Sphere 0.607843 0.607843 0.607843 96.2392 486 317 Sphere 0.607843 0.607843 0.607843 96.2392 618 22 Sphere 0.607843 0.607843 0.607843 96.2392 90 612 Sphere 0.607843 0.607843 0.607843 96.2392 222 317 Sphere 0.607843 0.607843 0.607843 96.2392 354 22 Sphere 0.607843 0.607843 0.607843 96.2392 -42 317 Sphere 0.607843 0.607843 0.607843 96.2392 90 22 Sphere 0.313725 0.313725 0.313725 96.2392 354 436 Sphere 0.313725 0.313725 0.313725 96.2392 486 141 Sphere 0.313725 0.313725 0.313725 96.2392 90 436 Sphere 0.313725 0.313725 0.313725 96.2392 222 141 Sphere 0.313725 0.313725 0.313725 96.2392 -42 141 Sphere 1 1 1 66.8328 354 550 Sphere 1 1 1 66.8328 486 256 Sphere 1 1 1 66.8328 618 -40 Sphere 1 1 1 66.8328 90 550 Sphere 1 1 1 66.8328 222 256 Sphere 1 1 1 66.8328 354 -40 Sphere 1 1 1 66.8328 -42 256 Sphere 1 1 1 66.8328 90 -40 Sphere 0.117647 0.117647 0.117647 66.8328 354 566 Sphere 0.117647 0.117647 0.117647 66.8328 486 272 Sphere 0.117647 0.117647 0.117647 66.8328 618 -24 Sphere 0.117647 0.117647 0.117647 66.8328 90 566 Sphere 0.117647 0.117647 0.117647 66.8328 222 272 Sphere 0.117647 0.117647 0.117647 66.8328 354 -24 Sphere 0.117647 0.117647 0.117647 66.8328 -42 272 Sphere 0.117647 0.117647 0.117647 66.8328 90 -24 Sphere newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath 0 setgray 1 setlinewidth stroke end grestore showpage %%Trailer %%EOF cleartomark countdictstack exch sub { end } repeat restore grestore % % End Imported PIC File: Pd210_CO_Btop.eps %%EndDocument % /Helvetica ff 375.00 scf sf 5400 6210 m gs 1 -1 sc (a\)) col0 sh gr /Helvetica ff 375.00 scf sf 9540 6255 m gs 1 -1 sc (b\)) col0 sh gr $F2psEnd rs %%EndDocument @endspecial -150 1040 a Fq(FIG.)39 b(2:)61 b(Adsorption)39 b(geometries)g(for)g(CO)g(on)g(Pd\(210\).)74 b(O)39 b(is)-150 1127 y(dra)n(wn)24 b(in)g(blac)n(k,)h(C)g(in)f(white,)h(the)f(Pd)g (atoms)g(are)h(shaded)f(in)g(gra)n(y)-6 b(.)-150 1214 y(The)24 b(left)h(panel)f(\(a\))h(illustrates)g(the)f(\014nal)g (adsorption)h(geometry)e(of)-150 1302 y(CO)h(at)h(site)g(E,)f(the)g (righ)n(t)h(panel)f(\(b\))g(at)g(site)h(C.)g(In)f(b)r(oth)g(cases,)i (the)-150 1389 y(bridge-b)r(onded,)f(inclined)h(CO)g(geometry)f(is)h (clearly)h(visible.)-150 1680 y Fs(of)k(the)g(surface)f(relaxation)g (on)g(the)i(CO)e(adsorption)g(energies)-150 1775 y(is)e(relativ)n(ely)f (w)n(eak,)h(ho)n(w)n(ev)n(er,)e(it)j(is)f(t)n(wice)g(as)g(large)f(for)h (the)g(C)-150 1871 y(site)e(than)h(for)e(the)i(E)f(site.)36 b(It)27 b(is)f(in)n(teresting)f(to)h(note)g(that)h(CO)-150 1966 y(adsorption)22 b(on)h(Pd\(210\))g(is)g(not)g(dominated)h(b)n(y)f (the)h(step)g(sites)-150 2062 y(B;)30 b(instead,)h(there)f(is)g(a)f (relativ)n(ely)g(small)h(corrugation)e(in)i(the)-150 2157 y(CO)d(adsorption)f(energies)h(across)e(the)j(surface)f(unit)h (cell.)-67 2258 y(Adsorption)19 b(at)g(site)g(E)g(migh)n(t)h(b)r(e)f (in)n(terpreted)g(as)g(an)g(adsorp-)-150 2353 y(tion)24 b(on)g(a)g(\(100\))f(terrace)g(with)i(an)f(angle)f(of)h(26)p Fm(:)p Fs(6)1433 2323 y Fl(\016)1494 2353 y Fs(against)f(the)-150 2449 y(\(210\))33 b(surface,)h(adsorption)e(at)h(site)g(C)h(as)f(an)g (adsorption)f(on)-150 2544 y(a)d(\(110\))g(facet)h(with)h(an)e(angle)g (of)h(18)p Fm(:)p Fs(4)1117 2514 y Fl(\016)1183 2544 y Fs(against)f(the)h(surface.)-150 2640 y(Both)21 b(sites)h(are)e(ho)n (w)n(ev)n(er)g(iden)n(tical)h(as)g(far)g(as)g(the)h(direct)f(b)r(ond-) -150 2735 y(ing)27 b(partners)f(of)i(the)f(CO)g(molecule)g(are)g (concerned,)f(only)h(the)-150 2831 y(next-nearest)e(neigh)n(b)r(ors)h (are)f(di\013eren)n(t.)37 b(Relaxed)26 b(adsorption)-150 2926 y(geometries)33 b(for)i(b)r(oth)g(sites)f(are)g(detailed)h(in)g(T) -7 b(able)34 b(I)r(I)r(I,)k(and)-150 3022 y(the)i(computed)f(atom)g (distances)g(at)g(b)r(oth)h(sites)f(are)f(iden)n(ti-)-150 3117 y(cal)25 b(within)h(our)e(n)n(umerical)g(accuracy)-7 b(.)35 b(F)-7 b(urthermore,)24 b(the)i(CO)-150 3213 y(molecule)21 b(is)g(b)r(onding)g(almost)g(p)r(erp)r(endicular)g(to)g(the)h(line)f (con-)-150 3308 y(necting)31 b(its)g(t)n(w)n(o)g(resp)r(ectiv)n(e,)g (fully)g(relaxed)f(palladium)h(part-)-150 3404 y(ners)25 b(and)h(p)r(erfectly)g(cen)n(tered)f(in)h(its)g(bridge)f(p)r(osition)g (in)h(b)r(oth)-150 3499 y(cases:)32 b(W)-7 b(e)21 b(only)g(note)f(one)g (Pd-C)g(distance)h(in)g(T)-7 b(able)20 b(I)r(I)r(I)h(as)f(dif-)-150 3595 y(ferences)32 b(are)g(b)r(elo)n(w)h(0)p Fm(:)p Fs(005)774 3580 y(\027)774 3595 y(A.)g(Ho)n(w)n(ev)n(er,)g(the)g(induced)g(la)n(y) n(er)-150 3690 y(relaxations)f(at)j(site)f(C)g(are)f(m)n(uc)n(h)h (stronger)f(than)h(at)g(site)h(E,)-150 4018 y Fq(T)-6 b(ABLE)24 b(I)r(I:)f(Adsorption)h(energies)g(p)r(er)g(molecule)f(for)i (di\013eren)n(t)e(ad-)-150 4105 y(sorption)33 b(sites)g(of)g(CO)g(on)f (Pd\(210\).)56 b(The)32 b(notation)h(of)g(the)f(sites)-150 4192 y(refers)19 b(to)e(Fig.)i(1.)32 b(F)-6 b(or)18 b(adsorption)g(at)g (the)f(on-top)g(site,)j(the)d(molecule)-150 4279 y(w)n(as)27 b(laterally)g(constrained)f(to)g(p)r(osition)g(D.)p 47 4405 1649 4 v 47 4422 V 979 4502 a Fh(E)1036 4511 y Fe(ad)1129 4502 y Fq([eV])p 547 4532 1150 4 v 63 4609 a(Co)n(v)n(erage)35 b(Site)e(Fixed)26 b(slab)33 b(Relaxed)26 b(slab)34 b(Exp.[45)q(])p 47 4638 1649 4 v 440 4719 a(E)176 b(1)p Fh(:)p Fq(83)285 b(1)p Fh(:)p Fq(88)250 b(1)p Fh(:)p Fq(45)438 4825 y(C)175 b(1)p Fh(:)p Fq(76)285 b(1)p Fh(:)p Fq(86)127 4932 y Fh(\022)23 b Fq(=)e(1)134 b(B)175 b(1)p Fh(:)p Fq(73)285 b(1)p Fh(:)p Fq(77)437 5039 y(A)173 b(1)p Fh(:)p Fq(50)285 b(1)p Fh(:)p Fq(58)437 5145 y(D)172 b(1)p Fh(:)p Fq(48)285 b(1)p Fh(:)p Fq(50)97 5284 y Fh(\022)23 b Fq(=)e(1)p Fh(:)p Fq(5)334 b(0)p Fh(:)p Fq(91)315 b(|)278 b(1)p Fh(:)p Fq(14)p 47 5313 V 47 5330 V 2042 -83 a Fs(c)n(hanging)26 b(the)h(orien)n(tation)f(of)i(the)f(Pd-Pd)g(axis)f(b)r(et)n(w)n(een)h (\014rst)2042 12 y(and)e(second)h(la)n(y)n(er)e(and)h(th)n(us)h(allo)n (wing)e(the)j(molecule)e(to)h(p)r(osi-)2042 108 y(tion)k(itself)h(in)g (a)f(more)f(uprigh)n(t)h(fashion)g(while)g(still)h(p)r(erfectly)2042 203 y(preserving)17 b(its)i(bridge-b)r(onding)f(p)r(osition.)34 b(This)19 b(also)f(explains)2042 299 y(the)27 b(relativ)n(ely)f(large)g (energy)f(gain)i(at)g(this)g(p)r(osition)g(when)g(re-)2042 394 y(laxing)21 b(the)i(substrate.)34 b(In)22 b(particular,)g(there)g (is)g(a)g(surprisingly)2042 490 y(strong)k(out)n(w)n(ard)h(relaxation)f (b)r(et)n(w)n(een)i(the)g(second)f(and)h(third)2042 585 y(la)n(y)n(er.)46 b(Note)32 b(that)g(at)f(the)h(clean)f(surface,)g(DFT) h(calculations)2042 681 y(yield)26 b(a)f(reduction)h(of)g Fm(d)2812 693 y Fk(23)2908 681 y Fs(with)h(resp)r(ect)e(to)h(the)g (bulk)g(v)-5 b(alue)26 b(of)2042 776 y Fn(\000)p Fs(3\045)h([23)o(].) 2125 891 y(Exp)r(erimen)n(tally)-7 b(,)23 b(electron)f(stim)n(ulated)h (desorption)f(ion)h(an-)2042 987 y(gular)40 b(distribution)i (\(ESDIAD\))i(measuremen)n(ts)d([9)o(])h(at)g(lo)n(w)2042 1082 y(co)n(v)n(erages)h(up)k(to)f Fm(\022)57 b Fs(=)d(1)46 b(suggest)f(adsorption)g(of)i(CO)f(in)2042 1178 y(a)35 b(bridge-b)r(onded)g(p)r(osition)g(at)g(site)h(E,)f(inclined)h(a)n(w)n (a)n(y)e(from)2042 1273 y(the)c(surface)f(normal,)g(in)h(agreemen)n(t)e (with)i(our)f(DFT)i(results.)2042 1369 y(Thermal)21 b(desorption)f (results)h(yield)g(an)h(initial)f(adsorption)f(en-)2042 1464 y(ergy)e(of)i(1)p Fm(:)p Fs(52)e(eV)i([7)o(])g(or)e(1)p Fm(:)p Fs(45)h(eV)g(p)r(er)h(molecule)f([45)o(].)34 b(The)20 b(bind-)2042 1560 y(ing)j(energy)f(for)g(the)i(bridge)e(site)i(E)e(is)h (th)n(us)h(considerably)d(o)n(v)n(er-)2042 1655 y(estimated.)36 b(GGA)27 b(calculations)d(using)i(the)g(PW91)f(exc)n(hange-)2042 1751 y(correlation)d(functional,)k(ho)n(w)n(ev)n(er,)d(tend)i(to)g(o)n (v)n(erestimate)e(the)2042 1846 y(CO)k(adsorption)f(on)h(a)h(wide)f (range)g(of)g(metal)h(surfaces)e([46)o(].)2125 1961 y(F)-7 b(or)31 b(the)g(CO)g(adsorption)f(on)h(Pd\(100\),)h(w)n(e)f(obtain)g (an)g(ad-)2042 2057 y(sorption)26 b(energy)h(of)g(1)p Fm(:)p Fs(91)f(eV)i(at)g(the)g(bridge)e(p)r(osition)i(for)f(the)2042 2152 y Fm(c)p Fs(\(2)2152 2083 y Fn(p)p 2221 2083 42 4 v 69 x Fs(2)10 b Fn(\002)2349 2083 y(p)p 2417 2083 V 2417 2152 a Fs(2\))24 b(CO)f(sup)r(erstructure,)h(in)f(go)r(o)r(d)g (agreemen)n(t)g(with)2042 2247 y(previous)g(calculations)h(using)g(a)h (sligh)n(tly)f(di\013eren)n(t)h(setup)g([11)o(].)2042 2352 y(Note)e(that)g(the)g Fm(c)p Fs(\(2)2661 2283 y Fn(p)p 2730 2283 V 69 x Fs(2)8 b Fn(\002)2854 2283 y(p)p 2923 2283 V 69 x Fs(2)o(\)\(100\))22 b(and)h(the)g(\(1)9 b Fn(\002)g Fs(1\)\(210\))21 b(sur-)2042 2447 y(face)27 b(unit)g(cells)g(ha)n(v)n(e)f(appro)n(ximately)f(the)j(same)e(area)g (so)g(that)2042 2543 y(these)37 b(calculations)f(corresp)r(ond)f(to)i (comparable)e(co)n(v)n(erages.)2042 2638 y(Nev)n(ertheless,)30 b(it)g(is)g(surprising)f(that)h(the)h(adsorption)d(energy)2042 2734 y(of)23 b(CO)f(in)h(fact)g(turns)g(out)g(b)r(e)g(sligh)n(tly)g(lo) n(w)n(er)e(on)h(Pd\(210\))g(than)2042 2829 y(on)34 b(Pd\(100\).)55 b(Giv)n(en)34 b(the)g(lo)n(w)g(co)r(ordination)f(of)h(the)g(top)g(Pd) 2042 2925 y(atom)23 b(and)g(th)n(us)g(its)g(high)g(reactivit)n(y)-7 b(,)23 b(it)h(migh)n(t)f(b)r(e)h(an)n(ticipated)2042 3020 y(that)29 b(CO)g(is)g(actually)f(strongly)g(b)r(ound)h(to)g (Pd\(210\).)40 b(F)-7 b(or)29 b(on-)2042 3116 y(top)e(adsorption,)f (this)h(is)g(indeed)g(true:)36 b(Adsorption)27 b(at)g(site)g(D)2042 3211 y(giv)n(es)19 b(a)i(binding)g(energy)f(of)g(1)p Fm(:)p Fs(50)g(eV,)h(whereas)f(on-top)g(adsorp-)2042 3572 y Fq(T)-6 b(ABLE)31 b(I)r(I)r(I:)g(Adsorption)g(geometries)g(for)h (CO)g(on)f(Pd\(210\))g(at)h(a)2042 3659 y(co)n(v)n(erage)25 b(of)f Fh(\022)g Fq(=)d(1.)34 b(The)24 b(used)g(notation)g(for)h(the)e (b)r(onding)h(lengths)2042 3746 y(and)h(angle)i(is)f(illustrated)g(in)g (the)f(\014gure.)34 b(F)-6 b(or)26 b(the)f(in)n(terla)n(y)n(er)h(spac-) 2042 3833 y(ings,)37 b Fh(d)2272 3841 y Fe(12)2371 3833 y Fq(and)c Fh(d)2568 3841 y Fe(23)2633 3833 y Fq(,)j(the)e(relativ)n(e) h(c)n(hange)f(in)g(\045)g(to)g(the)f(bulk)h(in-)2042 3920 y(terla)n(y)n(er)k(distance)g(is)g(giv)n(en)f(in)h(paren)n (theses.)71 b(Note)37 b(that,)k(on)d(a)2042 4007 y(\014xed)21 b(slab,)j(CO)f(adsorption)g(in)f(a)h(bridge-b)r(onded,)g(lo)r(cally)h (p)r(erp)r(en-)2042 4095 y(dicular)k(orien)n(tation)g(at)g(site)g(C)g (corresp)r(onds)g(to)f(an)h(inclination)g(of)2042 4182 y Fh(\022)2078 4190 y Fe(C)p Ff(\000)p Fe(O)2241 4182 y Fq(=)21 b(18)p Fh(:)p Fq(4)2457 4150 y Ff(\016)2520 4182 y Fq(as)27 b(measured)e(against)h(the)g(surface)h(normal.)2646 5014 y @beginspecial 0 @llx 0 @lly 272 @urx 231 @ury 850 @rhi @setspecial %%BeginDocument: Fig_TabIII.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: Pd210_COBondingParameter.eps %%Creator: fig2dev Version 3.2 Patchlevel 3c %%CreationDate: Mon Dec 9 11:12:31 2002 %%For: mlischka@berg (Markus Lischka) %%BoundingBox: 0 0 272 231 %%Magnification: 1.0000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save newpath 0 231 moveto 0 0 lineto 272 0 lineto 272 231 lineto closepath clip newpath -3.0 234.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /reencdict 12 dict def /ReEncode { reencdict begin /newcodesandnames exch def /newfontname exch def /basefontname exch def /basefontdict basefontname findfont def /newfont basefontdict maxlength dict def basefontdict { exch dup /FID ne { dup /Encoding eq { exch dup length array copy newfont 3 1 roll put } { exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall newfont /FontName newfontname put newcodesandnames aload pop 128 1 255 { newfont /Encoding get exch /.notdef put } for newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat newfontname newfont definefont pop end } def /isovec [ 8#055 /minus 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde 8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis 8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron 8#220 /dotlessi 8#230 /oe 8#231 /OE 8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling 8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis 8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot 8#255 /hyphen 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus 8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph 8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine 8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf 8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute 8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring 8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute 8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute 8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve 8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply 8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex 8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave 8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring 8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute 8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute 8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve 8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide 8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex 8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def /Times-Roman /Times-Roman-iso isovec ReEncode /Times-Roman /Times-Roman-iso isovec ReEncode /Times-Italic /Times-Italic-iso isovec ReEncode /DrawEllipse { /endangle exch def /startangle exch def /yrad exch def /xrad exch def /y exch def /x exch def /savematrix mtrx currentmatrix def x y tr xrad yrad sc 0 0 1 startangle endangle arc closepath savematrix setmatrix } def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def $F2psBegin %%Page: 1 1 10 setmiterlimit 0.06299 0.06299 sc % % Fig objects follow % 30.000 slw % Rotated Ellipse gs 2461 1575 tr -341.999 rot n 0 0 350 350 0 360 DrawEllipse 341.999 rot gs col7 0.10 shd ef gr gs col0 s gr gr % Rotated Ellipse gs 1475 2783 tr -341.999 rot n 0 0 550 550 0 360 DrawEllipse 341.999 rot gs col7 0.30 shd ef gr gs col0 s gr gr % Rotated Ellipse gs 2545 3130 tr -341.999 rot n 0 0 550 550 0 360 DrawEllipse 341.999 rot gs col7 0.60 shd ef gr gs col0 s gr gr % Polyline 7.500 slw n 2240 454 m 2240 2254 l 2795 529 l gs col0 s gr % Polyline n 2990 2018 m 3305 2918 l gs col0 s gr % Polyline n 2864 2058 m 3139 1963 l gs col0 s gr % Polyline n 3164 2958 m 3439 2863 l gs col0 s gr % Polyline n 1934 1378 m 1694 2083 l gs col0 s gr % Polyline n 1554 2033 m 1829 2128 l gs col0 s gr % Polyline n 1784 1323 m 2059 1418 l gs col0 s gr % Polyline [60] 0 sd n 162 2332 m 4119 3648 l gs col0 s gr [] 0 sd % Polyline 2 slj n 2250 585 m 2252 584 l 2257 584 l 2265 582 l 2275 581 l 2288 580 l 2305 579 l 2325 580 l 2352 581 l 2385 585 l 2411 589 l 2435 592 l 2454 595 l 2470 598 l 2481 600 l 2490 602 l 2498 604 l 2505 605 l 2514 607 l 2525 610 l 2541 614 l 2560 618 l 2584 624 l 2610 630 l 2643 639 l 2670 646 l 2690 653 l 2707 659 l 2720 664 l 2730 668 l 2738 672 l 2743 674 l 2745 675 l gs col0 s gr /Symbol ff 360.00 scf sf 2295 315 m gs 1 -1 sc (J) col0 sh gr /Times-Roman-iso ff 270.00 scf sf 1260 1800 m gs 1 -1 sc (C-O) col0 sh gr /Times-Roman-iso ff 270.00 scf sf 3510 2520 m gs 1 -1 sc (Pd-C) col0 sh gr /Times-Roman-iso ff 270.00 scf sf 2520 450 m gs 1 -1 sc (C-O) col0 sh gr /Times-Roman-iso ff 270.00 scf sf 3735 3060 m gs 1 -1 sc (\(210\)) col0 sh gr /Times-Roman-iso ff 270.00 scf sf 52 2722 m gs 1 -1 sc (18.4\260 ) col0 sh gr /Times-Italic-iso ff 360.00 scf sf 1035 1710 m gs 1 -1 sc (d) col0 sh gr /Times-Italic-iso ff 360.00 scf sf 3285 2385 m gs 1 -1 sc (d) col0 sh gr 30.000 slw % Rotated Ellipse gs 2239 2260 tr -341.999 rot n 0 0 350 350 0 360 DrawEllipse 341.999 rot gs col0 s gr gr % Polyline 0 slj 7.500 slw [60] 0 sd n 125 2779 m 4295 2779 l gs col0 s gr [] 0 sd $F2psEnd rs %%EndDocument @endspecial 2143 5025 1841 4 v 2143 5042 V 2159 5110 a Fk(Site)32 b Fd(d)2338 5119 y Fc(Pd)p Fb(\000)p Fc(C)2518 5110 y Fk([)2537 5100 y(\027)2537 5110 y(A])h Fd(d)2673 5118 y Fc(C)p Fb(\000)p Fc(O)2826 5110 y Fk([)2845 5100 y(\027)2845 5110 y(A])g Fd(#)2986 5118 y Fc(C)p Fb(\000)p Fc(O)3140 5110 y Fk([)3159 5085 y Fb(\016)3193 5110 y Fk(])104 b Fd(d)3351 5118 y Fc(12)3433 5110 y Fk([)3452 5100 y(\027)3452 5110 y(A])173 b Fd(d)3728 5118 y Fc(23)3810 5110 y Fk([)3829 5100 y(\027)3829 5110 y(A])p 2143 5133 V 2192 5202 a(E)157 b(1)p Fd(:)p Fk(99)203 b(1)p Fd(:)p Fk(18)185 b(18)p Fd(:)p Fk(0)106 b(0)p Fd(:)p Fk(760)23 b(\()p Fl(\000)p Fk(14\))50 b(0)p Fd(:)p Fk(950)22 b(\(+7\))2191 5290 y(C)156 b(1)p Fd(:)p Fk(99)203 b(1)p Fd(:)p Fk(18)185 b(12)p Fd(:)p Fk(0)106 b(0)p Fd(:)p Fk(723)23 b(\()p Fl(\000)p Fk(18\))33 b(1)p Fd(:)p Fk(023)23 b(\(+15\))p 2143 5313 V 2143 5330 V eop %%Page: 4 4 4 3 bop 4043 -299 a Fs(4)103 1369 y @beginspecial 0 @llx 0 @lly 537 @urx 537 @ury 1842 @rwi @setspecial %%BeginDocument: Fig3.eps %!PS-Adobe-2.0 EPSF-2.0 %%Title: Pd210_3COtop+cell.eps %%Creator: fig2dev Version 3.2 Patchlevel 3c %%CreationDate: Wed Dec 18 15:55:15 2002 %%For: mlischka@berg (Markus Lischka) %%BoundingBox: 0 0 537 537 %%Magnification: 1.0000 %%EndComments /$F2psDict 200 dict def $F2psDict begin $F2psDict /mtrx matrix put /col-1 {0 setgray} bind def /col0 {0.000 0.000 0.000 srgb} bind def /col1 {0.000 0.000 1.000 srgb} bind def /col2 {0.000 1.000 0.000 srgb} bind def /col3 {0.000 1.000 1.000 srgb} bind def /col4 {1.000 0.000 0.000 srgb} bind def /col5 {1.000 0.000 1.000 srgb} bind def /col6 {1.000 1.000 0.000 srgb} bind def /col7 {1.000 1.000 1.000 srgb} bind def /col8 {0.000 0.000 0.560 srgb} bind def /col9 {0.000 0.000 0.690 srgb} bind def /col10 {0.000 0.000 0.820 srgb} bind def /col11 {0.530 0.810 1.000 srgb} bind def /col12 {0.000 0.560 0.000 srgb} bind def /col13 {0.000 0.690 0.000 srgb} bind def /col14 {0.000 0.820 0.000 srgb} bind def /col15 {0.000 0.560 0.560 srgb} bind def /col16 {0.000 0.690 0.690 srgb} bind def /col17 {0.000 0.820 0.820 srgb} bind def /col18 {0.560 0.000 0.000 srgb} bind def /col19 {0.690 0.000 0.000 srgb} bind def /col20 {0.820 0.000 0.000 srgb} bind def /col21 {0.560 0.000 0.560 srgb} bind def /col22 {0.690 0.000 0.690 srgb} bind def /col23 {0.820 0.000 0.820 srgb} bind def /col24 {0.500 0.190 0.000 srgb} bind def /col25 {0.630 0.250 0.000 srgb} bind def /col26 {0.750 0.380 0.000 srgb} bind def /col27 {1.000 0.500 0.500 srgb} bind def /col28 {1.000 0.630 0.630 srgb} bind def /col29 {1.000 0.750 0.750 srgb} bind def /col30 {1.000 0.880 0.880 srgb} bind def /col31 {1.000 0.840 0.000 srgb} bind def end save newpath 0 537 moveto 0 0 lineto 537 0 lineto 537 537 lineto closepath clip newpath 1.0 533.0 translate 1 -1 scale /cp {closepath} bind def /ef {eofill} bind def /gr {grestore} bind def /gs {gsave} bind def /sa {save} bind def /rs {restore} bind def /l {lineto} bind def /m {moveto} bind def /rm {rmoveto} bind def /n {newpath} bind def /s {stroke} bind def /sh {show} bind def /slc {setlinecap} bind def /slj {setlinejoin} bind def /slw {setlinewidth} bind def /srgb {setrgbcolor} bind def /rot {rotate} bind def /sc {scale} bind def /sd {setdash} bind def /ff {findfont} bind def /sf {setfont} bind def /scf {scalefont} bind def /sw {stringwidth} bind def /tr {translate} bind def /tnt {dup dup currentrgbcolor 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb} bind def /shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul 4 -2 roll mul srgb} bind def /$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def /$F2psEnd {$F2psEnteredState restore end} def $F2psBegin %%Page: 1 1 10 setmiterlimit 0.06299 0.06299 sc % % Fig objects follow % % Polyline % % pen to black in case this eps object doesn't set color first 0 0 0 setrgbcolor % Begin Imported EPS File: Pd210_3COtop.eps %%BeginDocument: Pd210_3COtop.eps % n gs 0 -45 tr 15.874766 -15.874766 sc 0 -535 tr -30 -157 tr sa n 30 157 m 565 157 l 565 692 l 30 692 l cp clip n countdictstack mark /showpage {} def % EPS file follows: %!PS-Adobe-2.0 EPSF-2.0 %Creator: RasMol Version 2.7.2.1 %%Title: 3.eps %%BoundingBox: 30 157 565 692 %%Pages: 1 %%EndComments %%EndProlog %%BeginSetup 1 setlinecap 1 setlinejoin [] 0 setdash 1 setlinewidth 0 setgray %%EndSetup %%Page: 1 1 gsave 14 dict begin /handleerror { showpage } def /Inten { dup 4 index mul exch dup 4 index mul exch 3 index mul setrgbcolor } def /Dot { moveto 0 0 rlineto stroke } def /Wire { moveto lineto stroke } def /Label { moveto 1 -1 scale show mtrx setmatrix } def /Stick { closepath setrgbcolor fill } def /StickEnd { matrix currentmatrix 6 1 roll translate rotate 1 scale 0 0 3 2 roll 90 -90 arc setmatrix } def /Shade { closepath clip 45 rotate dup -0.81649658092 mul scale 0.2 Inten fill 0 0 0.999512 0 360 arc 0.2 Inten fill 0 0.03125 0.998045 0 360 arc 0.225806 Inten fill 0 0.0625 0.995596 0 360 arc 0.251613 Inten fill 0 0.09375 0.992157 0 360 arc 0.277419 Inten fill 0 0.125 0.987718 0 360 arc 0.303226 Inten fill 0 0.15625 0.982265 0 360 arc 0.329032 Inten fill 0 0.1875 0.975781 0 360 arc 0.354839 Inten fill 0 0.21875 0.968246 0 360 arc 0.380645 Inten fill 0 0.25 0.959635 0 360 arc 0.406452 Inten fill 0 0.28125 0.949918 0 360 arc 0.432258 Inten fill 0 0.3125 0.939061 0 360 arc 0.458065 Inten fill 0 0.34375 0.927025 0 360 arc 0.483871 Inten fill 0 0.375 0.913762 0 360 arc 0.509677 Inten fill 0 0.40625 0.899218 0 360 arc 0.535484 Inten fill 0 0.4375 0.883331 0 360 arc 0.56129 Inten fill 0 0.46875 0.866025 0 360 arc 0.587097 Inten fill 0 0.5 0.847215 0 360 arc 0.612903 Inten fill 0 0.53125 0.826797 0 360 arc 0.63871 Inten fill 0 0.5625 0.80465 0 360 arc 0.664516 Inten fill 0 0.59375 0.780625 0 360 arc 0.690323 Inten fill 0 0.625 0.754544 0 360 arc 0.716129 Inten fill 0 0.65625 0.726184 0 360 arc 0.741935 Inten fill 0 0.6875 0.695269 0 360 arc 0.767742 Inten fill 0 0.71875 0.661438 0 360 arc 0.793548 Inten fill 0 0.75 0.624218 0 360 arc 0.819355 Inten fill 0 0.78125 0.582961 0 360 arc 0.845161 Inten fill 0 0.8125 0.536736 0 360 arc 0.870968 Inten fill 0 0.84375 0.484123 0 360 arc 0.896774 Inten fill 0 0.875 0.422742 0 360 arc 0.922581 Inten fill 0 0.90625 0.347985 0 360 arc 0.948387 Inten fill 0 0.9375 0.248039 0 360 arc 0.974194 Inten fill pop pop pop } def /ClipSphere { translate 0 0 5 2 roll arc } def /ClipBox { translate rotate dup lineto dup neg dup 0 rlineto 0 exch rlineto 0 rlineto closepath clip newpath mtrx setmatrix } def /ClipEllips { translate rotate 1 scale 0 0 4 2 roll dup neg arc reversepath mtrx setmatrix } def /Sphere { gsave translate 0 0 2 index 0 360 arc Shade grestore } def 30 692 translate 0.928819 -0.928819 scale /mtrx matrix currentmatrix def newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath clip newpath 0.901961 0.901961 0.901961 56.77 599 444 Sphere 0.901961 0.901961 0.901961 56.77 443 444 Sphere 0.901961 0.901961 0.901961 56.77 599 97 Sphere 0.901961 0.901961 0.901961 56.77 288 444 Sphere 0.901961 0.901961 0.901961 56.77 443 97 Sphere 0.901961 0.901961 0.901961 56.77 133 444 Sphere 0.901961 0.901961 0.901961 56.77 288 97 Sphere 0.901961 0.901961 0.901961 56.77 -24 444 Sphere 0.901961 0.901961 0.901961 56.77 133 97 Sphere 0.901961 0.901961 0.901961 56.77 521 619 Sphere 0.901961 0.901961 0.901961 56.77 366 619 Sphere 0.901961 0.901961 0.901961 56.77 521 271 Sphere 0.901961 0.901961 0.901961 56.77 210 619 Sphere 0.901961 0.901961 0.901961 56.77 366 271 Sphere 0.901961 0.901961 0.901961 56.77 54 619 Sphere 0.901961 0.901961 0.901961 56.77 210 271 Sphere 0.901961 0.901961 0.901961 56.77 54 271 Sphere 0.901961 0.901961 0.901961 56.77 599 340 Sphere 0.901961 0.901961 0.901961 56.77 443 340 Sphere 0.901961 0.901961 0.901961 56.77 599 -8 Sphere 0.901961 0.901961 0.901961 56.77 288 340 Sphere 0.901961 0.901961 0.901961 56.77 443 -8 Sphere 0.901961 0.901961 0.901961 56.77 133 340 Sphere 0.901961 0.901961 0.901961 56.77 288 -8 Sphere 0.901961 0.901961 0.901961 56.77 -24 340 Sphere 0.901961 0.901961 0.901961 56.77 133 -8 Sphere 0.901961 0.901961 0.901961 56.77 521 514 Sphere 0.901961 0.901961 0.901961 56.77 366 514 Sphere 0.901961 0.901961 0.901961 56.77 521 166 Sphere 0.901961 0.901961 0.901961 56.77 210 514 Sphere 0.901961 0.901961 0.901961 56.77 366 166 Sphere 0.901961 0.901961 0.901961 56.77 54 514 Sphere 0.901961 0.901961 0.901961 56.77 210 166 Sphere 0.901961 0.901961 0.901961 56.77 54 166 Sphere 0.901961 0.901961 0.901961 56.77 521 410 Sphere 0.901961 0.901961 0.901961 56.77 366 410 Sphere 0.901961 0.901961 0.901961 56.77 521 62 Sphere 0.901961 0.901961 0.901961 56.77 210 410 Sphere 0.901961 0.901961 0.901961 56.77 366 62 Sphere 0.901961 0.901961 0.901961 56.77 54 410 Sphere 0.901961 0.901961 0.901961 56.77 210 62 Sphere 0.901961 0.901961 0.901961 56.77 54 62 Sphere 0.901961 0.901961 0.901961 56.77 443 584 Sphere 0.901961 0.901961 0.901961 56.77 599 236 Sphere 0.901961 0.901961 0.901961 56.77 288 584 Sphere 0.901961 0.901961 0.901961 56.77 443 236 Sphere 0.901961 0.901961 0.901961 56.77 133 584 Sphere 0.901961 0.901961 0.901961 56.77 288 236 Sphere 0.901961 0.901961 0.901961 56.77 -24 584 Sphere 0.901961 0.901961 0.901961 56.77 133 236 Sphere 0.901961 0.901961 0.901961 56.77 -24 236 Sphere 0.901961 0.901961 0.901961 56.77 521 305 Sphere 0.901961 0.901961 0.901961 56.77 366 305 Sphere 0.901961 0.901961 0.901961 56.77 521 -43 Sphere 0.901961 0.901961 0.901961 56.77 210 305 Sphere 0.901961 0.901961 0.901961 56.77 366 -43 Sphere 0.901961 0.901961 0.901961 56.77 54 305 Sphere 0.901961 0.901961 0.901961 56.77 210 -43 Sphere 0.901961 0.901961 0.901961 56.77 54 -43 Sphere 0.901961 0.901961 0.901961 56.77 443 479 Sphere 0.901961 0.901961 0.901961 56.77 599 131 Sphere 0.901961 0.901961 0.901961 56.77 288 479 Sphere 0.901961 0.901961 0.901961 56.77 443 131 Sphere 0.901961 0.901961 0.901961 56.77 133 479 Sphere 0.901961 0.901961 0.901961 56.77 288 131 Sphere 0.901961 0.901961 0.901961 56.77 -24 479 Sphere 0.901961 0.901961 0.901961 56.77 133 131 Sphere 0.901961 0.901961 0.901961 56.77 -24 131 Sphere 0.901961 0.901961 0.901961 56.77 599 375 Sphere 0.901961 0.901961 0.901961 56.77 443 375 Sphere 0.901961 0.901961 0.901961 56.77 599 27 Sphere 0.901961 0.901961 0.901961 56.77 288 375 Sphere 0.901961 0.901961 0.901961 56.77 443 27 Sphere 0.901961 0.901961 0.901961 56.77 133 375 Sphere 0.901961 0.901961 0.901961 56.77 288 27 Sphere 0.901961 0.901961 0.901961 56.77 -24 375 Sphere 0.901961 0.901961 0.901961 56.77 133 27 Sphere 0.901961 0.901961 0.901961 56.77 521 549 Sphere 0.901961 0.901961 0.901961 56.77 366 549 Sphere 0.901961 0.901961 0.901961 56.77 521 201 Sphere 0.901961 0.901961 0.901961 56.77 210 549 Sphere 0.901961 0.901961 0.901961 56.77 366 201 Sphere 0.901961 0.901961 0.901961 56.77 54 549 Sphere 0.901961 0.901961 0.901961 56.77 210 201 Sphere 0.901961 0.901961 0.901961 56.77 54 201 Sphere 0.901961 0.901961 0.901961 56.77 521 444 Sphere 0.901961 0.901961 0.901961 56.77 366 444 Sphere 0.901961 0.901961 0.901961 56.77 521 97 Sphere 0.901961 0.901961 0.901961 56.77 210 444 Sphere 0.901961 0.901961 0.901961 56.77 366 97 Sphere 0.901961 0.901961 0.901961 56.77 54 444 Sphere 0.901961 0.901961 0.901961 56.77 210 97 Sphere 0.901961 0.901961 0.901961 56.77 54 97 Sphere 0.901961 0.901961 0.901961 56.77 443 619 Sphere 0.901961 0.901961 0.901961 56.77 599 271 Sphere 0.901961 0.901961 0.901961 56.77 288 619 Sphere 0.901961 0.901961 0.901961 56.77 443 271 Sphere 0.901961 0.901961 0.901961 56.77 133 619 Sphere 0.901961 0.901961 0.901961 56.77 288 271 Sphere 0.901961 0.901961 0.901961 56.77 -24 619 Sphere 0.901961 0.901961 0.901961 56.77 133 271 Sphere 0.901961 0.901961 0.901961 56.77 -24 271 Sphere 0.901961 0.901961 0.901961 56.77 521 340 Sphere 0.901961 0.901961 0.901961 56.77 366 340 Sphere 0.901961 0.901961 0.901961 56.77 521 -8 Sphere 0.901961 0.901961 0.901961 56.77 210 340 Sphere 0.901961 0.901961 0.901961 56.77 366 -8 Sphere 0.901961 0.901961 0.901961 56.77 54 340 Sphere 0.901961 0.901961 0.901961 56.77 210 -8 Sphere 0.901961 0.901961 0.901961 56.77 54 -8 Sphere 0.901961 0.901961 0.901961 56.77 443 514 Sphere 0.901961 0.901961 0.901961 56.77 599 166 Sphere 0.901961 0.901961 0.901961 56.77 288 514 Sphere 0.901961 0.901961 0.901961 56.77 443 166 Sphere 0.901961 0.901961 0.901961 56.77 133 514 Sphere 0.901961 0.901961 0.901961 56.77 288 166 Sphere 0.901961 0.901961 0.901961 56.77 -24 514 Sphere 0.901961 0.901961 0.901961 56.77 133 166 Sphere 0.901961 0.901961 0.901961 56.77 -24 166 Sphere 0.901961 0.901961 0.901961 56.77 599 410 Sphere 0.901961 0.901961 0.901961 56.77 443 410 Sphere 0.901961 0.901961 0.901961 56.77 599 62 Sphere 0.901961 0.901961 0.901961 56.77 288 410 Sphere 0.901961 0.901961 0.901961 56.77 443 62 Sphere 0.901961 0.901961 0.901961 39.4236 133 410 Sphere 0.901961 0.901961 0.901961 39.4236 288 62 Sphere 0.901961 0.901961 0.901961 39.4236 -24 410 Sphere 0.901961 0.901961 0.901961 39.4236 133 62 Sphere 0.901961 0.901961 0.901961 39.4236 521 584 Sphere 0.901961 0.901961 0.901961 39.4236 366 584 Sphere 0.901961 0.901961 0.901961 39.4236 521 237 Sphere 0.901961 0.901961 0.901961 39.4236 210 584 Sphere 0.901961 0.901961 0.901961 39.4236 366 237 Sphere 0.901961 0.901961 0.901961 39.4236 54 584 Sphere 0.901961 0.901961 0.901961 39.4236 210 237 Sphere 0.901961 0.901961 0.901961 56.77 54 237 Sphere 0.901961 0.901961 0.901961 56.77 599 307 Sphere 0.901961 0.901961 0.901961 56.77 443 307 Sphere 0.901961 0.901961 0.901961 56.77 599 -41 Sphere 0.901961 0.901961 0.901961 56.77 288 307 Sphere 0.901961 0.901961 0.901961 56.77 443 -41 Sphere 0.901961 0.901961 0.901961 56.77 133 307 Sphere 0.901961 0.901961 0.901961 56.77 288 -41 Sphere 0.901961 0.901961 0.901961 56.77 -24 307 Sphere 0.901961 0.901961 0.901961 56.77 133 -41 Sphere 0.901961 0.901961 0.901961 56.77 521 481 Sphere 0.901961 0.901961 0.901961 56.77 366 481 Sphere 0.901961 0.901961 0.901961 56.77 521 134 Sphere 0.901961 0.901961 0.901961 56.77 210 481 Sphere 0.901961 0.901961 0.901961 56.77 366 134 Sphere 0.901961 0.901961 0.901961 56.77 54 481 Sphere 0.901961 0.901961 0.901961 56.77 210 134 Sphere 0.901961 0.901961 0.901961 56.77 54 134 Sphere 0.607843 0.607843 0.607843 56.77 521 375 Sphere 0.607843 0.607843 0.607843 56.77 366 375 Sphere 0.607843 0.607843 0.607843 56.77 521 27 Sphere 0.607843 0.607843 0.607843 56.77 210 375 Sphere 0.607843 0.607843 0.607843 56.77 366 27 Sphere 0.607843 0.607843 0.607843 56.77 54 375 Sphere 0.607843 0.607843 0.607843 56.77 210 27 Sphere 0.607843 0.607843 0.607843 56.77 54 27 Sphere 0.607843 0.607843 0.607843 56.77 443 549 Sphere 0.607843 0.607843 0.607843 56.77 599 201 Sphere 0.607843 0.607843 0.607843 56.77 288 549 Sphere 0.607843 0.607843 0.607843 56.77 443 201 Sphere 0.607843 0.607843 0.607843 56.77 133 549 Sphere 0.607843 0.607843 0.607843 56.77 288 201 Sphere 0.607843 0.607843 0.607843 56.77 -24 549 Sphere 0.607843 0.607843 0.607843 56.77 133 201 Sphere 0.607843 0.607843 0.607843 56.77 -24 201 Sphere 0.313725 0.313725 0.313725 56.77 599 443 Sphere 0.313725 0.313725 0.313725 56.77 443 443 Sphere 0.313725 0.313725 0.313725 56.77 599 95 Sphere 0.313725 0.313725 0.313725 56.77 288 443 Sphere 0.313725 0.313725 0.313725 56.77 443 95 Sphere 0.313725 0.313725 0.313725 56.77 133 443 Sphere 0.313725 0.313725 0.313725 56.77 288 95 Sphere 0.313725 0.313725 0.313725 56.77 -24 443 Sphere 0.313725 0.313725 0.313725 56.77 133 95 Sphere 0.313725 0.313725 0.313725 56.77 521 617 Sphere 0.313725 0.313725 0.313725 56.77 366 617 Sphere 0.313725 0.313725 0.313725 56.77 521 269 Sphere 0.313725 0.313725 0.313725 56.77 210 617 Sphere 0.313725 0.313725 0.313725 56.77 366 269 Sphere 0.313725 0.313725 0.313725 56.77 54 617 Sphere 0.313725 0.313725 0.313725 56.77 210 269 Sphere 0.313725 0.313725 0.313725 56.77 54 269 Sphere gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 475.702 480.733 ClipEllips 39.4236 -91.0389 -170.79 495 503 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 320.702 480.733 ClipEllips 39.4236 -91.0389 -170.79 340 503 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 475.702 132.733 ClipEllips 39.4236 -91.0389 -170.79 495 155 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 165.702 480.733 ClipEllips 39.4236 -91.0389 -170.79 185 503 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 320.702 132.733 ClipEllips 39.4236 -91.0389 -170.79 340 155 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.2627 88.1897 -0.160286 -131.455 9.22212 480.61 ClipEllips 39.4236 -92.5113 -170.399 29 503 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 25.7437 88.2182 -0.161581 -130.914 165.702 132.733 ClipEllips 39.4236 -91.0389 -170.79 185 155 ClipSphere 1 1 1 39.4236 Shade grestore 1 1 1 39.4236 29 155 Sphere gsave %% 1 1 24.8469 78.0259 -0.379661 173.157 412.885 611.374 ClipEllips 39.4236 206.099 140.216 441 608 ClipSphere 1 1 1 39.4236 Shade grestore gsave %% 1 1 24.8469 78.0259 -0.379661 173.157 567.885 263.374 ClipEllips 39.4236 206.099 140.216 596 260 ClipSphere 1 1 1 39.4236 Shade grestore 1 1 1 39.4236 286 608 Sphere gsave %% 1 1 24.8469 78.0259 -0.379661 173.157 412.885 263.374 ClipEllips 39.4236 206.099 140.216 441 260 ClipSphere 1 1 1 39.4236 Shade grestore 1 1 1 39.4236 130 608 Sphere 1 1 1 39.4236 286 260 Sphere 1 1 1 39.4236 -26 608 Sphere 1 1 1 39.4236 130 260 Sphere 1 1 1 39.4236 -26 260 Sphere 1 1 1 39.4236 553 389 Sphere 1 1 1 39.4236 397 389 Sphere 1 1 1 39.4236 553 41 Sphere 1 1 1 39.4236 242 389 Sphere 1 1 1 39.4236 397 41 Sphere 1 1 1 39.4236 86 389 Sphere 1 1 1 39.4236 242 41 Sphere 1 1 1 39.4236 86 41 Sphere 0.117647 0.117647 0.117647 39.4236 513 507 Sphere 0.117647 0.117647 0.117647 39.4236 358 507 Sphere 0.117647 0.117647 0.117647 39.4236 513 159 Sphere 0.117647 0.117647 0.117647 39.4236 203 507 Sphere 0.117647 0.117647 0.117647 39.4236 358 159 Sphere 0.117647 0.117647 0.117647 39.4236 46 507 Sphere 0.117647 0.117647 0.117647 39.4236 203 159 Sphere 0.117647 0.117647 0.117647 39.4236 46 159 Sphere 0.117647 0.117647 0.117647 39.4236 446 613 Sphere 0.117647 0.117647 0.117647 39.4236 602 265 Sphere 0.117647 0.117647 0.117647 39.4236 290 613 Sphere 0.117647 0.117647 0.117647 39.4236 446 265 Sphere 0.117647 0.117647 0.117647 39.4236 135 613 Sphere 0.117647 0.117647 0.117647 39.4236 290 265 Sphere 0.117647 0.117647 0.117647 39.4236 -21 613 Sphere 0.117647 0.117647 0.117647 39.4236 135 265 Sphere 0.117647 0.117647 0.117647 39.4236 -21 265 Sphere 0.117647 0.117647 0.117647 39.4236 552 380 Sphere 0.117647 0.117647 0.117647 39.4236 396 380 Sphere 0.117647 0.117647 0.117647 39.4236 552 32 Sphere 0.117647 0.117647 0.117647 39.4236 242 380 Sphere 0.117647 0.117647 0.117647 39.4236 396 32 Sphere 0.117647 0.117647 0.117647 39.4236 85 380 Sphere 0.117647 0.117647 0.117647 39.4236 242 32 Sphere 0.117647 0.117647 0.117647 39.4236 85 32 Sphere newpath 0 0 moveto 0 576 rlineto 576 0 rlineto 0 -576 rlineto closepath 0 setgray 1 setlinewidth stroke end grestore showpage %%Trailer %%EOF cleartomark countdictstack exch sub { end } repeat restore grestore % % End Imported PIC File: Pd210_3COtop.eps %%EndDocument % % Polyline 30.000 slw n 4275 1350 m 6570 1350 l 4230 6570 l 1935 6570 l cp gs col0 s gr $F2psEnd rs %%EndDocument @endspecial -150 1623 a Fq(FIG.)32 b(3:)46 b(Adsorption)31 b(geometry)g(of)h(CO/Pd\(210\))g(at)g(a)f(co)n(v)n(erage)-150 1710 y(of)g Fh(\022)g Fq(=)e(1)p Fh(:)p Fq(5.)50 b(The)31 b(color)g(co)r(ding)g(is)g(iden)n(tical)g(to)g(the)f(one)g(used)g(in) -150 1797 y(Fig.)20 b(2.)33 b(The)20 b(CO)f(molecules)h(are)g(\(appro)n (ximately\))e(lo)r(cated)i(at)f(sites)-150 1884 y(E,)27 b(B,)g(and)f(C')h(\(from)f(b)r(ottom)f(to)i(top\).)36 b(The)26 b(\(1)18 b Fa(\002)f Fq(2\))26 b(surface)i(unit)-150 1971 y(cell)f(is)f(also)h(sho)n(wn.)-150 2250 y Fs(tion)h(on)f (Pd\(100\))g(giv)n(es)g(1)p Fm(:)p Fs(44)f(eV)i([11)o(].)38 b(As)28 b(in)g(b)r(oth)g(cases)f(the)-150 2345 y(nearest-neigh)n(b)r (or)g(distance)i(of)g(the)g(CO)g(molecules)f(is)h(iden)n(ti-)-150 2441 y(cal,)24 b(i.e.,)h(the)f(Pd)g(lattice)g(constan)n(t,)g Fm(a)1068 2453 y Fk(0)1105 2441 y Fs(,)g(an)n(y)f(dip)r(ole-dip)r(ole)h (re-)-150 2536 y(pulsion)d(e\013ects)g(should)f(b)r(e)i(comparable)d (and)i(th)n(us)g(not)g(c)n(hange)-150 2632 y(an)n(y)36 b(relativ)n(e)g(di\013erences.)64 b(Besides,)39 b(dip)r(ole-dip)r(ole)e (in)n(terac-)-150 2727 y(tions)h(at)g(a)f(similar)h(co)n(v)n(erage)d (on)i(Pd\(110\))g(w)n(ere)g(estimated)-150 2823 y(to)d(b)r(e)g(on)g (the)g(order)f(of)h(30)f(meV)h([17].)56 b(Exp)r(erimen)n(tal)33 b(TDS)-150 2918 y(results,)f(to)r(o,)h(suggest)e(a)h(sligh)n(tly)f (higher)g(adsorption)g(energy)-150 3013 y(on)j(Pd\(100\))g(than)h(on)f (Pd\(210\))g([7)o(].)59 b(As)35 b(seen)f(in)h(T)-7 b(able)35 b(I)r(I)r(I,)-150 3109 y(adsorption)30 b(in)h(b)r(oth)g(bridge-b)r (onded)f(sites)h(results)f(in)h(rather)-150 3204 y(strong)g (relaxations,)g(and)g(a)h(tendency)g(to)f(minimize)i(the)f(CO)-150 3300 y(inclination)h(is)g(alw)n(a)n(ys)f(found.)54 b(This)33 b(suggests)f(that)h(the)h(CO)-150 3395 y(molecule)f(is)g(just)h(rep)r (elled)g(b)n(y)f(the)g(protruding)g(Pd)g(atom)g(at)-150 3491 y(the)d(next)f(\\step",)g(and)g(adsorption)f(is)h(th)n(us)g(not)g (as)g(fa)n(v)n(orable)-150 3586 y(as)c(on)g(a)g(\015at)g(\(100\))f (surface.)36 b(F)-7 b(urthermore,)25 b(v)-5 b(ariations)23 b(in)j(the)-150 3682 y(CO)33 b(adsorption)g(energy)f(from)i(site)g(to)f (site)h(are)f(comparably)-150 3777 y(small)25 b(and)g(a)f(rather)g (small)h(energy)f(gain)g(due)h(to)g(a)g(more)f(reac-)-150 3873 y(tiv)n(e)30 b(b)r(onding)g(partner)e(migh)n(t)i(just)h(b)r(e)f(o) n(v)n(ercomp)r(ensated)e(b)n(y)-150 3968 y(the)22 b(enforced,)h(but)f (unfa)n(v)n(orable)e(inclination)i(of)g(the)h(molecule.)-67 4070 y(On)e(Pd\(110\),)g(CO)f(adsorbs)f(in)i(a)g(near-bridge)e(site)i (at)f(mono-)-150 4166 y(la)n(y)n(er)f(co)n(v)n(erage.)32 b(The)21 b(molecules)g(are)f(alternately)g(tilted)i(along)-150 4261 y(the)k([100])e(direction)h(\(p)r(erp)r(endicular)h(to)f(the)h (top)g(la)n(y)n(er)e(ro)n(ws\),)-150 4356 y(resulting)h(in)h(a)f(\(2)15 b Fn(\002)f Fs(1\))26 b(p)r(erio)r(dicit)n(y)f([15)o(])h(forming)f(a)g (\\zig-zag")-150 4452 y(c)n(hain)19 b(of)g(CO)g(molecules.)34 b(In)20 b(con)n(trast)e(to)h(the)h(situation)f(on)g(the)-150 4547 y(\(210\))27 b(surface,)h(eac)n(h)f(Pd)g(atom)h(binds)g(t)n(w)n(o) g(alternately)f(tilted)-150 4643 y(CO)e(molecules.)35 b(Computations)25 b(in)g(a)g(\(1)13 b Fn(\002)g Fs(2\))24 b(unit)i(cell)f(of)g(the)-150 4738 y(\(210\))20 b(surface)g(rev)n (ealed)g(no)g(evidence)h(for)f(suc)n(h)h(an)f(alternating)-150 4834 y(structure)27 b(on)g(the)h(\(210\))f(surface.)-67 4936 y(The)65 b(exp)r(erimen)n(tal)g(saturation)f(co)n(v)n(erage)f(of)i (CO)g(on)-150 5031 y(Pd\(210\))22 b(is)g(rep)r(orted)g(to)h(b)r(e)g Fm(\022)i Fs(=)e(1)p Fm(:)p Fs(5)f([7)o(].)36 b(LEED)22 b(exp)r(erimen)n(ts)-150 5127 y(sho)n(w)27 b(that)i(this)f(co)n(v)n (erage)d(is)j(ac)n(hiev)n(ed)f(b)n(y)h(main)n(taining)f(ro)n(ws)-150 5222 y(of)k(CO)g(molecules)f(along)g(the)h([001])f(direction,)h(but)h (reducing)-150 5318 y(the)19 b(CO)g(distances)f(along)g(the)h([1)887 5300 y(\026)887 5318 y(2)o(0])g(direction.)34 b(A)19 b(p)r(ossible)f(mi-)-150 5413 y(croscopic)29 b(structure)i(is)g(sho)n (wn)f(in)i(Fig.)f(3.)47 b(The)31 b(energy)f(gain)2042 -83 y(of)e(additional)g(adsorption)g(of)g(one)h(CO)f(molecule)g(p)r(er) h(\(1)19 b Fn(\002)f Fs(2\))2042 12 y(unit)33 b(cell)f(going)f(from)h Fm(\022)h Fs(=)d(1)p Fm(:)p Fs(0)i(to)g Fm(\022)h Fs(=)d(1)p Fm(:)p Fs(5)i(is)g(0)p Fm(:)p Fs(91)f(eV.)h(The)2042 108 y(CO)c(molecules)h(rearrange)d(in)j(suc)n(h)g(a)f(w)n(a)n(y)g(that) h(one)g(of)g(them)2042 203 y(sta)n(ys)23 b(in)i(the)g(most)g(fa)n(v)n (orable)e(E)h(site,)h(whereas)f(the)h(other)f(t)n(w)n(o)2042 299 y(ro)n(ws)d(of)i(CO)g(molecules)f(are)g(pushed)i(to)f(appro)n (ximately)e(the)i(B)2042 394 y(and)28 b(C')g(sites.)40 b(In)28 b(comparison,)f(TDS)i(results)f(yield)g(a)g(w)n(eak)n(er)2042 490 y(b)r(ound)33 b Fm(\014)2350 502 y Fk(1)2421 490 y Fs(sp)r(ecies)f(with)i(an)f(adsorption)e(energy)h(of)h(1)p Fm(:)p Fs(14)f(eV)2042 585 y([45)o(].)48 b(It)32 b(is)f(in)h(fact)f (surprising)f(that)i(the)g(di\013eren)n(tial)f(heat)g(of)2042 681 y(adsorption)38 b(for)h(a)h(co)n(v)n(erage)c(of)k Fm(\022)46 b Fs(=)c(1)p Fm(:)p Fs(5)d(seems)g(to)h(b)r(e)g(un-)2042 776 y(derestimated)30 b(while)h(it)g(is)g(o)n(v)n(erestimated)e(at)h (lo)n(w)g(co)n(v)n(erages.)2042 872 y(Ho)n(w)n(ev)n(er,)21 b(no)i(comprehensiv)n(e)e(scan)h(of)g(p)r(ossible)g(structures)g(in) 2042 967 y(the)27 b(\(1)17 b Fn(\002)g Fs(2\))27 b(unit)h(cell)f(w)n (as)f(p)r(erformed)g(so)h(that)g(the)g(existence)2042 1063 y(of)g(other)g(structures)g(lo)n(w)n(er)f(in)i(energy)e(cannot)i (b)r(e)g(ruled)f(out.)2125 1185 y(Corresp)r(onding)e(to)j(the)g(large)e (in)n(trinsic)h(dip)r(ole)h(momen)n(t)f(of)2042 1281 y(the)37 b(CO)f(molecule,)j(a)d(CO)g(co)n(v)n(erage)e(of)i Fm(\022)k Fs(=)e(1)p Fm(:)p Fs(5)e(results)g(in)2042 1376 y(a)j(signi\014can)n(t)g(w)n(ork)g(function)h(increase)f(of)h (\001\010)j(=)g(1)p Fm(:)p Fs(45)c(eV)2042 1472 y(\(\010)23 b(=)g(6)p Fm(:)p Fs(37)j(eV\).)i(A)n(t)g(a)f(co)n(v)n(erage)e(of)j Fm(\022)d Fs(=)e(1)p Fm(:)p Fs(0,)j(a)i(still)g(consider-)2042 1567 y(able)j(increase)f(of)h(1)p Fm(:)p Fs(26)f(eV)i(is)f(found)h (\(\010)e(=)f(6)p Fm(:)p Fs(18)h(eV\).)i(In)g(CO)2042 1663 y(adsorption)20 b(exp)r(erimen)n(ts)h(on)h(Pd\(210\),)g(a)f(maxim) n(um)g(increase)2042 1758 y(of)g(the)g(w)n(ork)f(function)i(b)n(y)f(1)p Fm(:)p Fs(06)e(eV)j(is)f(rep)r(orted)f([7].)35 b(Similar)20 b(to)2042 1853 y(h)n(ydrogen-induced)32 b(w)n(ork)h(function)h(c)n (hanges)f([22)o(],)j(the)e(com-)2042 1949 y(puted)23 b(e\013ect)f(of)h(the)f(adsorbate)f(on)h(the)g(w)n(ork)f(function)i(is) f(th)n(us)2042 2044 y(o)n(v)n(erestimated.)2125 2167 y(CO)40 b(b)r(onding)h(to)f(a)g(metal)h(surface)f(is)g(usually)h (discussed)2042 2262 y(in)35 b(terms)f(of)h(the)g(Blyholder)e(mo)r(del) i([4].)58 b(A)35 b(more)e(thorough)2042 2358 y(discussion)d(can)i(b)r (e)f(based)g(on)h(the)f(analysis)g(of)g(the)h(resulting)2042 2453 y(mixed)i(orbitals)f(as)g(they)i(are)e(manifested)h(in)h(the)f (resp)r(ectiv)n(e)2042 2549 y(lo)r(cal)21 b(densit)n(y)h(of)g(states)f ([47)o(,)i(48)o(].)35 b(In)22 b(Fig.)g(4,)h(the)f(lo)r(cal)f(densit)n (y)2042 2644 y(of)31 b(states)g(for)g(b)r(oth)h(the)g(top)f(Pd)h(atom)f (and)g(the)h(carb)r(on)e(and)2042 2740 y(o)n(xygen)39 b(atoms)i(are)f(depicted.)78 b(The)42 b Fm(d)p Fs(-band)f(cen)n(ters)f (w)n(ere)2042 2835 y(determined)20 b(b)n(y)f(in)n(tegration)g(o)n(v)n (er)e(the)k(a)n(v)-5 b(ailable)18 b(energy)h(range)2042 2931 y(fully)33 b(including)g(all)f Fm(d)p Fs(-band)h(states.)52 b(Up)r(on)33 b(CO)g(adsorption,)2042 3026 y(the)e(Pd)g Fm(d)p Fs(-band)g(cen)n(ter)f(is)h(shifted)h(do)n(wn)e(from)h Fn(\000)p Fs(1)p Fm(:)p Fs(26)e(eV)i(to)2042 3122 y Fn(\000)p Fs(1)p Fm(:)p Fs(82)g(eV.)j(The)f(CO)f(1)p Fm(\031)s Fs(,)j(2)p Fm(\031)3018 3091 y Fl(\003)3089 3122 y Fs(and)e(the)g(Pd)g Fm(d)h Fs(orbitals)e(with)2042 3217 y Fm(\031)h Fs(symmetry)c(h)n (ybridize)g(to)h(giv)n(e)f(an)g(all-b)r(onding)g(1)t(~)-46 b Fm(\031)s Fs(,)30 b(a)g(non-)2042 3313 y(b)r(onding)2386 3291 y(~)2371 3313 y Fm(d)2414 3325 y Fd(\031)2460 3313 y Fs(,)39 b(and)d(an)g(an)n(ti-b)r(onding)g(2)t(~)-46 b Fm(\031)3406 3282 y Fl(\003)3481 3313 y Fs(orbital)35 b([47].)63 b(On)2042 3408 y(the)25 b(other)e(hand,)j(the)e(CO)g(4)p Fm(\033)s Fs(,)h(5)p Fm(\033)j Fs(and)c(the)h(Pd)f Fm(d)3637 3420 y Fd(\033)3707 3408 y Fs(in)n(teract)f(to)2042 3504 y(form)i(b)r(onding)h(4)t(~)-46 b Fm(\033)29 b Fs(and)c(5)t(~)-46 b Fm(\033)29 b Fs(orbitals)24 b(as)h(w)n(ell)h(as)f(a)g(broad)g(an)n (ti-)2042 3599 y(b)r(onding)2380 3577 y(~)2365 3599 y Fm(d)2408 3611 y Fd(\033)2483 3599 y Fs(band.)45 b(In)31 b(Fig.)f(4,)h(the)g(broad)e(resonance)g(of)h(the)2042 3694 y(CO)c(orbitals)g(with)h(the)g(resp)r(ectiv)n(e)f(metal)h Fm(d)p Fs(-band)f(orbitals)g(in)2042 3790 y(the)31 b(energy)f(range)g (of)h Fn(\000)p Fs(5)f(to)i(0)e(eV)i(are)e(clearly)g(visible.)47 b(The)2042 3885 y(m)n(uc)n(h)26 b(lo)n(w)n(er)f(densit)n(y)h(of)g (states)g(in)h(this)f(region)f(at)h(the)h(carb)r(on)2042 3981 y(atom)34 b(can)g(b)r(e)h(traced)f(bac)n(k)g(to)g(the)h(non-b)r (onding)f(c)n(haracter)2042 4076 y(of)29 b(the)2298 4054 y(~)2283 4076 y Fm(d)2326 4088 y Fd(\031)2401 4076 y Fs(orbital,)g(with)h(its)g(reduced)f(c)n(harge)f(densit)n(y)h(at)h(the) 2042 4172 y(carb)r(on)f(atom)g(due)h(to)f(its)h(no)r(dal)g(plane)f (there.)43 b(As)30 b(exp)r(ected,)2042 4267 y(the)39 b(distance)f(b)r(et)n(w)n(een)h(the)g(mo)r(di\014ed)g(4)p Fm(\033)j Fs(\()p Fm(E)47 b Fs(=)41 b Fn(\000)p Fs(9)p Fm(:)p Fs(5)d(eV\))2042 4363 y(and)32 b(5)p Fm(\033)i Fs(orbitals)d(\()p Fm(E)36 b Fs(=)30 b Fn(\000)p Fs(6)p Fm(:)p Fs(7)g(eV\))j(is)e(signi\014can)n(tly)g(reduced,)2042 4458 y(and)c(the)g(5)p Fm(\033)k Fs(orbital)26 b(is)h(ev)n(en)g(lo)r (cated)g(b)r(elo)n(w)g(the)g(1)p Fm(\031)s Fs(-deduced)2042 4554 y(states)20 b(\()p Fm(E)29 b Fs(=)22 b Fn(\000)p Fs(6)p Fm(:)p Fs(5)e(eV)i(and)f Fm(E)28 b Fs(=)22 b Fn(\000)p Fs(6)p Fm(:)p Fs(0)e(eV\))i(in)f(con)n(trast)f(to)h(the)2042 4649 y(free)29 b(CO)g(molecule.)42 b(The)29 b(deriv)n(ed)g(b)r(onding)g (scenario)f(is)h(v)n(ery)2042 4745 y(similar)24 b(to)h(the)h(one)f (found)g(for)g(bridge)f(site)i(adsorption)d(of)j(CO)2042 4840 y(on)19 b(Pd\(100\))f([11)o(].)35 b(W)-7 b(e)19 b(also)g(note)g(that)h(at)f(di\013eren)n(t)h(adsorption)2042 4936 y(sites)k(there)h(are)f(subtle)h(di\013erences)f(as)g(far)g(as)h (the)g(imp)r(ortance)2042 5031 y(of)d(the)g(h)n(ybridization)f(of)g (the)i(metal)e Fm(d)i Fs(states)e(with)h(the)h(5)p Fm(\033)h Fs(and)2042 5127 y(the)33 b(2)p Fm(\031)2282 5096 y Fl(\003)2353 5127 y Fs(orbitals)f(of)h(CO)g(is)g(concerned)f([11)o(,)i(49].)53 b(It)33 b(is)g(th)n(us)2042 5222 y(w)n(ell)27 b(conceiv)-5 b(able)27 b(that)h(the)f(upshift)i(of)e(the)h Fm(d)p Fs(-band)f(cen)n(ter)g(at)2042 5318 y(the)d(op)r(en)f(Pd\(210\))g (surface)f([23)o(])i(has)f(opp)r(osing)g(e\013ects)h(on)f(the)2042 5413 y(b)r(onding)29 b(mec)n(hanisms)f(at)h(the)g(top)g(and)g(bridge)f (sites)h(leading)p eop %%Page: 5 5 5 4 bop 4043 -299 a Fs(5)44 1878 y @beginspecial 88 @llx 4 @lly 321 @urx 292 @ury 1984 @rwi @setspecial %%BeginDocument: Fig4.eps %!PS-Adobe-2.0 EPSF-1.2 %%BoundingBox: 88 4 321 292 %%HiResBoundingBox: 88 4 320.938 291.875 %%Creator: (Mathematica 4.0 for X) %%CreationDate: (Tuesday, June 1, 2004) (21:29:13) %%Title: Clipboard %%DocumentNeededResources: font Helvetica %%+ font Courier %%DocumentSuppliedResources: font Math1 %%+ font Math2 %%DocumentFonts: Math1 %%+ Helvetica %%+ Courier %%+ Math2 %%EndComments %%BeginResource: font Math1 %%BeginFont: Math1 %!PS-AdobeFont-1.0: Math1 001.200 %%CreationDate: 1/15/98 at 3:20 PM %%VMusage: 1024 31499 % Mathematica typeface design by Andre Kuzniarek, with Gregg Snyder and Stephen Wolfram. Copyright \(c\) 1996, 1997 Wolfram Research, Inc. [http://www.wolfram.com]. All rights reserved. [Font version 1.20] % ADL: 800 200 0 %%EndComments FontDirectory/Math1 known{/Math1 findfont dup/UniqueID known{dup /UniqueID get 5095641 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 20 dict begin /FontInfo 16 dict dup begin /version (001.200) readonly def /FullName (Math1) readonly def /FamilyName (Math1) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -133 def /UnderlineThickness 20 def /Notice (Mathematica typeface design by Andre Kuzniarek, with Gregg Snyder and Stephen Wolfram. Copyright \(c\) 1996, 1997 Wolfram Research, Inc. [http://www.wolfram.com]. All rights reserved. [Font version 1.20]) readonly def /em 1000 def /ascent 800 def /descent 200 def end readonly def /FontName /Math1 def /Encoding 256 array dup 0/NUL put dup 1/Eth put dup 2/eth put dup 3/Lslash put dup 4/lslash put dup 5/Scaron put dup 6/scaron put dup 7/Yacute put dup 8/yacute put dup 9/HT put dup 10/LF put dup 11/Thorn put dup 12/thorn put dup 13/CR put dup 14/Zcaron put dup 15/zcaron put dup 16/DLE put dup 17/DC1 put dup 18/DC2 put dup 19/DC3 put dup 20/DC4 put dup 21/onehalf put dup 22/onequarter put dup 23/onesuperior put dup 24/threequarters put dup 25/threesuperior put dup 26/twosuperior put dup 27/brokenbar put dup 28/minus put dup 29/multiply put dup 30/RS put dup 31/US put dup 32/Space put dup 33/Exclamation put dup 34/ForAll put dup 35/NumberSign put dup 36/Exists put dup 37/Percent put dup 38/Ampersand put dup 39/SmallMember put dup 40/LParen put dup 41/RParen put dup 42/Star put dup 43/Plus put dup 44/Comma put dup 45/Minus put dup 46/Period put dup 47/Slash put dup 48/Zero put dup 49/One put dup 50/Two put dup 51/Three put dup 52/Four put dup 53/Five put dup 54/Six put dup 55/Seven put dup 56/Eight put dup 57/Nine put dup 58/Colon put dup 59/SemiColon put dup 60/Less put dup 61/Equal put dup 62/Greater put dup 63/Question put dup 64/TildeFullEqual put dup 65/CapAlpha put dup 66/CapBeta put dup 67/CapChi put dup 68/CapDelta put dup 69/CapEpsilon put dup 70/CapPhi put dup 71/CapGamma put dup 72/CapEta put dup 73/CapIota put dup 74/CurlyTheta put dup 75/CapKappa put dup 76/CapLambda put dup 77/CapMu put dup 78/CapNu put dup 79/CapOmicron put dup 80/CapPi put dup 81/CapTheta put dup 82/CapRho put dup 83/CapSigma put dup 84/CapTau put dup 85/CapUpsilon put dup 86/FinalSigma put dup 87/CapOmega put dup 88/CapXi put dup 89/CapPsi put dup 90/CapZeta put dup 91/LBracket put dup 92/Therefore put dup 93/RBracket put dup 94/Perpendicular put dup 95/Underbar put dup 96/Hat put dup 97/Alpha put dup 98/Beta put dup 99/Chi put dup 100/Delta put dup 101/Epsilon put dup 102/Phi put dup 103/Gamma put dup 104/Eta put dup 105/Iota put dup 106/CurlyPhi put dup 107/Kappa put dup 108/Lambda put dup 109/Mu put dup 110/Nu put dup 111/Omicron put dup 112/Pi put dup 113/Theta put dup 114/Rho put dup 115/Sigma put dup 116/Tau put dup 117/Upsilon put dup 118/CurlyPi put dup 119/Omega put dup 120/Xi put dup 121/Psi put dup 122/Zeta put dup 123/LBrace put dup 124/VertBar put dup 125/RBrace put dup 126/Tilde put dup 127/DEL put dup 128/FractionBarExt put dup 129/EscapeChar put dup 130/SelectPlaceholder put dup 131/Placeholder put dup 132/Continuation put dup 133/Skeleton put dup 134/LSkeleton put dup 135/RSkeleton put dup 136/Spacer put dup 137/Cross put dup 138/DblEqual put dup 139/Grave put dup 140/Acute put dup 141/DoubleAcute put dup 142/OverTilde put dup 143/OverBar put dup 144/DblUpDownArrow put dup 145/DblUpExtens1 put dup 146/DblLongLArrow put dup 147/DblExtens put dup 148/DblLongRArrow put dup 149/DblLRArrow2 put dup 150/DblLongLRArrow put dup 151/UpDownArrow put dup 152/LongLArrow put dup 153/LongRArrow put dup 154/LongLRArrow put dup 155/ColonEqual put dup 156/Diamond2 put dup 157/SprsetEqual put dup 158/AtSign put dup 159/Solidmedsqr put dup 160/OverDot put dup 161/CurlyCapUpsilon put dup 162/Prime put dup 163/LessEqual put dup 164/Fraction put dup 165/Infinity put dup 166/RuleDelayed put dup 167/ClubSuit put dup 168/DiamondSuit put dup 169/HeartSuit put dup 170/SpadeSuit put dup 171/LRArrow put dup 172/LArrow put dup 173/UpArrow put dup 174/RArrow put dup 175/DownArrow put dup 176/Degree put dup 177/PlusMinus put dup 178/DoublePrime put dup 179/GreaterEqual put dup 180/Multiply put dup 181/Proportional put dup 182/PartialDiff put dup 183/Bullet put dup 184/Divide put dup 185/NotEqual put dup 186/Equivalence put dup 187/Approxequal put dup 188/Ellipsis put dup 189/ArrowVertEx put dup 190/ArrowHorizEx put dup 191/CarriageReturn put dup 192/Aleph put dup 193/IFraktur put dup 194/RFraktur put dup 195/Weierstrass put dup 196/CircleMultiply put dup 197/CirclePlus put dup 198/EmptySet put dup 199/Union put dup 200/Intersection put dup 201/ProperSuperset put dup 202/NbSpace put dup 203/NotSubset put dup 204/ProperSubset put dup 205/ReflexSubset put dup 206/Element put dup 207/NotElement put dup 208/Angle put dup 209/Gradient put dup 210/RegTM put dup 211/Copyright put dup 212/TM put dup 213/Product put dup 214/Radical put dup 215/DotMath put dup 216/LogicalNot put dup 217/Wedge put dup 218/Vee put dup 219/DblLRArrow put dup 220/DblLArrow put dup 221/DblUpArrow put dup 222/DblRArrow put dup 223/DblDownArrow put dup 224/Lozenge put dup 225/LAngle put dup 226/Diffd put dup 227/Expe put dup 228/Imagi put dup 229/Sum put dup 230/LParenTop put dup 231/LParenEx put dup 232/LParenBot put dup 233/LBracketTop put dup 234/LBracketEx put dup 235/LBracketBot put dup 236/LBraceTop put dup 237/LBraceMid put dup 238/LBraceBot put dup 239/BraceEx put dup 240/Slot put dup 241/RAngle put dup 242/Intergral put dup 243/IntegralTop put dup 244/IntegralEx put dup 245/IntegralBot put dup 246/RParenTop put dup 247/RParenEx put dup 248/RParenBot put dup 249/RBracketTop put dup 250/RBracketEx put dup 251/RBracketBot put dup 252/RBraceTop put dup 253/RBraceMid put dup 254/RBraceBot put dup 255/Wolf put readonly def /PaintType 0 def /FontType 1 def /StrokeWidth 0 def /FontMatrix[0.001 0 0 0.001 0 0]readonly def /UniqueID 5095641 def /FontBBox{-120 -220 1544 923}readonly def currentdict end currentfile eexec D8061D93A8246509E76A3EC656E953B7C22E43117F5A3BC2421790057C314DAE3EFBFF49F45DA348 36A298BFE548664863E5CE0AAB01EF317486F5BC0A777A9D5EA6EDEF05CA0DD46D529D2E42D4134D ED3F9D1AC637EF38660A14FA16763BAF5259CF4517F67B8B8B26F91DF86A2CDAF4F4E69F77BC345C 85A0CFEA99EF7D3EE9573DAD4628CFF3875A7B1F394CA844B688FC694E5D5DA569A762876769217F 39DF76392C40958EFABFFA6EEF55261753BF98F09B656FDF958CC2820688463E8F5D0EE92865EA6A 0ADD27AB74F7E60AEB07AAD5B7761AE3086C6B36A8BEC653D0F16535E63F39328B0D85EE6C7D860B EA5328FA406340FF43365FE2294F55FA2982664FC12C185343AE5C438CB1D34B0F5A073FD7BBCD1C 5B1ADDF3A3CAC387C92EC59987E9A3406483F64F3CC3596306BC6DBBBCB48F7241B0AA68ADF24731 52209EEA3464AFE55DD0095D0158D63EEE9833C3381AEEA40F35B7051BF5E4597710B9248B6214DE E416336980E64ACF33ABDCD395DB4284F25465D271CE02D6D891EDB49DF3A35DCF0F4B08B59B0F45 CF6AB57478889ADEED9835A46610A5B534E45D08072C66871D4F9D937A0012C5081C2E33936404AB 0803F7265A3D5E2A5EC80544D6047E13990F54AF326D88F5BE59707770E7D971AF037233E38B6FC9 50E312EBC7DC654D218F15163E3DE15D4443863E17782CA107A646DB6FC04A3C39A9C666DBD9BEE3 0912465087D3AB5B1FD38CD86EBBBEA879769C458BB6A24D7C2472717FD57241F9581F943AF9736F 1D6607F5626D7CA8EAE8754B1859AD7B041D09FF3EF46E4019E4E03C5C00501811EAE48F8793D7F9 2B7943A113904026301CE62CBAC5EDF4C3DDFA65EEF1F06F38A0743B8C7CF367EF210FD300139FAE CB831F54AC5673B09A6029A5B6365CFC883907AFC51A0FA6DB1C388E06955888A3B5BFC18D6AEC43 1C88140FA478B414CEDD5330DDE9A8063AAA4665CF1D018C1DD1B58C88224BCB92D2A3983FB1EFD0 552A0A9D9C314D4659387A1BEABCD1981788229F5F6842D32C4C40E6C6D373A2D54164D3380533B1 694795F3B1B1B179E5C7DF55905B2E4955D59CFDC16A227FB08F54055C2EA6FF10ECD2C97EA99044 720A89B464F660C38091C195415227381F612465A262D54BEE912F541240E3785852A38ABA27690F 04CC35BA0CB1CE169400C1E35E2DB30A8E3752FBA7D0E8FA4DC8EB5E48890B809A4C849DF5C435B7 01F6C2334704F953B4E8DB5E7C69ADEE7CE681E2AAA344D006E4CE598C0472CBE9BEC3D567D55EAF 80C96B9FEE2F8A82C521F506066927CCA8B382000A12E26A6FF71FF52F885E21F5CDF664724FD50C CD7830845836BD84C1658B6FF324C0F916E007FFC5DB85EA783EF1DC34C98A63235155A2E98E9925 00349921BF84B12FF8C29468B222E246D4023E625074928456D88A6443513AF3FE4932AF95EC8F2A EEFE4A90ECB176B6CF075F431B35A1705CCACF23A9ADBA83D8280DFB565176F29E1B5E8D34EB4791 D2BDE959B91756AD1171ED3BB773EEC15EB9CAA9CBEDDE75A9F5B96239829EA7C007263744B21413 63DCDF83CC374443078207D0B0F3A166C3C3B3031825BF4F24B7AEDD49B17EA23301FBB5EEA56FA5 C9BD35B8B288FAC4440198006F532E93EB3A45599D49A6A58CB188E63E25750FA1CF1A994E99B597 8D5C2425A0C3C482DBAE0A5768C209AAAF7B7EC728520BCB6BABAB0A3073E0D170397A43661EA301 06B3745AF43C72B725DACDAD17E5B6ED61C5640ED261C67D2DDEB7DA6646B18058F11C772CE365A1 B0F60BB4CF2800DCDECC7FA26EF1C23290CBBBD67C45F2844CB7E6352B01A2D55140DC022ABE66EB 464BB29A0312A8ED048CA1D1822D1FAF781BEDA2935F346254C8DD71AA7CA4186DA5105CA8C3753F 59B55AD9BDA3ED88CA194D6DEFDEB67C5892CF874E66691453A1FCE633205C5F5BB3B4EA2F088E73 03620385B2BCBDB8C316E8E7BD3C66D8D50B11A9BFBC004C09C488164A9695407E9C1DCED71B4074 B440F45FC3AB908632D93ED111FBC5BD7F3415BD0815C09846F5B32CAA02461FB4FCA7DAF98C6385 4A2940682EB1363CA167CBCBAF02B143231C77F4F94EB3C9F34C34BD2372A5299C34D9B703905E53 746887A84030EBBEB721DB935C8DCCA86F2D10F5037C79BCDDDDF6755D6E072B6B07C8A30A6F7831 374E24F92C1D51A7E9AF2701DB280116BD6C74256755E4DB536DDA78F09A0461141012D1F982E7B8 6AE70721D60CCC8F42B61550AAEC9F2D0E1CB600B90CFCB67126C5D43A21A50AB5822EC5E39FE302 0B0CE7326E055C8CB615AD706AFE9F074BD6CB1EA4A9BAA240D3E69AE14C72EC48BB584E879612B9 1C6568EF7EE19DF97874CC63B2FB2B910C83867FD7C9F9C7FFC25856E1DC3C2800666418CD6930D4 91670A3A883AA2C09519BE18BA827166E3A6AECE1FD06E04A3914F08926D8A3D517A585142B257BD 30093DC361CA298483FF3BE13541A41C063B7E5A4FBA1223DFAC545CA6E3E7BBD6020DBBF6D28992 7EDD2DA0FB82DCF22872771483C26AB3578C567D85CA6C762F5D55B3D8564E4501B5C01702243DDA 137A83AC4FFBC4C4D301F5773E0ADFB7EABD02D85C8A005DAB94F7E3F7F6065AEBBB8179569E9124 7875866F1A966EF6F51DB8E9204D1D3104D6F0AAB6C7A567F2B299387F67AE5C2AE7619830F40744 083DF51ABD9D449F53D103A2F8FB2ECDC9A74323D49D160CA3022FA0602424F4D4883432515BD70C C954ACC9A95DB98E18BB87A7DEAFEC6CC7A7A0D6BD32C95887F222D156BE2E528A12D9D87BC1A716 D079F3855C196EABB3B1CC95F18239917E8967AC4BF895B8A3E5FF4E5A37189ADCEBDE983427C959 06D4A72459746AFC34E9D216E414046D8A454503B1409DE90E5300A00C93A2335970BB1D396B745D 9F4F67DCE3413EC5DA4EAABEDFEAEB4F0C528B5BF35230B14BC163DC759A1833801EF9883EA96C11 2CD3A011F2A9C75A06B2C9B878F962F69F12AA1000CCA30F9503DE811C793B284FF47AF5B55A1F47 F4BD51372A8688CAE93C1322EDFF0C28616FBABD8A03CAA147F42BE70D9DB5D03C1FEF3ECED0B243 A9E7C6B36DE6297EF07D956123BF832C6EB55D43A01929AE684A357753C005D0D65296F8A76CCC5E 9B6DEBA31330C1F7BB65743E0ED0CE647B5E0999E5A80BCC3E8C75E94498201220FC387EEC620D16 3B3EE65A3B37820F3ED878FC47E9C96CFF7514724A99004967A029CCDE652A200AF66DDB92B371FD 8FFF3D914855036D4D4970BBABB98A5D429BD8718865D81BD2601D411C8AC1E2EAA8A05C412FB771 FE2F6DA454352BF30A2C4CECAE902730F2AADBB9F2FDFEE5645A29917A0F7EDD650CE34B95BA3852 DDAD05A8FE536B72F63435A0A14D1D24CBF6079D777C245ABA02C7CF82424835D6C577A3DB81D480 3F774D1001B7978B5795AA7B4D8BB1123A12147883FCDF21A2CF9985566FC0012C7F4656FD096B43 5B11216C365EA21770DE27316C1DF9AA671E5E96A3B8604176132429D47ECDD31902E52BC37D3567 AA4604F3221270EA27C713A85940F45695FDC9453BEB07114C31C9014CBC9347994A1BC62026A7B6 BB17370C1AC4C1F438653C0B1F5A38F06AD58D0F6189A89CC75A1D72ADD4E84A92E2B7A0CDE16658 698595B2CEC0E6D8C815E24BEBFA7C362F47E2BCB39617D460BBB345197217123BF880A6B21C0218 F589F7042223D0306B17896793239BCA4AFAED823C6CD20351367CE455999FD4ABC3769F19DB9CD7 D6DDB4F097620BBEC50E0FE3957BF9877718266680D474FAE398453AF3EBFADA41C5FD61AF822CC3 EE7393BC62C151EAC79251EA07A58E002CB459A1AC2B1223C711827A0D80D7818F83C57F05400296 EB47D561C9F2F4017C9014F6966F06E1F8E91E55C45C07FB97FBF53F7B11B0E36C5BE36081623E0E 26E92BEF1EF304959F0AA03550135384A288498897771CE83D252B842115915F6BA9F41EB7543AF7 8578F3C69372653003CDBE22446CFC5AECE6E9DBFFC714DE9ED180A0E514344C3E1C0CB246074F11 FA87F2F2DF8C2533F2615C5FCEDFED56C2E65766F95C15347056E063C55D82415C33EFCF8675C133 A87B7F6F41A0EB717FADCB0E403FB5745429F0406AA873F3EC4BE82166B48350FAF5046B4B27EA6E 5A8E98C0B0F8D9366222453B343071ED402F040EF964D5851EF319FE0613C2B29324EC43A33E9BDC 93E7D39128239B8411660412E5A540E22FB582C7A35845F5C4D4967F6E005599F52CCE7C51302B58 FFEB7D62CC3E3E820C3D42850EE4410214391F5314541B0CBAA41CA188CF0004674E81BC80E06408 FD8183486B1723EAC5E73CDE30818F0184BE0CE304BEF5DA2D48ED1CC7B73B35D3E0CDA5A9D2D243 45E2E6A2F12C8E1E74AF75C1056CD47FB22E854CDAB9999F5768276CD470D4DC48BD98C8577D4F86 E8EE0669CCAC19CA20A5DBC2C5835C99331AE63957974A7FE1F28C361528C4F0C47D429D3197B482 EB9549A80643F9B2355EB5E9BA2B6C47FC2C8C2721F5DF4BFD077851489F15CA6365F27014C04FD5 444148DB42269DDC02570873EF5B3F76AA03C63CF996BDFB7E63599231673A9B6690B0BABEDFB362 A1249DBBF9D9E89A08B5AA2C476AA352FBBBA1E86C30D61700DB1EF588238891683DB1DE7FA8A770 3F7BCA261CC3B14F8766873019DF32AF4E9C7D6CDBBDFB606C9AE79E5EE159FA1FCEB39549368949 857788E9E9D71F8BB63D77E1F3FB7DC90826F5E2A10C55AA649B9388B6ECCC21F8CF2AA1904B6B82 68A3E489CDE77FE28F26F036A43CB336D42A59186FB2952F42C1840A66CDC44A5C13431241BDF619 1CDB089F28B6E7C78A29645DE23194772F116234DA4994871B1B2F947203B55F57F17AD68DB1C1C1 38CA66DBB4068C49C5C22CF626867C6BC321A4BBB91792F9D3BBC8F75EA6712426039576855FC519 00BD69D58AB83FFA63140C9C70ACB304E42A9A719570076586E873E90DE33E62D1AB8E8EFC2992A2 0F8B64C66D8E99F40C85A4814502CC62E9E8A0A0E984EA0EEB7ACB7B77FD7BC9FFB5CBC779D3EF0B 8A5F57D3207D02B8B773563458DA2DC74557F1418E7B8CA81AE4E472489BC08875CA49F8B1F401F1 CCA1DB033DFF7DF1B1B82583478B9B3483D7277E25DBA941E4A59E770E16491AF94E1AFC25060369 D8EE69B70BB1846414DE8CC726F8D5AAF7EFACE482117EFE7146F6C530731FC658606D14BE7FCC2C CB866C04BCA824270A979F9D22947DAF090BF4AE482411BEA61CFDB5AEA23C9DBDBD3E40D93BCB88 97A31B9546FBC11896B3DDCC0497719327568AC401A7315CA3B350AA57C76536D6D9AA8E8FBA6517 823017F50F8B4ACBA68E0B200814FF09623DD451A083F0DC9870811D903D0F2F2BD4788D80EB0B95 0D74CA0FB5DD6FD6B9820312C3F4AD39456A8A84B4301A1FDA1FE16419CFB23F440B30C87818324B CD8E30FC0A2C60B5433FBFFCA924CAAAD31D46A236D933C22A89B8CDCC3E712D6E6FC17BD644E7B1 62C319EBC659A48696C9F09FEDE38E0705187C1798F015BF596A8D2136A9486B930029B0319A1EAA C5DA3144C74B9D6328D895969DA01D44448E569022BEFF5606476249D1D29C49375E91EE25FF7503 B22FE1AF92355040B9654719BCF47882D349F50F0C4000A21F912AB7D78058C6AC1EDB3EAC808DDE 01BAD3D6DA50AF13CC9BA431C3E2F22127F9609BD348AF7C31381D99E9A46CB8BCB908E122465848 0ADEC289ED9A384441591916C2E62956E11A1026ADE7FCA7DCA8A7E588DAD25D053E4FC5FDD9CE77 7E1FEDD9B940E9D2D13A5EDBFFD32FAABD68ABF612BB8BBFB5B347FFB91C2754741E0390E90CE6AD 0901BA359CBE5CB262202358FA59978CDA9BF68C5D4047A1C1D010B369AAC981BBE21475601E05BE EC59DF4BE6BA93A9CBBBFB24E3E7AE41093D29B7E7FBA35D9B06D072802F54AC58D6DC0488FFF1F0 A8CB3DDB2CBDF4EAE21711660D452243132CBE30621DB11832232A6689A1BA66637800DEECBD2C75 E2D9269542FC6D7BC2E758463DDA6CF2B930840F5371D9137337EA551A498F1CDC531B1ACC0C5BE4 778D95373952891193C82EA34FADF0539482D8E733314417A70984363AD50B2565BBF87F4C338D18 8482D11ED90C93373FFF76484E3E3B667D7D55A07A16DB934594B180E934C303C685522B866FF182 24505291C933A73E069D42F5916B6820A264D7AD1B41484224A400BE9D2FB66DC98938BB516EF888 8FB3E36932C9509F0D0353503CCED26EF6345E1BC7C9691363AA12DB9D026697A9D053689B47FBBA 4D8071FF62A4BA881DEBB06C64F75FD6FC1E9F82F27523C3C364086F1C2D28293FA92D5F39E45572 61694E08490C3A60B4B4D063613A1FC7EB1BBBA5F58B97A1E51F197F7B3885D15B7D18BAB8CEB1CA 1D86EEF07A158F8B5D0630F286679FB6C61A11B4F14849D9053AD4F4EC6B9EB263417113FBDAD10F 821F886EB1DEDFC24A599AFFC7A86508E8D0A71587A25811B35B4AEE85585128D87CC893146C12D1 E3F6760C4B4B05A34B1855B2B6E338A349AE5E55C7629973DCBE1162E3D53BA144329CE50F2B0607 5E65C36F28534E3C3F821CF7E82FD85886073948307DBF951815303BB983536BA49F6BAF64F16316 E6482D5BD30D1D0B1DE4568B9AE3826DCF756E020AB3194264D09F52E5713785E59B556D213962B5 61AED86027741F9E0244FE0887BDE98453A88217FA70D62A46A048C8BD672C3D3E0EA2DCB4F4C1CE F1049D8CECEEE1F947461D25DA9A44059FD26F11476B114BCFD39450BC3B9F193C98D0A8BF5937D1 44790D2F77F19D7994B3E1153628A8099747E77551F1EE99F3162771FCC71BC402D8D7FEBFCB09B4 8EF94D5D77B22B6C93D85975DF71CE0D57DB68E60BE09AA3CB2557B8F32FE4D1DDDF493DF5AB7BCC 2759B9C503D2267D0A1B28CD36539635EF8AB88812846F0AA8857000F8842377013AF8F9613162D6 F58D43297A8BB0ACF96D0318642ACB11D4A5D76BA0137189D3B5160DBA5FED11AC41D7B13AB61DAE CC5BD5E6F5FD4F9822953E23D0BFF412278C99EB0BF080788C5449BDFB030A9F91AEA7C914E65B20 69CD77938C230C3A0DC0F90B48FA1270AB92A6169213A72F7CCE50653E61322AEFB8DFDB0B24A395 F245CAA3F93EFFAA441E606F79715459F8A10962DB40EC1AA7D62A48E045B7C88E3587E0F49CDCE0 CEEA09C390B3184F5B6D2B3585228887C137A8BA08C91006983F49C2D195AD80F3FE63BC7CC81154 219B642BB89CCC8F3572C61228B299A7EE6083EF9E35B167DCC0D7E88DEA7134E211C15E3112FABD 7E0F3D873BB710D50C2B0DB66C5D779EA217D92A9D2876A9AB5D2FBC80F12D9DBCA4CD987D259817 BD885EF3050D8225F70E452DD99DDA6F005645B77ABF6FE3F39D4F60B54E535F95BFA37D13C408AC 31A7E593FE5F5F004C277B152E60B7BA3769785CD98FFA92E61AFA68DB99BE6F9E4E9DA7848D666F 44CC93FC917A2E74DD1DB50DABC1C18468CC336BE0C3E2F885F616EBF2CEBD364A91CF96B16C84E1 7308AB2D1D9AC75BD3148029A2DD4A2EF3B27179B1885DC35681D491B41957724B5E72BC1FD24B38 BBCB1BC3945E1AE0EE6C4D3ABE735CEEBB538BD836599294CC0A8DA8F5FC0D7D552B990B9FF181E3 792C3255D5322B94AC51B976BD732044A74CBFA620207C00F82D3C49DF0B72E9051F97A60D37F503 B6FF553C16234D2818071A37411C49EB40AAC8DC5BD798E888843FA5E76BF3BF07644BE2A796AAEB DAAB98734B391614BA9118B40DBB61291C1CCE28B50EE6CCCBF74FB42DB779B0696D19D1E367F8F7 3640430748B9B41DEE700D158E1ACF300E2D5FDCF6C885FEC4D6937926768EEE3B5AB8EE755ABB6F 6FC0889BACC847EF2D2E63614F4AAA3374A04BC969CF74348588CE6792B2BCED2D69C12A86497C44 2119FA4CEFBD42349BF1307D1A8B5C7F937BF7FEE930B35DCD5F43F074D9088DD391E6C84199FC4B E7CBDC0CADB4C0FEF0BED0D23D58AC1822C04B407D67B94E76F02DB2F442D52C353A3FBC736DC914 8BED338F85C3090D5A54EB4E77F2CE54942639675FDB0A486988929F8897AF5C70C7AFBBA555C941 02CCBC3E0D61A6FD2B88D816DDB5BD0333854B3F53EE882CD05F493A69E858C1D6B2A9929736E69F AAEF33FA8BB09FC35B7324C8EAEDF35506C19A3AFB1663458C386142D98D87E534E780CDDCDB2123 647BFA97B8D8F007A07C4A974931D5BD521257EAAC304E0BF82C46918ACA11B86D9E94BEEBCD04CC 385BE42925AD6B5A6EABE97C891BE4F17A0D468680000B980A071806D58856A99A0BCA1FB8B82902 A36CA2372B300722F8026998371F3F631AB4935FCF50C877EF2F33DFD3640C92414BF734D3D5E89F 19087B773036786BCF8B97825863BB2F68D5D362A3FE4443783128B982CBEC8EF56F382C007D1B83 6E4FBA7C85D411532195C407DCC6F66552128159C053B03A8872549780AE8D86A7FA6BBF8DBEE686 B0309D1DCC50630D5557C1E77F162DC1DD5D81CDE4D348058C47DABF18C8E3D48C85709142CFB7A5 EBA58DB8CB1A33DF25CE92CF050C8A7E3571850DF8454F53CADC6442B478ABD955D39FE03C57FA26 75CD6DE0EE45F30B052EAF4A9D6032FBBF167CCD6126A0FA5A1833F1C23B71D117406737C0CDB3FA B27BC283A74E941244092DB0673C11B425359EE5B604D7A27CE79CAE576790A258EC243E135A9E42 66377137F02A07E6CDC9C1C08C372DBE2C3AC23DB2DF27EDAE8CF7D678D8ECBBB5D71EB8F1915124 8B60C77F662C0C14C6864EAADEC95E6ED183BB85E26A2F5C215054274F6431EDD45BE08EC9BC0F48 C5F0C0002BBFCE04C9F9D67D5F500DDA0E6D1935BB0197847EF1DE7010B4ECE15E292648567039B4 87E36CBE48D2A4055CB4ED71C6428C762C40EAAD78534C244559EE287289313CB083D8DF0E489A04 D1D2AA1D8A65192BD75A413495A198AE52D0064783F054BCD70639665100D3E3EC2934D25213A75B 37282B172176DA1D647660177505125200B61CE2B6FEEA0BBBCDB701F30A52A95F1D908D26799F53 1CC4FC4B3D66056C596AAE146006F0B7DF834337A2E0CA0F86705BC02DD8789748E6186CC1E638EE E85A0068D2D34D9684BD6423E7A6B4D5E1263099A0F456A3486AE2A05FB653C093741EC5F17079B5 F70779A00918DED5E62069709BD818C479F594D8FD6901DFE95184EB8CBE3994F3455E0AFB4BC8CF 0E8C86BEC159A1B2AAC06017DACE79F78B1348CEE5C4E1ADDC7A2D46E3E2D871AFF4290670CE15E3 0390C46DD3C2D14C418113392C118D290A02FEBA5D34B7A5939DF6DB53C553190DE4383C64983518 A0817ED0D07EAFA8AFC6D84E47960DA85B7144C8ABACFB157ED5F6C0AE66BD60536DF81F22C11DD1 45619B801261ADD6EC62319599556741DB49E0975640C3386569E6F095C4080A8F0BCC40727C0E62 A036D227208E55CC65B05DAA7B12D808A426F1DB4478922E528233AAAE456DAD671E71496AB99000 25C273EA2E7D4AD65E05099033616DC9BF04D012D97472AE1C37FB7A12F6E447C57CE0D27B504CE4 6F814A2F72F31D86A9811E4C698EC913ED17993DDC6288ACF80F3F506C906A90C872DFBD0019FEE7 1094BC3573DEE021CAEB6C9108DED6B50E392709010E511F90F17A2D3D3671600DB55429AE8B4344 9D147A037A83B3223809CBD49ECE2BD75847C41B22190E0F5EF7783D1FB4F0E26C9B51C9CFDFF8A0 491901A56F6C31FDEDBF2DC4404FD340874FDE5D348F3572C61228B29993B27785CFD45F2B6BDD54 1FD06DC1A0666C7AE74FCFBD01ADF34D96D7232A1DC547F0CBD7D56E4F56B29FAB689E33E680EBCB 4A5377BD5E8715FF3054CE2953C7D251619C92D989EB32764460C94612ED2EA766979B2CCDE6D042 0D10D721521E41F9D3F7A6EF4FAB2AEE7F1B485870EDB2759C944FF64FADE24540B18660297137A8 33A2161B9D9EEEF1361C7863B84BEFB5E9EF44671E1E813858624E98C62141B1E307A2F52A2643D7 76F8143014AC28A99236E479205DDED97683D61C49E74237929DBD3082583C264085FB2F423293B9 47C48E17D0673162F914821563F7D0122CBA3DF368EB99EAC6131B4F0C77B2A676C89C335B7E68D2 35E7FAF29512939760FD8F0F50AC9F72D47A5BC368CCBCDBBD4FABA92BD4A8AB3BE606D30FFD87CB 82E3D0A411B436BE59CF699C44A7C5CC23B9255D0A66C72EE4EFC45F83259B8A34F428590D086C8F 0A5DC22907271A8172A4E7EDBA7C866CB36AE90F9942A7AA857739E833837411BE9F6DE44F166807 1D6553037CB97E1A03B1123FA2F193377DF67BC8EEF8019F443B50E195EEC289F5BDB22EE65D7D2B 897C1AD9E767D0F4A1A1796C6B55C7F3959937AD6066F5C0C405D202424D0A81BFE15A8153A0FB05 501EBBFF4FA6E8F00F9500902F237264B11861085DFDC9BB7291A0770214B2889F1D596BB59ED3AC 8F92B6B19E2031A5CE45951E66D9C11957043F1E2CE40AABF54406A28C9D5DA14BE7DF15C1DC12EB D78BC44205905EBBABAA0C717E4A9FB7C8AEA5FA5057F1A6699A13C8C8482E1B4B29536B98BB239C DBEDB1B94CB3D240992F6E8D684BAA57D1346E1E52B33026F60AEAD797D13C2F8BA7240BF80F9ACD EA3179E41B55CE983A247E8172F0212DA4EC13A3C4CCBEEE8FE59F6A3589BAED72BF04A75CA35621 98BE951FAD72251BE317EA9CB56D4EC0121EC02EAB70B9A8D6DD0EA78A5705983AF2FA9AEDCA5947 1195CE27FDB91992E69458134C9873680537FBB74000525D3E3233F7A53282F483770495EE170CCB 3F67CDA6426C190BB205C6D07A51B97AC649EB4131D87414CD08A5A87B71FE5D5C3A8C014CCF37B1 2408A23BBD3B5C12AE7C688D6CC73D4D0F102F623F79CB4628A202CC9C554FA264DCB937760E5245 9199F76FE2BDAAA8A632ABCC1EA154EA85745BC7B9D0937926F8688E593472B110F7BF7284465022 A07C7051652307D7E5FFAB0685B037E8565BBE2A51BB9964C4C4E977F4C3B034E4A4B764191E20C2 0B82D5D8F670303836B4AA716C35812DA72D793CDE620A120068B48B770AA194F9F78F48EEF7716C 79311EEADB9A0F3CD3CE6F5F4B519C768A86F8487D18CC296DEC1A27A8A0626124431C0CD58A904E 04D408FDA2071B2755DBDB774DE8BE04E36C18E71EC5BE15F590D6B6DF335D78B0F64160A7E4EFF1 28BA86EF4F2F1DF513C87FA639909D6A361F39E7557C3BEB9A0EB11957D208277C1B6D361517E3D1 38BCF8A5E481646DF7C38E25977153354561047D6507F484D5DB92F05931DDD78FFA353BA8AB2808 10727CD228A32573C16C6A4B11E46B519241E935B7F1EC7FB273D5712D0D993D9C57AE7F2D0C2C2C C1C869483C42B423B84BBFA20A9674F1EF2A8F3711340225FF27B0C87F1405E0AD759A9BB6622DFA FDF010792C49B612D2B2E27A76D1D7A44B64DB187E3669FFCAA0892F9490D8743D7E7D76E6E73CEA AF2AFEDBDC2FD2594D664AC6C4A7C97B97DBA0905C46663133FCD1B9E3C29553AFC6F4D0355E7FE3 DEE28A2CB5AE762A76DBF58F8C7DE218B5101DFB5A41BFE05CC66BF93DDAC8394EF99EF3BCFA361C A8C8969878BA60209BB7749FEDD190A9C0CCA0592D5420F352570BB99F949B21D2DA7DFC9BFEF82E 4D15D97ABEF8609D27DB01A253E055BC4AA6779E3449EAADC716EC282A7CB05FC31999664937ADA8 3B6098DB35AEC2FBC207F848ACF456ACEED7F342E07058C971F8FAC1CAC1823099D25B2FB0EC6C0F 1793291547C804D55DF3AF9DCC29C2A8FCDCC43B920C557D54A4149E24AB16E8B4209842365AD399 6747A4A3F0B7E02B914979AF1128D7E102623C491C81CA9F878850A88C720C5AECD1237DEF7403CB FAB60F60D8DEAA3CFA6EC8EEA7189257ADE417806AEAC15F2D30BDDB3211D935D653A92554A2942D 90B3085A0797130E1C49840DAA302A97DF49EA50BA948397454F9703A8EED8F587284FBD5CB84057 CF02B8268268F936778E5240B6651E4B937DFDA5535699F91895BC5C9BA0897F1022B525538070DE BC546508BB27E1E1C6FF0B94156CB6B5190EF123BD69A44659AC0CD710745782A3AE64AACA6AEFD9 93FAE52583C7B4E9C43BE849321C57C4C03F0329F458DCF4CDE45F9EBE58F05E260B0F0A0338B537 6587272EFA178E4135D7BDC00D4836E0262AD10F1DE56917C21AB919CF01C844C7B5D0CD0FBBA6AB A62A43D2FA3B5D47B5A0AC5E86D28091400526A7B117C328A32EFB05CD95E7854025465982C1D6C5 AFF06C280223B6BA31DB28735A0E31BA7E0795F18C320B02409C638761CC6AF2BF4EAC2559BC9CE9 277D04862BB469C0CE26B7089A9E5AEF1E2E9BC28CC620A223F0253E339DB0C56705A67A295A9B48 4BBB1C65E47AC2610F0E0C5E7C32CB87065608559EC0999C1380127CD89CAB7CE91BFC7C22581CD7 D51CD0EA69B5276DCD9297CC07294714270D592477561676946C73DC2C8371C187EB19B15AF8DFC2 F39165C03C0A3D43EE33903197D971C0ED217DFE9CA87742643D2DCCBC3828FC1FEA0E36C6AFCCD3 52E5815144FC8799B7F1FE02F2C1E623729F76C16DED1F556D86BABA3EBDED28714FE8DFB224A07F 1FA5E13289EE2C0B8BE41A9B5888FB9929EA9053C5F20D07205B981638C8B32493925D412985408D 8DC70B38EF820CDE40894123EABA8EDDBD93896123AC4B2A74A89CAB8C2963D35367DC2590968305 F5B933E6C973361BBEE5000EF1F656CF540EC29537C12D5FA50664328B5B19E0D01472DAD12EB1AD CC0898049784A1E4FE960A9C49AF0BA905A1D113BC52B8FE505A3A5AC2DD8028C883947C57B9A2C2 C685D760C56D1D6B6EFD95466E7726095DA51E0146EA7C952ACDB4B761E8C5B73348E0939FB601BD B0A3AF05470BB1821A2326F31CAE5251EAF469300A982A93D756E9BA81BB0CF4542B70CD0DDDBA87 CC3E0715D07DC43372744F66068C6105BF016692A9B6D93D4B3CD40FE34BD4C06DD3908D16DAF621 E2C0E1C77AE0368E96D69AE3884999F89FA73D652227D619E7EE26826E38DC54E9E25236EA61CA1E F9C90BFF6006F3AF368430DCFB0B199C314DF1100C23399BFB22BFE86F5761B956345D13246430F7 F26C01F34946C4A1F3FF2433CDB04F9CA9C15A9F33B65CFECF23AD011D5837DE07F94B6BCC63F6FC 74072540EB2B661E454EF2CB9DC6A317F9A8583EC3D608DF913473A7FD5F2C73755D648C8D6F42DD 3B00155078DDF9614AFA56EC4FF7714B59B224A13D6D8250596C42F45E2348712E0B304C4A3BE262 C7718690BA7F9C81C5EA96465E9D1CEEED733F5662E0619BEE780FA5B87C60600357A28BB240E812 1EE54B3691097EAB59825C880DF2C8B8F7EDBB7F5B97CAED9072A39FB1954009A50247F8BCE8873A 1116E51F7616F9065FC6F1641D78F6E8F024A3E04B735CC0ED84B7C0E11DFAE10208464103BAA99F 5C66A7A0EF3990CF7EE7E88D86F0E40C9531C59036EE026887033CDE346C0AA6C0C5748DA057E757 EF6F61F8487CC3EF42B9F8FBF9579BC39305AC922BEABD1359B0D1B92DE805F9327E1A24491B6266 4F033479474AA6779CD1DFAEA16F5CE5B4E289CF684EAAD7E4C1121ED91DA1723747EBD5D61AEC45 D14EA53B8857780ED7633760DE473103DC93110C003E9F46826E0EF944F7AEF8761FE40DC90376E8 74A4530D1AE31E7C39AD073E9FAAB13086B642C7F9CA9932724890CF7DE07D4E913543040D196519 F3294235732D78B9CA76800C32CBDCCC2DE7CAFAF608CE48F1A78C066EDD2268DBE77919E03623AC 6532B49C3E8D6641D517324A5F13863C6DE6952E2B733B46CCD8911A639D44D4A3D3EB4505ACFE1D D02ECCD0CDB3973E5328E8F8184FF23B0F479FAD70343D27049BAB612DD76685A7B1D3C950C8FCA1 E5B2AB9FF904B5A8725E4D52DB59B03A4A31DAD25F6B6C60E58EB6E0B464E2FECB7F3EB64C649C59 0359FC7C564884D4E7EE09BBF99667C862148E149B6A81CD535C06981609891BD5C5BEB5DF9B18F7 20457B482DC0F153245ACD98D134DF12594D7FCA54F79C68FD181B1D52D0E54A8CB69B6868D20438 DC4006D5D5D315574AC763D29EB5595ACA6D0D528A80F619B4875C98750EC21723368E4D65C45559 E595100A9523D77E66AC6DB98B94763B27336CFDC83EC8BE8E5FAAC6137C91FAC01686AF3E617666 B1C481DDDE7FD80C6C513808EF0D8895C3A2BB663A21EE4C0900963138DBE420EC2F1017592C5D7D 8406E96CFCA3FA08AF9647B8F276DAE9C5A713D5BC1BBB7AFBB1807A0A127295CFAAA5C52CBC5A94 477E42E5B394AB608555B181C887AC432FD0A14F8B3F46536CEAEAC04A8E271230E9606A448E47D9 441EE1B64220F2B1910EBF808906E71447E7246F4D9AF765FBAC8289555CC675EDD28A453CF152EF BBA7ED171F83C996DA96766AF0087A6566A561B85B619EA01FFC31F803CCB53775A35EA94C9E2BFA 721E37718414B909FBA31D93F1E8D78E5EF7F1DB386CE6D063C373690292B0380480CFF8831E501C 4DA55E2E9CD8785DAC54017A7E441019FFF2005141C1D0A77AA1D047437E20FDFAD7A7B994DDB725 C5F834EAAEFCB165E877624BBE5C99A5E98A99A77407A3C57DD48CFE9223AFE67D6803838BBEF2BC 2B66987487BCF2D927FB222D18F267C6F6074074AC364BECE22AC8D40F5D23696050E79A8FAF3780 D9AA224FD4DE8D084BAAB6D16B714FBA410068716F5BA0E847BBB41CB3BDD3235E6F61927E102DCB E06530F7677666D250483534EF8FEA914827A8880AA2D27A29E075FB969AAEEC58AFA5B0335E062E 690DD4F599AA18F6FCBAC15B2DFE42CAEE34B6A2FD04EC2A1D8783E66B90CFE2F918DBADF828562B F3CEECAF624FD99BF3032C9A24CBC5DAC456FF5EAD60CEEB78404C459354134477A95D936D17BC00 B746BA4B116561310F0DD08CA082BA238ECB73E10AC541EC03F12E145EC599FFEDC84980642A6D74 DFDFC74E56C3B2545BEC1D0F72071230540BBBE0BABFC0CF16151ADE7E76B3DBAA892C7EC5027050 FEC7C20B84DF8DEA5DE2DEDB20952FD09CC1E2BAC005E00F8E1BA4FBB258E8DD64B380C14DBB7655 2361F694EEF7D70433C9EBA5287AA7669C04993A0EC5A8F7F198630E07561268907BC8085EC28EC4 DF41EC6680A4E02A09961D1ED74DC26EF79320EC41C6ABBDAFC55866F97DBBF5FD3EAA563CFE65E7 60AFB1C03FE2F1CE26FFBFE0BC20319C1A9262B5571CA99C33A59B8E6A31D07DF3A19438DC2189DD 0BE538B8198DE0B1C24D7A9501C6CC131593A815EC8A034A2035EF891C3C101A7FAF74292EABAE04 85B9A56EB5B2D5820A61C65AE59F40266CF1B0980A6D8C790ED17A80AEB506FE5C9F1E057F3DBE10 74A7807B18D539E78B650137F30F198FE8497AE66488210C2F407DE0A28EBBBEFA42165C5A223D5F 9FA2A8AB0E8D58AB4852B16930ED7815FDF8432DC5AA231926E174388547D3A8E929236790C58934 80AEB65E46DEB9A8E2CAF037CB95A34A1EF647BA7968216D0E0C1096197E3BD4F9F3A31B3E3F5728 D4EACFE214FD8774082D1B66858D244A0E2818FC8D7AE137BA2FC48148A8537449A9B8DBD965046B DD1F689968BA3C3C8C69E39C9CE85368F936876D464A66A668CEF084B7B7B93714C86AC2D0FCB92C 592A09D8755324C245ACD5DF5E9C5D8597688C92C207C2DDDC99276A5336F18907D712A393D094A9 F1A620C082C599524AB09AAB4A6C91218128DA1DC90FEFC7C13813847884D69C3A12431ED8D8AB78 D49BA7EEE3D87CF3BB00AD086E4328F6887DC8F24AC33EB8F913827AF2DEC8D838ABBD906F12797F 841458E2039FCEE4E85C06093C5E6475D4542CB604580A973410066B4DF3E44B8C5130A7CAB7AEC6 6AE257CF57C5982FA1A8494FEA508C76A8E14C59D9D60784DFE364A935C62F7BEEC5654B380CE5E2 DD711117E06AACFD46094DFAC489F0B3459C79571D73EC78B1E421119CB03834C1A94B437F8C1694 93FBC7EA977CF50D9CB1F9011A205A39A7FD5411EAEA201CDCF7BF4F5829257DC02412FABA6C0FE8 3EDA1D1AD1DB9B4D2246D7068D01534215B1B64B6D75F4A546858B1F4DDDB0B13362581FE6FCF9FE 0D5793BD1BB2FD313F71A4643C006A166F5D5308008E5CB13656A8346326204BEF2479B3FC35520E 71F1048787634A187A08ADA4AE4803F200F302E6F247F438898BA8B6F041EFB7BA24A828A9750DB2 2F7301B2CF18E3856334AF7DB47356BBCE8FC8E9FE394E893008FC58850810311FB93185DA126C03 A5901AECD828012F4163069A8548CBCE5E3DB39EA2A718992D03C02A0666FB260CADC0D0E5674965 1D3C5BBC3F195BB619FE33F23F3DFDBFD59F1B266FC57DC2CC5F34DE74AA9439F9BA7D2F9B0D1895 FD15054DBFAE3C7C50A716DBC5247A69EB9358E8C067C58D6D587E2D54B3AEF7DE648D0AA7BC2285 256BEED80B8D4853E2CB7C6258A9164BAF2E7ED5F5ED7937D069D046A6F8F3BD9903873B4A4BE11A E987570E27491D7B5BE5BBB0A22D125D7717FB64D519A24F7E7FDE314BD33CEB36CD8A5D02D61516 93C7E24C2DEDBB06225AACFF2B6684AD14A7EE54F247E822D35F8AF8C906215C8C58D833C626F315 3DE6DB92D18FBA0209ACE8F7309C744719BB13510DBABA2F5EF0F9F63CBCCF1FD1B8E9013E03B636 DC91B2B645447E81AB05CB2E171EE9903B6FE2F7F9BF42EBFB1C2776E3FF3FD42361DC8EB7110E76 B4E9742C2B0945C15B4E71150645685476C2A4D357AAAB888F83AB1B73ECB848613DF970FAF17687 277B2413E5C31DD3CDA037FFDF8C6C70D5BB93626BA36B871CD254BC6D7BBDE500A38F1D917EEE8E CA06634E862D9AB3E933551AE8C963821A3B311489357DF16618950210C5F33909BBAA5EA57C7237 EAA67F83FA8E52EB4B4478454CE5D1C96A92470F96797DAD3A7B6371E468A90F4319704F82FF798C 7AE817076400B21B060F96E9884AE3C29EBB55D7780051F5F41E96E981504203C14169DDFA469167 F1DAE6B90D9511FE995CCF4C86EEB585927F3E3417FC3B7D18DBA0F31EB37F05CD76BBA3991B06E5 F664F441ED1DEBD05F2BF60472B4F79D2810FC033990647505B8155A6F30C2414661A47EFB0918B1 589836E28C5E8190E7697462EEEB0D292AC20B884DBFAC079ACB94BF9D36073FE9A3C515FC66BBA9 94EF4C6EBC68479C2A9EF6E2612B21B880972DA86DADC9194586C492ACD3A69C4118725561ADE4D0 328DBE079D128F4EE6E84E81D887A9225F3617EE5C65977C667CC0C4A108CBCCA90B9CE67412C028 6EDAA8D73BBEB8F17FD3771C548C24354FDB4E52BAEC0AB163BB9A33785518E7AB610102B54AD5B9 A93EA77984AED61C4BE6DC410CD4439329255B42F4868816EBF9DFEDBB7AAD24C84483AE6E922994 F301F8A598F9DF00EA5E38A34CE8AB316306A9BF87BE5A7DCE6C1E59130573E80DDBB2A2F85ECF81 734EAC361F24F9D97CE1F0EB38D7D3B0F8A0FAABE5FC3484C84CAE1E450720E32324F07B7B572AAC C94187DCC0864E9ACEE6A2DDE4745AFF66C04FA9E28DFA8018A01AA5CC513FA35E738A5C344A52EE E0232EDA0365E201F43AECDCD2DC7041E916315C3940EB531E6DB40F4DF3F0AA82E558ABCF667233 7FAA00F8C15A8A5DAEE67A66D817EF497E34BF33ED65721346472FA9382478A0FD01B53854D4FE7D 5093C3DAE8A5F5D95DD73587B6F8B4676E3920DF23C76BA718093D92156FEE6E328B3332BE5F88FF 8EE24502D031EDA1012EDF7259C3A6BDE6CDE0EB46CE2BD632BB6F187DDFECB615F6713B32C3C286 4D26CD876B2D0EDD96A3D936EC121E4852854053C340A5DE310B4F5EF86EA206E53B7C6E73D804CB 786530BDAAF49FEA8E8129DC73E6ECD37837396204827EFA0BB8BF4EFD72AC43B3733D9576AD99FC ECD5C2F007F270DBE07818E107576F151E4F94AB36F051AA858FC8A60172F4AB1F1E18B60C85B4D5 B3F8FF44A9055DD0E3913211EEC73E9776F16B6E54543ABC140FB612BAFD642A06044121B172914F 5706BC9FA7D43976F59C0E6ED3BE418C575F54C604C92A01F03BB7C9111274D03340B6C0DAFB44B6 33A6BF7CED6CB2F5C88BCB248108B9F36B52AF4E15449D794AE3CAD355EF388E1CA53A87F7DD429A 132F7713E0CEBB7CA4564350C7617887F5F29F17C1907E76E56FF78E547744A9E4A2FAA4B6022B1F 153132EC21259CE2DACB8B902D03B7F31F8F458F4772D36B0022E6A3D04C2DF1858171C45441E2E3 0269905E952876D8F113A021F64D54DDF7FA101A4168651284E6BF56DBC2EBBA203F92FF64E288D8 2DF11B39BA2FBBB070CBDF4CF273BBA80632C702C691FC179C5AD71E34DBB0DC5A1798A719718004 6D27FFB1AE4311352A54B39CB1AC19FB0C536B33AFDE5933784641894A174B4CBE1CFBD51158A2BA 25C830A1367E7BCF5B088C0113587B833453685189B02995630DCB69522A317C382990C0810247FD 2962709586DB159E417EA9B771BE762C3D003310C14F8049BC35E949C8F6CBE2BC0C17635FDC7CAF 1435B5F5FF5CF7BF1B0F8848EFBD7F411263129691A610147B88469A0E63A9A4C831998154F0CDE6 C06844E3C21847CD4FD4799D3305C7748B30D38D7DBDB9E43C4759D6F878423D2D3EFDA6671D61B8 52DDD52B134522E75FE8B5A4EE24720275035EFBE19FA6A5F9804D1ED5B42B57952ADE67CE73351C 720734CB162326D70C5E25C0CE624F2291C1265EBFBA1AE5EEDAE69CD244AEDBFB549997512CC352 CE85F8A9C7A30EBAA5D26D5A4C13868D6726E4DA292C0E6FFA2FA3362331CF75BE2ADC8DDC2992BA 56DA3E58E4FC388D7355FE645BD2AAD2DBDAD8A689175B59E96485FDD928C24E2C48A7D2C6D7CAC6 22C4ECBB03153DE3866CB6616B9FDE8569F2BEBC643D9D3DB22AF8D71B0BCE462B68F84B2530BA96 A0F1B0947AE35604C92C2543ABCD40ADE56447859B71E44678EF5C9B4D9F269AA949C0190BBDF02E C93DEC63EB4A03210854A171B87756CBB3D0FE0D47AD8F19D56F9B865CFF89EFDF6DCC3A87E852EA 613F8633EDA73779B2FF35E33C0EEBBA9FC0EBBB1BCAA69EB9A4C710C9CCA8590D23688C4841F165 394AC251DB4E8CF284B673B125CE3412C18684DB041540E76373DDA9C979B61D0CDFB80AC34D15E2 3DB15C3AA3E2D73B63974B3B4FD5A2B9DE25E1A3DFCB96CF2170F89D3482FB0241DE1B38173449C5 A696C671A4A6542E0C0DA8AAE127C935B0CFE353C76B1D0D92D7106EFCCF4B18C01DCACFD446C222 BA83ED50DCA5BE83C7028D94EECB852BA1996FB3760ADC7D75A140150EB8D9495B23B87548476072 9AE50585C6E4E8E0E03E3ADFBDBC241875E5889628B1A9F1C01C66DE11DA07D0741D2D32170DF3E7 4F4E1401166508729F770C6D3F6F62B6E694D0DAEEF02608D453999D9F3CF8D502F138C7577D4F0A 00E130E6AF2EAFE51BDE1EC414BBBCEE613CCEB599841FD65DA560C8C37218294E5CED537539C55F 119EE599397EE87BC6AFA91F25B2BFE37D8BF3B6FF89127AE1F94F173A5CD0FED676F6F1BF01B535 BA30844F327DA5394D3C62D2CA15829305EC5E4F19106BBC0443073BAFC243D3AB832F2D64BBE840 3957CE3B61985B8D530597A357257065C77AEB344F978A30F519A7CB5C05AECBEA3E8BB661518599 937689D6D36B5C39A6E22E5A3F4067F3178F638389D185A987FDEF0C84F312C1463F02BC1E81A026 FDFEDAA4971D5BD524EEF06C10A23389ED01183FD7DCFFD4AAEEACFBF4978B5BC327263AB5DB7519 033A575222D178E465CFAA0841D3EED70D0ABD2662554072C9E7CE45E5C615B78799D63BB12FC1EE E4EB4109946BB08A48BB0A48B6FB06940129FE1065ED44D4744FB311E793E2BA8914D13D8F541F50 206094ABEB70A4BAAD0C97DDB904EE252F748059D3D61AEE4CC09C17EB696579C886B9AFF48E66FF C84577DCACA02AACAE4C868214913819D314D60618993094FE14B362867C12D71DBA5F594C2107AB 25E770BD9E95A5E8A6869B261EDA48C2597B89E609E30C8CB4EFD155B665D65784541EFF8192B8CF C99CF1A068090765D6DC5EBBD88C3FAC72618447DC37FF75259F322F6645DEF0734F36410E40D852 D1E2C6F80C5C3454FED31E844CC75B2DEA9849C6326688ACB324E2EB6EEC6E663C7E2910EA54DCFC 57D6ECE6BE1EFD0CAC2AA52C6D05F4FBA61AC3029E03DC8554DA498FBDA5FF37A629ED1C04BB011E 7298F33B7607DAE04AF61387C3227FCC74911E91087C16F630C2DB4F38D2801BE2B766D8FA5EA50F 0926716C3B92AA54B4E2C03C27B36EADB2B55573E30374628434D116F87DA6F970EBF73BF798C388 F6CEDE195978A7DE54918F5F452207BA1AFB9DD3184212D56D3ABD66C69C50B21596C2ACCC2DE21F 239BC7249F5A5B328CCA516CF160A542CD8BD9C19C92E6E515EA9AC179134E879EEDBA8BF96F5AD7 9CAD64192BC135789FB5072E7A230169C95987742B0FFE4CB69090C23EB9DDB4D1AAD2EBA5050E24 A42575A9091636959213D8E0FD7240474200B26919DADB9AFE14BCC8A248F72BE22C1AA5E64D6BE9 17B21D3CA08A85679ED14DA23F70F2694E38C4A1A503B230C131FC6D221B6554A74E8046747410FA C13A504FB34FE81AB1735BDDE54C6D6C7764A498E78EA63357380EEF00056B9F44EEA065F79F7F9A 315700669CD81E776EE037EA1E8889BE7F2A2C69164CF9BEFC08DBD6B533E1439D67DE0DB51D88A1 55E023733E5EFABC2164F23DA2548061CF36F9DFD3B95C204F637D28D230F6F25950DD2A38C2A39E 0E934C96D308A95F34D90C76C79AEE878A92F2ECFE289F1BCF0A34225316E1173240831482FCBD45 489401449377FE83D211C24C99DB3EEBAF0BD4A3892AE078D3B02CB4ACBF6529AF57C6F7CC3B980B F4C471CC2C16F58B8491413F3EEEB174056E1F0296B00D03BE007028080278E26344BC00107E70E7 855BDE6F097AF6BA4FF07A7746F79312E10DC69995AD248DE8C79DFE44A0B63E29E64520C12AF90C DDB08D95855BF476D19E409B67B8BC667DE1EF4BC7FD60EC1C7F3BBEF2BF22294131506E25EC60E9 708EBBF18A265018558E08103350677FB46387B2783B949BC78E046A04B2BDE2C17E73737FB0D4B7 C8C8638209AD54DD2BA3991B876A616EE4DEA9E0E1CE6225BD59F4F522FFD9AF6E2AFF682A476807 9D9862272966417D605BDA1F3C47D879D83A296AFEC76811A7E1371366DB0E23D72248732803D2AA 717969C09DC26EAF080AA88BACEDECDA8D2618E364CA2640B2173CC522E936966E75039A90AC4055 D2FC52CA65B30B8B4546B1B55349A0AE3041F4F80B0D621D53B2EBDB78C0B8E373A55D816F89BF4A CD98AA6130FA951D2EA42522AF544A7130531D1BEFAAC47D4CFC6D736D0C6B6E4B6E9FEAFA5AA1BD CBFEF0D97C8FD546E761B02341A0C4EB33C6F0AEFD0D9E9EA7181501A660E30E719D75F46E79D6EE 1EC557DB9B74CCB9E39EDEE2939E03750E89A9B75271387C6CE71026ACB0BDF16FE7EC3293FCBEBE 8422B9EADA9582A8F00F44078D4EF975D666FA1762D371FEE1AE9267306920BC061A9974626BA23B 25157E8B80A35D8AC16A32DBDF7AF4975CEFA212EC09AB9577D1EBD4F52C36216A83FBE5FC61EF59 47221905C7CBA474975147C5DC17C9D7E30B5064D55BB5BD96ABB63C20C363C8161BB3436F6344E6 1F71CACD781F9E9D5900DFDFD8E75FAFA448D93E99FE89AE3160C4D88EBB03B1085AEF3F537F1AE8 908C74E6A631A3D607AB97C75F3A96075AF281A912B70C3F1E66A9B62204340A4C612435E426BD90 F1129016FCEFD7639B6C5707D993446088A4AC8A7A2F2FF34E646FD6BA3CA49D8F0375F02C510634 2219CA46220D5F869F8B66422B95F85D6B6C53DC72629F1D2BDA7EDB3EAC66BED869FE8630B53001 09F111DB576624414826E0A3D23E202957092F1EA98CEA8B64241ADFB3F1A093A9D1CBE47E9EECFA 48458A0AA6C8963770D2EBAAA8C3130398439CBF1ED17A1EA3A65587D10397FE409C513D4FCCF54B 09B2F274C49210470D83C565B479E7B78BB7F571E22CCA5826EE3D61C6AE7A9A19522F50A0960BF2 334F4FA130FCADA9821830B1EF97EB2EE032F4EF54E79F28C9D60AC95230B673BBDEDC158257D1D3 F684B9CAF6068BBC434D019DADF3F524D8DF855C3C1DC3931FFC585F943969FC059ED1B6F551DD4D 5CD19D02A52BE90FEF8CFE0DC73CB50DEFC6B71C162193CEF1E199F7B548BF8A04B55C72E9ACD482 892601DDFB7B903413BFD32E0FFC66E8FFED706EFB33AA862110AE95CBAB506A0D5CFC9C1C34ED7C CF67BB844CE21A7B4FA86564EC031A3D4D5867290CD9FDFEF7783642B566CAD76DD8BDBCD69F6D29 76AA586E3422BAE165584D00C6EBC3FEBB8F5BE8948F41D7851B1907C8836BA80257B7C9047D2D5E 616C40BED36BFC03C60A0F3D83B95B90559B3CE11488D73C9695102C531AB4CB38D9D55F5F5629E9 9F41B8D41EA44E9A7629255564B775E942C05B7E23B8508813EEC76A610F44F8DF1942C5BD35996C 616559837EDE74B989E37442342E6DBF74B933DC18E224B137DF978B388AFB5F48A0F221FEE9CE1E D89D0A0B547A3B49F636AF17DC6F7A2D1545DA00051D1116B1A5EE9C36E436D9EE298689AEED605C 0FB42D730961FFB9ACF1421E19B5C29CBF7C29A1EB0F6EB0FBDC1187E71C73B94A809A6547FE6487 7381E23546DE4DA9BD5D979AF4DDA1D5699605AB930DA83E0746D6834C27A1718D78A5BEF2E403EF EA4E90A67A106A875DAE357FFE21AA58D58261C4C6600DCDC5171E5B82E6DEA7C0E3C01D1901AFB1 1012E1E5D8BA599FE4FBB85B68F955BB7E83480FA36AE25E16B27DD74587D52524F6D0458D5280B4 AE17A546284007A22BB20A0641C1A6224D085C2D7474D69338310E3E22EF2B63FC94F80910809F91 2A97B65BC8EA993AFC983D301D2F220550E773F6C97C95FF084174C14993066C66230CE2C48FE650 CDDEE1FA22BBBF560E163AA0A39D1F20C10CF5FD0405D4DCF7A660DDC729B8F3381BD701949D6E99 CCDA5D383A8BC9373831F6E0FD52BDDB8DBFC6E7A6A9062653F783E09A0AC52933B4B2036D2A450F F48166C27D6764DCAD18A96E78E89EE22C3836E556C6FA4F6D531B20E9F08941AF7A2772ED230D92 8D4C59CFDFEC94167979073AE59A2B182D6835289016E1036F083982E067F085652F65999C36AFE9 B4332DC3829261D1945FD8388EF8385B44110FDB6C20851DDEAF8195931BF6A90E44B0F62E5BF765 F326C3F96696A2F77D421C603393D8F9F757750ABD2BB8816AE50B14E4FD9BC2F2260B525D99B8A7 D5720A05277E9638D9A494FFCE7E2006766D42DD0704AB10EDB41E14024BC4F2A04B3B91FEFF26B7 9CF9AB0DBF635A5D9530AC2A11B610C6EA42375BB93438D53F65FF616F7145C02CD7374B8D427E79 0E49F0F58753FA0456DD41C8EAC7090DB4A1AFE5BE585858C82BF9C00DD37B899E6345C29213D830 058FCE3A301D32A5805873E50D2BBAC796C33BF6C7AE77EC3F0F2C43C71A2D4ED192A55966337192 89A6802AD1BAD9CC15D271FC596190E43DC29FC9EAE751F21A84E34FE0C5937CEFB4128ABDDBFF01 8930725CC878EE7324B5E41FBA3ED393EB4A7287153FC2B15DB2DDD7A411677A024297ED55E55CD3 261252C70248AA4CB53A8451298CE56392E5A41FF0F3FEB0E25A1C3BCB5CCC85245686699C2DBC53 6D8F442E3C589164973982CCB4E89BAD4C2294EE59CF370745AE40A873569BF9F43289C2DD1CB3C9 D47DED3E9D3944FDFBC1C13CE667AEB796F35562C14CF07F44F2F5DE8C9959057A75EDF72CCCAA2D AFA21213F644DEC9C525796F3F95298E62F0B774CDA8F73A0CFE1BB99534C0C8C0BCD5A85752C60B 436187396E6FBF26C9330477807FFFB2132C19A91EF5D1CB4F9B9D50EAD014CC19C0392CB0FE9D04 3A371F1D8D09E750CE090491835081C7DAC4F12D10ED525F92B6E3619FADEF3778623417495F5F27 C2A9E2E1284409C2AE08D38CF6C7BBE00E6EFC08335DFCD90DC3D5F870BB4A2347200D6ADD0E3149 3A70179C431953FC0B8970603F56F2C38DAB3A2CCF4CE5A621575781845A63CC36F9D91EEEA9ED0D B087BD165DD1E5224DD85F3333524DC8D3D82EF44C0F3380BC67BD7D038DEAE10984BD8678332394 44808088BE1761769C965C47E033BC060B2BE0C3528CC1679AAAA19E76538874BC3B130203F2662C 0A787E4F732369CA1162655C93829287C1FA640E7B3925BCC0D1CA103A95C58CEFE08284F2DF4DA6 1A2DC64EE541FAFB34126922E288D10FAA87F769D96AEED45A253D131D7AEEEEB56CBFCC1C1B2248 5021C8D79C0E23F4EE1DDD3E317E71182A76CE6C50E8CA824C5B0213A0345D8F617BDB41EAD5031B 39DE491738BF4EA239D3EE3DDBDE766CEC71104E1051A71434AA42BF4F3F1CDC1E4807FEF24C6803 F145B362030CA288792CE1C50E0C2DFCA60EABBEE545EE5FB394A925F3F495AE75BC583CBE11D7FF 5815D85180A804E1E6331163C3E565A1F7832A3CE610CF311075BCF1C8A3649B1A8E2198C59309DF 430AF704FF4DE699B0C94DC026FC04AE12A3DD37ACA8D073CBE9A9B15B2537F5A1E43BF11143AA86 534265EDC6C4E89242ACD86BA80B1A068EE2AA750B67006A7168F6D359347B1D87C2832AE766D1D8 162133DD5C0877F2697F14FAD879952CA714CDAD6C82EB0873C4D35142C6EDE94C6B3B5A3EDBD767 2173A0F0690E9C80EC775ACEB93FD78BDAF899C462FF6167611C31B971C5ABC367F0A6CFE4E067B2 4AE98D50635A3D7A3758CD85324E37079F2F00EBE245CFAFAB15AFEF6A8D86CE908D58C4BE6841F2 CB72648386027F8B104D129222203F0F53E46949E23FC08EB31926614CB9AF8D66BF746A6986EE04 F98A5C710AEE885698876ED19F44C22EA1BC2F6C5D15AAC1C4AAA888F0B64B113140E87AF5108800 728884A637FB1CE3152DBEDC96341692BDEA1DC05E1D2C58F82FFD2B4EC40EC00D7545CEB92AFE3A 709B03B52526962FCF5EE3A44D1AF8C1E8FB8117A60AF084D4BB927838656640BECECB71826104FE D8353A0E62AEC9C106026B613345263FB4D98813C18958099F97E90CDE05902B1E7AEAFD19691AA0 3EB87AF58C35ADE06F242CE4B093B22D149B929062E53BE73F24691F01498A26A1EC950C97CBD235 2A838101B241F6C93EEDD4672D44AC531C597BD386AC51AA347708162ED8FA899DB36C8AF43E3616 A21D5B988ABDF9126971383DBF13C61BC201432BC4E1DD5A3639F13688FAC7B9A29BC822ECBC8539 D1E6D470BDB72F59B70EA0261EF396163AE6D4BE86B3B0D6C6A2DEE7054764780E06978236269C3F 4951CBCEBAFE828054DBB58A8CD4B6BD6375D42D62EFD6FADF79CF5311BA14B0C6AFFEBD88EDBF69 11266E55175AC2F9E0F11DAFE78DD179B535EBC0A07170A90CA2BDDE5065CE9B1D88B0D10AFA4D2E A86F64FE13ACAD5ED826AA24D5BAAA38BB89D543D36C63A9D672A007E8E5FB09B5BAD0FAC84D55C2 B35EBE6D59D6DE7F5CBDF11E37D0583A8CA82638C3AD6487B71974D2AB3FAC5507A24A0AF8954E80 B94D670CFCEE4509E5D7F044D50CF3622846E6A1EA015A6D60C81963EF81264DDF04886436545BF8 B3D1A0FFB3833FD9605748E7E692E4B00FDBF3FAD161090EBA660EEC4350395A434C91AD91849703 AC88F1CCD24D3B002261255DE7C8AED379D76D5E0F8B04E063802ABC7EF0FC42B7CED70401AFEFA1 6B4A24493F29988742DC34FE87C6BCCDDF0A6AC9FFF054CC02C69455E12826F83F140008E6CD3DDF D19DA70608A68ECC3954E822F635CCDD7A4AD49CA9CCE2006E4C2262B5CB9373F0DF40C0B6774458 D0A81EF007F6104EF0B1B5C01DF05B4680994A3DF6AF4C4860E8A930485DF4E8B1E92AB331873CBE F227FFDA634FB724CD562326276A61414D50278BDE96C2306C6BB9DF30F7FA40F42A1E1F2CA738C4 96E086DD4184BB40D8791D481D244DBDD7B7D256AF2D5C916C8740D4F31B39562159B7F27227C16B 4B5D1135F81B5CAC26AF72CA0C6FEFA6A3D12FAFEB5281AB36489CF5496A36921989DC96BEB78D07 955A9615C4BAE933C53FE28F805B1A236A0F31B30647321C4761E79A3E17452B76CFC381D5275E3D AA4F76429B162C40A56F2299CBD12D9F984349E3EA52763B91F1E8A5CBA6F0C8EC17087A6BF478BF 0C190F08EE5FD7B95563D8017DC397CBD92A8C16E24CB857533A41F872F458E80AA30046BD80EB94 2A326FCB12044D3F329ADFE10BBE099A810AA62ABF5F32DADD8D59802E1EC5F78F09FEEF1FD24BF7 1A1993E5FF412E7CA4931256A2C1BB7D287E6C6F82AAC85066415478975FE4D0DC51B97F8EB08009 01C4F76F2A66B9CEA01B5C827DF52815CFA127AE297FD61B458253D44ABBECE237F992B8AEBC3C41 C979C24875F9263F26EBF8DA5360E0E418528B235B942CDB6516C64F64FD682F623E6BC153648BE6 5FEAE45031FC039E702C224B0D2B8BFF81D93CEFED86851E9F61561B5C5490EDEAF702CA7CB077C4 FF8502B8D930CD9839C875AD0E9E844EBA2B182E9E221C57A9AAF664CF90B084222B93AE396B32E6 40676EAF51FB1A46B316A51482EF9214ADB64F62573597D02192106BD39B2CEA9B46DE7E366767AA 380941CE0D2FD356E7EC7B0F951D26AF82A95FE04F20F8580B3934662262A1EFF59A37F138A7D285 1EC56AB1D65587132B6DF8D035B7EBC89C2F8E56971B6398C914EF9C290B6D17A1A0AD0552B2C07C D35EF8A7BB32F61293A1AD94DF4E9FAE4A4890421B09FA2139454268862F5E8415A1F50804EAE9B2 1C43D1552C5F35CD788C36AC0CF554301210CB41C66C3FE8C6DDE14F15D932BA7D8CAF628FF16D5A E071816813412F57239C8A47D7510F4A97ABE9F2E4DB879B39E772DFDDC78E1BCA69456AC4F58E02 35EA4FF327762DE60AEC4EABD20948AB04464326FF6B4489125B3BAD0E270CFC0CFB031B2C6FE4BE 6B40946F10FDDF1FD7A459E309DD82DAA3BBCDFD79CB2AE1A86D1B5EEBF5D26F5CEEB8170CEC72EF AB6BB126B3BBF082054633649E80AF8C89FC7628B90C604D75D44C504CB6A818D860D3E7DC98C1BE 53F20DA4F8B643A35FDC1736D0303DA93AAC59E7A53BE50DFE35E2AA539519B8E277B2760261CC0F A7085EEEB0D8939F74CD13D7A407CE0EC44DF2FF49C4591E08BAF3B17BBCDA5EE5B165A5E60715D6 46507CDE02580CCC6524E5645BB9BD77ADEC03D8F7300FA8AB56B2B2BDBFED5CDC96513A536D3042 171F72026DB6C8A08C568A14B2AA632E139725BDACC3711947874B05FA92AB12E18EAF4824E43DDB A5588641F9DF78E82C2FD66FD6979473DD38D90889B660AEC6AF3F5049290C7EEF79C67D81D5B7EB 751A3B7555A7C2F53F2CA5C5CF0D5E9FF849325B37A09B2B1C541924B396DF746F14F8F8B2A4F119 90129B3C4164FA336B93475708408E7037E5120C39877480D430CA7CC780DAF88DA6BD16ED147E2C DB4B40234C67475E7600A6378D37FF68B21CCCA29E74C2C7E82706ECA869C15CF096A8B3C0291063 B7F2920F9005D30D26DB07B6F608BFA005ECC1C527805C82913B4C6873F57078CA99AC10DC67754E 02DBABCE1BF6179544F0443E5EACB8456CA05F0239919AB17D170AAFA0D54368D18DC500B67736C8 30D5DCC2A893C3549F6FEB68A3E4833723F09F060E0514785DC018E34343DD96D425A91369DFBF02 E06EEF379558B2B07667FA243BFA35C5AAC7D90B8EC36B7B06F82677C72BAB149E7C2C8F018BD298 C5E2E8C55A0DDD921728BB9ABE1E2BC953B87DD649611E92A0763E2B817B21A621B76C9112C0BE60 BAB250D85196A8E0BB4D092AD7E1FD44E1A0470F1C9CFBDFDD2D295E7A0DB78E7809756C7E8360C3 8681C3F1FD95628211EAF283E4693EB21F26FB646D2C31131724147A0BF5F05E28D64B6257BDD7DE CD59D046D0C8BA04BE0AA5CD518BEA445BD5301612C1701BCF429EAD79658552D9A1F49D6A06661A 90366AC5AA5620BED5D1529E4370EFE95663FFE645E85A307AF8F4269854EC4DE9FCD4215979B9C2 4B7E9E944CB34DA89A161F6E8CE82D1A8DEE15EE19E240FA15E3CC9DF8CB6F684BDCA9D0142383E7 3015A8DAD414DCE585D723DA1EB5F38F6CF7C6DAD13842BB57937AB4360802D7160787D29C32911F 0A6120B1C3BFD9447AEDAFE730735756B94A3B5F1679BD241E49BC709D8D8DF141ECB2C0EAA7F8FE 556D59CDAED7AB71F8F42006666AF10CA5DB52EFD18B0B477135BD18745C02C35F5878B5ECFD7366 F98BF63086BAC10D55968884026FA3EE60CCCD19211BDD95C4176497C5AFDF293C4B34CDF1A51FE3 2A7D6F3F5F5BBDF9E09A59C6D05AC3E481AE137010753A234275F2CD02F74304801813EA6A048E48 56CF55682DC008EFD7477FEB18A985A60ACBAE8F082C3C33C2188A8BF8E2D45479CE458A1748809B 4D5A81418DD0871AF587DAC64B4813C10A19394D64A1C017395A63952037D0384F37171609E62A26 D3A7BBA5189FCE0845FC8EC3D5434AB07BC7544534D17AC2E2E13FC8954E49ED246CA431DF905E39 23F9280236F32A772614D93FCA478979D7134EC260F90484747F5BA080F154A2D2024805962833D1 892F516043415777134308E7CA5AE64E6CA639EEEE5F0E5F70F8A66EF8D4EC58AFB823768630B77D B219B2C3D6D6DA91343C67D50D1D72411BDAA13BF8D9DF92FE6E19F8CB8A1A89CF178A3EF0D068FF 511945D319201C4A65255B0415B4348840CF041BB396E98D609A755F2F18A493A87A5AFCA57E0CA0 8AD74025E4EBD8937D885ADF43063EABD72B8FEE03ACFBC6E1C0FB58433F4520D7EFE7F7AF20BED3 C1CFD996F2600610A3C20978F082DFBF59C4723EBBFF2F02C44CDEE5E2248817F3C24B684B16EA4C 9387BEA4CB233BF246F3AF9E4B7B26CED8019068C537E0881A95D958BBD4C9FE3D2AD1A4BCF2ABE6 BF2603FFCEDAF0CEC84058B23D9205F8CEBBCC4EF46425BA54FCB4160F7EC804B29B76471D732D2A EA5E7AFB221295BFD0DE1181D45F705358759289B26AB3D5B9EEA41AE7B2BD7F8A7B28568A942111 A1491B5CC6C5925B61973842B6C2ACEC469E73B71C5B72AFB64220A2E7FD2F70368E8299CC02C539 C4AA1E88403075BB54182472C73B92A767D04D960EAB0F260DBC4259FA761D78C3445868ECFAA8DB F80BCADE838012A3AB4DA10378225825B6817E4F4FA84273275CEFB49C05A0B62BAD6B4309EE6B27 9DA899C56BCC960515EB1D3A89FB31D3568E16F0107238581966E974AFD221A57FAD203F923939CE DE5484CB06F8ECE62A568A343200BE46405508F99B83D956CC6247E7660704A3E8B83A0F45CD62C5 8F27142C75D1C5D5BBD91FC2C9AEDDF8F11D176BACEF5ADF0E92EE2E252B422F31967F725540B065 8E8A3B3DDAB60E8BEF464AB835C75369D73246FFAAC9036AF55E2F998527ADDFAA515A79D294175B 98195AA9793C24B366D52E67A78E42C237D89D16498817E13E70D1DA632BBF73D37E1C0D4635FF75 35BC3C3D399EBD4A5D9F3A6A94CEF80CCB1426CB2DE9DE6A5D57D592C2958107518DA560C24F471B A54044B544854F0A1A0BD36EAC7C52100E56B009DF839FB6941A6B9CA0B46C4819E522BE17B0E2DE A668D5ABDE9201C8DA1A4DF7CA106F6528DB8EB0E3C408D9D5A9E155A5F1839C68ECAAC66F70EE3A D161323175007AF18F8E6C8BF590A3908D4CC63C243A5BC37F543B956E5CFACB25CB22D930C8CB63 61F5394830B3179A335589189F24287D2BB8F7BB1509D70650975ED2094FAF8D56097E55AAEC75BA 10A746E4FC7D1E3BD15254A211D8F15B2468687FA4C5A3EFE2131DB442F7EE39A85A6F32B561E600 F92B7ED65E1EA1849C2455B269ED25F4E2C228F4778E28A97DC0AE1692A0E0EBE51514A91930C412 55AF974BE13E5A3F56F1C7AECE4A6988982D7E6E6819891A690EB1B5E21D10C45BF3F8FC423F27DC 981BD0EA3BCE47E0CDF2C27CDA9682B384D05D7E90BC0AD7C99A1FE319EF40EF57CD4C1D692931F4 2A28E1963DF8B6806AD7C0DB7B113038DF8CDE7CA8575A1ED6BD386518D8752F779100A67856E1E1 07ACCE20701FB7F6C15E0B4E904A874C55C930CC075B633E019636A2C21B55138456EE9257655210 7EC1B3F87E460A51969C9E070DB68B45DED206DC77395F380040602D9F56BDD868D8BB7D6D14B1F5 9B93B0341C71E079D6427FFED88C7A7D64AC58F2B1E9470508126616EC7848660CA8035C666DA2F2 4ACD1370C8D9F37A4A5C9FA275BA629C247FAF08E24D3C97BF97B13E1ABE97FFD0ECF6E866570ADD D6052C09E08C97069158ED94118ACE2FFC0668D8119D246055031F4D9877FD004C089E926A9ADB62 799ADB62110EC2C686BF839BB4E73F577E45EACCCF6D43CB7F3CD517DFD8BF79C8A01BDB80AB3A45 C8ECA6C2E7E16483598CCAFDA8949FB40E8DE107217B81648E39605EAF8D3413CEC220B79FEEFA9C 421B2376C80792A81E3D206C98A65D595C13DC5D8DC4BA3EC37CEC45AF7F77361F721421815F7FC1 F01859BA1AF2DE58CC354790D6A714AE877EEAA2F55703E2925683CF43CD6BC89075EF6E0E02E03B B530B8F447702086557FFC5F0BC2FADF7B7F629DCF44519E38461C68CB2E646F866B9582A7DD2BD4 2EBCA7605DDBE3BBA8BC551785840E2D29F45360970D898B654B059E7569F44A5F4429D48CFF9C3E 043DBE54401DE294D9F2096F1B54915F1C8B9EB07278668F4773F07AFC37C53F7C5BFA6FD3647B7F 84F4AEA84C807D71D7D2483664928002F243814A6019D4819FD5713A8B4CA8B25E913E026E124E46 C789BAEF22E7FF14E460A0E2C4008CBD16FBEE77668AD680FA6B7A9CA7AB6A866A85B0D58A70BEE9 9EB80AF90BD89F2A1362F5377EBFBEC5E0E0F5A5EA6D438FF2BF92D2E325D6C22D35E35D7D5B3F49 003CDCE2326AA29ADD396C07BCF5504E5CFC45F6955B0718CBBBB61FD65E286DFF51E3ABBF55FEE0 3F64BA3CC042815DC5736EE92069EC4B68BA573039DCAEE1B7071D94CFA37B46557B31373D3119D2 AA1F217EAA63AAECCAC7BC7DC35D248D4D132EA37B16D9B26CB39C56A40F7CB5B79B2C5FFA4BA835 2997016DAC76D5856FCD43358BFF87B3DDEBCBABECFE4D933AE160A66A8F6AB9DE99AE10C0456C26 9A90B94A793395E17F37C1E44CAF00B6BD77E37700D71225B59B6EF782588C7B787284606403BEA2 3FBF598550AB13679112CAF4F3607F124B886DB2769912009FE418F3C1FA1D206056760E0D706B4F DACAECA78DA0D96DBE5528F0ED5F182F7F2867B5DCE3E761338FF20166EB39B4EDA4896B6A6E15E6 899284FB8560E3E1F3D0B9D232E6191DF69912BDF76FD4EDDF45B94FCDE65C7757BD4F34E65787FF 2ABD5E6CCF69DF9E53249304784889C761FB7C1525D3C49BFB280E0E82CBB12AD54F2E1E5ED818ED F39C716A0121086802DFEE5A0691B761FFD7A69DDB4A47C92DCC2E6EC0A13CA7C2D6408C0213EE5F E65D6366B02E0C704B1037DF8713C12F73D7FEEEEEAE29768ADC885B6633B4B0831B336190FAC2D2 74FA8830A10A342454A303F930E866E81E16E6904C01C5BFA24EF86744E7CA5DFDA5D383A09C6E56 5F9E5A514F81DC014DAF2352F0CCC5C41453F6393BDFC8B8A622956A58BE5DB4BAAF58C52360D0C2 D1E03565027E891421E86EA88D0AD118606C410644CC9590777CCB12B032F557BE4AC371AFF95073 308B9882EED92D3070CC6C99120190CC9C9445306345DC0427D6136C41C838F8DC27993C54982823 FA823A128BFFE4ABA2508DAB994D3C13D27BF297F4996FDDDEF5444AE6BF9F198AB4C92B144512F5 ECD305F5BD8D614401BB5B853BAB2727268C05468D5ADFD9134A1F075DDC2EC941F03AEF6C42FA32 552B3C45315666F4166A67810C6D6F4877719AC597CFF0089589E06D03AB1753C09F10056206116F 1E5D096D4A937A76B903C54D790BB5ADB336C57229B9593C18E22A289CA61584AD36F59DDD7E6559 FD414CAFECCF8AC122B16AF42DE84B6E3865883CFE512A522A4E9538AC1AD02A0FB1F5F992EEB03C BFBF81CF46519AEDBA17D96E563C7C5250B337724D441F01DA5013DE53B21A49AD46370C77C68140 C05C04F150A614636CADC0320F3A4641D613B49F48DEBD9217EB713E81AA7EEC1A2D8275B55963EA 7E0CFD2E7E2648E18198872378FC5D3F8858D28356E2B14431B42C468A253B1BCC309CB8435F1DA0 88683AB1D67D58F03D910F4F615651709F4628749F47E1766822533E60C115C5F4C55BF2CB25502D 4731EEBEC5C8C892FD160662E5BF9D4D5A91A621D1669D067B60705624EE08A500ACC6DFB6E77731 418E3D68833C9C56FF9E355BA95149B9B9717FD9D0E147CDB1E5C5B43E40B07B91B382AE45D6B109 B42C6C8718AD14974CEF91D8EAD6035BAB01DFFDECE7F651E2163F9FC3859AD8995B853C38F6C53D A0D2AD98C47E226424C2F6AE9D24331E0DC8DCDEA1C79C96A9EA3E13C51F7EAB651E1085BC6A8173 ACBB5F23B784E6BB2D105D496EA9DCC7511E3836D375E3F763003BDB78838C22D8CC03BF63347341 FB694A45C826E7D5439FAAA91DBFF88991BA9DCC012283B1348B672D24710BCDA86D654F2CF7AD48 9EB94276E8005E9578091F5204EE8B40BA474EA6DD4D0AFF713A35EA9373394CADF97A3822B000D8 84CAC7B37C7A41359F8697B61D7CC6AA3188445922F3CE56777B75F58E83A568B7F9744AE8C68C86 2898B320644CA960CFAB9EFFC192D7230E14439CD5C906A49FB870E6F702690EBA4A50ADD3C23CBB ED0C5F00E27830CCDA19A73ACDD52360725E4DC832C7C1A3567355C6D5F631D0364F0A1D016514D5 5076F53EFCCE462CB5DD6AF3EB4941994E943F307FF14195DCE6245909E179EECA2D1C78990DF19D 15A459D78D79D4E2F0DD2AC8998F4E5DE9B6C5410396B4863A73F4199043A7DBEBC1224BA40DEBF6 5D6FDB002A3A06226CEF487D8BD8E868AEA0D586C7C3250676593519100516CB82DF17B2A742CF3B 4AB65123919BACF0D10AB6EA5D989598C27FB81515458ECD2C2B491D82545E05FF24136554A099D6 B6795C1C2071738263C123CBC722038C5CA632F54409EEC9A6AB890C8761EC16FFEB25366146B280 E225729B03FB37E0CC5F48D450E42B9A3D9B478F9FD6F7E71BAAE301DD52C6886D307965D298FF87 FC420B919F8B280C113047EE3C3C48DA328FC97ED7EE50D6176F987D72CA784B78A140D520292492 0B532AC6C8028A0A636EED447F291222A61319649E2837525858F5BCBB0B3163E5B944B8CCC71D39 E61C0CC7A062BB4A958C6A364C71A7492B6A081FDD00C7E33A6F523EB790460AA00EB4327EC0B848 D3CB915AB6B7BF9B5E43F6A024D5AACAED7F406F1F228F138E14CFB64F7D1827B07CDC75B89167EC EAAF2FBEE702705CD798FF98F1236ACB5A51517B36C1752314712FF6747904388A568E8734F68657 F5A3B0663694CA909638479F4E54E10F9E5753F5C2BD76CABBBF0227B8823061C7C9157DE40A306D CF8D552AF6535588F06907AB88FFE3BD28CDEE9E19CE8BFB8F2E61C3138F749D1FE40EBE5FF83D87 6C3848716D6E0F565321F74B00875E6D4EF8A74B6EF33B8D88C490A3C993102DBB5DC0CA1A0EFB01 8D1041F327614059AB127A0638995FD0A7E155C5F5BE19DA9ED70E34631553763B74D9CCFF9D2F3A 4B8FC9F41136A89757924B07944B290A7ACCB470707FBEAB4360D3CF52941D627C95B92E10EC34A2 8B74CFD955688A4EC01BFC1DF628398A9E780225D5D0BDDB7163B09606FC62B820D96337DA118D11 B0E23E57C962AF1DE3F081A4B3EB071D55927352550CD336A41D99B6F90F6EC65A98EBBB0291C60F B21E98E2F4395A3EA7FBB555FD61D06B7F23A3AB32B8A6F69A4E87DAE09B79B8EF1081D3E8060DE1 F54C036F1BFA6BE1C370157EC9C8730A3688992E63224BCEF19BC5374A6F7A065E8E3543D2437F23 2D525782DF03791C3F6A2BDEB5A6CB19CCFEEB17EE4D4DF1FBDB31FB0FBAC3FC5FA587815BF9AD2A 475539FE4791DBBFFB36E38917C7ECFFAEE7360067B29648E98A19B7CE9A6548BC280215D2482C1C 172F85AB91B401B811E6A2DD9FB476BCEF97C6596FDE01A6E4D7AE807535B85A37EDBAF4C7C8C59D 0B706B3DF848E2F0D35FFD2F52502C07A5EEE42F716A48DE81ABCA7C961997FA7F284E011060D718 B70650052DD1A88F747E40C353407330D884E482B84BF2397D574CCE7D66108725AE587BD2ADB9CD 6583B4C7342526F49E1F6F712B2B553E76E16AE151E253DCDFD31A294AD4CA60BC02710D664DC485 33DAECB4EBAE509573BE0470C5A33E70930AB8CC35EDDBACD09A899242CA87FC8EF7A78365D8D672 D96A3BE5DDA65DB374809DE51D3B2C98D090E54EB030925CCBCFCE31957EA0728B8EEEBCBBA06A4A DC961E79EC99001DBCA4F2402F261AB31BB0CDAFCCBFB17AE4BAAA98E73912201FD6028B535D901C 21BA3346AF0EF507B7A07AFEE4435468869133E51F8212D5257E6CD10F55A99AE1DBB00C7253AF13 C2AD3CF463CC53D42C3B6AAEA0D05DBBF54ED219C64F6B97D7A11E3F2FDDD49601AF0A6A50BE085A 1EE2650B01709ECB19A277877D0B60448439F17672920FE2C0F74ED330F442DC3E0E63896A0D472F A7A6572B421A4E8F5AC547C2A103EEF9F8EE1399D444D95025D9B656065D70406539532FFAA35018 31F3E2E95FDF9DDB5BD5AF26056EDE1DA349AB29B83BA49951B2D337657A6BE4EC597F7E765853E6 7276A310C0B36D3A1797DCF484B0896A683B04C3A143BA24500CEAD3D195232E1BE0070F19B2E117 E4FEC099CD707B2ABCEA0DDE109C7D7A5BAB7C6E6019FDDF28EF40C644781ACE30AB7915C4458FCE 97823B8F5FB8BD76C71B13A635F422B9BADBDB54F94A84323E559D27FAD999AAB64394B6418DD10D 74AB93F58F48EA83E25EEDAA8A80ECB104DB10AC6342A50BB8C8050660E7EC698133E5CDFC3439EF 4A22DDF93950DD09077E1D7C30867813C78A9ED3E42F35136415EC9EF0301AD9DC91AC514277ABE8 8FC0ACDF46CB9A76EDD1F4D180B64EB11500A2E717694362E9CE2E7579D27905197D6C3BAC24CCFA 7AA7BB3BB3446F0C645E6DB42FEEBCBF6775FB1AC49123804D943E49B21F59CC28882F638FF0D12F DD3C02C15D6D44AF68DD00F23E52E68441FBC76FC8C1E586769C15F20860AD25B9A7AC9D77FC1FA1 CABB379ED8DD9625026A6D38BDE8EBCA060E899BB5FE0F3A38A8EF456B2122E8DCF8B4198E84BE1C A8EB8FA4779DCFD674F35165D238159C6FA89387EB5838BA3D6719683B913862B9A7E65E905703F5 2F4ECCD89560B47068C8641A2115AD4F46E6137451817BEA9C43F7D6EB274AF4E5949914AAD107CD B9B2408FB1428E4BB19CA912E59425F56A53A423B18B181D17681E5956144A897AB2E8C55A54AAF5 27F581E3167373093645B401DA7BD85A91F2B4AC3CAEBF5F33CBE4B6157C86C1257B8F23A5E94527 3715083C5EECB71F2053EFEA9EFA6B2D9B6B2F5DBD7CFD0A35CC353AF80E6490664F08326696A4AD CF6168FF43E1D364654DD6E2839A58A46E12099322D20EBB6C6835BFB19845F6F9C368721480EB8E B0D5636F72C40BCB26BEFA00B34251152CF1A1D211FA26D9C152E6B5BB2DD0232C729F35EE893F9B CFBEF6016641E307E6F9831851DC493CCEE1E20856DCC465E38A44F711E24769B30CF11FFF2A5F64 E18373DDFD3D34C171452F76A0A30450CAC64840E3C4B0D03040515BBD0B4D83AF96FDF545797692 B723FEEB52F6C252D99CC1EB2EF383C9897C200C0C78BA892F28A5704D699162D5DD27BD67CBB448 4468F24A9B1CCEA852CE77CB548561A3CFB786089DAA2FE40C5A555A41FA4B0E5F7456CA14492459 17D034F91B7B00F0BCD4A0B3B8D6833D121D09CF1073E86E6864FB9E02B4D2FE03CCD73E69E49983 918B157D6671244892F061BAF33F8133B79482A6B38B2F46710A2854D5AF4033209A74B769462DB9 A8219F3487974CFFEEEEF6E2EBE5E28DDCA95726B86B51907D88911EFF791B749E911876468C7EE5 42DBD6CA6ABFC7C9D3BB9C95D45E9E699213806DF288734EEBE2132E6DD7D44B609B817F92408936 0C8AB9F96F18FF84FE535275954DB1498D0F6696F3423951A94C3F3B1CB868CEB04A1A13AE5C3BC4 26E1D785690EB608154577E29E9406B340F724C7AEB2C160F59A31DA4357E84D4B8EC6BBD5D250AF 6A5CED53E1AF0181DDFD9E59BA8E13C7BCD72B79AE19EC9252E654EF5344DBFD4531E7BB25CD5A63 7D4E10B91685D07FECB32E261F8ACE07BE21C8927FFEA389C2CF26FA3F804595C6BFFB6FAA458630 EFBABA7EBFAC409E3EE2D25114D664CDF41B1E42133EF71F9A3B035BFA3258E6AEC7D688CACD589A 55720E797F0FC5838C3DAFEE62154B2FEFCA3B657835FB8C78C40F8BE5CD3C53493D8A5FA41DDA3E 38F89A8AA230B09963FA69AA727E36046CF3B76D4AAFC79E6EDD9F076F28607F78D54602CE15FAD2 88E73030DBE456CD4C4FB8725623A69CC4AF6AD3256643DB1EC1CE60E36F6D958DD61B8FB85ED28F FC2830026061417302A5D820F1DB135BCE65FCFB1BACE4E976404892506D8CC572889805F316B02E 2C05BA5159258F5731FC0463BFFC1EA5B3890FD5007F7DAB7EEF38A6A8779DDE8510719C43AD03C9 EF363D8DFEEB91AF6624D10E0502C513CF709E99F6EA8D35EB1B7D8DBBCC2FC1C5F3515D2765EA1A C5FF6E8CD6EACE00D8E4590CBB71F544A03860BA5A8E9C5095A13862AB7208F5FF49AE30D8477F73 3931E531BD1FA4A3935E0B8CE19547F6941F8606C422870C4A894C4E9B763C89485E2BFE9D1EBCBE 2FAA8E3218630C72899FAAB0B2BAAD5AB78E9A2013EE8C35E43484EEF5BF2BEC2B0DA7C9FA382A04 2B459D01CBB39DF72B67A1E5B55B8E49B9602018EF7E09A447F3D0D649DCBED79231464CAAFBA8B4 0ECB98AA8BF4ED80B4148A5AF665EE869552F63F03F32F16DD38EB2F3B7A2E456DF210328BA231AA CEC48A86A613C0EF68DA1107CE5955B0A17632A2605C74FAF91DC67AFFBB1B8F5BF901839692CA6F 284C2955D456DD2FEB8117E68FDAC0C2A322B2A6AE65DD2C9E7AEB478DDCA6901BCFA8A22D17B020 8333C12E481E92DE1AE92EE09135E4EF6565F0C404D0608EA9944E9EE34D9F5A94F80CA91C527604 21AA7DF75CF739DEF662F371F8E344FE2ECDAEC679320DF617F74A73D96BA06A69C089B794B476A7 FB4EAF39AF6E96DF55CABA4849BD6C6830BB134217C0380C37EBF1CE9709D0642DBFDA77660D663F C8E4123E8049A81F828A24829E0FD6D02CCD73888673D788BA13325DCC233ADDC29B857DD988B00A A5D7D9D856A4CD6FD0EBF0691DF740DD8E74765C86C8A7C62A5A591E3F82FD590064609847AA4D7C 315DB74895C884D929BEB24E7A2A0690C33115ABBCEE2091C030649018B4D3263D687459D7F2A641 6BDC3F976B29F8F2325B94E85974AA32ECD5ECA2C8E3C3578CE7C9 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark{restore}if %%EndFont %%EndResource %%BeginResource: font Math2 %%BeginFont: Math2 %!PS-AdobeFont-1.0: Math2 001.200 %%CreationDate: 1/15/98 at 5:42 PM %%VMusage: 1024 29030 % Mathematica typeface design by Andre Kuzniarek. Copyright \(c\) 1996-98 Wolfram Research, Inc. [http://www.wolfram.com]. All rights reserved. [Font version 1.20] % ADL: 800 200 0 %%EndComments FontDirectory/Math2 known{/Math2 findfont dup/UniqueID known{dup /UniqueID get 5095643 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 20 dict begin /FontInfo 16 dict dup begin /version (001.200) readonly def /FullName (Math2) readonly def /FamilyName (Math2) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -133 def /UnderlineThickness 20 def /Notice (Mathematica typeface design by Andre Kuzniarek. Copyright \(c\) 1996-98 Wolfram Research, Inc. [http://www.wolfram.com]. All rights reserved. [Font version 1.20]) readonly def /em 1000 def /ascent 800 def /descent 200 def end readonly def /FontName /Math2 def /Encoding 256 array dup 0/NUL put dup 1/Eth put dup 2/eth put dup 3/Lslash put dup 4/lslash put dup 5/Scaron put dup 6/scaron put dup 7/Yacute put dup 8/yacute put dup 9/HT put dup 10/LF put dup 11/Thorn put dup 12/thorn put dup 13/CR put dup 14/Zcaron put dup 15/zcaron put dup 16/DLE put dup 17/DC1 put dup 18/DC2 put dup 19/DC3 put dup 20/DC4 put dup 21/onehalf put dup 22/onequarter put dup 23/onesuperior put dup 24/threequarters put dup 25/threesuperior put dup 26/twosuperior put dup 27/brokenbar put dup 28/minus put dup 29/multiply put dup 30/RS put dup 31/US put dup 32/Space put dup 33/Radical1Extens put dup 34/Radical2 put dup 35/Radical2Extens put dup 36/Radical3 put dup 37/Radical3Extens put dup 38/Radical4 put dup 39/Radical4Extens put dup 40/Radical5 put dup 41/Radical5VertExtens put dup 42/Radical5Top put dup 43/Radical5Extens put dup 44/FixedFreeRadical1 put dup 45/FixedFreeRadical2 put dup 46/FixedFreeRadical3 put dup 47/FixedFreeRadical4 put dup 48/TexRad1 put dup 49/TexRad2 put dup 50/TexRad3 put dup 51/TexRad4 put dup 52/TexRad5 put dup 53/TexRad5VertExt put dup 54/TexRad5Top put dup 55/TexRadExtens put dup 56/LBrace1 put dup 57/LBrace2 put dup 58/LBrace3 put dup 59/LBrace4 put dup 60/RBrace1 put dup 61/RBrace2 put dup 62/RBrace3 put dup 63/RBrace4 put dup 64/LBracket1 put dup 65/LBracket2 put dup 66/LBracket3 put dup 67/LBracket4 put dup 68/RBracket1 put dup 69/RBracket2 put dup 70/RBracket3 put dup 71/RBracket4 put dup 72/LParen1 put dup 73/LParen2 put dup 74/LParen3 put dup 75/LParen4 put dup 76/RParen1 put dup 77/RParen2 put dup 78/RParen3 put dup 79/RParen4 put dup 80/DblLBracket1 put dup 81/DblLBracket2 put dup 82/DblLBracket3 put dup 83/DblLBracket4 put dup 84/DblRBracket1 put dup 85/DblRBracket2 put dup 86/DblRBracket3 put dup 87/DblRBracket4 put dup 88/LAngleBracket1 put dup 89/LAngleBracket2 put dup 90/LAngleBracket3 put dup 91/LAngleBracket4 put dup 92/RAngleBracket1 put dup 93/RAngleBracket2 put dup 94/RAngleBracket3 put dup 95/RAngleBracket4 put dup 96/LCeiling1 put dup 97/LCeiling2 put dup 98/LCeiling3 put dup 99/LCeiling4 put dup 100/LFloor1 put dup 101/LFloor2 put dup 102/LFloor3 put dup 103/LFloor4 put dup 104/LFlrClngExtens put dup 105/LParenTop put dup 106/LParenExtens put dup 107/LParenBottom put dup 108/LBraceTop put dup 109/LBraceMiddle put dup 110/LBraceBottom put dup 111/BraceExtens put dup 112/RCeiling1 put dup 113/RCeiling2 put dup 114/RCeiling3 put dup 115/RCeiling4 put dup 116/RFloor1 put dup 117/RFloor2 put dup 118/RFloor3 put dup 119/RFloor4 put dup 120/RFlrClngExtens put dup 121/RParenTop put dup 122/RParenExtens put dup 123/RParenBottom put dup 124/RBraceTop put dup 125/RBraceMiddle put dup 126/RBraceBottom put dup 127/DEL put dup 128/LBracketTop put dup 129/LBracketExtens put dup 130/LBracketBottom put dup 131/RBracketTop put dup 132/RBracketExtens put dup 133/RBracketBottom put dup 134/DblLBracketBottom put dup 135/DblLBracketExtens put dup 136/DblLBracketTop put dup 137/DblRBracketBottom put dup 138/DblRBracketExtens put dup 139/DblRBracketTop put dup 140/LeftHook put dup 141/HookExt put dup 142/RightHook put dup 143/Radical1 put dup 144/Slash1 put dup 145/Slash2 put dup 146/Slash3 put dup 147/Slash4 put dup 148/BackSlash1 put dup 149/BackSlash2 put dup 150/BackSlash3 put dup 151/BackSlash4 put dup 152/ContourIntegral put dup 153/DblContInteg put dup 154/CntrClckwContInteg put dup 155/ClckwContInteg put dup 156/SquareContInteg put dup 157/UnionPlus put dup 158/SquareIntersection put dup 159/SquareUnion put dup 160/LBracketBar1 put dup 161/LBracketBar2 put dup 162/LBracketBar3 put dup 163/LBracketBar4 put dup 164/RBracketBar1 put dup 165/RBracketBar2 put dup 166/RBracketBar3 put dup 167/RBracketBar4 put dup 168/ContourIntegral2 put dup 169/DblContInteg2 put dup 170/CntrClckwContInteg2 put dup 171/ClckwContInteg2 put dup 172/SquareContInteg2 put dup 173/UnionPlus2 put dup 174/SquareIntersection2 put dup 175/SquareUnion2 put dup 176/DblLBracketBar1 put dup 177/DblLBracketBar2 put dup 178/DblLBracketBar3 put dup 179/DblLBracketBar4 put dup 180/DblRBracketBar1 put dup 181/DblRBracketBar2 put dup 182/DblRBracketBar3 put dup 183/DblRBracketBar4 put dup 184/ContourIntegral3 put dup 185/DblContInteg3 put dup 186/CntrClckwContInteg3 put dup 187/ClckwContInteg3 put dup 188/SquareContInteg3 put dup 189/UnionPlus3 put dup 190/SquareIntersection3 put dup 191/SquareUnion3 put dup 192/DblBar1 put dup 193/DblBar2 put dup 194/DblBar3 put dup 195/DblBar4 put dup 196/BarExt put dup 197/DblBarExt put dup 198/OverCircle put dup 199/Hacek put dup 200/VertBar1 put dup 201/VertBar2 put dup 202/Nbspace put dup 203/VertBar3 put dup 204/VertBar4 put dup 205/FIntegral put dup 206/FIntegral2 put dup 207/FIntegral3 put dup 208/OverDoubleDot put dup 209/OverTripleDot put dup 210/OverLVector put dup 211/OverRVector put dup 212/OverLRVector put dup 213/OverLArrow put dup 214/OverArrowVectExt put dup 215/OverRArrow put dup 216/OverLRArrow put dup 217/Integral put dup 218/Summation put dup 219/Product put dup 220/Intersection put dup 221/Union put dup 222/LogicalOr put dup 223/LogicalAnd put dup 224/Integral1 put dup 225/Integral2 put dup 226/Sum1 put dup 227/Sum2 put dup 228/Product1 put dup 229/Product2 put dup 230/Union1 put dup 231/Union2 put dup 232/Intersect1 put dup 233/Intersect2 put dup 234/Or1 put dup 235/Or2 put dup 236/And1 put dup 237/And2 put dup 238/SmallVee put dup 239/SmallWedge put dup 240/DoubleGrave put dup 241/Breve put dup 242/DownBreve put dup 243/OverTilde put dup 244/Tilde2 put dup 245/Tilde3 put dup 246/Tilde4 put dup 247/BackQuote put dup 248/DblBackQuote put dup 249/Quote put dup 250/DblQuote put dup 251/VertBar put dup 252/DblVertBar put dup 253/VertBarExten put dup 254/DblVertBarExten put dup 255/Coproduct put readonly def /PaintType 0 def /FontType 1 def /StrokeWidth 0 def /FontMatrix[0.001 0 0 0.001 0 0]readonly def /UniqueID 5095643 def /FontBBox{-13 -4075 2499 2436}readonly def currentdict end currentfile eexec D8061D93A8246509E76A3EC656E953B7C22E43117F5A3BC2421790057C314DAE3EFBFF49F45DD7CF 0D7279BE264237679F24E8FBCFCB8A2DBC1773E5E76EF1B7C89088DB5961384530246FF7BFADCA2F F59AA58D3FFF3D21E7E8A53047B7339488AD0E149D6FB36A0D75F5393B3109E76A2C628A073F1B1B E8026FDFB94EB5FF3B4FC20C543D55E1941801FC8CAE5FD9F38DCBFA718151848F7A245C1F1C9F7E AAE5037C8A77160626976B64338A2C4A2DFA1E7271865F6DE5818BC8C0621B9A6176AEF2757B82AB E86E21A4C4A7E7E228BA23458585A46C463755C12676094FB9BA634A068C54FECD048EF67C9CDB0B 81484DDA4B8631511A47888033D5D54B79963A5FE22B821F032F205A19B94D16BC49D1FDFA03B444 4DC6410D3D031A62DF5D5BE3153DC7964B51D4213E597E7464E5D26788A371200266FA6AE6AE6DAF BF6A044DE1506FCA54E0789539DD05CEAB5EC68C02BB8E66373DCA999B18A5078C1273C91A6A3AD6 545E233F5DF933CCD09046E504811F2CB585CCEC161956EDEEC9700BF37E208A1D44AA626C101218 8D87226074533E4DAE2731E0F02B0A8E6D838E2C0F3E617D241438BA8375C7C43FD252F9FCC11E92 1BAAE918597265F5BB35CFF02FB8A3F7CF78ABA114E1BAA3AF036779C7437B3CF11A13D067684723 7BD37B3D44D1A03AE9C97FAB5876C57A3C20A96312F6B362A405D3AF7F25A1FBCC7D35E5893BA4B2 8E27C54A4AA0D8A6A185C1D6A3731F45260861338074409B215EF1AF2F1DBF362C9C3A0E6B7945D7 F2622CCF4F7DC297EE2BAD3B8F70635AD93BFD1AC7E43F77F5F57347A53B8BDA042E5BC4ED9677F2 C2B42A91779B5C3CD95A96EEB53ACEA43863C3123F8285D67B5C30120EEEDEB064B436E2DA86DFC5 B6F79F4816B1283170264659B73DFB35EDB28BBCEF5FD3F0EECFF398891CB2FE929066294E760202 8EA4C7BE84BD343E4B5DAA019952D00D759B9E404FB09DFF7A6F7E4C1B290C4AEC04D15BB87CCFE9 DB7BA730491F48E8B7424247FFF54C716F27D2796DA18AE294E5EF842FA9A0AE28A1EB25E43525FB 1E16C07E28CC359DF61F426B7D41EA4FBCD844D197D89BE482781F0660A9BD6A289CC9216E527ADE 571D31B97ADEDEF63925E287FDB79AA57B4B09275D3619B06C872C065B1C912AA8BF58CDAB479486 745A302F6426CC72060175B77EE9814175AC6BE0B2A69255AEA9FFB2DF8F5ABD86CB0F8CDC1E3601 4C5E4B552ED455A7E851ABB49F9BED16F01618420EBF5E7AC4FBE100278FA791A4B8E19AF458A9D0 B5764CAB101FEA21758186064B054C0E276D9B038B151CE7DC56C85E9C77F82765AC0F5E3086DD9F 4FA1AFBE75B73654308213597AC288A1FBCF8AC169EE5445860121C4BF9C536407B798DC0D4302F8 BDC410346D7B737FA7A3F021F3675257AC32605F7A1504E37E745F1479A31C41898847C50FD3BBD1 33772C7E683E51BC4D0556B335847D92DEBA757BEB45CB70E9ECF0A8AE384ABCD459D9E622466C83 BEDF22F6F7A3782EABE98111D318CE870EBCC71AA9DAE678029CC028DB4F843A77D28247DE6ED9B9 566C0A08B92C88B164B449E106F04530708DD345BA50ABD469779FEA8BB3837EA40B702235D78104 3CED8B0D7D809CEA366D2CE36C8075C8B4A9C1BD503601BD881AD5FA3CF92EABEB224A12624530F2 BE60F5EFFD455E741036F3659E6DFE08F2186F700BE90B21809EF065A9ED10BAABE02691DC132314 B543230894E1A2BE6D19F774B87B0ADC5A2AF6E679B580A1C4115C66ADE8B052FA671F8C6EB4CF7F 37B1C025F8ED5BE267C06E4710B0A3B92C547AD258AD1BCAB46B9FE00ED8E93186364DA57FB38472 BD1C43BA670C9FE8693A55B55B53E1B9BC2677A240CFF7AF2A1419FCA21C2BA0E91A28622E4A16B0 F538FEDCA86D03E4CE9A7AD206951449C9BB017EAF0666606FA10D5A73466BB60A3ABB3A89EF0230 9F278195034CCFA452A7C80293A7DF1542F4A6D851D762403E5FE2EE7A48CC7FF2A513DDC93A3272 99A7FAD7E6A2773117419C593801BDBFD8485708BFD41D48162F0550BDDCBFE8B01C6A3F3CDD80DF 52D5E6D548CC02ABFCD20A15D54F0889A875620924A542BA1ACB9CC7290F0B1D0A9939A1BAF7A621 4A7B17865CD91DD84FADBE9B59B952B782FC83E73B75F87515958B0A78533835F0DB3DB5D4A9E47A 352A0AFC906EF04477E45868928B176252F0BDDA7712D1AF3ADBDA2CCFAC11305DD013635C943C22 A9AC41630A8C1934BD6E31114928F5D95A135AD83B2E95185C9863EA619527FAA43EDE3941219CDA A6D39FA8E3160C44C9719DDF95D2A34B25A3A19B5FDDCF2B6224E44991B6EF38C81510BA8E9E21D0 4A605CAAD97F63AB1AF8FFF15D70CE08A78191DDF65DFC70CD3B05D68BFC0FC3F3FB7756533BF4DD C05B1EE34D44288408F19A3303C4D388C3BFDA71A67D9BCF96731CB9914210BCF3E15263D4608558 92E6C227F0A3BEEC6BE4E776ADAE3DE4159A62BDA6E06D6483E3E2783AAE79F05131ED652E41D9A9 C1CA2630E88A2197BB040B80B1792E23353AFAA46CD4EF14694C7615B4C4BEC0A9AAC3AF12CA90E3 E5A826E14FC93E69AE0C28332849B5F8F83C11C31EBF0AABEDA9BE7FE121D57AA101DFA274A32F5E D5AAABAA6369C7A00BF255C309357939A8333DA432979646DB43017B812A8ACEC4A55E5BA4C73A72 C9F6F23ED67D9EF38B3D115BDC6DAFA960DA3BDF225DFB66D0F948A0C97CEE96B1EF1241896D8C4C E6E580CDF8E8B495132B559BEADBB8CB35C3BFE174F6EBBA08252A01C27F7FC3E1D764605BA581E8 B4982FE7F3266855EDA1A9F3019E8E6DD5A662B0CB6D4CA5CD77E5E5DBDF27CFDA1369A8D64579A5 BE07F6B05A0195443CCE8A3159328F2D30719BFEB585881D1EC5325FD9FD8606430E1CA77574D3D7 7C2863D8942596798C6E8AA0E6A0BCACD9B90098AC648E5A132ECBCC546FDD9EB1DC5CE6C4B9430C DE021C82AA541654B93841AD6CDB43F05FA89ABFF54408F6B931C2BDC8435306CE9695A77008044D FB3DF3FD219E6E34215830FB2A65EC759E3AE9B3C6739F6A27188F92A194F8E0971F6D32D4F51C48 72BCD5F63457897EB1BE6B0DBE757C736355175218EBBFEB6F1C24BA3166701360B7489126C5E9AF 9E61DAF26FB9386F6978E6B23AC7EE49E2A93732CD4B8EF7D6CC1CC89E9D2FDC9CB31DAD6DAD8204 DC1C1AB47FE1F3953DFBB49B22DA7F6B63DCAEC87EE48791C466F2549BE951DF933202ADC0BA73EF AC9DEE4201F01BA6D719692103D9E14EF9098A8EE56717624B4C1ACB68E9F2BE0D01AFE7A7EF1ED4 A5167FEDB48BD9B6C3DE1D5E272BD7B849D09F039C3AAC6FCD273FE63BFBBD3CC318DA14B60CE3B5 E47BFD09040518B649965271DE9D73BDBEA67DC8F3C49CB8B71C20C433BCCFD94D75C53B5F111DDB 3390A527DA60AE74C08984D3C7E8D743A74AB756DD3C57E317F20AC8DC896A3AA27E99EC31E841C1 C4BAECAEFF12E62790E54A5D835D4899A37B119707CCB25E91428CE4567210C6A92B91093771E506 0307D853203D66BE810660B9C78D821A3E073FEB4BCCFD682644453F6CADC95AB3EEF5819CE8F87A 85A6F4FD4104F1ADBD125CF7B43E842A066ED75EBC0CBC69F2CCA2B9E7277B8882BA77778CCC654C 041F3024DBE0FDDFA8C3D3417242395C7AF2319957A07D9465C4ABA847CB3F9B0AB61AEABBA5D0EA D621EBEEF9062D282301720FD38E8958EC9F60482AD4B61300391A9E0662CCC01C620791768D4BD7 1DFD740F108321E78FE3379C5D110427CC6BDFFB30B15A98E888A9DEAC87F1145AD951AB5A9D12BF 4F4E8524C54DD271A3EAEA96B0914E498F05C1F1CE9E8798E0FCF20A4386DFB009B0CBEF3E6207F2 C9605C5EF1A8042252E71172231B4557418BF5FF678EACDC05357889053CE334FD262C1FD3C66070 0439242334D4AB33D9D67E2C76F8378543FFD89DC4847E83A3AC633202D13858A9BD31443FFD3870 989464A9653FCFC14C473C492298247FB6C51DC7D3456A37D3E7BFEA8046311D9F33E2BE3EC00BB7 72D51626E53799834F24D0276FF2A5C633EBD1DAFCCEF6E965C622B65B393B830AD24B755A6628F6 4D2EA83F70BFE9EE5CE41A41B4E9DC949B71146CABA26F735823E490DECE07197CED8813B57DADEC 20F500FAD2C6841095830AD14C9297389BB145D24D8337BABF1E5C0A237DBA9B6E73F98E99531A7F 142B2ECCF7AC527F48E9BABE7EF9C8A1AB4D5EE53481A115C104DEFCB8A7D6312011F19ED1F3B4EE ED4259A8E441D949B0C4D958DEBC3A20BBCC7BDC71E07F10A9CE2DBFCD2C13E3407D72F0F8100B69 5A3F731AB8969524DD756EF3D11EB2DAD9822D7F843A374EFEC51E7FD284EC1FA2E8245394A62960 61F227C9052CA30955974C5C635193D0BE4498C3D3DB974EB2D1D1F7D9D13FAF8CE8953EC309EED1 9E319A1AA585ADD480C4F1A4DC3084B3C790643746255D95CC9EEA2A4E241B91085A9148723FD1DF 9403CCF422260A9FC405E04ED94800D2ACB73DA610B5CAFA7EB75D260809DB4C3F3E88B02BC9FA27 71DDC45E09EB804BAC03780D60BD826B7C446EDC01138ADD81249789CD7B5E7C4B94C7170C1BE1C9 B314A6666BC546DA806AA78F051532ABD26CD2624BC64B2EB98F79097563C75C035E38918C1A32DA C99C9EB8A26BB8782D98BEDEBC453179960D2E5A99FFD9313DF904B4CC97822D5BD76176014E78F2 54F4BB06B0FA89412DB8ED7703A357355EB3987A8029D7BB18917816665D15E88BADD46F8522F03C 2A5ACB6E7F6FE1B768507D773302EC3AF030A239E230D8BE5B2CEDA107856D4A9891625B72234974 2B5834EF1B199B65E4B3E4C43B957CBDB3FA55E2AA155997EE4647E4660844A3EC150F69DED62E6C 640A3D0293E8B40E1E0B0CD4D0B7D57F01AC04487B9C9279EFF22D72CF87B3ADCA1B9E831FB4F609 69620510FE32FC57B691287819F3A78A1331E386DEA49835AE10D25B886AC1FEA3B05B1C4D54A6A7 E079677F4C620BDF5DA5A1313A77B6EE1167816CF40A3A71191C30C24B37AC621B556BCA4D9C38E7 810520B18573C4FEEAFEB7CA45110E5CF977BD03C8FA16BC6DA805CA38297E7D4CBD3C77A1A46C4C C497B879B3AFF6E713FF77AD426226617A6CCAA91589BED1D31A443C2B5FE3E1CA8ADFF189BF5B81 1AA4F189E14A62614924480F2217F0A08B5CD6F971E1E50ECCB37A8F4FBEA8F5C288E1D86016FD02 03EEB79C8C630A0BCD45363688334A467D8363F5F8FAAA22D8E2671D34C3E2C76946685351EBEAC6 3B62F22B7C5F3703FAE18CE2CE02B6647F7FA4B3D8DB76AB3F6FA470C0EB16593374F4BAE62F8208 61F6C81C8B64CF39B32DA33647A0D73B9ABE92FD9A5F0C3C67FCFB4C39F1F036A40257B9DC2D4B44 72CBD5DE6ADC8FEAE4594D40A091ADB52251361613B41597DEF75411EEB43B59DA9A16523CF77CEF 50111A68DB0B40D013D895C5E1EC333223940BD73664ACEC136588FF7A211A860F0D83FACD117AE2 E7C72B32D42F451399BFE8D862A65CA090B14D4520462A1E2833A02756BF327517024845DA1DCC0A F8EEE52EAFFA4AAE7C2DACF47C54083C9654D175D5C00293D140A06B3E0A42FDC9F91E0895A0FA62 40A73B90C3D8CB8762EBD1839588534CAB832AAC5BEB67CD73F166DB1A88D8793A76BE643CFFE92A C35FED1CFF736E7E0F548323FC96EAB5CEF9DFDC9DEEF9CFEDB4BC9F7C70970C17496C49BCE0FBBF 7C95502AEDCE8C7347BF62ECB40352AF12FEDD0A29B79CA80A4E7855987D313C893C980310F8640D 4DD41E29DF4E49B88B10163F814F1FDFFA906882568A8C771A8F0C035F7BBB731521E1644C8DADC1 CEB0F947E22EA6D8BB4043645DDB89988EE085BE0A33BE6CBDF38C28BC558BDB0F0EFFB0D73EA671 477EFB6D0D7EAD99E80DFE129683665D6BA5F6F2484F4BE870DE53FADF7261710136ED27904923D0 7A60BCD5B52074BCDB439A697575BF5E2EE3DEBE8C4E540EA37B742CF465AB30C391D3A54F115A7D 85909676A68CC833BB90E3BE793E5C19F89DB290F519D20DB7A252D0A82D6081D32F5291B98E7F3C 007BCEF8D24B2EB525CB90F05D37D7C3ADC739DBC44FE1C3B9B80172191F5DB98D8E62AF29156283 C80E24EF07F36E323B53F57605F55437378B7F26BBA3661D0B33524C63CA76C2EA73C8DE1E7A3BA8 D69A3BD14278BCB89F6F6C4F6E57AD41310862234107ACDC43D8499579C36F79F778256D3AE6D1D4 72B0E3AD305E25ABCC9747D4BA49CB8F6B79A76B3063317355AF6963CE65911FCC16ED905071ADDF 9AEACF56BE9BDD3A9CB3FEA600CD49E912860C620E878F024A8EAFF3E1C71705A9B2A6C86CA23922 A4EAC9144E5245EBC432561F4D38E692306D544BDFDAFEE7AF963F7A77BCA527BD5643378EEBA9B1 82F4CB380301628C3995C6494FE83B5FCD9F5DFB3EA1470E51A00A89BBEEB9316106D0BB36A05464 D091179DD200EEED55727118B1AAF153CEBC1260A3181752D6D032DEAB5822082D287824E20F9816 CCAF929982DC884AAD95C4C7269D42D7BB17B43318456E66E498DBA969BF2EEC6B0E2198F4B17F7C 797D7DFF56C38E48D11E395986B3A5639D781D7615692E1AB0D2ED176559F2654C610E2B0B3A0D3B F4DC988DF84AF9C1A63F5015B84A9EA4B620918CC77020A5AB7932C8D122A39E44083612463B39DB 595B5449C717EBC7FD0555BD52FC14D59EE86918E8AC66D0517E4DF492D0001BA16A9BC94A89002A B9F8518F41638AE24EFF0BAEEFAAA0B30D12ED07AC2BD2E4BB3E7234B6206A0FC9EE9CD6E2FC655A CF9E906D5FCBFB21620C1CC21681B3BD96D7B4CFB9315E8A5E55C92481A3D8D1E703B7C4455C32F4 537F3184327300EAD4E56BF3C2BAD27B9AE8B074382A14C13AE1FAD29D243660E41AFE2A07C957E1 D3EEC571D517F3141042ACCBA8090E1485F98528CE2AF71E1352BD889DBEF32ECB18D19CC24E2D57 A04D10E63C12E77C860A971FC0BDDB6CA455BEEEB5FCEA137A340B17B6170AFFC26EFE402D1283A5 7319231E68D70E4E19C551162BAAF5EBAF239FBC196AE030BF7F8FC058AC5AD0E28DA2D09886A9E1 52B507CB249ADABAFBD68CB514EDAD839B4BB2B3DAAC90BA65855613B65060CD202D07DAAA92E4CC 7A1C2A3CEEA70DA3333BE2BFC970C77FB5CB7385E5F76C33959EF18CDFEBCB91C2A14847CA72DE44 D6A8390764985C1F794EF1D497B6875FC73C7E9C1E50DBCC8286ADA222A8EEE6E5C39DA5621E4B81 C11B251FAF989FC05020EF2459755B92B309EF2E9A79DED8E1E1B2FFDA16FD61190A5300C70ADD76 2E131D95A170941996E6DEFBB91D31B0BB0A0A1603AF11280BF57CFFCD9B98A90574CDFCB534E516 94A121525174B5FEEF8D4985D445E380E7FCE42CDD1D01990A15A383851C9D2151C95DF3FC8F309F 65471FDEA96A9F950895B717E7F7C57DF056A033D6F3C4B54062350D0EE59739F0BBA156D924B441 CBD071C2AC6E94536AF1F0CE76E5B9E63AB19B9D4069733995ADA62D89C3BEBC5DF585768185F7EA 8604D2C5B84D21AE8EBBF0FDE3ECDFF3C187408A7CB33E51CC2E61E6004C09346EBC622630C4E4B2 5D20F12CA04606397A5C582BCDE2BDAB086498917A16AB216CF54CE38D027E726F84406E9804CA31 87F66EA9F4F3FA663ECC57844DA64690239B55217AC7F24CC2B2FE40A94EA2B72424BE54DF7736FE C115C0CF1D8DF18ED22BC1A4A67547DE408AC98EC70C2505A0EF60C67EDA52A10BAEC737700390CC D8C93A7F7242CC8124B9062FBA5D7500EC02B8557C74CF78674FA0D4BFDCA2471192A0F7DB56DABF BDB19039654BD5A0AC9CC4D930C746DE01EDA4D30DD8E43C8F691DD20A0745CD51D3EA3E2A2622AE C2C7E4F636F547CE557F7EAEB311563F994950B209A4245A41B7DEF401D1717160351BE3F7D8C7A1 CEF9A7E4E68C610989E92EA2DAA86857295651E5F38203D094C19079B7B15A82D13981BF659753AC 407E4AA054FDE195D96ABFF388DC40D9234099826583DC38B297316CD29C0276EC3C69A53F815805 EF6ECE991316C9F5091B40A51D14430FB834044F1DECFF1130C270C5023CB8350DF837410024451D 70400AD14A26ADE647D6E12FFD605FD02FF40EFF201B0088D2C0ECA618A865AA1B7F5DCE0E38FAF9 EFA97D237F8361C5FBC0909052DBFC013076923F134E9F79DC3077F89C32C324159979F3AEE341F2 0B2D33A2501D62D2BDA9CC3424A1FDDE52BF9FC2A5309AD5FF6FF297E759E7FD22C2965E694A4742 1ADC241B509805F947DCF5117F039A86D3D85D990EF935042C4DED92729AA103742D1AA2AC012341 6F98554936DF2BC468CD58842202A03AC99CCAF99D1BBB40F9FEF4DD2837541612577993A5CA477B 8670B858C1AAB3914C0C7DC9E4A7D7EFA3A5782286B154C1CBDE091A2554065253506EEF1BB5D04C C7768D6E1D34DA7D5DE3CA094BF01E197E227A647A57E0BA421F285933D439CF670F2463865B8278 A89A9A71142EB3283B8618FCD0363F6BCBA43CD1FE500E855583405AC861AD1AEDD39DADC89959F7 5FEAFF1DD004FDD5BBBA9636C4D88622F156ECA42E09BAE593285AB0C537762A8B7FDB691DD0784F 24C47ECDCF55B31BEDE1A1DA0121062427B742FD50C53B77AF4DF8EB2B3B6C3E5FDFD45A86ED9FA5 1F8C46D0008915E9F5CE7392FD9E5421928BD10DCE23031521B126F79C5D1F55187CDF2BCA8ED4DC C43AD46DCD0F8DECD8B7D0E1C9B621F15E5C576663C3F3E174CCF73D4C452E45E50CD3678F90B059 E94B0216D457320B9CFBDB34F8BC82B74556ECBDCF8E4D1A2C96ADBEEE11FAB4782764D5FB4CA623 D672503C20C6AC7BF6DBE2ED6EFBC677E4233697E19DA339E1B53C39CB95B59AC46B60B32C083DA1 6B20A73E949CB7BB4A2A87D50D5C297D02C8C15847D6E5BE02E9CE7E01306FCC7C930A7474F80070 7FFE8E6A75AC416ADCA99F24F5F0F44145C0A5D3B1D62F0A319FB33C2DBA5D3C752403478ABD39ED 201DBECE68675B78D064DF072BF0E1ED925530A7F924F0B1B695285DAC81FD1DD0FA217BE570DE01 55A7EA720A0314F8E1A15C05564D719A2C05989038BBFCEA146C9BF8D39F82B838E532A225A9DBDD 0C545ACA1E688B3CD10D905910CC08D9036C1C009E1F501D30FB81A5C1D595FC69BBFCFF33B761DE D83DA1CECF4206E28308AE571585D2362AD6BA04EE44A281222115A1419D5B871CBD8FB9CE5E1B8F BB712DDA01BA5A5B1B575C6B77CC52337EF0B705FB81AFC7DB4AEEF39CF2DEF104F71588A9DE3955 BDC6925C90E6DEA81AD7F32065EE02F5B1DF7DFADCAC25F012AEA5FBB09E839EB5E8F3997E66D3A6 46C324F4F71179979B0EEF350B1B29DCC966F3C6A2A26EB3E7264774CF3957D5C24D8DF8591250EA 59FC0CFFBF74F9F97ECF35163F7356F5BC5ABC622B0F87A155C1A326FFBA6AAA15B7DC1C33BB35CD F3F25B87B69F5CE93DF4D7F0DC8717A1E2E4043F51F358D281A701854DF86DA72C1047B008EDC47D E619346F91F3D27D877D30A1AAFE861B383D08304C6BAF4DF32D20CF0C3F047739DC6491CFA59D90 386385BF6A60D623503BBE0335ACE44BF5CFC39EAE394164082ACD1B7E6ECCEC859BDEAF3D3FC533 B8845616E0E9DBE710CE5D86E41950FEA858DA85E8B5E5141E330F3C660A6CC3BC63B346A702C6C8 F4A82712EC86832ACFDB1583AB036B77C46EDC34626B7CADD0B1AB6568E7B4C7B6A4A7B91CDD2DE7 C6D505A8A561DA46BCC31A4B958E02F65D9DB3C748C9EDCF5BBB7B30F49960611721E4F60EDD379D 0B3BA4F7F9533D3CE0893BF9CCD4063AEB8CE2A611E6D65C7899637811FE84956A7D1D8A271BE0E5 9ED4AE55752F73592FF10A030C095DBABA59A060828EC661AD9AF67AF35220289C56E6C1D489C1CF DC94F49F359B73088FB3965A8916FABA9BA11B837FEF520437B7E12D57B515B361382D189D507F30 4E40D3903FFD361D1B2E8A3A78548F15503B83EBCE770AF42B0BB98A93B7389469B91DE7906428AA DADA8620A03307011400B71C50573BE71DAD838E9AF3BF431A9D769C68DA4D596E3C582AC729D0EB C1BDDB1F80D8EDE526C7B555FE4E4A84325EC2ECA1E2C33F281264457790E514F8F02A9C1D9E6FE7 BD495CCCD38EA3524FCB6C375C2122D1943ECC6081657D9BFBDE4C41216658624CBA94DE7D1D8618 4B63455362143021A8490C4EDB26125EB1F04ABC2F4D4717E576A7C1F566DC2D8DE18DFF1F396331 218F244396FC32346334F918996EC9F0F1AA45FFD23927789BF756E3676290C402E8AACBA76445F3 246981740A027DEBD9DA7BDCD03277CE312E4C29733F1F134D103438AC85424C513E9F97F1F70F8C AA5E2EA1DB359EEA4DD60A410933BEF4E0584124E259C75F51D8CBCC212CB342B6541A2632E9DC15 7E3F1C5E8F892442B22FA9E042D285A2AEF6475486FE409515E6F8DCBB98818412553AD9AD73FD60 781C2D56A25BBA29FF2F8828FAE32A0F5EF9582533C7F6AEBCFA2873B013B7DFB5DD975924AE6C84 391D432AD49E297158D88F9B205F60BAD6011D57D382363DCF80F429BA95DD47699372972AB98314 F81AC28B04BE3856810644C391C8D8DDCE314F4DAF2501AE12B20AE3949C391BEED6939D6EBB8848 7226CEB042791799D92269E52F326AD73350A731061AB1FA4198FD71A495D6E2E9418A0094677E7B C926BF3D503F70880ACE8A5E29D3919C2D623367A265C2E3A132589946C1255AC87E7F0FFFF35709 0F9B6B38E6F1C0F56DDA7B228ABAD8A783AF981DB1EF4EBD7914042628EDCCE7FEB24847E66539D8 D5CA840F64023E15FC5731F5CF051374777B449E2290EE249660377313483016F61F7A7DC7421FFF 27A2665ACC65F6C17EC14CC07CDD2CF438AD9C93BE5D60537741C5ADC37971B8BE7B0532F570738A 91BAE29BA25B04BA3CA73C61952CFB66BB5852F815ABDE5AE47645BF7F751DD2B27BEDA5BE523B93 79E0BBFC5EABA46DE8A5F9E957DB8DDD05ACDC67067AD5C3F8AD32D8284896860A9EAB8018131244 D70BA43CD0428BA27A2A08DB8B2C2E4727881113749849821C82DA90582F277736E0F9D58183C64B 7C606EA48EB515044C282CE1A54D1B95137A90E3D00214F1E45FB6D1A1576D794A6F622F187AB0AB C721EFCB1FC2E21D9A261A5703D6AF7E08AE351AA3498D5438E8C9FF7B28BD90CF52B4E0CBAA2196 9107B36A7C3DA52B2F545D9ADD34DB4C389B0BFAA45C4B061EEDFF927BAC68585AA4C7911162F8C8 669EB3A311558363320CFE5E4D19F0400C2A19D15277277B43A78EA47B8C95C251090888A6325026 D32C16433D3395CF19E5DA39BF4ACADC453968BFB34C7265D0856B99596DCD2CD7031F299614AA64 6117F15830609E7476564FB9D11EBA2D4460E44179285C7214EDAEF5B742A3C5959C4290BE3D5822 B68DDFBF5173647DDD62748E1FB1F875059F788669012298B32C3F03368C228FD8D02E7B0E396D34 0ED8FF5239B2BEB26E6EA71F8A7D8B092CED9F775AC2743E3D8CEE37A23AD6D9574199CC7FF78D90 67796A421246C65B5404E34C9EB31FCBCE7026685ADE4941124B37972C9224AE051CA8ACA67645EA 9CB0DCD99164FAAA708756F9411C38E953DAF7E65C678123B55DAD86852BDA01DCAA2CE497BA9275 0A102C387BFFFE787D3C8B050292984C6BF5FD4BC9E5BE4052712C69FD6E69A8907E852BF67A2F60 7884A25C238904B498809B5F2335292306F6CFA8F74135B4B451A424DDA0EE62199CBA4321B6DEF1 A091C89AF5DAF600D4BDDE79B5AFF8C3BDE8B918630C40DD4E33651BF4C3C54E755CE08C1F7D1A29 E82CED79367D3D2C1E3C469144A730B0667709AA3C1323848E6782E5CF0490DCF58D47483F297C96 10826F1B92156D255B6A223D0FB68988E149D587D5217FB2DA65F752BBB1FC1B453E35E05657E994 5361DF5C0A16D395AC93C6BC32468D840423FBFB77C5EADC257B6DA639DA438F3C795C41F68F234F 5F4B973B5C5D4AC552DFE1548C660B8598B81DD5C54980DDEB41DDC0AC749B43529D04849E43EFC1 692555C6C9DE57212FB1FCC88E491FF110E5BB8409281E8D6BFAD1F4C05683E0BED54F16FCABB4EA 75518941DA66D9DF30D3EC6B57269B336D9FD254048508B859FBC8503809AC56C9DB3EB4CBAF6342 370693C351BCDA8D9CC4E91D055902398BA70F1906DE94E06497EB2C795CE9594B603ED6A9736A69 EF291CC3EA5EED8C0D63EB8060A81E15ACC8450A38D08CD518C1EFACAEB65BE1205684C4B8E51550 AF5D25733FE5B96ACF126EE4D75D623ACB669009D0A73370D9159AE31D4C4E94610338D3486B88F8 C80FFFDF727636CF853756D2167A1FBD63AC17DC896D9362A2BC0C9851B26D3A4F85F43405996E50 823D884D7BC7E88651EFD5EC2D6AA1E4263108E6613A2B9345CDD451D9922E49EF710BF9AC1C484E CCC4470A393BA928F1B79773DD0A103ED7FA22A2093FBC722B484CE5FC7D5E3A15F3549CD4BAA057 7C4294D2078C7EAD31A155076B92F081915280CEE35788CF24DA5C529BD9D1E8972AB5F85822C021 2332F2B650DABA6EABDCAE9BF98A74949C8DE22E39EA31148763F3A48898961330E25A69F824B959 6E75D695C0A263DA0F48EACC210ADF5CD965D9C94D56D018F145BB6A0C63F1F23D82B25A7E43926A 8875F9F17CB3AD9037AF794BD02F6A51F2855940176F9AA41C6EFBC45F08968D4EDC79C547E2AC62 409453D3B43002F0007ADF983BE21C1A3EE1DBA865D585A3DAE94BADF4387F6658B7762C91F152BD 8BD555423ACBEDC038C9BDB54C26332C135505F366C542136E7D799EC63B8E1B027F58E2C5FB6B89 2F6B9AEDF6904303C73E1684DE6CB6FCDF0C120176B19AE89CC3CAA78E4B9BC2974131112351CC9C 0F4BE91CD69E35DA361C3C9CA8A1FB6A082DE093195F84B3AE492992D84DAFD3EFB32F3A80AD7702 5FC7C26011513B6D550BDF24ABEC87EB3A51DC212BA1602FF796DBFDC9928CC1EA75FF1D869A2717 53F290B0F3A36481677D9FA87BF9FF81B3FB11AD7311DFFC18EAA58A2A0BB36F5F265558C688A22B 53AE1C5881B25378D0B3765F841D72689EE04D7F9C14BE780C39D34A8E8376051A6C198D156F8C11 C182A56FF9A34E6FFAEDA053627336E65D466FAEDF35381F9D7985C09BE367E13A5A216C2661ECA5 EF706D96ED7628EF3AC1AACDA7BF1F7D036A94408052EEB5DF7A6D45D5028920DE741EED37A804C7 9703C7F5F9D18D292F0C432E0F9B9C358324E88050D3BB46F2E41B91ABD95E53232AB78160DABC40 1B3422674865A91985028D5D368715D530C512764FD17DFD7185A7154B0FC28415EA5EF26D13212A 7550CF82D0B2DFF2E99C52B1E16D033106805F707393C02BA4EE012100E90248279A5A7DEFC4ADB2 2532F99A7AD573F301A3414379C4271E2EB5C8BFEA39C83A79AF75758BB78AB538F130CB48DA6610 1C9BBEECFAB72C2A95BA3C750D66D92DC6347E38CB06AC9E243C614DB874DB2D65159FB3E710576D 5B6F60C8F38E748F1796BE435CE6E88BBEA29D500B6AB11FBE2E621A93C4DB14D897B65FD609DB8B 1F4AE96F0AA8C7BD211F16EBF911EB6C9920C174F212E5B2A550948FCC6BF708C5D75DDD71698B9C D5747F7D3314926B1B22CD50C354D4B74774F271AB5D23739FAB9FBF99CED5726EF1FB7341CA7F74 27BD46D1D2CD8ECDA9C187941F0112CD98F298C2C58BF31847363DE99FE0314ACEF332EEC5CA4270 25DDFF28596C291F8CB4B6651472D645A7D5CA8B3FF165D3EBAAB524A944750ACFCA69AC058C7E78 A56E5077B9B6928C3A321ED286FAFCE5188CA6CD2544F47CE72C00D5E7B80076084F53F3256872BF 1EF3A2880B78DE31E9E64B777ADC581A18B2CD93AD5B8D726355FD0302476D8B992ADC4602DFC5AC 201F390D0337EE6C67278E8C29FBF64AB8793985978AE714D88527B22A631D1B7D8CA4D1AB910AEE BFB76D3DA5A7B7E7B19A914444C5D592AD188FCB3CB9041EE52BB48D79BFD0872E0AB3E60D291591 D6790D79B4D531E59C6A4A2E4459272ABC39FFF931E04F8D0790C94EF2EE620F973FD76F75A9DFA8 E9B14D69D656DD01A302074932D61C5DABDF104FC65D91D62A15BD2010413EE347C5CACD2C399C74 22C48EE0A820AA950F55C0850BAC56996E259E37A5E511F17194DD5D6E3550F132A69C616C4DD094 D5D751C2468B63252DE5AC2C1592EE78F0D9A834D474F03FDECB633493555DE8B4ADB8E992EB7B0B B5ABE6B41FB84E793F46C0745DAFD2AEAA14470E1D3511AAE8FA0DA91F54BDCA7538E57BCF0D51E6 AEB731AE0ED7AB23DCAA94E8FC7DB18A10BCA6F236C7462D2124CA9EFF6EA1A3F18C90581B3CE87E 229F3B60A432B743A4BB034EA8C2C4AF0B1EC3E406300A912B97CBB8E7234C4F08D846D75857E435 E98A6E4811E2A64CBA5322454C6A9D5ECD23D9367192262C46A58A502B20ADB90B25B5368A00E4A2 DF0CC5F613BF076C3544EFB7C0D8EA20EBD944FC83F6362FE08D7A1AC4CA8FBCFFE2246992737238 70B6F3975F21925B7EC6368828265597EC51B8150F8AAC02EFBE6306F53F5045DF8B16024BE37948 BCD62388F4EE1AE818EDD536995400FFEE07E92634647350E1D3C11E82714923715720DF4B6BF278 00384E4FFC042CA6BCF3CAC59339CD07FAF20FB9FDEA3373DB24C47FDF7513E808E4A5D0D8C41B82 490101B22A3F12EFD849445BF16964EBE8C2CA04AC1613EB616D76770F9D154EED032509A11C810B FBB07D5046EF90DE2CA886BF19FC952EF5721C904EF7582893802336B2B740638731E654E563577C 5BA7DDA5BE3BA4A2C739BD0C6B618501A2F8E07DAB5B879322B58579ABC96EBB50D62CEC3E4C8374 1A41DEF2A9C59C6F8A86E9CB363BD91CD44CB23543A44F341786F0848CE1954137E9370ADD96106B 5677B8AC8A9DAF9DAAD4DC86B73F5FF5E768B5747DE3BB02AFED148260C14C36D00F3E31417483E5 4D4A099AF3CD87DEA749FCB800269A89CDDDAD05B0CCD9CEFD1EAAF8B9C00968AEFB7EA7C8E7FF32 4028262AB5FC3A84B02A27D9BE810C7568DA80231529816BDEE28809999820C6CFFC0DA677329AE1 AEE453E09F11325B57C1BC348781C92A3F746068632D00A4529D91A892A6E754A88C38F21C24338F 97123EF6E15C5834B1B00A27074B80A8DCFE9C4282C7E1923087568DC26873F2D9BD96BCDADEE9CF EEE4F9315DDCB3E7DFFCC48BA145D00BF20041AAB1363115AEC60FC489A2439FCCDDA16048A59BEE E6B1BBF102B941DDC252BA9DD2E9C21E76FECBC4E7191A608A5F563D7093D3D16340A6CADF5BECA9 25EAAA1AD3C9303213DFA00BB7B2306946F4A7AFBF766349F3D2177077BF40AF8DE1E273C0E19EE4 07FEACF7A887BF8987F392B7745484B9D2E87C68F4B5EDE731A14E2DD156457703BAD22A076C426B D322522A61A70502A290AB00C113A1B53C19B29FBAF4D1D6BA5D025610C343403295C01A05423378 6540502E0DB33E4B74DC0B28A3BC194D9265968375BE41392E339696526B3F51C20ECB1A2099DA2C C3A3CEBC309F83CEFD6D6EC3184F6B7E8C5F540FC88A3BEF45EA3755000B9B2C670573C93AA6B649 07D344FD31BAC47FF8A5420728AE44098C67FC5FB3F211B31D69271FE9BAB2F367CBAE3F4EEA17B9 23CA33EE0330F077C67988258950A19AAFE42BC0F6872989792D686AD8199ED6B0A6015416A67742 445A4CE12EE54718D1C64BBA34F62F912B03C567972445E481014836A078AD133DFB92300185E097 5B67280C54F980DEDEE0EF61085E8C758B6E304792E6052B6C84F839360649B10D875E1493FADA8F 59B3847C3E9ABD1B0ED73E65CE46EE20A06586EFED30F9E96B7B6D8915754C45660F3AC5AD8445CA 5CA14D304EA1D0514FD240ABBD16665EAA00BCB2C057E2334F75D982D6EB3A07885CE8F9F6AEE20D A07C4395EFE0BD4CCE327837F2CDB129E7D219F726A2E80BAB6AEE30ED3BF6E1197257619AF2F4E3 A840715F937EEA933CE87632AE19975FF3007FD071F79D319B3C84F626AFB345F7E24DAA100D90ED 97FA1B6632E993F6C22FA0128F0BD65531675E1EB69F21430C8D1831ACC613AC0E65B23BC684ECB4 8717FD337E79B0A36F6687308A145B83DDB4FA5C699EAB79FFA08B5B369A5C08F1089A200C257666 92DC00C10A3A863C286995E1C4D6E34665C94EED38E13DFA4D51DE370220314DD131F567BF10F962 730B00F21EFAA68E7A2D65280923FBF116E673F07F24262B24D97E3586C3C76A6F3988B3EBB30C5D B078CF6DC21CE16204A30607A224898A86939D2011E8B630F4EB876880C410E29EC0FEA1D576B0CE 82310CED8D745E160948059EBE807A510A1E8E0CA1066F10B31CB6E470A2E4326E571B67D1937D9B AE8B24FFF2E9C0B416B604F5429F198AFE8BC5D4345097329902C0DDBA3DFC2A6BD6F408EE55354D 061C3929070F216AA41587A92A15553D19000744149E6B8EDDE3F06B53FE19EBE9D05A961ADD8B21 2E65BA70D316B87C329E9B38B5DE82B2B641C1D75BECA86E1C91AB528699D945649C306AFE5AA4CD 1808BD057C41656C50CADAE59963C6AA57B2E41FB396CF5C3D7906C0DC2287E1005ACD7F1B3A6D1E 7D86A962E50AA7EDF6D7C5CBDE8288FAEE7232BAA171459EC5918BBEBCDB9686B6A4843C2CD9071F C168828347C0663272F4C9C9EFE18A2A2B7E033E87DFAA3F5090CFE470BF4B1751F3A6BB1BA1EA51 4396342990B8B6132493F49F00FBCB69D2660273CEF7CC41002C67181949A1351F8DB5C3610275FF E55D19515F5920589A37F1ECA4107C9729F70A035632F18109A7B61D9EC13073FFF0F358B080F423 FD2BF1DC8CBC69607446FC33FC0BF80230ED507A4AFEBB5EA6E36F8D4179C2854867BA2649E037F8 D10DB4AE0C1D68B24134B9AE8E02370D750555F1656951B52D06142BF888780E22305D2224C5BDBB 0EEDBE566F1EFDEA83746B08530BD56709165C6B1A80216FE1CB301D360DB7CB0845EE2303E07D1B E252ED08720BE5AE08343A734C6F09BD228E415CBDE07368A75805662E3EE324EDE809BD878F60EE 77439A0A74F42B33CF1667D31981B715C685E368C55D29081F8EBEB8BA10DF06B359C262D91BE84F 9FE8C8DE01DB5E0E959C5B4C34A31BC462D3809AFBC8A0B67527715CD2FDC690BB693BECA51AE543 532D9E385EF56D299AAA98DD3EB94D293253766751374E2761E1DF08E3538A379021EB939F1C92B0 C6980329A1969122902D5E91BE8EDD073673405135D0E207665C17E862E48AF6CFAD75792CED8F7C B54733910E4CD4B9006D08DC9A9E1034794BF285B4CDA46F0F648013D8901EBB437A6DFDA7E1EE93 613DFD60D2D615DF66C8B4F59C58EC9A7A5DD9ABA96DF11783DC9A7CE9FAEFE523C26C52589B60E5 1F1AA402E1BD347E0FB4B346F7115C2EC1E7B0D2ACEA0EB92DD354C8F39966AB1B25F4BE08FB294A 000809A3EE00849CBBDEC1348C7DF0E5FCEF022CC4C8D717FEB7BEB0F8AE1F2AF2B9AF5FFA9EAA66 07E911D155A58FE5D36DDD632F035311C2284E3567ABB3C25CD195A8E2E23476F93346517D2D5444 B0AEBFD5DE6755F9E07E0D01A759744E50690520C152FB431759BE19341F349D221C9238431787E5 0A5B4ED612FD4D4673D4676F96204289974F2CF3783576D03C8420A4D71BE19BABAD6CCF4DDD0B2B CA0929093BC009453A86B3C5411E9C2791C4DB13AE1AF08E2BC0214A6D2873BAA9AE1167433F1FE7 C28ECC3F08B48E456E6E31978C3A88D231722018FF3C20A6BA49BCDA9C0BBF9CFC369A4D2A513BD6 53FD6E3E7FDF34A517DDEFD817355CAD4AAF27B93D6B047453B6D8F65A9219039BF5515DFC828396 D14B99D6B8E6561D698003A6B7EBE4DC7D360F800B0AD2B26BB2577B4673BCEB1C00894E1DCCD8B0 3F9E2029783632403B2D9FD8AD8B3DA0F5B29977B0FED12A902CC100EB0C094D83F2F9843A43153D AA6235B61DDB2C056DDF11F793D678C8ADF97F52A52E6D687B82712D51D74C832DCFC2DDBE8D9D78 684B25CC6B8671015EC14A69413311941A238816E23DD5D8C099CAC4C8834BE9ED403CA53E3DB267 04EFCB2871F5AAE9E139303BE9356A7290021C6E8315ED6BB8BD877A6AD38AF52320DEF4D56026AA 425F7D5E9D00D029022614929AC5696A341A238626A7502C8F8F83002D49615FA313C3F5768E7651 C1DAE51F6E746C8013E98BB10CF7F6B3D54BDA93B497A1348416782D7423832604597F768C53F306 D7301CEE02EFAC3719DB8637E97B3161E3EE1D653FD958009CE262838587BEE454651C8CF46E22DE 55CB038C9DFADD15AF15EC2D620C4DDF6C9D5F41B161B9B10C3DD7D6B0B8ABB9918A8D0B6ECF43A8 0F6E6C9E84B422CF6B95838F8A666C03CBC12E69E5ED7FC847B51ED2A7073E3BCC94D16A06897C42 235A26D1EBDF4015070815E3FC9D2C87ECAFA4D207D4394F949B52DC801C8050340248B7EBDBB0D0 D442A45E36F66A1ECB06F1591D3E78CBD149DCC0FA0586512F487B81805673AC57E12C8911FFCAB1 4654AC12A934FE088D62E0FDA207865F69F93D75805F3662800CC1657B1F83268222FA886D7AC577 645DD5BF709A42AF048FEC4CAD0740CFA3DEAC87C1BC2E6B458013F26FE3B19F1AF249994004AD2A 28B447843C51A83D7D4560F6F0D75C27F14AD7A7D6464686BC23796D5E30E98BCC32D55D4FABED7B 012156EDFDB2CB9C0D7525CA015A98AAF882F1D1C8B53DEA3B17082A38DCBBBD4FEDC19E01CC0309 4EEB7E94A65BD58657AD4B16B515995CDB573355A68954E62AB93A503841C692A5BD352C4B383821 D74A3B31B36F6042018CE61489234E17A05078F694C2803F234DCC3D4BBDB7A6E0FDAD1CAFE77AAB C71BF9CDDEE0A44DEA7E7A646B8258B4FDB402EDC24080FDDA209BA9ADE2089AEBB282765BCC12B1 F696782FFCE128A8633B5B4890460271419777DD10369E591E8449DBCDDD8F1078A800F902B5A483 4BAEEABB20F29309944E45B8A195D59C73EE711FD4B59F4E2A4D7938A2AC1ADCED7A228382369C79 EF2B069361B624FEC04BC0DA3DA6C9B506E5A4DAA3496CA25B2AD5603D80020E01D087B411B01925 0820BCEC042E80D3B38795786AE106584E2D2DB6232FA4059C56AB74F63549CA05AF77F7FE96E438 C38EA3EAE6BDD6DA15DB7DFFEF30AB3E91158CC795A77142444B13B3D27E8F18DC57C95ADC2555D0 78D2C5011181FD21297FAA64722B5D6E5F2E0D95B2C12F2A6FD2F89579E872298219B170A6D62BB9 B9E392E2CA575C0F3FCDAD8DFB30112585D0F8D956AE454F0706FC94BC91F2FCB89DA0969BA53F71 781DC6F5CE1739E8FD8173DA23B7A33BD9B6AC918C88B307149F40F2D9DC9F941241FDC326F4346D C4F2863BF2714B76A5CA3394FEA7CECAD01BCA28C830C3A51BE7E12416E19F109FFB927D79FAC81B 7FDFF1A99957A8C99915F9210B979BEA6A0393A1BECEB47A8EACD1D242A0106D42720239EC048CFB BDBF64F034FED0D8F7C4B111ABF4A2C86EECED845B17896B12AAE42552B8EFB9DB090109A9F844FB EEE3111B2D1C44C39F8A729C08147BD6D8CA26935FACEAE14612BAE9BEC28147E9B15B8020AE9A0F 2144CA784EBB9ADEF132994BFB834681F0C331F7377F9523A740A9187932A01FFE65DCCB4A7DD1DF 924D6B56DD01E0ECFE6CA79A6EAC913C7D68F6EEA1B3CA9B335E2B4EE3C37FE9961699CBFD148965 81689898EAFD44DFC5EDFF2F8D544B803B6AADB2993C71E2987D113322051E8501AF343FC7B5E48D 90F7B997C381C0754028B6DB5F8D69A86E5DD66E39B7F4F84D2AC87FFC7CC7BEA54DCC9530A71ECC C6757C85CF0C73D8E57FB702B2350A9C1283C701D1CAE5B5AB8CED9D9E2669BD3AC89EEAC6CC410E 5FD8738B1BD115F381B8D4C7C60D7C55CAFD8403032A993D34E9FD8E6B5B14410AF6F0A822571194 92B81BBF402A0CB9131A179651326BC709D3AD8C6AD8E5E67885C8202507AE6B128D3FA9EBC3C37B F19CD62C488D60D537F407F25DF297552F1141409E583F31FCC8EDF04110E2F7CFB4189AAEDE522A 2859B1448646243D251175532D9F12B759F9A9F2C598540CAE37CFDC4A34770A5F0BCF075DEA89D6 EBB893E0D3DEB96B924ED3DF9028ED61C4E3408C9C069EE423580EFD2CC4366512824B90C5796D8F 17EDA7D813C7D56A919AE641C7A5F76BCD29541FFE0E5CE97F38EE8F6A73DFA1742210E3081E3947 50F729DBAE41DB5495EC246C2571FBF85F0074B6F2511D29DDE026858BFA4BEE75CD4354FE67CBBC CA7A6E0FDEE258169F14038113BEEF9A775B6781D03166ADA9D295E303AD926FDA71211F3E3F0648 965C44A95AFFF30927F848A6B0DC6CD88C3EE854FEA7A73E948E4CBAFA314502379C1B52A9EE451A D73C1774BE768CB8B15BFC272AB05EC7BE4C039E8A96D83DD21AE91296B09EF47D40B8509ADB5E6D E6EE915C4931E3D788BAB7A7B9667A0D58A510D585F8ADA6A7A30C148BACA63969BE5CFB697C562E 7D41D7D1559DE166425E3B21479DAE0897959F909447C7417BD74B7D7A53D0CBBE50366053B44AA0 224B4C8C6B59478EE443132F197634E065C6AE98CC203D34A04181AB1A2A0E8B4694F9A70392B47D 53C417963632C749F8F3967CFB4B22DCD05C7D6E4F794825A0CFD9DC7F4592BB752FCD6A9EB69376 57B1EFC80760B8E3E732D6B75E5F8C87E1EEA7E7D05ED4442E53EB5C0C573413923D556F3F3BB219 723CCB344035E9444EF69730A03A37C12D48D9FD2FC1FD8D4AA2EBF67C5F63DD1E4C99AF7103F28E 56F1340204CEC3983E2C5AEA8C6129CB9B4322C265219EFB2D67F4BEF965ED8C36245BC1035358DD C3AE2C05846BF25D2F0A705D4D281D2B34C27CFFCC109EB8A3932C800869C3C3E1F0E39BB32868A1 40E57C228AED97E55BD9F0E004653B501FE4D0F38416F3E98588E4AE0BE18FAD6074BC08964E552F 916D810F863B4E38BAFAB41132D9AA7920722EFA39EB8B7C4BF8A4159A88C7A7ED3D98B8DE6CE0E2 5E46BBD7A54C6937042A8C66D6FB73E98331D2E5661B40F4F56BAC817959BCCE9E468C380BCD7582 ADCC973DECFCE72B210FF5700557199E3AAC95176EFC2CCBAE2A714A1A1BAA54AACF4A1A3FFC8B38 60F244A91E372B6363E962B27ACFA2B428BB6F214DBF80BBBA0BE61ECA4DA62AA4AAD81D27E5F68E ACD8692EF8B391A1AAAEEA2B68802218AE7C1606560D467473DB0D3A684B6444A25B695BAD126F02 06706D1A9E0E746AF666C345CDECF617A5198B010626A29802E4347201274856A208D3B2AF42691D 33991934F02C8C54D4967F522E02E00D454E75BB99CB91BD73A1D6239074358613C61BC3FFE65DD7 F77F55B8996D018E813EE20AF38CA9F224978E26FCDB316722262429109DEF45655842B1CFB4EF2F BFCF383CE8C9C6A05A7336BF51FF735172DBC521BC86B6862000D7076C7C799A57B8017590E68A79 BA7ECAE837E3FD7F739C98C637CCB76C2011C8FDF167BE350D55D4897A43D6C1AE79CC567078F78C AC4D519D7C87599719C661936260DF33BA095FB884A074C5C573FA498EA2290ED58B19EEFE889FE5 CDBC0ADE7E06A3523AC8D6E05E981E252839B1BC8687AFA1989F5C403599D42702CDF257E4CE9E7C E1CCFFBCB537A9307EA4AF06F09199B34A3717C715D6A2386B15C104878D8957B89B9F4AD7FEEF86 B4D501A6CB35B6E5CFE7EEEAC24533CAF8AD48627BD737912AE154B6D8653874A889DD5E5CDBDCED A04A6E80ADD98114590D0312B3FC24753A2ED7665912A5A759C12A24C90D07137084267C1BDDCC50 1D9053121BDC8E1CB992CA72850CB4D3F16EF07779D8CC90E2789EFD9B5ED3EE53ADD740563CF275 0468314BF1CE32147318149F10BA68A392160CC83B7E956D1A50C0F573815C869338C33094976084 D4C587D9389BDE28A99D685375AD0CCA514465DAF4E3C100E692A85F5C444B6C5CC96EEAF4ACB547 070DE2704925A152913523BB260C082F56CBFD9901DE3104F466FD0BE767F738722DAF63C479CD84 961A18FAA9A69D25DCD461F26A57E902CFFE91143CE142554886D80F206CA664F13EE26F3BEED546 8C942509F4FEEA795CD0C72816955FE626D572AF21190225342A142C4B982A80C008ACFE75CB4F47 648791C215648C6A63078CFDED6994D87C64C092A946F95B507458508A2395F2184FE5A47E3FCBD8 47616C1FF8C40555CCA8E615A5E7BEE3F5486704662E4221FE1A898EFBCCE6A1E9F847097365EE8A 810271A5AB79CC2F6226A29EB101CC89184857A505E68DBF1A3288D74D078482622591A9E5056FB5 51353ECDC23932C0BFDABA1F330F1E42640FBD17A1822B4130707ED113432280CD0EA3880843451E 4CD5AB52C9DDE4438CF68709A0C74AD9792AAAD2F05C20FB342FFB250601026ECDD60CA6B14880EB 900C61659C9CCE404EDB15087EDA17284C6A05BD5CC9EEAD6FD92E8B57617D592854D9560AAB8A45 B57597EA7776A425825452A938BECE3EDD3EC83173A5E5966F531FA30C2B13139C3E78D911689D23 19F5A5A3610055BEB2CE243E4F1FDDD553742373AB7048DBAD311FC0686B4A36023A5D48442CDB31 E7F88064BEB1584FC63CDDA9A88BEB0775DBE362ACAF0769B98A9D5E541F7FF05AAFE1CBB6BC31A6 E4A91C623D3466784E9CF347BB761F57DF16D1A92A90EDA65AD0FDB60EB8E6EE2A9C46EE098BCEC0 E3F15C2655133CA0596CFC7FB6A3F7758B6E0D946D7D83910360F0C25A2B378149E86194A7907BC1 198C003E02164228F5B04F094A20D21B64E258413AC5DFCE35684C73554EEA88CBB99B73C5C8357E C640BFE81A23EF6B84F2A6797723ACCDA54773C6E7F0BB559A1998A45E5E3A6CAED749FAAD608C0A 792ECC879972ADCBF8648CC5499E0E1149899DAE841095875D8B8228855C1FA2F3BFAB69EB44159A C220E168EEF01F6C33B4205B62EBC136917657380E28F85A0D46F88A2FC74079887AD5F5AFA59F9D D124E70BD2F2FE9DD692C537AC03D517FC0B410062626407715CD8A3F7712F4E36059CE1B5CB9D3D D7875270B24A053CAD4469AE41FDC0F3AF3BAA138EC9911FA69848FAE7B980AC3979608FF362EF55 F55FC85D2DD16F582CD7B2C7633043D2FC774F6853A898FF98291CF1EE7BC55A43FEC9C838773534 48DFF9739098D565E029E47C3322905DB08C4349D49F1BF781EFAAEA30619808299E954773D08468 FE6A8E09341C280D0D419097381F19FAEECDC8D373DB502BD457267015586A4A445C72D8F1B4254F 67EDA61100E174535D33B340A4E977D5B10341469EE30F974E8C78C31E91175CF1C73A835B4E5A83 1C29F7EF0FD0113C56B08A194EB543B751A4A6CC504E97BB52B46A6FB2FBAA2E55BA7E2124754557 443E5C73822136F1A9BEE2FE5E55EDF836C6B5E5820843C7732DA60033ADB56B9D55434EF9B8E858 A1504F7445FFE59C7AB082B3041FB3E270EEA6E42F8377EC54C437973476AD5FC047E2E3E6E01D79 DC68CEB148EC9D2BFFB5120D7B202754D95BEC6D6DD558EBAA8554C6989AC0063CEC333C457AB322 AD7FB0EC594C743C7D8BF77A8E9FEB49515F802969D1A2E7ED589D28215C22C03F871304540016E3 DB2DBF74B67BEA99977D2986333A0F84321FC3EA14C7B24CBFE4B0D24C1686722C4D8D1045BC261D 759DB994B6F377A6CAA536A70C6FB6D8C550F8EA3AFD624DC158286CD0F0191DEF8C15CA033176F1 45801E7A7A3B96F70A552313E59999734F8B688D89810335E4A9F6C4EB44512FAFED3F050F8F53E9 D3A0CAA2D3A6DD3C2AD4583D1F73E7FA3D552861431CC30BD855203656EFBC6368245071EF60DCFE 889C07AEEC7E7102718AB7E1F58B992231AA79D6B0DB030812D95FF402B9F40B4A0ECA1DD35671B1 F6204A3AC7664C8DF4E5EEF550529302C4B0ECC808BB611B22A50D203DB597C06E09BEB13E84DA08 199F77B57D46BC996C2CB48CBDFDDCCC561EAF08223358C96E51A24809DE8B8B0BC54AEA9E4EA15B 5ED75753E24452396FA7003A99EBACFF328514AB675F53C9EE3B7045FD94620A38023A42E4559899 DA5D5033F213FBC9B52F059A3DF83BE6BF85CBB61FD31921E25EAFD215EC46F7C5E22FD133991BC2 9B632BEE33F917974E5144872C9A178C5D1F6B87DC501B51EC9712E8A1D21E2720CDAF329051863C 08BF27468060AE901FCC4A17B5696B6671C6EEE1DBC5929FC1368E589EB0516D3D9C2E9F9C8D3116 96E2B677E8C62157994070EE3A4EB3898FDE90DF9731CF6568701C957AA6737189C26630A4F07E45 AD08B2C192148071F9334885128E50B6B5DDEC88349D008F401D9EEABB7F8E066F0CAFE3530BB0A8 88299FCFE435B4847FA5101FACE27FB0DBF04C49E168DDEBB670D6FB694C4FD62F1169BCC9B24C97 D2B2868826A1714B1085F2FB657AF6C1E46C3D8A39B618D79C2133E2B173D4329F8C030667B27CE4 A0014E1B64CCFDC06C4A77ACB639BFAA9B0E8527E1161BF4ABDA5468A42D7F4CF12DEEED4DE8AF28 7ED6C2D3128A9CD5453D880D6A277ABAA408724E716CCA4D797245002B167C58E3D0F39952AB779D 31693694E976480396A4519960B39D39139BF385AF2E7A54AAC86DEC3DABE1488B0B85AE1617CD2E 5243F3325C6D8E8A5C292EB5295BFD8EFDD64B75BB5F5A4490CEBDD5ED87E0F4F8C6FBE86C17F470 6FAB2207FAC9389CB909760EC9BCAE1A3ADAB154A287B7A0CA9A06C0BBB45929457FFEA44EAA425B CBBA937F508B8117375AAC372997A79EDF0C7688C8FC6912A2628554AE9B932011A8D6774753FB16 9ADD267BEEE60CDC67CDB0C93468C76195615C01E4627FF418A239DF8E1936E27D667CD27229EF25 7613CA4A9CC9C227AA0F281E25FC87C22B4F15C40BFE76B2B0F18A40A93AA4FB3F573D455076E6D4 2B8C0F4469FBB45BFA02E895CBD06924238D6945CEF9CD6B8B7AEBA4A9568399D943A3839A4D403C 49A1945E21DE8849C28C23E8F3DFA8DB4846C331601ED687A21B3272755514432AD104E000DA71AE AC094A023EA3A77186B2041E73412F3A388F0ABD4D1F155FD2B3D76D23EA719B6746F27E5C61FD4C 220FC43E41243D25B321370CCC178DAD3C301E86E280B5AD33700A2C679DCFEEDCF187DD991C936D 4B466BBD82A7F5F260955E99CB2599C0221D0B6D6F2BC6D5FDB07F7F469E41322E68D6A82130507B B2719EAF85E225B33298F57EEF41ABC8B7C9F30450A07EF083BCAAF0DD6406C22F284192E7517046 9A8D2DC89471C2C21C50E6B68DD1DB9EE000EDA057D2ACE2678A0D28B4729708D6DE2FB5DE46B447 FEE25BFA1FDBB92AE722C24795C0B37C8D5BA43AD6FF914E66C29ADB84337C21FCCC822D13B7982F 4A2B4A336E100EF264D076DE2E2B573C3F5B5BAE92A7A6897BBFB985B9625BB38A1F5BD12D610784 2337CC5DA6121110638379979B24B7803E383D20D05F086168E900B98E64D6165CCE1971AD04D17A D5BBD4C0EB69B75C375DCEA4EF2D384E5E92BB7066B5E3411C00D231D0FA212659C32D0FE794D363 E12BF382F5CD2D078FEA3558F114303D16A9B0C6524EFAD4ED1565CCEE6CDFE1AD8919376F069ACE A3D64F1AF139DBABA666E83B4BA230965FE4FBB4CEB62205C21ACDD3D28DBD475AAC9637C899D72D C1B0B9ED36558757B721E96F7E47BFB165EF1E5520727BC5397C57BA5F803EAC0AF7363C2DCEE654 1044BB5A00FF6D29717CE5D58BD616CF309B72C6F66984294005153E29B4720B6087BE3E309BAB6D E62842CE2771C6E4E8F8894755A9605D5D86CD0BD1C09094FE2AE16C3945D169CE08204F6571A44A 76A613E32DDDF18769CA151C02E3DE8C84D7A8C7BD0E74E5566C8CC1B77A445C25AB4CB0962D7DF3 4692D6B04886817DAF0707793E67914355F3866F1A966EE8240550D2C5ECE30A67C94DA8D3735E0A F81E16398559741BCA5CDF5DE6782D8D9A395FA792201E3AAF5D41D8997569B8250405C8B7F20B90 00029FB54CBB837BB16EA376A14D5CBCD6C1C8A75D1246781345F4C992DF5E56785708A97D02D559 CAE331CD375EF3D26CF479FD8C24D2225F5DDA85F57CB686373CF1F731A004D7BAFF984CC15BA5CB A72361B31E6A986FA66031B8D11E0FEE5B110C22234AFFC7A8CE6EBB8CB8DDC53A240EE3EFB57C4A 029F9AA9AA80DB5ECF09686033D681665FCE7EFB12E0B17CB548B1DD1ACA8B32DD139903E970996F 16F79E238BF32D66C261E4504B111C51095217002BF5E752F280575099D68D45292D31991C718846 6D26274BDA9A60741E66381C4B5AEC47E7B41182CD86B93E202DB79B4775EAB6B1E98D2B0AB4AA16 252ECE74EABAF5FE4347F5E849645097D2950B03D1CCBCCA6776AA0F4E2A6F10DAF4864C2D6F44F6 9FD7BDCDA3CE93E85D54F2B88C07C919CBF25AF4037803BD7BCF51F31909120BA85C0F3994DB2D82 A1E7C630F75CC8C7ACEB24B79EBC1892175FDA1089D7302FAC0E52F95F6FF934995D1A53A83E785D 80C7F3F1E0846202CED35ECEC5C707C01161A60413235F261F8C41A90A52F1D40D363BF64C04C2A6 99761D3D0185D62237549E73970D4948B00367F639EFF6C349E52720F05BDCB3C245823DB5BD97F9 E90449D2DB017CC8C8D9E9F6AF85A9D05A1B2FB85937E9877D405697B4DF1C47F9BA205E9C697E5A B2A528369CF5B9C76FE88F0C763BF113C1D4205EEFE9EDBB155CBB7EB66746093C0C0060D11D0959 DD95F6481DD2A4075E0BC792D9216ABCDA43BEC77F49C0950AEAD11172571C4CDD0935256C34090E 8E34316A76DCBC704AA57521D77F6FCD210C19010BAFD7262096D85283E8F510B659916AC019F1A1 3FB3804BE8883B75875A13365337D8458994BB9BCDC6FF85655D8B4B8C73110CFE624AB67365E089 3F9483CF56529C81A1DC9D3C78DC0B42963F9CF0ACDC2842B906FB7A9F15AB0E44EAF2F82CBD7FA5 4C664498918EF29D8BC597A4A25FD034054281948A688A7C6DB6A7955725028472AD203299C5E810 3ACD2AFC903C61AE4324B4EEDE977A89A00727E446E635712FA1CACFA6AEE05DC4921AFA53FEE34E FFA1659BAD3F75A7825BC8E5A398EA500D98B588FD5AE6C89E5C10485BAD0083A18A0AB37279DAD5 A5CA97C2DC115D13109267A6295FCEAEF3420D6D422EDC233BD0284462299A38D3F6EA9CA58CA99B 957C2EA18156393FAC79C82898F837C2D3E0A60BC10EE09E2CC5E9302A4D4B297EDDC6DB0A5A9A5E 04FC9416DB200E5ACDAA6320070CDC51E8A6384BB5812AEB2FE8E7BDDCB2B5AB1773D96A2018837B 233FDE36D926022C6E582DFDCDCCFD7846B146B0EE4137C7B35E50B904F48E5CF0DF2C040AAFEAF5 6FCE2FCDBB2EE3237A96334C970712884DB56F810E7835A0B3AB511E28B8D90338E1E1A13852DC17 3BA9BD22299DA9DD2274DA64B465C9224B18C54850E274AF8464004D4094A4F48DC9F3D969CC538C 65772A9E242917B54C44FF32779D49860D94FFF0CD0870266DC21B91103D18F7F2918709F74CE7F2 96FBF7913FD0F78EB33B20EF0A2E391E841A91A393FE6FDDD41D58CA0CD6E031D6C0BB2959FC6D52 ED857E4317845B2AA13036DD82D6DFBE4AB9104466BF7D2B8239C379256E002CCEC970F9C436E1F7 70E4FCBEFD574E608B56E93270F147CA6AF44430632D452BC960C33B9C7F19095A5884C56A48CB5B 14B0852C27B4CF4A5DA2808DF2D98F9A1F17C1C375649FC6A5C87995CA31AA66DDE6CBB6DD43B95F B6AB61C50B6AFF94E781BD036E90ABE1CBB7727C266D16A43E1398EE4BF3A321F9AB7C0FD05801B4 1A43CF77B31463FE3E0CE8AD09EC8C4BD66970B794E561AE9DB3C7A022B29F1093C6454B5935633F 48254D8F02C50D028604AFB784B5BB8AE3EB0F4B8DD3551975170EE2C13567391E12D71910FA0AC8 DF5478DFC12F851838477F543892C92C2C68A2D55C4D9131D3E844DA2D1036A598E5F8CDE8E46414 AB3E5461C4FEF1F819DB4F02DE440EA354205ED3C1FF802395886484A483F71DEDF796A6316E56AF 8C4B8DBD45FD8B1EA3520B30E3C27A27B59726D8F0C18B5002839E83D12C13AF0A9BB569F71969FA 9AB260B8CF169D9A75917B8EB91698A6675D735769514A8192034A4B773E730BE8D2C50B7EFAAFE1 6B81FDBD1B4EDD9F3B1B4318E61E95B03C87D6053D01DFE83BD80B642E41DAB33470BE85DEB561BA 0E643340281FCA5032287ED8D7492597FA88E1ACF9428676D8F9CD36304E5C6626AE7E66B1CECD89 3C77CFC3331C4D6DD7BD35FC93F1C7C6872CD79387B5E7D3570BA85BB9847AD3BEE068EAF10AA6BC 09F853D73E0DC4EEDE74BD4CAC2CCB6BD4CBA4AFF33C9CBD3658F3FDFBCDF35B2BAB3099C0A42CED 99165127B424384DEFBE9759301F399E066DD54929BC982298194CDC92A23F1E9ECB06055A47623B 2406EE524DE0060898AA8E782589F41C2363B335AF778C9AFD659FE646EDA652192519FBDB986F8F 92D88C697D38EA17FF8C8ED96AD5B16FB66E654ADEF14CC718CE2EAE4BEB0EFAE77B73B313412076 5F09778575644A9A4DBF7B43BB12440629A597B29600561860C76C5343CD91E6E73F57AA4B5BFFAE EC942421183F6AAE57C3190434E75CA977544F816BC5F23DD00D2EB8E2920B6ED9F51AEA0524B035 FDC8BB6D7429ABD50DD69614B9D50320AC591D64EDD09B904DA359995FC0BF2161752A010333D1C9 29E0F6E1F0CCC31B0FEB036942A5B8BFD146D7FD2702299B0CB60A88EBE16387D218857D94056D90 F73C1268BC18CC21515AD9C8B36F7B1B860C6DD78FE145F6D1D8EA811E971F3827116A349B7AE458 C1622F9307B01CEA1EE36A88F1A57E08A7C7DA8ABDD5C64F26763D6192778F6006C49C1CEEFF0432 AEB96209FF49CEFAC27EB6184CFBA306FC5F423D92347FD186CF56755A816D47963BBEE4AA21D4E2 2E31F791C0FFC065DB3D707F3A4EA49E2EC4901B416F270BD38797EA9CD81C58BC51E25E1E2EFDD9 68C6E308759F3335DFDCF51EC0AEFFF115C188E9E31625C66BB655463D188919775E79C625EFB0CB 793E570E99D76C6A7251D2CBBECDB3CD90FC065A0BAE6314F831131B232F20F1DF3E646D22A9870D 3594F3D2F1406490D5474C7F143B8C13BC84A2DC3C7AAC99F937DF08DAD3DE5F61CE71FA7754930E 4E7E57177BB6FEF27177D35BB3DC3C8A89D43526E53ABE01E32432DB6BDFCB219A12DF9898C7C104 808545387F9115983D7B56212D37F5F5D1CC5ED9E4B88F72BC0256B3A7D01D47EAB4DAD94FC92A87 5FC56BB245B046C244C9E9E68091544C98F97098AFBEED521835FB6FF24A66CC88F16A79805689AB 7ACE163426F38BB5B62BF101D8EA950902EABA01C5C45AD18974C289950FFFE659D9E83F8D6F791A 04E7E65B77A0783558156AE18CB370576B994D69380914DC68385C83EA139E90D3293C0C8D3DAD1A CFC4EAA8B465EB62CC9200B12842E41C06B2B8E696B1715F93EAC235907AA73A7A1E49E7255DB974 0E223DBDF23C64B0A7B6A997B5C65A7E43C2751C69660ECF56850254328682547C69741FE58E4022 EF1980962EE5E03021C4988B323B16501B671AE89007692331A8017BE25BEC5FDFDEEAC0A9CF4DBE 25026C2B41FF4D6B9E3471CAE3ED42DC9D3A7E29C2E7724760E803C4868FA90834137DE81CF88EF0 B1396E7FFA059A3D4FB0703C0E223433C24865CC6D14A39D8757E65BB16B34DBB5F877CA6EB78ACC 15CA3A35251419FB61C3865002D875EB95170F56AF91D1110D1EEC64951C046CAB99B3567E799376 496676700C531CA95A58CC683401FDAA5CB72AA2E6BB9737A22D4705C6153EDA07C89A22EA68D384 179309E61CDF211699F5DFE0A49A396B5B692F807891B84EFBEF4F2828FC560B5833FCF446D5D506 15615C1F078915D3CBC54B8CEC7250EC2C658EE2A5FDA61568EF8076551B3322D425D416C3282769 217C58DC1F7FA76AA281E8FBD7D80461B4F6F79ABB2CA0318B5C810C5AB7EEF93AAE5409FB618124 D1296289D65DD9660ABF531DF996124E5C1B59C350D7F43E3D3D41CADB3C66DBEEA7E6533F0D5D17 B24AC52FA1C52A805B190C00C00DB84350E87153276F99524DB31BB553F7E9C35537D2A5C78214A8 C24A7542DC7FF200668C7AFD1657C7174218E38828EAC232AA508D5BD61F23EFF5B7D73F3B5B67A5 5A81F67A362A72E4DFE27F7EF79ADAD6D5A47FD1E749C4057CC381955DE77F1E88413D2E5C49B17B D3439B2FCDA132810F994AA7D51538B28DA220C9DF7E4A2BA6C18C879B404928E8EDF06C4AA2D4D1 86E2C36A0F56E7F2BD22B7A72EC9BCD0252D9E77E7590215C1835DAE40B1FC99C16E4728C7AC1EF0 581654F32C743971BDB3D3C816A3FDD8B40680387D7A52616FE43548012E870E6535ABCAEC6AEE2C 8F5F58D8DA256777D1AAA90F8843565B19161F5109B52E1B33B5906BBB7257F0D59A308317466C34 2C0CC92701A05BBBE8338163BFAED1D402A358A328B18E2111C15108A1C1940ADC1B87E2EF3C470F CAA0B4C7013E6ED440253ADB2B4E400D3B53483B010501A8ADB5D99CCA37586EB951EE5C52CB3BF5 6F0CF1190BDDF369E7F69CA69076913F45C0D27D21F97015BCD7C3111A543C63A022B60817EE951A 01396B2C1E6EBB8F792B8E276EAD9AD1D83D4BC592FAE00C00C4022C33028F5C68A5B6FCA03262CA EC8F8E955400E9D70E261F646F7F0723E24CD7E3ADA265365EA2AAB7400EC125C6D4AF4A33D517F0 0BC98D113220F2C857FEF9171C97837DC055C31AD6B1F107450ABE77A6BBEB1E94D08C807337A054 35C97F703A98E09E6B815B87C241453E86885E8920A250E4193B7562CCBF1D2CCDF725B4A29C5B85 9A60505CF4A95BD5FD0822FCB0F270A73F77A78296C46FDC793C141DAE1492D85C3D7CF5BC84599B C88F21E304460061EF55B80668589CD27C8C32AECA7263F4514DDB0816DC1370E8841F5B0EDFBD42 8CD87224253F747A4BBCA4DFDC42839889C031A09ED74D780C4835304E83B81AD5F06738C91ACCE4 71D4C67DD2BC4930432DAE667093D21581AECC75F699BFAAFE509DC7D6B80BB10195467D7BB41690 EDA78EF7E650D100CBD0ABB96994741AC7E027455FB32722EFBE5E30B873D2A9CD6345947ECAA411 542C40CC804E440845869789BDB85C08A74E3994AFAE5399F86F361F2B73D2D45779AA8E5DD85087 651DB0892DDCD92D1DAE8DCB2993874B3D3A0E1DD6480EECDED4164972EEE83E7CA0E0CAE2FEEFFF 4CADB237781739E8686DB917E166D769CA5EF754C42D5B405534E47C652BA35BB44EDFD8E8FC8BAF 05FB840B908804144B5F7DE6EE56B69685FBEC14BBA34ED5F89027D1502B1CAAF83409BB8FE1F64A D0E62361D2C8887D8B3F19D7B97B5C404D6342EE3219C78712992808C2A016D904F4C446B7FC00DE 2923BE663DB998E8D1C42F448B93963945C436DCD34082A00134EEDB8E039F503329002C1C8A7D20 151444B807731DD9A5F1AD15C4AD6A64D57230D9FAAFD8659911A1E4C4EC448794BE5E95B9C795A2 DE8A116AC84F9C7B54CD6A32C231CB3D1D84CE0615963F32CDBBAAC18238B4219889964C12D36DEF 9585902836E2335984ADB4EEEED351BB7EB54590C27AE8F1A58A4E0374D96A6801A1CECAA0FD6254 E9EA98BCDD79BEC0BEB45F20F345DB83EEFD7FD036BA20E008F2E948414501AF98F3ACB86AB6F815 85739C59159A14365FCC12FD73FD16C44BF22CBC82E1B8DD78BD847DF2D169D8E74F7EEA457B22BE 2332E9029B58AA9E9FFA2DB5F1EAEF85964CC9C5B064E7DEB87F58B9BD22A2FDE837EC07ECEADCF1 8F3B5AF751C529940D7B38340F73A264712A246D033C7B6ED919E9D6CF056E7C847C20899EE8C3CC 9E2026C58FE960E222323A8200049ABBC81C9D9DB51E0AC865C3A989A493822EF3271DBE74E55023 DBFEC5977142EBC72E14B1D8F982C1A598BB29342016D1C2FCC90C7BAE43B45EA637373809981AAA F2C894D8440BF15F8E3FEA17274DC488DED6EEF09DAC11858F27EA74742843B1BD644ECEA1D322C3 B352F17CF7ADEB8BDF9FBD9BDF6A94BD4FF4F6A0D73710F72DDE3A8E10F9EB602CDEB174B54E1035 1607E3ACA4124214E9A51DAA16056B12AE5DAAC03EF0E7BB16FE2B550C1904304AE6F65D04693A44 930F313777F9F8EBB364EBC4593480C12341F22E3EE1D2F07C05F6AB7B9FE80FD76AC25206A395EB AF4FDF0F7484BA614B9D00D9F165272A78082CB052A9F4D0FE37A32655481B79B9A4492D666CEFB2 0B4CC075C4493583BC7538912BEAD563AB2949BF502F636142E8C9456E8E8443C227BC14AB2F7B98 3CB05C2781068EA5038EC92AACAB0B64175D2EBB46DE3A35B56AAD70BD6927D619649A1851B9C2E9 26AE2E7C7D058B83D136466F5A92B7522C69F0E2BBC4D63F28724187BE8A18A92146AAC7CAE6EAE1 C630E7A427D552019FF33E7C0A26B3482E8DAF2D93D99E78128EF9B6C7D30022A0FF38BECEB08055 FDCE186E776DBABDC86FA76C02FF5DBA9AFAAB6AD6F09848004B6D33E2ECC2B34CD8A7EEE562B006 97321DC43A37E016BD517054398392EDE9C93B2D180DD0F91CEF8F867B2A1959392FDFCA3BBB06A5 A28D2CCE32302ECC8264FE43A72A0D9F61D10A71B81873BACB92A300D39288F35B7F25C335620A8B 21B72F814F4B803CE198A8F728B58F605A1FDBB5A9BB3162F4AB01808F8F3AAB22A42D6D24DD8D17 25A60C6BECA4716F670DC26264856DD0DD7C7F1350127D65E9618D63ED32EB3DD75C5DB6A61BDE10 9F948F885A247829A37E6BC8C152924D718E6A59352244DBE77CCEFEEBCC07920C4E3B0DF4696827 3064C78D044AD21DABE9F44F4AB3632F41925AFC03FBF56A02805A7ED764677090AFE0E3799FB195 8FBB8FFAFEEE51A59FA3435D1D3BC136D7FD1A58C8F7750C9AB813D1453CD5591433DED716FC608C 85EC0044DBAB5C1DE619EC3DC79A31CDF740B12E1C64F19EFB19072BC537DEC89CD3506A1BB80D6C F15CB74E0855624FE9964ACCC4D51D0D1B4AF2EA992C4CEACAB5FC12F90A366823734E2B434F5398 139D70C4D64412B1870C2C25248DA78CE14F9B94855322EACA233EFCB2D0EEFA8169FBFF1F0C1ED6 C4E0933BEEA75B3A72D61D5991BA0BB075AF7FB9CA6BDE3D129F4D43E38FFB266EEA05F216F7C297 FD97E98C29986A51DB38C0195FF39C27A740F33F051AE4184D5158FFF3F7D5E4ADF1FB654085527A C3A894C577D34A114B4634BBB1258E8C175856E6E6F50D9B899E0EFA1C84D4304F85536CFFAF95AF A7BA054234CC78B8290E58CE26E5A3F2417F0B4A1035C06D531D62ED6C835E17752A439F5B45C48F 51DC0C8BF9E2E772B70FA26010C8AC8B57B9B534EB76B5D8C2ED56C1BDC937B8BE9231D9F21FB79A 6FCE3A94DB7374BF97DECAE2E2276F4DC86ED5BF1F8E63B644F3DCDDC80F54F62C8B885EF60ACC61 7679425E3DD664D613E14F685F0269111EA7D0D2A90DEAC12FCE5664CC721EB8F8FE5A92A98978F5 30E9201C3A4818C21BCEC0D9BF9D5A1E75BC7395E96C7173B126EE8FC0EF22FA5CA0571CE9835104 3972313875D4B6D132366A333826FD8EC8410082931432A4855E1744A2A87C6E6F80EA5366A95572 E4267501E9C45361398887E44E7A5E58AD6430DEB130916A25F3475D90C24E2D15A302FB96D6CCB8 9F93DA89C345794EC9504EDD8EB4F7C3EECA3D86F955752BBEF80EC67FF79A05130A976B7E3B860B F6DAC3 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark{restore}if %%EndFont %%EndResource /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 295.875 translate 1 -1 scale gsave 150 dict begin /Mfixwid true def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /Plain /Courier findfont def /Bold /Courier-Bold findfont def /Italic /Courier-Oblique findfont def /MathPictureStart { /Mimatrix matrix currentmatrix def gsave newpath Mleft Mbottom translate /Mtmatrix matrix currentmatrix def Plain Mfontsize scalefont setfont 0 setgray 0 setlinewidth } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mleft Mbottom Mwidth Mheight 9 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 11 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mleft 0 def /Mbottom 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mbottom exch def /Mleft exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 0 0 moveto false charpath flattenpath pathbbox newpath } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get show } for } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub dup /MsaveAx exch def div 4 1 roll exch sub dup /MsaveAy exch def div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabsproc { 0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt } bind def /Mabswid { Mabsproc setlinewidth } bind def /Mabsdash { exch [ exch { Mabsproc } forall ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop } repeat } bind def } ifelse % Here are the short operators /g { setgray} bind def /k { setcmykcolor} bind def /m { moveto} bind def /p { gsave} bind def /r { setrgbcolor} bind def /w { setlinewidth} bind def /C { curveto} bind def /F { fill} bind def /L { lineto} bind def /P { grestore} bind def /s { stroke} bind def /MFill { 0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill } bind def /MPlotRegion { 3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def } bind def /Mcharproc { currentfile (x) readhexstring pop 0 get exch div } bind def /Mshadeproc { dup 3 1 roll { dup Mcharproc 3 1 roll } repeat 1 eq { setgray } { 3 eq { setrgbcolor } { setcmykcolor } ifelse } ifelse } bind def /Mrectproc { 3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill } bind def /_Mcolorimage { 7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index { 1 1 4 index { dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc } for pop } for pop pop pop pop } bind def /_Mimage { pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index { 1 1 4 index { dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc } for pop } for pop pop pop } bind def /Mimage { 4 index 4 index mul 1600 gt { image } { _Mimage } ifelse } def /Mcolorimage { 6 index 6 index mul 1600 gt { colorimage } { _Mcolorimage } ifelse } def /Mnodistort true def 1.000000 1.000000 scale 88.000000 291.875000 translate 1.000000 -1.000000 scale -0.000000 -0.000000 translate /Mleft 0.000000 def /Mbottom 0.000000 def /Mwidth 232.937500 def /Mheight 287.875000 def 0 setgray 0 setlinewidth /Courier findfont 12 scalefont setfont /Mfontsize 12 def /Plain /Courier findfont def %! %%Creator: Mathematica %%AspectRatio: 1.23607 MathPictureStart /Mabs { Mgmatrix idtransform Mtmatrix dtransform } bind def /Mabsadd { Mabs 3 -1 roll add 3 1 roll add exch } bind def %% Graphics %%IncludeResource: font Courier %%IncludeFont: Courier /Courier findfont 10 scalefont setfont % Scaling calculations 0.0238095 0.952381 0.618034 0.952381 [ [.00476 .74883 -17.75 -5.59375 ] [.00476 .74883 0 5.59375 ] [.00476 .87964 -17.75 -5.59375 ] [.00476 .87964 0 5.59375 ] [.00476 1.01044 -17.75 -5.59375 ] [.00476 1.01044 0 5.59375 ] [.00476 1.14124 -17.75 -5.59375 ] [.00476 1.14124 0 5.59375 ] [.08428 .01038 -10.7188 -11.1875 ] [.08428 .01038 10.7188 0 ] [.23545 .01038 -7.96875 -11.1875 ] [.23545 .01038 7.96875 0 ] [.38662 .01038 -7.96875 -11.1875 ] [.38662 .01038 7.96875 0 ] [.53779 .01038 -7.96875 -11.1875 ] [.53779 .01038 7.96875 0 ] [.68896 .01038 -7.96875 -11.1875 ] [.68896 .01038 7.96875 0 ] [.84014 .01038 -4.75 -11.1875 ] [.84014 .01038 4.75 0 ] [.00476 .16023 -17.75 -5.59375 ] [.00476 .16023 0 5.59375 ] [.00476 .29103 -17.75 -5.59375 ] [.00476 .29103 0 5.59375 ] [.00476 .42183 -17.75 -5.59375 ] [.00476 .42183 0 5.59375 ] [.00476 .55263 -17.75 -5.59375 ] [.00476 .55263 0 5.59375 ] [-0.11905 .91234 -11.375 -41.0938 ] [-0.11905 .91234 0 41.0938 ] [.5 -0.05886 -25.2812 -11.1875 ] [.5 -0.05886 25.2812 0 ] [-0.11905 .32373 -11.375 -41.0938 ] [-0.11905 .32373 0 41.0938 ] [ 0 0 0 0 ] [ 1 1.23607 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath % Start of sub-graphic p 0.0238095 0.618034 0.97619 1.20664 MathSubStart %% Graphics %%IncludeResource: font Courier %%IncludeFont: Courier /Courier findfont 10 scalefont setfont % Scaling calculations 0.857143 0.0793651 -2.08167e-17 0.137341 [ [ 0 0 -0.25 0 ] [ 0 0 -0.25 0 ] [ 0 .61803 .25 0 ] [ 1 0 .25 0 ] [ 0 0 0 0 ] [ 1 .61803 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath 0 g .5 Mabswid [ ] 0 setdash .06349 0 m .06349 .00625 L s .22222 0 m .22222 .00625 L s .38095 0 m .38095 .00625 L s .53968 0 m .53968 .00625 L s .69841 0 m .69841 .00625 L s .85714 0 m .85714 .00625 L s .02381 0 m .02381 .00312 L s .10317 0 m .10317 .00312 L s .14286 0 m .14286 .00312 L s .18254 0 m .18254 .00312 L s .2619 0 m .2619 .00312 L s .30159 0 m .30159 .00312 L s .34127 0 m .34127 .00312 L s .42063 0 m .42063 .00312 L s .46032 0 m .46032 .00312 L s .5 0 m .5 .00312 L s .57937 0 m .57937 .00312 L s .61905 0 m .61905 .00312 L s .65873 0 m .65873 .00312 L s .7381 0 m .7381 .00312 L s .77778 0 m .77778 .00312 L s .81746 0 m .81746 .00312 L s .89683 0 m .89683 .00312 L s .93651 0 m .93651 .00312 L s .97619 0 m .97619 .00312 L s 0 0 m 1 0 L s 0 .13734 m .00625 .13734 L s 0 .27468 m .00625 .27468 L s 0 .41202 m .00625 .41202 L s 0 .54936 m .00625 .54936 L s 0 .02747 m .00313 .02747 L s 0 .05494 m .00313 .05494 L s 0 .0824 m .00313 .0824 L s 0 .10987 m .00313 .10987 L s 0 .16481 m .00313 .16481 L s 0 .19228 m .00313 .19228 L s 0 .21975 m .00313 .21975 L s 0 .24721 m .00313 .24721 L s 0 .30215 m .00313 .30215 L s 0 .32962 m .00313 .32962 L s 0 .35709 m .00313 .35709 L s 0 .38455 m .00313 .38455 L s 0 .43949 m .00313 .43949 L s 0 .46696 m .00313 .46696 L s 0 .49443 m .00313 .49443 L s 0 .5219 m .00313 .5219 L s 0 .57683 m .00313 .57683 L s 0 .6043 m .00313 .6043 L s .25 Mabswid 0 .13734 m 0 .13734 L s 0 .27468 m 0 .27468 L s 0 .41202 m 0 .41202 L s 0 .54936 m 0 .54936 L s .5 Mabswid 0 0 m 0 .61803 L s .06349 .61178 m .06349 .61803 L s .22222 .61178 m .22222 .61803 L s .38095 .61178 m .38095 .61803 L s .53968 .61178 m .53968 .61803 L s .69841 .61178 m .69841 .61803 L s .85714 .61178 m .85714 .61803 L s .02381 .61491 m .02381 .61803 L s .10317 .61491 m .10317 .61803 L s .14286 .61491 m .14286 .61803 L s .18254 .61491 m .18254 .61803 L s .2619 .61491 m .2619 .61803 L s .30159 .61491 m .30159 .61803 L s .34127 .61491 m .34127 .61803 L s .42063 .61491 m .42063 .61803 L s .46032 .61491 m .46032 .61803 L s .5 .61491 m .5 .61803 L s .57937 .61491 m .57937 .61803 L s .61905 .61491 m .61905 .61803 L s .65873 .61491 m .65873 .61803 L s .7381 .61491 m .7381 .61803 L s .77778 .61491 m .77778 .61803 L s .81746 .61491 m .81746 .61803 L s .89683 .61491 m .89683 .61803 L s .93651 .61491 m .93651 .61803 L s .97619 .61491 m .97619 .61803 L s 0 .61803 m 1 .61803 L s .99375 0 m 1 0 L s .99375 .13734 m 1 .13734 L s .99375 .27468 m 1 .27468 L s .99375 .41202 m 1 .41202 L s .99375 .54936 m 1 .54936 L s .99688 .02747 m 1 .02747 L s .99688 .05494 m 1 .05494 L s .99688 .0824 m 1 .0824 L s .99688 .10987 m 1 .10987 L s .99688 .16481 m 1 .16481 L s .99688 .19228 m 1 .19228 L s .99688 .21975 m 1 .21975 L s .99688 .24721 m 1 .24721 L s .99688 .30215 m 1 .30215 L s .99688 .32962 m 1 .32962 L s .99688 .35709 m 1 .35709 L s .99688 .38455 m 1 .38455 L s .99688 .43949 m 1 .43949 L s .99688 .46696 m 1 .46696 L s .99688 .49443 m 1 .49443 L s .99688 .5219 m 1 .5219 L s .99688 .57683 m 1 .57683 L s .99688 .6043 m 1 .6043 L s 1 0 m 1 .61803 L s 0 0 m 1 0 L s .85714 0 m .85714 .61803 L s 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath newpath [ ] 0 Mabsdash .02381 0 m .02435 0 L .02494 0 L .02549 0 L .02573 0 L .02599 0 L .02629 0 L .02657 0 L .02688 0 L .02705 0 L .02721 0 L .0275 0 L .02777 0 L .02808 0 L .02837 0 L .02895 0 L .02956 0 L .02986 0 L .03014 0 L .03039 0 L .03067 0 L .03097 0 L .0313 0 L .03197 0 L .03318 0 L .03386 0 L .0342 0 L .03451 0 L .03479 0 L .03509 0 L .03539 0 L .03556 0 L .03573 0 L .03588 0 L .03606 0 L .03624 0 L .03641 0 L .03672 0 L .03704 0 L .03742 0 L .03778 0 L .03846 0 L .03877 0 L .03906 0 L .03936 0 L .03952 0 L .03969 0 L .04082 0 L .04151 0 L .04217 0 L Mistroke .04275 0 L .04308 0 L .04339 0 L .04369 0 L .04401 0 L .04433 0 L .04451 0 L .04468 0 L .04499 0 L .04527 0 L .04559 0 L .0459 0 L .04646 0 L .04699 0 L .04756 0 L .04785 0 L .04817 0 L .04946 0 L .05017 0 L .05082 0 L .05143 0 L .0517 0 L .05199 0 L .0523 0 L .0526 0 L .05277 0 L .05294 0 L .05326 0 L .05355 0 L .05381 0 L .05412 0 L .05441 0 L .05493 0 L .0555 0 L .05611 0 L .05643 0 L .05661 0 L .05677 0 L .05707 0 L .05734 0 L .05796 0 L .05857 0 L .05923 0 L .05984 0 L .06042 0 L .06073 0 L .06089 0 L .06107 0 L .06138 0 L .06166 0 L Mistroke .06182 0 L .06199 0 L .0623 0 L .06249 0 L .06268 0 L .06302 0 L .06332 0 L .06364 0 L .06424 0 L .06476 0 L .06506 0 L .06534 0 L .06564 0 L .06597 1e-05 L .06663 1e-05 L .06782 3e-05 L .06839 3e-05 L .0687 3e-05 L .06902 3e-05 L .0693 4e-05 L .06961 4e-05 L .06989 4e-05 L .07015 4e-05 L .07041 4e-05 L .07069 4e-05 L .07092 4e-05 L .07118 3e-05 L .07145 3e-05 L .07175 3e-05 L .07228 3e-05 L .07291 2e-05 L .07357 0 L Mfstroke .07357 0 m .07379 0 L s .0918 0 m .0928 .00539 L .09405 .01311 L .09628 .02896 L .10133 .0706 L .10363 .09052 L .10489 .0997 L .10609 .10671 L .10663 .10922 L .1072 .1114 L .1075 .11231 L .10783 .11314 L .10813 .11373 L .10841 .11412 L .10867 .11435 L .10894 .11357 L .10918 .1118 L .10943 .10974 L .11053 .09957 L .11318 .06887 L .11568 .03669 L .11677 .02316 L .11706 .01974 L .11737 .01615 L .11766 .01345 L .11793 .01207 L .11853 .00921 L .11919 .00649 L .12036 .00268 L .12095 .00122 L s .12095 .00122 m .12154 0 L s .13564 0 m .13578 1e-05 L .13636 5e-05 L .13699 8e-05 L .13754 .0001 L .13781 .00011 L .13811 .00012 L .13836 .00012 L .13863 .00012 L .13889 .00012 L .13913 .00012 L .13941 .00012 L .13968 .00012 L .13998 .00012 L .1403 .00011 L .14095 .0001 L .14154 8e-05 L .1427 4e-05 L .14326 2e-05 L .1435 1e-05 L .14377 0 L .14408 0 L .14437 0 L .145 0 L .14535 0 L .14571 0 L .14602 0 L .14619 0 L .14635 0 L .14667 0 L .14697 0 L .14728 0 L .14746 0 L .14762 0 L .1479 0 L .1482 0 L .14851 0 L .14881 0 L .15119 0 L .15177 0 L .15209 0 L .15239 0 L .15256 0 L .15275 0 L .15307 0 L .1537 0 L .15424 0 L .15455 0 L .15484 0 L .15514 0 L Mistroke .15542 0 L .15573 0 L .15604 0 L .1563 0 L .15657 0 L .15683 0 L .15707 0 L .15765 0 L .15819 0 L .15942 0 L .16056 0 L .16086 0 L .16114 0 L .1613 0 L .16146 0 L .16176 0 L .16244 0 L .16274 0 L .16307 0 L .16335 0 L .1636 0 L .16386 0 L .1641 0 L .16438 0 L .16465 0 L .16494 0 L .16524 0 L .16554 0 L .16586 0 L .16645 0 L .16702 0 L .16755 0 L .16869 0 L .16899 0 L .16931 0 L .16962 0 L .16991 0 L .17017 0 L .17046 0 L .17106 0 L .1716 0 L .17211 0 L .1724 0 L .17272 0 L .17288 0 L .17305 0 L .17336 0 L .17368 0 L .17397 0 L .17423 0 L Mistroke .17452 0 L .17517 0 L .17587 0 L .17712 0 L .17773 0 L .17803 0 L .17831 0 L .17856 0 L .17883 0 L .1794 0 L .18186 0 L .18629 0 L .19638 0 L .2061 0 L .21545 0 L .2202 0 L .2254 0 L .22779 0 L .22911 0 L .22976 0 L .23004 0 L .23036 0 L .23065 0 L .23092 0 L .23152 0 L .23278 0 L .23384 0 L .23413 0 L .23443 0 L .23472 0 L .23498 0 L .23528 0 L .23544 0 L .23561 0 L .23589 0 L .23619 0 L .23647 0 L .23676 0 L .23704 0 L .2373 0 L .23791 0 L .23857 0 L .23887 0 L .23904 0 L .23919 0 L .2395 0 L .23977 0 L .24081 0 L .24191 0 L .24249 0 L Mistroke .24279 0 L .24312 0 L .24342 0 L .24369 0 L .24397 0 L .24423 0 L .2445 0 L .2448 0 L .24509 0 L .24534 0 L .24565 0 L .24597 0 L .24658 0 L .2472 0 L .24754 0 L .24771 0 L .24787 0 L .24817 0 L .24833 0 L .2485 0 L .24907 0 L .2501 0 L .2512 0 L .25152 0 L .25183 0 L .25213 0 L .25241 0 L .25267 0 L .25295 0 L .25323 0 L .25354 0 L .25383 0 L .25411 0 L .25441 0 L .25473 0 L .25539 0 L .25598 0 L .25625 0 L .25654 0 L .25685 0 L .25714 0 L .25823 0 L .25939 0 L .26004 0 L .26035 0 L .26063 0 L .26097 0 L .26115 0 L .26134 0 L .26152 0 L Mistroke .26168 0 L .262 0 L .26216 0 L .26232 0 L .26262 0 L .26293 0 L .26328 0 L .26389 0 L .26456 0 L .26486 0 L .26503 0 L .26518 0 L .26546 0 L .26576 0 L .26686 0 L .26802 0 L .26863 0 L .26895 0 L .2693 0 L .26961 0 L .2699 0 L .27019 0 L .27046 0 L .27078 0 L .27094 0 L .27112 0 L .27143 0 L .27173 0 L .27207 0 L .27239 0 L .27309 0 L .27365 0 L .27396 0 L .27426 0 L .27457 0 L .27485 0 L .27549 0 L .27664 0 L .2772 0 L .27771 0 L .27798 0 L .27828 0 L .27859 0 L .27888 0 L .27904 0 L .27921 0 L .27938 0 L .27955 0 L .27984 0 L .28016 0 L Mistroke .28049 0 L .28085 0 L .28151 0 L .28215 0 L .28243 0 L .28274 0 L .28306 0 L .28339 0 L .28398 0 L .28462 0 L .28531 0 L .28596 0 L .28656 0 L .28684 0 L .28715 0 L .28745 0 L .28772 0 L .28798 0 L .28826 0 L .28852 0 L .28876 0 L .28903 0 L .28932 0 L .28991 0 L .29049 0 L .29081 0 L .29111 0 L .2914 0 L .2917 0 L .29198 1e-05 L .29223 1e-05 L .29337 3e-05 L .294 4e-05 L .29431 4e-05 L .29459 5e-05 L .29485 5e-05 L .29513 5e-05 L .29543 5e-05 L .29571 5e-05 L .29598 5e-05 L .29627 5e-05 L .29654 5e-05 L .29678 4e-05 L .29708 4e-05 L .29739 4e-05 L .29795 3e-05 L .29861 1e-05 L Mfstroke .29861 1e-05 m .29881 0 L s .31434 0 m .31486 .00077 L .31594 .00292 L .31655 .00447 L .31688 .00543 L .3172 .00641 L .31749 .0074 L .31781 .00938 L .31836 .01342 L .32101 .03482 L .32352 .05591 L .32474 .06558 L .32585 .07363 L .32614 .07557 L .32646 .0769 L .32675 .07753 L .32703 .07804 L .32764 .07897 L .32795 .07933 L .32829 .07966 L .32864 .07992 L .32895 .08009 L .32912 .08016 L .3293 .08021 L .32949 .08025 L .32967 .08028 L .32984 .08028 L .33 .08028 L .33029 .08025 L .33061 .08017 L .3308 .08011 L .33096 .08005 L .33316 .07865 L .33379 .07817 L .33439 .07774 L .33465 .07756 L .33493 .07739 L .33523 .07782 L .33552 .07846 L .3381 .08466 L .33937 .08759 L .34052 .08999 L .3416 .09187 L .34218 .09267 L .34279 .09337 L .34311 .09365 L .3434 .09386 L .3437 .09398 L .34398 .0937 L .34458 .09292 L Mistroke .34523 .09184 L .34635 .08941 L .34754 .08606 L .34966 .07815 L .35083 .0728 L .35194 .06709 L .35323 .05794 L .3544 .04819 L .35673 .02886 L .35884 .01307 L .35995 .00602 L .36054 .00281 L .36069 .00203 L .36086 .00122 L .36116 .00031 L .36148 .00034 L .36166 .0004 L .36182 .0005 L .36214 .00076 L .36244 .0011 L .36301 .00203 L .36364 .00339 L .36476 .00667 L .36595 .01111 L .36809 .0208 L .37042 .03197 L .37287 .04204 L .37496 .0492 L .37615 .05233 L .37667 .05346 L .37725 .05447 L .37757 .05493 L .37786 .05529 L .37813 .05556 L .37844 .0558 L .37871 .05542 L .37896 .05482 L .37952 .05335 L .38194 .04462 L .38453 .0326 L .38581 .02629 L .38699 .02049 L .38813 .01652 L .38935 .01286 L .39191 .00623 L .39313 .00366 L .39427 .00158 L .3953 1e-05 L Mfstroke .3953 1e-05 m .3953 0 L s .40553 0 m .40622 .00021 L .41088 .00119 L .41215 .00142 L .41277 .00152 L .41304 .00156 L .41333 .0016 L .41364 .00161 L .41393 .00162 L .41409 .00163 L .41426 .00163 L .41457 .00163 L .41473 .00164 L .4149 .00164 L .41521 .00164 L .41539 .00164 L .41559 .00164 L .41575 .00164 L .41593 .00163 L .41625 .00163 L .41654 .00162 L .4172 .0016 L .41779 .00157 L .41841 .00154 L .42067 .00138 L .42575 .00097 L .42804 .00081 L .42932 .00074 L .42993 .00071 L .43022 .0007 L .43049 .00069 L .43076 .00069 L .43102 .0007 L .43158 .00073 L .43277 .00079 L .43493 .00094 L .4373 .00111 L .43849 .00118 L .43882 .0012 L .439 .00121 L .43917 .00122 L .43933 .00123 L .4395 .00123 L .4398 .00122 L .44211 .0011 L .44428 .00099 L .44482 .00097 L .44538 .00095 L .44567 .00094 L .446 .00093 L Mistroke .44629 .00093 L .44656 .00092 L .44672 .00092 L .44689 .00092 L .4472 .00092 L .4475 .00093 L .44778 .00093 L .44808 .00094 L .44825 .00095 L .44841 .00097 L .44908 .00103 L .45036 .0012 L .45154 .00138 L .45417 .00193 L .45533 .00224 L .45597 .00242 L .45657 .0026 L .45713 .00284 L .45773 .00313 L .45879 .00365 L .46119 .00483 L .46246 .0054 L .46382 .00595 L .46449 .00618 L .46482 .00628 L .46513 .00637 L .46541 .00645 L .4657 .00642 L .46633 .00634 L .46744 .00613 L .46866 .00585 L .47133 .00515 L .4725 .00487 L .47312 .00474 L .47346 .00467 L .47378 .00462 L .47409 .00457 L .47427 .00456 L .47443 .00456 L .47472 .00457 L .47503 .00459 L .47531 .00461 L .47558 .00463 L .47619 .0047 L .47677 .0048 L .47729 .00491 L .47848 .00523 L .47972 .00571 L .48108 .0064 L .48236 .00722 L Mistroke .48354 .00827 L .48806 .01386 L .49306 .02123 L .49814 .02868 L .5028 .03361 L .50766 .03727 L .51003 .03907 L .51218 .04092 L .51439 .0435 L .51563 .04533 L .51676 .04732 L .518 .0502 L .51934 .0546 L .52178 .06348 L .53133 .0963 L .54051 .12823 L .54167 .13215 L .54293 .13604 L .54351 .13766 L .54382 .13842 L .54412 .13888 L .5447 .13969 L .54523 .14033 L .5465 .14154 L .54721 .14203 L .54787 .14237 L .54843 .14258 L .54875 .14267 L .54905 .14274 L .54936 .1428 L .54965 .14283 L .54981 .14284 L .54998 .14285 L .55029 .14286 L .55059 .14285 L .55086 .14283 L .55116 .1428 L .55147 .14275 L .552 .14265 L .5523 .14258 L .55257 .14259 L .55273 .14261 L .55289 .14264 L .5532 .14267 L .5535 .1427 L .55378 .14272 L .55408 .14274 L .55425 .14274 L .55442 .14275 L .55459 .14275 L Mistroke .55474 .14274 L .55492 .14274 L .55509 .14273 L .55538 .14271 L .55555 .1427 L .55571 .14268 L .55636 .1426 L .55692 .14249 L .55753 .14235 L .55892 .14189 L .55958 .1416 L .56019 .14131 L .56047 .14116 L .56078 .14098 L .56107 .14081 L .56133 .14049 L .56256 .13873 L .56477 .13557 L .56602 .13397 L .5672 .13273 L .56784 .13219 L .56843 .13181 L .56876 .13163 L .56908 .13151 L .56924 .13146 L .56942 .13141 L .56961 .13138 L .56978 .13136 L .57008 .13157 L .57026 .13175 L .57042 .13193 L .57108 .13278 L .57228 .13472 L .57498 .14091 L .57734 .14816 L .57987 .15876 L .58467 .18165 L .58599 .18698 L .58671 .18958 L .58688 .19016 L .58706 .19075 L .58722 .19124 L .58739 .19137 L .58768 .19145 L .58796 .19148 L .58826 .19147 L .58858 .19142 L .58875 .19137 L .58893 .19131 L .58927 .19116 L Mistroke .5899 .19079 L .59234 .18865 L .59367 .18745 L .59433 .18697 L .59461 .1868 L .59492 .18664 L .59521 .18652 L .59547 .18644 L .59572 .18639 L .59599 .18658 L .5963 .18728 L .59659 .18798 L .59713 .18938 L .59956 .19693 L .60892 .22923 L .61121 .23661 L .61247 .24105 L .61367 .2461 L .61508 .25416 L .61636 .26162 L .61887 .27573 L .62003 .28167 L .62067 .28469 L .62126 .28733 L .62177 .28943 L .62205 .29038 L .62231 .29054 L .6226 .29067 L .62291 .29077 L .6232 .29081 L .62347 .29082 L .62378 .29078 L .62396 .29075 L .62412 .2907 L .62442 .2906 L .62474 .29047 L .62589 .28982 L .62723 .28894 L .62782 .2886 L .62813 .28845 L .62846 .28831 L .62875 .28822 L .62892 .28818 L .62907 .28816 L .62935 .28813 L .62964 .28814 L .62992 .28818 L .63022 .28828 L .63048 .2884 L .63076 .28864 L Mistroke .63092 .2892 L .63108 .28974 L .63137 .2908 L .63203 .29336 L .63322 .29856 L .63766 .32299 L .6421 .3526 L .64462 .36865 L .64585 .37542 L .64698 .38075 L .64755 .38308 L .64785 .3842 L .64817 .38514 L .64848 .3853 L .64876 .38537 L .64904 .38538 L .6493 .38532 L .64961 .38519 L .64976 .3851 L .64993 .38498 L .6505 .38442 L .65082 .384 L .65117 .38348 L .6518 .38237 L .65317 .37921 L .65446 .37551 L .6569 .36756 L .65924 .36095 L .66173 .35432 L .66385 .34951 L .66443 .3484 L .66474 .34786 L .66506 .34732 L .66534 .34687 L .66565 .34677 L .66593 .34699 L .6662 .34722 L .66875 .35013 L .67 .35158 L .67056 .35213 L .67116 .35263 L .67142 .35282 L .6717 .35298 L .67195 .3531 L .67221 .3532 L .67251 .35327 L .67279 .35329 L .67307 .35328 L .67332 .35322 L .67363 .3531 L Mistroke .67392 .35293 L .67418 .35273 L .67446 .35176 L .67567 .34641 L .68563 .29452 L .68803 .28666 L .68935 .28235 L .69059 .27813 L .69116 .27615 L .69147 .27504 L .69176 .27362 L .69207 .27169 L .69241 .26956 L .69302 .26577 L .69522 .25226 L .6975 .23996 L .69862 .23504 L .69967 .23138 L .69996 .23053 L .70024 .2298 L .7004 .22965 L .70057 .22954 L .70086 .22941 L .70102 .22938 L .70119 .22937 L .70137 .2294 L .70154 .22946 L .70184 .22965 L .70201 .2298 L .70216 .22996 L .70272 .23077 L .70304 .23138 L .70334 .23205 L .70445 .23547 L .70503 .23785 L .70557 .24038 L .70678 .24735 L .70792 .2555 L .70847 .26005 L .70871 .26215 L .70897 .26452 L .70926 .26826 L .70953 .27193 L .71013 .2803 L .7114 .29909 L .71397 .33942 L .71645 .37821 L .71878 .408 L .71995 .41922 L .72121 .42932 L Mistroke .72193 .4341 L .72261 .43796 L .72327 .44102 L .72388 .44329 L .72447 .44487 L .7248 .4455 L .72511 .44593 L .72536 .44616 L .72565 .44628 L .72594 .44626 L .72621 .44609 L .72637 .44593 L .72654 .44481 L .72684 .44264 L .72741 .43817 L .7287 .42645 L .73316 .37691 L .73426 .36498 L .73483 .35911 L .73512 .35643 L .73544 .35513 L .73612 .35274 L .73674 .35097 L .73737 .34957 L .73796 .34861 L .73828 .34822 L .73845 .34805 L .73862 .3479 L .73878 .34778 L .73895 .34769 L .73925 .34757 L .73954 .34753 L .73986 .34756 L .74015 .34766 L .74042 .34781 L .74076 .34806 L .74107 .34836 L .74177 .34928 L .74239 .35034 L .74305 .35171 L .74424 .35498 L .74532 .35885 L .74777 .36841 L .74991 .37657 L .75109 .3805 L .75166 .3822 L .7522 .38361 L .75249 .38428 L .75279 .38409 L .7531 .38385 L Mistroke .75344 .38352 L .75457 .38198 L .75571 .37983 L .75678 .37741 L .75935 .37063 L .75997 .36894 L .76062 .36716 L .76094 .36631 L .76124 .36559 L .76151 .36545 L .7618 .36531 L .76414 .36443 L .76539 .36391 L .76602 .36357 L .76671 .36312 L .76792 .36204 L .76851 .36136 L .76905 .36062 L .7693 .36023 L .76958 .35977 L .76984 .35931 L .77009 .35822 L .7712 .3527 L .77573 .32917 L .77697 .32366 L .77762 .32113 L .77797 .31988 L .7783 .3188 L .7786 .31796 L .77891 .31877 L .77957 .32071 L .78072 .32469 L .78321 .33394 L .78452 .33808 L .78518 .33972 L .78555 .34048 L .7859 .34104 L .78606 .34125 L .78623 .34145 L .78653 .34171 L .78671 .34181 L .78689 .34186 L .78706 .34188 L .78722 .34185 L .78752 .33978 L .78785 .33721 L .78844 .33219 L .79079 .3089 L .79308 .28315 L .79434 .26896 L Mistroke .79554 .25614 L .79587 .25279 L .79603 .25139 L .79621 .25036 L .7966 .2483 L .79695 .2465 L .79823 .24076 L .79954 .23611 L .80074 .23279 L .80197 .23022 L .80313 .22843 L .80376 .22768 L .80436 .22711 L .80569 .22568 L .8063 .22514 L .80687 .22471 L .80739 .22439 L .80794 .22411 L .80823 .224 L .80854 .22389 L .80883 .2238 L .80909 .22374 L .8094 .22368 L .80957 .22366 L .80973 .22364 L .81002 .22362 L .81033 .22361 L .81063 .22361 L .8109 .22362 L .8112 .22365 L .81151 .22369 L .81204 .22379 L .81261 .22392 L .81294 .22401 L .81324 .2241 L .81341 .22423 L .81359 .22451 L .81391 .225 L .81513 .22684 L .81641 .22857 L .81712 .22932 L .81746 .22962 L .81777 .22985 L .81804 .23002 L .81833 .23015 L .81864 .23025 L .81894 .23029 L .81911 .23029 L .81926 .23028 L .81944 .23024 L Mistroke .8196 .23019 L .8199 .23005 L .82022 .22983 L .82052 .22955 L .82079 .22923 L .82141 .22829 L .82169 .22777 L .82198 .22712 L .82227 .22566 L .82253 .22388 L .82506 .20403 L .82769 .18105 L .82898 .17008 L .82955 .1655 L .83017 .16071 L .83043 .15874 L .83068 .15693 L .83097 .15573 L .83123 .15486 L .83181 .15313 L .83235 .15175 L .8329 .15057 L .83348 .14955 L .83411 .14868 L .8347 .14811 L .83501 .14788 L .83529 .14772 L .83545 .14765 L .83562 .14759 L .83593 .14752 L .83622 .1475 L .83653 .14752 L .83679 .14757 L .83708 .14766 L .83724 .14772 L .83742 .1478 L .83773 .14798 L .83843 .1485 L .83903 .14909 L .8392 .14926 L .83938 .14946 L .8397 .15 L .84217 .15514 L .84348 .15777 L .84419 .15905 L .84486 .1601 L .84549 .16093 L .84607 .16151 L .8464 .16176 L .84671 .16194 L Mistroke .84688 .16201 L .84704 .16206 L .84721 .1621 L .8474 .16211 L .8477 .16208 L .84788 .16203 L .84803 .16197 L .84832 .16117 L .84863 .16001 L .84974 .15521 L .85895 .10356 L .86408 .08254 L .86875 .05704 L .87107 .0447 L .8723 .0394 L .87297 .03696 L .8736 .03501 L .87386 .03429 L .87414 .03361 L .87445 .03384 L .87473 .03441 L .87598 .0378 L .87819 .04613 L .8805 .05626 L .88177 .06161 L .8824 .06403 L .88267 .06503 L .88297 .06603 L .88325 .06612 L .88352 .06616 L .88379 .06616 L .88409 .06612 L .88425 .06607 L .88442 .06601 L .88473 .06586 L .88503 .06566 L .88531 .06544 L .88633 .06431 L .88743 .0626 L .88993 .05713 L .89263 .04971 L .89752 .0351 L .90003 .02795 L .90236 .02245 L .9048 .01806 L .90609 .01641 L .90682 .01572 L .90716 .01545 L .90747 .01524 L .90776 .01508 L Mistroke .90803 .01495 L .90833 .01485 L .90864 .01478 L .90893 .01474 L .90925 .01499 L .90941 .01522 L .90958 .01547 L .90988 .01596 L .91211 .02026 L .91473 .02623 L .91588 .0288 L .91654 .03018 L .91715 .0314 L .91745 .03196 L .91773 .03245 L .91789 .03252 L .91806 .03259 L .91836 .0327 L .91868 .03278 L .91884 .03282 L .91902 .03284 L .91934 .03287 L .91964 .03287 L .9198 .03285 L .91997 .03284 L .92015 .03281 L .92031 .03278 L .92061 .0327 L .92093 .03259 L .92167 .03226 L .92233 .03185 L .92354 .03087 L .92485 .02949 L .92545 .02877 L .92608 .02794 L .92722 .02589 L .92951 .02113 L .93196 .01641 L .93315 .01455 L .93374 .01378 L .93428 .01316 L .93477 .0127 L .93505 .01249 L .93529 .0127 L .93557 .01308 L .93586 .01351 L .9364 .01439 L .94114 .02436 L .94244 .02701 L .94316 .02831 L Mistroke .94351 .0289 L .94366 .02914 L .94384 .02939 L .94414 .0293 L .94447 .02917 L .94515 .02877 L .94577 .02829 L .94635 .02775 L .94875 .02468 L .95096 .02115 L .95353 .01726 L .95593 .01455 L .95833 .01219 L .96052 .01046 L .96112 .01006 L .96177 .00974 L .96295 .0093 L .9636 .00912 L .96396 .00904 L .96429 .00898 L .9646 .00893 L .96489 .0089 L .9652 .00887 L .96537 .00885 L .96554 .00885 L .96584 .00884 L .96601 .00884 L .96617 .00884 L .96646 .00885 L .96676 .00887 L .96704 .0089 L .96729 .00893 L .96787 .00903 L .9685 .00917 L .96907 .00934 L .96939 .00944 L .96973 .00957 L .97005 .00971 L .97035 .00989 L .97482 .01332 L .97619 .01455 L Mfstroke [ 6 4 ] 0 Mabsdash .02381 0 m .03318 0 L .04339 0 L .05298 0 L .06221 0 L .07203 0 L .08148 0 L .09153 0 L .10121 0 L .11052 0 L .12043 0 L .12997 0 L .13914 0 L .14891 0 L .15831 0 L .16309 0 L .1683 0 L .17335 0 L .17793 0 L .1827 0 L .18534 0 L .18778 0 L .19245 0 L .1949 0 L .19749 0 L .19979 0 L .20106 0 L .20225 0 L .20337 0 L .20458 0 L .2056 0 L .2067 0 L .20731 0 L .20787 0 L .20898 0 L .20956 0 L .2102 0 L .21053 0 L .21087 0 L s .21087 0 m .21088 0 L s .21492 0 m .2153 0 L .21593 0 L .21627 0 L .21659 0 L .21674 0 L .21691 0 L .21709 0 L .21726 0 L .21758 0 L .21788 0 L .21818 0 L .21846 0 L .21877 0 L .21892 0 L .21909 0 L .21967 0 L .21999 0 L .22028 0 L .22055 0 L .2208 0 L .22107 0 L .22136 0 L .22168 0 L .22185 0 L .22201 0 L .22231 0 L .22263 0 L .22279 0 L .22296 0 L .22328 0 L .22399 0 L .22431 0 L .22447 0 L .22465 0 L .2248 0 L .22498 0 L .22528 0 L .22557 0 L .22588 0 L .22618 0 L .22645 0 L .22676 0 L .22705 0 L .22731 0 L .2276 0 L .22819 0 L .22852 0 L .22882 0 L .22909 0 L Mistroke .22937 0 L .22969 0 L .22997 0 L .23023 0 L .23052 0 L .23078 0 L .23103 0 L .23135 0 L .23153 0 L .23169 0 L .23231 0 L .2326 0 L .23287 0 L .23315 0 L .23346 0 L .23362 0 L .2338 0 L .23412 0 L .23442 0 L .23471 0 L .23502 0 L .2352 0 L .23536 0 L .23605 0 L .23634 0 L .23664 0 L .23693 0 L .23719 0 L .2375 0 L .23767 0 L .23783 0 L .23812 0 L .23844 0 L .23873 0 L .23905 0 L .23936 0 L .23963 0 L .24031 0 L .24065 0 L .24095 0 L .24122 0 L .24148 0 L .24175 0 L .24205 0 L .24235 0 L .24251 0 L .24267 0 L .24297 0 L .24325 0 L .24353 0 L Mistroke .2438 0 L .2443 0 L .24457 0 L .24485 0 L .24515 0 L .24543 0 L .24572 0 L .24604 0 L .24634 0 L .24662 0 L .2469 0 L .24715 0 L .24744 0 L .24771 0 L .24829 0 L .2486 0 L .24889 0 L .24921 0 L .24938 0 L .24956 0 L .24988 0 L .25017 0 L .25044 0 L .25073 0 L .25098 0 L .25126 0 L .25155 0 L .25187 0 L .25244 0 L .25273 0 L .25299 0 L .25327 0 L .25357 0 L .25383 0 L .25407 0 L .25434 0 L .2546 0 L .25488 0 L .25518 0 L Mfstroke .25518 0 m .25524 0 L s .25548 0 m .25572 0 L .25636 0 L .25668 0 L .25696 0 L .25725 0 L .25757 0 L .25773 0 L .25791 0 L .25808 0 L .25824 0 L .25852 0 L .25883 0 L s .25883 0 m .25909 0 L s .25953 0 m .25973 0 L .26003 0 L .2603 0 L .26058 0 L .26084 0 L .26112 0 L .26137 0 L .26161 0 L .26189 0 L .26219 0 L .26245 0 L s .26245 0 m .26272 0 L s .26391 0 m .26392 0 L .2642 0 L .26451 0 L .26479 0 L .26505 0 L .26535 0 L .26553 0 L .26568 0 L s .26568 0 m .26589 0 L s .28384 0 m .28417 0 L .28452 0 L .28515 0 L .28641 0 L .28779 0 L .28901 0 L .29031 0 L .29266 0 L .29386 0 L .29514 0 L .29581 0 L .29599 0 L .29619 0 L .29654 0 L .29689 0 L .29722 0 L .29751 0 L .29768 0 L .29783 0 L .29799 0 L .29816 0 L .29848 0 L .29876 0 L .29906 0 L .29922 0 L .29938 0 L .29968 0 L .29987 0 L .30004 0 L .3002 0 L .30037 0 L .30272 0 L .30382 0 L .30414 0 L .30444 0 L .305 0 L .3053 0 L .30562 0 L .30581 0 L .30598 0 L .30615 0 L .3063 0 L .3066 0 L .30676 0 L .30693 0 L .30721 0 L .30752 0 L .30769 0 L .30786 0 L Mistroke .30802 0 L .30819 0 L .3085 0 L .30879 0 L .31016 0 L .31144 0 L .31262 0 L .31372 0 L .31429 0 L .31489 0 L .3152 0 L .31549 0 L .31578 0 L .31606 0 L .31637 0 L .31667 0 L .31733 0 L .31786 0 L .31836 0 L .31949 0 L .32176 0 L .32428 0 L .32553 0 L .32668 0 L .32772 0 L .3283 0 L .32883 0 L .32913 0 L .32941 0 L .32971 0 L .32987 0 L .33003 0 L .33032 0 L .33062 0 L .33091 0 L .33117 0 L .33146 0 L .33173 0 L .33205 0 L .33234 0 L .33263 0 L .33293 0 L .33358 0 L .3358 0 L .33824 0 L .33888 0 L .33957 0 L .34018 0 L .34034 0 L .34052 0 L Mistroke .34084 0 L .34101 0 L .34117 0 L .34147 0 L .34164 0 L .34179 0 L .34196 0 L .34214 0 L .3423 0 L .34247 0 L .34278 0 L .34335 0 L .34393 0 L .34454 0 L .34563 0 L .35008 0 L .35239 0 L .35368 0 L .35486 0 L .35595 0 L .35625 0 L .35657 0 L .35685 0 L .35714 0 L .35742 0 L .35768 0 L .35793 0 L .35817 0 L .35845 0 L .35875 0 L .35902 0 L .35931 0 L .35961 0 L .35978 0 L .35994 0 L .36029 0 L .3606 0 L .3609 0 L .36118 0 L .3618 0 L .36212 0 L .3623 0 L .36247 0 L .36277 0 L .36292 0 L .36309 0 L .36326 0 L .36345 0 L .36364 0 L .36382 0 L Mistroke .36399 0 L .36415 0 L .3645 0 L .3648 0 L .36495 0 L .36512 0 L Mfstroke .36512 0 m .3656 0 L s .37302 0 m .37323 0 L .37349 0 L .3741 0 L .37527 1e-05 L .37593 1e-05 L .37656 1e-05 L .37781 2e-05 L .37916 3e-05 L .38169 5e-05 L .38403 7e-05 L .38464 7e-05 L .38494 8e-05 L .38521 8e-05 L .38553 8e-05 L .3857 8e-05 L .38588 8e-05 L .38648 8e-05 L .38787 8e-05 L .38848 8e-05 L .38881 8e-05 L .38898 8e-05 L .38915 8e-05 L .38944 8e-05 L .38959 9e-05 L .38976 9e-05 L .39033 9e-05 L .39144 .0001 L .3939 .00012 L .39503 .00013 L .39622 .00013 L .39671 .00014 L .39698 .00014 L .39723 .00014 L .39754 .00014 L .39781 .00014 L .39807 .00014 L .39835 .00014 L .39945 .00014 L .39974 .00014 L .40006 .00014 L .40036 .00014 L .40064 .00014 L .40081 .00014 L .40096 .00014 L .40115 .00014 L .40132 .00014 L .40161 .00014 L .40178 .00014 L .40194 .00014 L Mistroke .40316 .00015 L .40434 .00016 L .40564 .00018 L .40826 .00022 L .40887 .00023 L .40919 .00024 L .40953 .00024 L .41015 .00025 L .41073 .00026 L .41299 .00027 L .41543 .00029 L .41806 .00031 L .41926 .00032 L .41955 .00032 L .41986 .00032 L .42004 .00032 L .42021 .00032 L .42052 .00032 L .42081 .00032 L .42108 .00032 L .42138 .00032 L .42169 .00032 L .42196 .00032 L .42221 .00031 L .42278 .0003 L .42492 .00024 L .42721 .00016 L .42783 .00014 L .42849 .00012 L .42881 .00012 L .42911 .00011 L .42938 .00011 L .42967 .0001 L .42984 .0001 L .43 .0001 L .43017 .0001 L .43034 .0001 L .43067 .00011 L .43096 .00011 L .43167 .00013 L .43235 .00016 L .43294 .00019 L .43357 .00022 L .43469 .0003 L .43722 .00054 L .4395 .00076 L .44016 .00081 L .44079 .00085 L .44135 .00089 L .44166 .0009 L Mistroke .44196 .00091 L .44223 .00092 L .44253 .00092 L .44281 .00092 L .44306 .00092 L .44329 .00091 L .44355 .00091 L .44408 .00089 L .44466 .00086 L .44527 .00083 L .44639 .00075 L .44886 .0005 L .44953 .00044 L .4499 .0004 L .45008 .00039 L .45025 .00038 L .45054 .00036 L .45086 .00035 L .45154 .00032 L .45182 .00031 L .45213 .00031 L .45239 .0003 L .45267 .0003 L .45285 .00029 L .45301 .00029 L .45332 .00029 L .45361 .00029 L .45391 .00029 L .45421 .00029 L .45453 .00029 L .45483 .00029 L .4551 .0003 L .45642 .00032 L .45757 .00033 L .45791 .00034 L .45822 .00034 L .4585 .00034 L .45881 .00034 L .45986 .00032 L .46042 .00031 L .46073 .0003 L .46102 .0003 L .46119 .0003 L .46137 .0003 L .46168 .0003 L .462 .0003 L .4623 .0003 L .46261 .00031 L .46279 .00031 L .46295 .00032 L Mistroke .46364 .00035 L .46425 .00039 L .4648 .00043 L .46605 .00056 L .47566 .00194 L .47686 .00192 L .47816 .00189 L .47875 .00188 L .47908 .00187 L .47938 .00186 L .47964 .00186 L .47992 .00186 L .48023 .00186 L .48051 .00187 L .48078 .00188 L .48107 .0019 L .48132 .00192 L .48159 .00194 L .48188 .00198 L .4822 .00202 L .48247 .00207 L .48277 .00213 L .48331 .00229 L .48389 .0025 L .48491 .00295 L .4861 .00361 L .48738 .00452 L .48967 .00656 L .49475 .01131 L .49957 .01647 L .50211 .01943 L .50273 .02003 L .50339 .02055 L .50412 .02097 L .5048 .02128 L .50511 .02139 L .50545 .02149 L .50564 .02153 L .50581 .02157 L .50599 .0216 L .50615 .02162 L .50647 .02164 L .50663 .02165 L .50681 .02165 L .50711 .02161 L .50727 .02157 L .50743 .02151 L .50859 .02103 L .50984 .02038 L .51043 .02007 L Mistroke .51075 .0199 L .51108 .01974 L .51138 .01963 L .5117 .01953 L .51227 .01938 L .51253 .01932 L .51282 .01927 L .51313 .01923 L .51341 .0192 L .51367 .01919 L .51392 .01919 L .51419 .0192 L .51448 .01922 L .51478 .01927 L .51495 .0193 L .51511 .01934 L .51543 .0195 L .51577 .01971 L .51697 .02058 L .51835 .02173 L .51966 .02277 L .52088 .02353 L .52152 .02388 L .52221 .0242 L .52254 .02433 L .52285 .02444 L .52312 .02453 L .52342 .02456 L .52371 .02454 L .52401 .02451 L .52454 .02444 L .52516 .02436 L .52547 .02432 L .52575 .02429 L .526 .02428 L .52628 .02427 L .52655 .02427 L .52685 .02429 L .52717 .02434 L .52746 .02443 L .52761 .02449 L .52778 .02457 L .52812 .02476 L .52875 .0252 L .52931 .02571 L .53043 .02703 L .53104 .02795 L .53162 .02906 L .53376 .03457 L .53821 .04794 L Mistroke .54074 .05451 L .5431 .05929 L .54793 .06625 L .54918 .06813 L .55055 .06993 L .55117 .07062 L .55184 .07125 L .55214 .07151 L .55246 .07175 L .55276 .07194 L .55303 .07208 L .55331 .07218 L .55361 .07225 L .55392 .07226 L .55409 .07224 L .55424 .07222 L .55452 .07212 L .55482 .07197 L .55511 .07176 L .55537 .07152 L .55568 .07116 L .55597 .07054 L .55663 .06881 L .55796 .06457 L .56011 .05667 L .56125 .05251 L .56246 .04869 L .56314 .04698 L .56347 .04632 L .56377 .0458 L .56407 .04569 L .56422 .0457 L .56439 .04574 L .56467 .04586 L .56498 .04608 L .56529 .04639 L .56558 .04673 L .56622 .0477 L .56737 .05002 L .56955 .05522 L .57074 .05802 L .57133 .05926 L .57158 .05976 L .57186 .06028 L .57213 .06054 L .57241 .06075 L .57272 .06093 L .57301 .06106 L .57332 .06118 L .57349 .06123 L Mistroke .57366 .06127 L .57397 .06133 L .57427 .06137 L .57453 .06139 L .57478 .0614 L .57507 .06141 L .57533 .06141 L .57562 .06141 L .57593 .06142 L .57622 .06151 L .57649 .06162 L .57777 .0622 L .57911 .06303 L .58028 .064 L .58153 .06543 L .58403 .06889 L .58673 .07286 L .58928 .07782 L .59163 .08313 L .59277 .08537 L .5934 .08641 L .594 .08726 L .59455 .08791 L .59484 .08821 L .59515 .08847 L .59541 .08865 L .5957 .08881 L .59596 .08892 L .5962 .08898 L .59651 .08885 L .59669 .08872 L .59685 .08858 L .59746 .08796 L .59862 .08641 L .59987 .08446 L .60122 .08241 L .60187 .08157 L .60255 .08085 L .60283 .08062 L .60314 .08041 L .60331 .08032 L .60347 .08025 L .60378 .08017 L .60409 .08015 L .60437 .08019 L .60468 .0805 L .60502 .08092 L .60558 .0818 L .60619 .08304 L .60731 .08598 L Mistroke .60852 .0901 L .6107 .10003 L .61546 .12514 L .61798 .13715 L .61937 .14269 L .62005 .14507 L .62067 .14704 L .62192 .14986 L .62257 .151 L .62328 .15205 L .62383 .15272 L .62443 .15332 L .62506 .15379 L .62565 .15411 L .62681 .15456 L .62805 .15494 L .62865 .15516 L .62922 .15542 L .63028 .1561 L .63089 .15664 L .63146 .15727 L .63212 .15818 L .63273 .15922 L .63303 .15992 L .63335 .16076 L .63403 .1627 L .63541 .16729 L .63794 .17813 L .63905 .1834 L .63969 .18618 L .64028 .18855 L .64056 .18957 L .64086 .19056 L .64101 .19087 L .64118 .19114 L .64148 .19156 L .6418 .19191 L .64197 .19207 L .64214 .19219 L .64229 .19228 L .64246 .19236 L .64275 .19245 L .64292 .19248 L .64308 .19248 L .64325 .19246 L .64343 .19243 L .64362 .19237 L .64381 .19229 L .64415 .1921 L .64445 .19188 L Mistroke .64477 .19161 L .64493 .19144 L .64511 .19107 L .64544 .19038 L .64665 .18789 L .64698 .18732 L .64733 .18681 L .64763 .18646 L .6478 .18631 L .64795 .1862 L .64826 .18608 L .64855 .1861 L .64881 .18623 L .6491 .1868 L .6494 .188 L .64973 .18945 L .65032 .19251 L .65277 .21021 L .65511 .23309 L .65612 .24249 L .65668 .24708 L .65695 .24913 L .65721 .25073 L .6575 .2518 L .65783 .25275 L .6581 .25339 L .65839 .25395 L .65867 .25434 L .65893 .2546 L .6592 .25477 L .65949 .25484 L .65981 .25479 L .6601 .25465 L .66042 .25439 L .66076 .25401 L .66133 .25314 L .66195 .25179 L .66313 .2491 L .66364 .24803 L .6642 .24703 L .6645 .24661 L .66481 .24626 L .66499 .24612 L .66515 .24602 L .66546 .24643 L .66563 .24685 L .66579 .24727 L .66615 .24833 L .66681 .25059 L .66926 .26136 L Mistroke .67146 .2704 L .67209 .27255 L .67269 .27429 L .67295 .27494 L .67323 .27555 L .67353 .27583 L .67381 .27583 L .67399 .27579 L .67415 .27573 L .67432 .27563 L .67451 .27551 L .67483 .27523 L .67517 .27486 L .6764 .27306 L .67756 .27105 L .67817 .26992 L .67882 .26891 L .67913 .26852 L .6793 .26835 L .67948 .26819 L .6798 .26801 L .68009 .26793 L .68025 .26794 L .68041 .26799 L .68072 .26817 L .68102 .26849 L .6813 .26893 L .68159 .26977 L .68187 .27091 L .68239 .27341 L .68356 .28073 L .68483 .29123 L .68599 .30358 L .68863 .33805 L .69083 .36498 L .69204 .37729 L .69319 .38701 L .69384 .39129 L .69421 .39304 L .69454 .39445 L .69514 .39648 L .69545 .39729 L .69578 .39801 L .69609 .39854 L .69637 .3989 L .69664 .39915 L .69693 .39931 L .69724 .39937 L .69754 .39932 L .69786 .39906 L Mistroke .69804 .39881 L .6982 .39856 L .70046 .39343 L .701 .39205 L .70131 .39132 L .70159 .39067 L .70175 .39032 L .70193 .39022 L .70224 .39009 L .70255 .39002 L .70285 .38999 L .70301 .38999 L .70319 .39 L .70336 .39003 L .70351 .39006 L .70381 .39014 L .70412 .39026 L .70476 .3906 L .70547 .39105 L .70663 .39188 L .70724 .39229 L .70789 .39267 L .7082 .39282 L .70855 .39296 L .70886 .39305 L .70916 .3931 L .70946 .39311 L .70974 .39309 L .71004 .39284 L .71036 .39243 L .71262 .38874 L .71322 .3877 L .71352 .38721 L .71379 .38677 L .71411 .38646 L .71427 .38635 L .71445 .38624 L .71504 .38593 L .7157 .38566 L .71642 .38542 L .71703 .38524 L .71735 .38515 L .71769 .38504 L .71787 .38499 L .71804 .38499 L .71835 .38504 L .71864 .38507 L .71896 .38508 L .71926 .38505 L .71942 .38502 L Mistroke .71959 .38498 L .71988 .38486 L .72016 .3847 L .72045 .38447 L .72073 .38419 L .72125 .38349 L .72181 .38243 L .72212 .38162 L .72241 .38055 L .72358 .37522 L .72487 .36751 L .72622 .35728 L .72748 .34388 L .72868 .33115 L .72932 .32493 L .72967 .32178 L .73 .319 L .73031 .31686 L .73065 .31515 L .73124 .3128 L .73153 .31193 L .73184 .31123 L .7321 .3108 L .73239 .31053 L .73269 .31046 L .73297 .3106 L .73323 .3109 L .73351 .3114 L .73381 .31217 L .73398 .31269 L .73413 .31325 L .73441 .31479 L .73471 .31688 L .73688 .33668 L .74626 .41262 L .74877 .42986 L .75112 .44319 L .75172 .44602 L .7523 .44823 L .75261 .44925 L .75296 .45015 L .75327 .45079 L .75356 .45122 L .75388 .4515 L .75418 .45156 L .75435 .4515 L .7545 .4513 L .75468 .4508 L .75486 .45024 L .75551 .44752 L Mistroke .75623 .44353 L .75751 .43401 L .7589 .41989 L .76012 .40337 L .76141 .38716 L .76197 .38118 L .76228 .3783 L .76257 .37588 L .76274 .37523 L .76292 .37492 L .76323 .37467 L .76355 .3748 L .76385 .37524 L .76412 .3759 L .76437 .37672 L .76494 .37933 L .7655 .38276 L .7661 .38734 L .77559 .44851 L .78046 .4741 L .78174 .48529 L .78236 .49006 L .78264 .49192 L .78294 .49357 L .7831 .49406 L .78326 .49446 L .78344 .49484 L .7836 .49512 L .78378 .49536 L .78395 .4955 L .78413 .49558 L .78432 .49558 L .78464 .49538 L .7848 .49519 L .78498 .49491 L .78529 .49422 L .78558 .49337 L .78617 .49103 L .78648 .48941 L .78678 .48768 L .78704 .48576 L .78731 .48324 L .78789 .47742 L .79037 .44809 L .7915 .43563 L .79269 .42495 L .7938 .41668 L .79434 .41329 L .79483 .41062 L .7954 .40832 L Mistroke .79571 .40741 L .79601 .40671 L .79617 .4064 L .79633 .40612 L .79663 .40574 L .79681 .40559 L .79699 .4055 L .79714 .40546 L .79731 .40547 L .79748 .40552 L .79763 .40561 L .79781 .40576 L .79799 .40598 L .79837 .4066 L .79871 .40737 L .79938 .40928 L .8 .41146 L .80058 .41415 L .8012 .4177 L .80187 .42244 L .80251 .42776 L .80364 .44032 L .80488 .45861 L .80936 .53939 L .81059 .56016 L .81127 .56998 L .8119 .57678 L .8125 .58187 L .81281 .58406 L .81314 .58598 L .81342 .58729 L .81373 .5884 L .814 .5891 L .81427 .58948 L .81457 .58958 L .81474 .58948 L .81489 .58928 L .81518 .58866 L .81549 .58713 L .81579 .58485 L .81608 .58239 L .81661 .57704 L .81913 .54192 L .82162 .50075 L .82227 .49053 L .82298 .48043 L .82332 .47593 L .82364 .47282 L .82424 .46846 L .82478 .46528 L Mistroke .82536 .46255 L .82599 .46021 L .82657 .45854 L .82779 .45607 L .82912 .45386 L .83024 .45186 L .83086 .45043 L .83116 .44962 L .83144 .44879 L .83169 .44765 L .83197 .44587 L .83255 .44187 L .83361 .43404 L .83482 .42499 L .83548 .42037 L .8361 .4172 L .83677 .41454 L .8375 .41216 L .83812 .4106 L .83847 .40991 L .83879 .40937 L .83909 .40898 L .83942 .40864 L .83959 .40851 L .83975 .40848 L .83992 .40857 L .84011 .4087 L .84042 .40898 L .84076 .40936 L .84135 .41019 L .84257 .41224 L .84315 .4132 L .8434 .4136 L .84368 .41401 L .84396 .41418 L .84425 .41426 L .84457 .41429 L .84487 .41427 L .84515 .41421 L .84541 .41411 L .84571 .41394 L .84599 .41373 L .84661 .41311 L .84718 .4123 L .84784 .41109 L .84847 .40972 L .8496 .40645 L .85062 .40251 L .85173 .39709 L .85292 .38973 L Mistroke .85523 .37045 L .85654 .35566 L .85776 .33928 L .86287 .25791 L .87231 .12761 L .87464 .09369 L .87712 .06154 L .87841 .04799 L .8791 .04174 L .87983 .03579 L .88051 .0314 L .88113 .02843 L .88172 .02613 L .88234 .02416 L .88296 .02268 L .88351 .02165 L .8846 .02021 L .8852 .01954 L .88555 .01925 L .88586 .01905 L .88614 .01891 L .88644 .01879 L .88676 .01872 L .88706 .01869 L .88736 .01869 L .88754 .01871 L .8877 .01873 L .88799 .0188 L .88831 .0189 L .88857 .01894 L .88886 .01899 L .88916 .01907 L .88945 .01917 L .89008 .01948 L .89067 .01987 L .89131 .02042 L .89201 .02117 L .89466 .02604 L .89716 .03118 L .89825 .03304 L .8994 .03465 L .9 .0353 L .90017 .03546 L .90035 .03561 L .90051 .03574 L .90067 .0358 L .90095 .03585 L .90127 .03586 L .90156 .03584 L .90184 .03579 L Mistroke .90214 .0357 L .90243 .03559 L .90307 .03526 L .90424 .03443 L .90641 .03268 L .91129 .02904 L .91624 .02535 L .91866 .02324 L .92086 .02095 L .92531 .01445 L .92651 .0124 L .92778 .0104 L .92831 .00968 L .92887 .00899 L .92949 .00845 L .92979 .00824 L .93007 .00807 L .93036 .00792 L .93063 .00782 L .93093 .00773 L .93125 .00768 L .93155 .00766 L .93172 .00767 L .93188 .00769 L .93218 .00775 L .93248 .00785 L .93275 .00797 L .93303 .00814 L .9333 .00843 L .93354 .00871 L .9347 .01037 L .93731 .01507 L .93858 .01735 L .93973 .01919 L .94028 .01995 L .94058 .02032 L .94088 .02066 L .94115 .02093 L .94145 .02109 L .94171 .02121 L .94197 .0213 L .94228 .02137 L .94256 .02141 L .94286 .02141 L .94304 .02139 L .9432 .02137 L .94346 .02131 L .94375 .02121 L .94406 .02108 L .94434 .02092 L Mistroke .94496 .0205 L .94527 .02021 L .94561 .0198 L .94677 .01818 L .94811 .0161 L .94937 .0142 L .95057 .01287 L .9512 .01228 L .95187 .01174 L .95243 .01137 L .95273 .0112 L .95305 .01104 L .95334 .01095 L .95361 .01095 L .95388 .01097 L .95414 .01101 L .95443 .01106 L .95475 .01113 L .9554 .01129 L .95601 .01145 L .95657 .01158 L .95689 .01164 L .95705 .01166 L .95723 .01168 L .9574 .01166 L .95756 .01161 L .95794 .01147 L .95922 .01081 L .96051 .00992 L .9617 .00888 L .96298 .00752 L .96366 .00685 L .96439 .00622 L .96472 .00597 L .96503 .00577 L .96531 .00561 L .96561 .00553 L .9659 .00555 L .96621 .0056 L .9665 .00568 L .96676 .00577 L .96738 .00606 L .96805 .00649 L .96927 .0075 L .97619 .01286 L Mfstroke MathSubEnd P % End of sub-graphic % Start of sub-graphic p 0.0238095 0.0294302 0.97619 0.618034 MathSubStart %% Graphics %%IncludeResource: font Courier %%IncludeFont: Courier /Courier findfont 10 scalefont setfont % Scaling calculations 0.857143 0.0793651 -2.08167e-17 0.137341 [ [ 0 0 -0.25 0 ] [ 0 0 -0.25 0 ] [ 0 .61803 .25 0 ] [ 1 0 .25 0 ] [ 0 0 0 0 ] [ 1 .61803 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath 0 g .5 Mabswid [ ] 0 setdash .06349 0 m .06349 .00625 L s .22222 0 m .22222 .00625 L s .38095 0 m .38095 .00625 L s .53968 0 m .53968 .00625 L s .69841 0 m .69841 .00625 L s .85714 0 m .85714 .00625 L s .02381 0 m .02381 .00312 L s .10317 0 m .10317 .00312 L s .14286 0 m .14286 .00312 L s .18254 0 m .18254 .00312 L s .2619 0 m .2619 .00312 L s .30159 0 m .30159 .00312 L s .34127 0 m .34127 .00312 L s .42063 0 m .42063 .00312 L s .46032 0 m .46032 .00312 L s .5 0 m .5 .00312 L s .57937 0 m .57937 .00312 L s .61905 0 m .61905 .00312 L s .65873 0 m .65873 .00312 L s .7381 0 m .7381 .00312 L s .77778 0 m .77778 .00312 L s .81746 0 m .81746 .00312 L s .89683 0 m .89683 .00312 L s .93651 0 m .93651 .00312 L s .97619 0 m .97619 .00312 L s 0 0 m 1 0 L s 0 .13734 m .00625 .13734 L s 0 .27468 m .00625 .27468 L s 0 .41202 m .00625 .41202 L s 0 .54936 m .00625 .54936 L s 0 .02747 m .00313 .02747 L s 0 .05494 m .00313 .05494 L s 0 .0824 m .00313 .0824 L s 0 .10987 m .00313 .10987 L s 0 .16481 m .00313 .16481 L s 0 .19228 m .00313 .19228 L s 0 .21975 m .00313 .21975 L s 0 .24721 m .00313 .24721 L s 0 .30215 m .00313 .30215 L s 0 .32962 m .00313 .32962 L s 0 .35709 m .00313 .35709 L s 0 .38455 m .00313 .38455 L s 0 .43949 m .00313 .43949 L s 0 .46696 m .00313 .46696 L s 0 .49443 m .00313 .49443 L s 0 .5219 m .00313 .5219 L s 0 .57683 m .00313 .57683 L s 0 .6043 m .00313 .6043 L s .25 Mabswid 0 .13734 m 0 .13734 L s 0 .27468 m 0 .27468 L s 0 .41202 m 0 .41202 L s 0 .54936 m 0 .54936 L s .5 Mabswid 0 0 m 0 .61803 L s .06349 .61178 m .06349 .61803 L s .22222 .61178 m .22222 .61803 L s .38095 .61178 m .38095 .61803 L s .53968 .61178 m .53968 .61803 L s .69841 .61178 m .69841 .61803 L s .85714 .61178 m .85714 .61803 L s .02381 .61491 m .02381 .61803 L s .10317 .61491 m .10317 .61803 L s .14286 .61491 m .14286 .61803 L s .18254 .61491 m .18254 .61803 L s .2619 .61491 m .2619 .61803 L s .30159 .61491 m .30159 .61803 L s .34127 .61491 m .34127 .61803 L s .42063 .61491 m .42063 .61803 L s .46032 .61491 m .46032 .61803 L s .5 .61491 m .5 .61803 L s .57937 .61491 m .57937 .61803 L s .61905 .61491 m .61905 .61803 L s .65873 .61491 m .65873 .61803 L s .7381 .61491 m .7381 .61803 L s .77778 .61491 m .77778 .61803 L s .81746 .61491 m .81746 .61803 L s .89683 .61491 m .89683 .61803 L s .93651 .61491 m .93651 .61803 L s .97619 .61491 m .97619 .61803 L s 0 .61803 m 1 .61803 L s .99375 0 m 1 0 L s .99375 .13734 m 1 .13734 L s .99375 .27468 m 1 .27468 L s .99375 .41202 m 1 .41202 L s .99375 .54936 m 1 .54936 L s .99688 .02747 m 1 .02747 L s .99688 .05494 m 1 .05494 L s .99688 .0824 m 1 .0824 L s .99688 .10987 m 1 .10987 L s .99688 .16481 m 1 .16481 L s .99688 .19228 m 1 .19228 L s .99688 .21975 m 1 .21975 L s .99688 .24721 m 1 .24721 L s .99688 .30215 m 1 .30215 L s .99688 .32962 m 1 .32962 L s .99688 .35709 m 1 .35709 L s .99688 .38455 m 1 .38455 L s .99688 .43949 m 1 .43949 L s .99688 .46696 m 1 .46696 L s .99688 .49443 m 1 .49443 L s .99688 .5219 m 1 .5219 L s .99688 .57683 m 1 .57683 L s .99688 .6043 m 1 .6043 L s 1 0 m 1 .61803 L s 0 0 m 1 0 L s .85714 0 m .85714 .61803 L s 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath newpath [ ] 0 Mabsdash .02381 0 m .02435 0 L .02494 0 L .02549 0 L .02573 0 L .02599 0 L .02629 0 L .02657 0 L .02688 0 L .02705 0 L .02721 0 L .0275 0 L .02777 0 L .02808 0 L .02837 0 L .02895 0 L .02956 0 L .02986 0 L .03014 0 L .03039 0 L .03067 0 L .03097 0 L .0313 0 L .03197 0 L .03318 0 L .03386 0 L .0342 0 L .03451 0 L .03479 0 L .03509 0 L .03539 0 L .03556 0 L .03573 0 L .03588 0 L .03606 0 L .03624 0 L .03641 0 L .03672 0 L .03704 0 L .03742 0 L .03778 0 L .03846 0 L .03877 0 L .03906 0 L .03936 0 L .03952 0 L .03969 0 L .04082 0 L .04151 0 L .04217 0 L Mistroke .04275 0 L .04308 0 L .04339 0 L .04369 0 L .04401 0 L .04433 0 L .04451 0 L .04468 0 L .04499 0 L .04527 0 L .04559 0 L .0459 0 L .04646 0 L .04699 0 L .04756 0 L .04785 0 L .04817 0 L .04946 0 L .05017 0 L .05082 0 L .05143 0 L .0517 0 L .05199 0 L .0523 0 L .0526 0 L .05277 0 L .05294 0 L .05326 0 L .05355 0 L .05381 0 L .05412 0 L .05441 0 L .05493 0 L .0555 0 L .05611 0 L .05643 0 L .05661 0 L .05677 0 L .05707 0 L .05734 0 L .05796 0 L .05857 0 L .05923 0 L .05984 0 L .06042 0 L .06073 0 L .06089 0 L .06107 0 L .06138 0 L .06166 0 L Mistroke .06182 0 L .06199 0 L .0623 0 L .06249 0 L .06268 0 L .06302 0 L .06332 0 L .06364 0 L .06424 0 L .06476 0 L .06506 0 L .06534 0 L .06564 2e-05 L .06597 4e-05 L .06663 9e-05 L .06782 .00016 L .06839 .00019 L .0687 .0002 L .06902 .00021 L .0693 .00022 L .06961 .00023 L .06989 .00023 L .07015 .00023 L .07041 .00023 L .07069 .00023 L .07092 .00022 L .07118 .00022 L .07145 .00021 L .07175 .00019 L .07228 .00016 L .07291 .00011 L .07357 3e-05 L Mfstroke .07357 3e-05 m .07378 0 L s .09177 0 m .0928 .03423 L .09405 .08181 L .09628 .179 L .10133 .42853 L .10363 .54337 L .10489 .59572 L s .10489 .59572 m .10557 .61803 L s .10998 .61803 m .11053 .58738 L .11318 .40468 L .11568 .21393 L .11677 .13396 L .11706 .11374 L .11737 .09253 L .11766 .07662 L .11793 .06849 L .11853 .05175 L .11919 .03585 L .12036 .01377 L .12095 .00532 L s .12095 .00532 m .1214 0 L s .13563 0 m .13592 .00013 L .13653 .00035 L .13684 .00044 L .13718 .00052 L .13745 .00058 L .13774 .00063 L .13805 .00067 L .13833 .00069 L .13862 .00071 L .13888 .00072 L .13913 .00072 L .13939 .00071 L .13966 .0007 L .13996 .00068 L .14024 .00065 L .14049 .00063 L .14171 .00043 L .14288 .00018 L .14321 .00011 L .14338 7e-05 L .14355 3e-05 L s .14355 3e-05 m .14371 0 L s .14371 0 m .14387 0 L .14417 1e-05 L .14474 1e-05 L .14535 2e-05 L .14586 2e-05 L .14616 2e-05 L .14643 2e-05 L .14671 2e-05 L .14697 2e-05 L .14721 2e-05 L .14747 2e-05 L .14775 2e-05 L .14805 2e-05 L .1483 2e-05 L .14858 2e-05 L .15106 1e-05 L .15166 0 L .15199 0 L .1523 0 L .15248 0 L .15267 0 L .15301 0 L .15367 0 L .15423 0 L .15455 0 L .15485 0 L .15516 0 L .15545 0 L .15561 0 L .15578 0 L .15609 0 L .15639 0 L .15666 0 L .15696 0 L .15725 0 L .15777 0 L .15833 0 L .15956 0 L .16016 0 L .16071 0 L .16101 0 L .16129 0 L .16158 0 L .16191 0 L .16224 0 L .16259 0 L .16292 0 L .16322 0 L .16347 0 L Mistroke .16375 0 L .16404 0 L .16432 0 L .16458 0 L .16486 0 L .16512 0 L .16536 0 L .16566 0 L .16594 0 L .16657 0 L .16771 0 L .16885 0 L .16915 0 L .16947 0 L .16978 0 L .17007 0 L .17063 0 L .17122 0 L .17172 0 L .172 0 L .17227 0 L .17256 0 L .17288 0 L .17304 0 L .17321 0 L .17353 0 L .17384 0 L .17413 0 L .17439 0 L .17468 0 L .17533 0 L .17603 0 L .17728 0 L .17789 0 L .17819 0 L .17847 0 L .17872 0 L .17899 0 L .17956 0 L .18202 0 L .18646 0 L .19654 0 L .20626 0 L .21561 0 L .22036 0 L .22556 0 L .22795 0 L .22927 0 L .22992 0 L .2302 0 L Mistroke .23052 0 L .23081 0 L .23108 0 L .23168 0 L .23294 0 L .23345 0 L .234 0 L .23428 0 L .23459 0 L .23488 0 L .23514 0 L .23545 0 L .23561 0 L .23578 0 L .23608 0 L .23637 0 L .23654 0 L .2367 0 L .23701 0 L .23734 0 L .2377 0 L .2383 0 L .23863 0 L .23895 0 L .23924 0 L .23956 0 L .24011 0 L .24125 0 L .24187 0 L .24246 0 L .24295 0 L .24321 0 L .24349 0 L .24379 0 L .24408 0 L .24436 0 L .24461 0 L .24492 0 L .2452 0 L .24546 0 L .24574 0 L .24605 0 L .24637 0 L .24696 0 L .24724 0 L .24755 0 L .24784 0 L .24811 0 L .24835 0 L .24862 0 L Mistroke .24915 0 L .2504 0 L .25109 0 L .25142 0 L .25174 0 L .25203 0 L .25234 0 L .25266 0 L .25284 0 L .253 0 L .25329 0 L .25355 0 L .25385 0 L .25415 0 L .25445 0 L .25478 0 L .25536 0 L .25594 0 L .25619 0 L .25647 0 L .25676 0 L .25704 0 L .25767 0 L .25894 0 L .25951 0 L .26013 0 L .26041 0 L .26072 0 L .261 0 L .26126 0 L .26154 0 L .26179 0 L .26207 0 L .26236 0 L .26261 0 L .26285 0 L .26311 0 L .26339 0 L .26401 0 L .26467 0 L .26495 0 L .26524 0 L .26541 0 L .26556 0 L .26586 0 L .26714 0 L .26782 0 L .26855 0 L .26888 0 L .26919 0 L Mistroke .2695 0 L .26978 0 L .27005 0 L .27033 0 L .27061 0 L .27093 0 L .27109 0 L .27125 0 L .27155 0 L .27187 0 L .27222 0 L .27285 0 L .27343 0 L .27371 0 L .27401 0 L .27427 0 L .27455 0 L .27576 0 L .27635 0 L .2769 0 L .27745 0 L .27795 0 L .27824 0 L .27854 0 L .27885 0 L .27903 0 L .27919 0 L .27937 0 L .27953 0 L .27984 0 L .28001 0 L .28017 0 L .28053 0 L .28085 0 L .28114 0 L .2817 0 L .28229 0 L .28246 0 L .28263 0 L .28294 0 L .28323 0 L .28356 1e-05 L .28414 1e-05 L .28524 1e-05 L .28586 2e-05 L .2862 2e-05 L .28652 2e-05 L .28681 2e-05 L .28708 2e-05 L .28738 2e-05 L Mistroke .28754 2e-05 L .2877 2e-05 L .28798 2e-05 L .28823 2e-05 L .28853 2e-05 L .2888 2e-05 L .28906 2e-05 L .28929 2e-05 L .28982 2e-05 L .29036 1e-05 L .29095 1e-05 L .29125 0 L .29157 0 L .29187 3e-05 L .29215 6e-05 L .29331 .00015 L .29395 .00019 L .29426 .00021 L .29454 .00022 L .29481 .00023 L .29509 .00024 L .29537 .00024 L .29569 .00024 L .29595 .00024 L .29624 .00023 L .29651 .00022 L .29676 .00021 L .29707 .00019 L .29741 .00016 L .298 .0001 L Mfstroke .298 .0001 m .29864 0 L s .31343 0 m .31353 .00055 L .31416 .00464 L .31539 .01566 L .31596 .02213 L .31655 .03003 L .31709 .03813 L .31737 .04282 L .31768 .05006 L .31796 .05966 L .31821 .06862 L .31871 .08671 L .32105 .17787 L .32329 .26782 L .32452 .31414 L .32568 .35374 L .32597 .36299 L .32628 .37233 L .32644 .37403 L .32662 .37555 L .32692 .3779 L .32727 .38008 L .32763 .3819 L .32781 .38261 L .32798 .38318 L .3283 .38399 L .32859 .38446 L .3289 .38468 L .32917 .38466 L .32946 .38443 L .32977 .38395 L .32995 .38358 L .33011 .38319 L .33071 .38128 L .33295 .37033 L .33408 .36409 L .33439 .36247 L .33456 .36165 L .33473 .36082 L .33504 .35972 L .33533 .36268 L .33794 .39181 L .33921 .40576 L .34036 .41719 L .34093 .42213 L .34155 .42684 L .34208 .43026 L .34267 .43324 L .34299 .43449 L .34329 .43539 L Mistroke .34361 .43605 L .34379 .4352 L .34395 .43387 L .34514 .42177 L .34623 .40702 L .34742 .38728 L .34959 .34266 L .35088 .31154 L .35209 .27957 L .35436 .19709 L .35683 .10679 L .35818 .06352 L .35944 .02959 L .36002 .01671 L .36056 .00623 L .36086 .00123 L Mfstroke .36086 .00123 m .36094 0 L s .36123 0 m .36147 .0023 L .36176 .0057 L .36297 .02496 L .36431 .05473 L .36879 .19381 L .37107 .26664 L .37348 .33151 L .37474 .35914 L .37541 .37141 L .37612 .38249 L .37677 .39064 L .37737 .39618 L .37766 .39818 L .37797 .39984 L .37826 .40088 L .37854 .4009 L .37884 .39505 L .37913 .38902 L .37967 .3765 L .38089 .34327 L .38308 .27012 L .38551 .18006 L .38615 .15627 L .38684 .13108 L .38809 .09894 L .39061 .05161 L .3929 .0195 L .39403 .00725 L .39465 .00156 L s .39465 .00156 m .39484 0 L s .40674 0 m .40726 .00022 L .40954 .00097 L .41083 .00129 L .41205 .00152 L .41267 .00161 L .41301 .00165 L .41333 .00168 L .4136 .0017 L .41389 .00171 L .41405 .00172 L .41421 .00172 L .4145 .00173 L .41482 .00173 L .41498 .00174 L .41516 .00173 L .41547 .00173 L .41577 .00173 L .41594 .00172 L .41611 .00171 L .41643 .0017 L .41714 .00166 L .41777 .00162 L .41836 .00157 L .41947 .00146 L .42195 .00116 L .4264 .00077 L .42877 .00059 L .42997 .00052 L .43029 .0005 L .43047 .00049 L .43064 .00048 L .4308 .00048 L .43098 .00048 L .43128 .00048 L .43155 .00048 L .43181 .00049 L .4321 .00049 L .43241 .00049 L .43303 .0005 L .4336 .00052 L .43576 .00058 L .43691 .00061 L .43814 .00065 L .43873 .00067 L .43902 .00068 L .43929 .00069 L .43954 .00068 L .4398 .00068 L .44035 .00066 L Mistroke .44277 .00059 L .4441 .00056 L .44476 .00054 L .44537 .00053 L .44594 .00052 L .44626 .00052 L .44656 .00052 L .44672 .00052 L .44688 .00052 L .44704 .00052 L .44722 .00052 L .44752 .00052 L .44769 .00052 L .44785 .00052 L .44814 .00052 L .44842 .00053 L .44894 .00056 L .45012 .00062 L .45122 .00069 L .45225 .00077 L .45456 .00101 L .45569 .00115 L .45631 .00124 L .45662 .00128 L .4569 .00134 L .45745 .00147 L .45805 .00162 L .4591 .00189 L .46167 .00252 L .46293 .00279 L .4641 .003 L .4647 .00309 L .46499 .00313 L .46526 .00316 L .46554 .00317 L .46584 .00315 L .46648 .00308 L .46781 .0029 L .46907 .00269 L .47121 .00226 L .47243 .002 L .47358 .00176 L .47386 .00171 L .47413 .00165 L .4744 .00162 L .4747 .00159 L .47534 .00153 L .47592 .00148 L .47712 .00139 L .47779 .00136 L Mistroke .47809 .00135 L .4784 .00134 L .47868 .00133 L .47898 .00132 L .47925 .00132 L .47951 .00131 L .47981 .00131 L .48008 .00131 L .4804 .00131 L .4807 .00131 L .48096 .00132 L .48124 .00133 L .48174 .00134 L .48233 .00137 L .48259 .00138 L .48287 .0014 L .48316 .00144 L .48343 .00148 L .48405 .00157 L .4853 .00179 L .48754 .0022 L .48882 .00245 L .49017 .0027 L .49072 .0028 L .49132 .0029 L .49149 .00293 L .49166 .00294 L .49198 .00297 L .49259 .003 L .49377 .00306 L .49444 .00308 L .49506 .0031 L .49573 .00312 L .49636 .00313 L .49709 .00314 L .49775 .00314 L .49889 .00315 L .49951 .00316 L .49981 .00316 L .50009 .00316 L .5004 .00317 L .50056 .00318 L .50072 .00319 L .50141 .00323 L .50263 .00329 L .50496 .00342 L .50624 .00349 L .50745 .00354 L .50794 .00356 L .50847 .00358 L Mistroke .50874 .00359 L .50904 .00359 L .50931 .00359 L .50957 .00358 L .51191 .00352 L .51313 .00349 L .51378 .00347 L .51413 .00347 L .51446 .00346 L .51477 .00346 L .51505 .00346 L .51537 .00346 L .51554 .00345 L .51571 .00345 L .51599 .00345 L .51626 .00346 L .51655 .00346 L .51686 .00346 L .51717 .00347 L .51745 .00348 L .51775 .00349 L .51791 .00351 L .51808 .00353 L .51923 .00367 L .52137 .00399 L .53117 .00499 L .5406 .00604 L .54541 .00679 L .54812 .00713 L .54942 .00726 L .55063 .00736 L .55116 .00739 L .55171 .00742 L .55199 .00743 L .55231 .00744 L .55259 .00744 L .55286 .00743 L .55348 .00741 L .55405 .00738 L .55532 .00729 L .55788 .00705 L .5603 .00678 L .56474 .00626 L .56595 .00614 L .56663 .00609 L .56726 .00605 L .56785 .00602 L .56816 .006 L .5685 .00599 L .5688 .00598 L Mistroke .56908 .00597 L .56936 .00597 L .56962 .00597 L .5699 .00597 L .57021 .00599 L .57083 .00605 L .57194 .00617 L .57444 .00655 L .57708 .00706 L .57955 .00765 L .58407 .00883 L .58531 .00912 L .58599 .00926 L .58663 .00939 L .58691 .00944 L .58717 .00949 L .58748 .00952 L .58775 .00954 L .5884 .00958 L .58899 .0096 L .58961 .00962 L .58995 .00963 L .59027 .00963 L .59057 .00964 L .59084 .00964 L .59114 .00964 L .59146 .00964 L .59178 .00964 L .59196 .00964 L .59212 .00964 L .59274 .00963 L .59347 .00962 L .59415 .00961 L .59474 .0096 L .59537 .00959 L .59562 .00959 L .5959 .00958 L .59621 .00959 L .59649 .0096 L .59903 .00973 L .60135 .00987 L .60389 .01007 L .60657 .01028 L .609 .0105 L .61017 .01064 L .61145 .01081 L .61254 .01099 L .61375 .01124 L .61442 .01144 L .61504 .01164 L Mistroke .61639 .01207 L .61883 .01284 L .62004 .0132 L .62067 .01337 L .62135 .01355 L .62169 .01363 L .622 .0137 L .62229 .01371 L .62259 .01373 L .62288 .01373 L .62319 .01374 L .62346 .01374 L .62374 .01374 L .62405 .01374 L .62433 .01374 L .62459 .01374 L .62487 .01373 L .62549 .01372 L .62607 .0137 L .6272 .01366 L .62824 .01363 L .62879 .01362 L .62906 .01361 L .62936 .01361 L .62967 .01361 L .62984 .01361 L .62999 .01361 L .63029 .01361 L .63057 .01361 L .63084 .01363 L .63112 .01368 L .63163 .01377 L .63277 .014 L .63776 .01526 L .64257 .01653 L .64467 .01702 L .64696 .01749 L .64757 .0176 L .64821 .01771 L .64938 .01785 L .65048 .01796 L .65168 .01806 L .65239 .01811 L .65305 .01814 L .65366 .01817 L .65434 .01819 L .65463 .0182 L .65494 .0182 L .65521 .01821 L .65551 .01821 L Mistroke .65568 .01821 L .65584 .01822 L .65615 .01822 L .65644 .01822 L .65674 .01822 L .65703 .01821 L .65735 .01821 L .65793 .01819 L .65902 .01816 L .6603 .0181 L .66148 .01803 L .66591 .01776 L .66647 .01775 L .66706 .01774 L .66813 .01772 L .66871 .0177 L .66925 .01768 L .67047 .01762 L .6711 .01758 L .67179 .01752 L .67304 .0174 L .67363 .01732 L .67396 .01728 L .67426 .01723 L .67452 .01716 L .6748 .01708 L .6754 .01691 L .68059 .01517 L .68293 .01436 L .68548 .0137 L .69034 .01268 L .69302 .01222 L .69545 .01187 L .69663 .01174 L .69724 .01169 L .6979 .01164 L .69847 .01161 L .6988 .0116 L .6991 .01159 L .69938 .01158 L .69963 .01158 L .69993 .01158 L .70021 .01158 L .70053 .0116 L .70082 .01162 L .70147 .01167 L .70264 .0118 L .704 .012 L .70529 .01224 L .70766 .01278 L Mistroke .71016 .01356 L .71464 .01523 L .71695 .016 L .71761 .01619 L .71824 .01633 L .71941 .01652 L .71995 .0166 L .72052 .01666 L .72101 .01671 L .72154 .01675 L .72184 .01676 L .72211 .01678 L .72237 .01678 L .72265 .01679 L .72295 .01679 L .72323 .01679 L .72353 .01679 L .72371 .01678 L .72386 .01678 L .72415 .01677 L .72442 .01675 L .72504 .0167 L .72564 .01664 L .72595 .0166 L .72611 .01658 L .72629 .01656 L .7266 .01649 L .72689 .01641 L .72745 .01625 L .72852 .01591 L .73357 .01396 L .73589 .01307 L .73833 .01229 L .7406 .01168 L .74271 .01125 L .74326 .01116 L .74354 .01112 L .74379 .01109 L .74408 .01109 L .74439 .0111 L .74466 .01111 L .74495 .01112 L .74555 .01115 L .74611 .01119 L .74739 .01129 L .74998 .01154 L .75126 .01165 L .75188 .0117 L .75218 .01171 L .75245 .01173 L Mistroke .75273 .0117 L .75303 .01165 L .75358 .01156 L .7548 .01136 L .75736 .01087 L .75953 .01048 L .76015 .01038 L .76074 .0103 L .761 .01026 L .76127 .01024 L .76157 .01025 L .76185 .01027 L .76297 .01034 L .76421 .01045 L .76642 .01071 L .76769 .01087 L .76839 .01095 L .76903 .01103 L .76934 .01106 L .76963 .0111 L .76989 .01112 L .77018 .01113 L .77049 .01113 L .77078 .01113 L .7711 .01113 L .77125 .01113 L .77143 .01113 L .77174 .01113 L .77204 .01113 L .77231 .01113 L .7726 .01112 L .77325 .01111 L .77385 .0111 L .77495 .01107 L .77612 .01102 L .78118 .01089 L .7824 .01087 L .78368 .01085 L .78509 .01081 L .78571 .01078 L .78638 .01076 L .78671 .01074 L .78702 .01073 L .78729 .01071 L .78759 .01068 L .78872 .01055 L .79128 .01024 L .79376 .00995 L .79497 .00982 L .7955 .00977 L Mistroke .79578 .00975 L .79608 .00973 L .79639 .00974 L .79668 .00974 L .79725 .00975 L .79791 .00977 L .79851 .00978 L .79981 .00983 L .80118 .00988 L .80234 .00991 L .80265 .00992 L .80299 .00992 L .80332 .00993 L .80361 .00993 L .80389 .00993 L .80416 .00993 L .80445 .00993 L .80476 .00992 L .80502 .00989 L .80527 .00987 L .80584 .0098 L .81089 .0091 L .81212 .00891 L .81272 .00882 L .81299 .00879 L .81327 .00875 L .81357 .00872 L .81385 .0087 L .81447 .00865 L .81578 .00857 L .8181 .00842 L .82026 .00828 L .82137 .00819 L .82169 .00817 L .82199 .00814 L .82226 .0081 L .82256 .00805 L .82508 .0076 L .82776 .00714 L .82902 .00695 L .83018 .0068 L .83048 .00677 L .83076 .00674 L .83105 .00674 L .83136 .00674 L .83153 .00674 L .83169 .00674 L .83198 .00675 L .8323 .00675 L .83264 .00676 L Mistroke .83323 .00678 L .83384 .00681 L .83496 .00688 L .83741 .00706 L .83869 .00717 L .83903 .0072 L .83922 .00722 L .83939 .00723 L .83956 .00724 L .83973 .00725 L .84004 .00726 L .84122 .00732 L .84251 .00736 L .84359 .0074 L .84477 .00743 L .84531 .00744 L .84589 .00745 L .84621 .00745 L .84651 .00746 L .8468 .00746 L .84708 .00746 L .84733 .00746 L .8476 .00746 L .84787 .00746 L .84817 .00746 L .84843 .00745 L .8487 .00744 L .8492 .00742 L .85405 .00718 L .85523 .00713 L .85588 .00711 L .85649 .0071 L .85666 .00709 L .85684 .00709 L .85704 .00711 L .85722 .00712 L .85788 .00719 L .85917 .00732 L .86034 .00744 L .86145 .00753 L .86206 .00757 L .86239 .00759 L .86273 .00761 L .86305 .00762 L .86334 .00763 L .86363 .00764 L .8639 .00764 L .86416 .00764 L .86444 .00764 L .86474 .00764 L Mistroke .86501 .00763 L .86527 .00762 L .86551 .00761 L .86578 .00751 L .86603 .00738 L .86834 .00622 L .86955 .00565 L .87068 .00519 L .8713 .00498 L .87186 .00483 L .87216 .00476 L .87249 .0047 L .87282 .00466 L .873 .00464 L .87317 .00462 L .87345 .00461 L .87375 .00462 L .87404 .00463 L .8743 .00472 L .87454 .00496 L .8748 .00523 L .87533 .0058 L .87763 .00869 L .88005 .01197 L .88124 .01351 L .88235 .01481 L .88267 .01515 L .88296 .01545 L .88313 .01551 L .88331 .01556 L .88362 .01563 L .88397 .0157 L .88416 .01573 L .88434 .01575 L .88465 .01578 L .88482 .01579 L .885 .01579 L .88531 .01579 L .88548 .01578 L .88565 .01577 L .88595 .01574 L .88626 .0157 L .88681 .0156 L .88741 .01545 L .88861 .01503 L .88987 .01446 L .89211 .01317 L .89717 .0098 L .89967 .00811 L .90203 .00667 L Mistroke .90414 .00562 L .90533 .00517 L .90643 .00487 L .9067 .00482 L .907 .00476 L .90725 .00472 L .90753 .00469 L .9077 .00467 L .90786 .00466 L .90816 .00465 L .90845 .00464 L .90874 .00465 L .90903 .00466 L .90934 .00482 L .90991 .00516 L .91119 .00605 L .91362 .008 L .9149 .00907 L .91627 .01016 L .91695 .01066 L .91728 .01089 L .91759 .0111 L .91787 .0112 L .91816 .01125 L .91846 .01128 L .91863 .01129 L .91879 .01131 L .91909 .01132 L .91937 .01133 L .91967 .01133 L .91984 .01133 L .92 .01132 L .92028 .01131 L .92054 .01129 L .92084 .01127 L .92113 .01124 L .92175 .01115 L .92241 .01104 L .92358 .01078 L .92624 .01003 L .92854 .00921 L .92981 .0088 L .93101 .00847 L .93155 .00836 L .93212 .00825 L .93242 .00821 L .93275 .00817 L .93305 .00815 L .93333 .00813 L .93359 .00812 L Mistroke .93387 .00812 L .9341 .00812 L .93435 .00814 L .93463 .00816 L .93492 .00819 L .9352 .0083 L .93545 .00852 L .93791 .01089 L .9405 .01355 L .94157 .01453 L .94272 .01545 L .94305 .01568 L .94337 .01588 L .94366 .01605 L .94397 .01609 L .94427 .01597 L .94459 .01582 L .94515 .01552 L .94768 .01363 L .95005 .01138 L .95107 .01038 L .95217 .00933 L .95232 .00919 L .95249 .00903 L .95279 .00885 L .95336 .00856 L .95448 .00806 L .95564 .00764 L .95686 .0073 L .95748 .00717 L .95781 .00712 L .95816 .00707 L .95849 .00703 L .95878 .007 L .95908 .00698 L .95936 .00697 L .95965 .00696 L .9599 .00696 L .9602 .00697 L .96048 .00698 L .96073 .007 L .96097 .00702 L .96123 .00705 L .96151 .00711 L .96262 .00742 L .96385 .00786 L .96632 .00907 L .96858 .01048 L .97365 .01441 L .97619 .01658 L Mistroke Mfstroke [ 6 4 ] 0 Mabsdash .02381 0 m .02435 0 L .02494 0 L .02549 0 L .02573 0 L .02599 0 L .02629 0 L .02657 0 L .02688 0 L .02705 0 L .02721 0 L .0275 0 L .02777 0 L .02808 0 L .02837 0 L .02895 0 L .02956 0 L .02986 0 L .03014 0 L .03039 0 L .03067 0 L .03097 0 L .0313 0 L .03197 0 L .03318 0 L .03386 0 L .0342 0 L .03451 0 L .03479 0 L .03509 0 L .03539 0 L .03556 0 L .03573 0 L .03588 0 L .03606 0 L .03624 0 L .03641 0 L .03672 0 L .03704 0 L .03742 0 L .03778 0 L .03846 0 L .03877 0 L .03906 0 L .03936 0 L .03952 0 L .03969 0 L .04082 0 L .04151 0 L .04217 0 L Mistroke .04275 0 L .04308 0 L .04339 0 L .04369 0 L .04401 0 L .04433 0 L .04451 0 L .04468 0 L .04499 0 L .04527 0 L .04559 0 L .0459 0 L .04646 0 L .04699 0 L .04756 0 L .04785 0 L .04817 0 L .04946 0 L .05017 0 L .05082 0 L .05143 0 L .0517 0 L .05199 0 L .0523 0 L .0526 0 L .05277 0 L .05294 0 L .05326 0 L .05355 0 L .05381 0 L .05412 0 L .05441 0 L .05493 0 L .0555 0 L .05611 0 L .05643 0 L .05661 0 L .05677 0 L .05707 0 L .05734 0 L .05796 0 L .05857 0 L .05923 0 L .05984 0 L .06042 0 L .06073 0 L .06089 0 L .06107 0 L .06138 0 L .06166 0 L Mistroke .06182 0 L .06199 0 L .0623 0 L .06249 0 L .06268 0 L .06302 0 L .06332 0 L .06364 0 L .06424 0 L .06476 0 L .06506 0 L .06534 0 L .06564 1e-05 L .06597 3e-05 L .06663 5e-05 L .06782 .0001 L .06839 .00011 L .0687 .00012 L .06902 .00013 L .0693 .00013 L .06961 .00014 L .06989 .00014 L .07015 .00014 L .07041 .00014 L .07069 .00014 L .07092 .00014 L .07118 .00013 L .07145 .00013 L .07175 .00012 L .07228 .0001 L .07291 6e-05 L .07357 2e-05 L Mfstroke .07357 2e-05 m .07379 0 L s .09179 0 m .0928 .02042 L .09405 .04954 L .09628 .10923 L .10133 .26466 L .10363 .33795 L .10489 .37161 L .10609 .39717 L .10663 .40629 L .1072 .41414 L .1075 .41743 L .10783 .4204 L .10813 .42246 L .10841 .42382 L .10867 .42456 L .10894 .42159 L .10918 .41497 L .10943 .40729 L .11053 .36936 L .11318 .25506 L .11568 .13542 L .11677 .08519 L .11706 .07249 L .11737 .05916 L .11766 .04915 L .11793 .04403 L .11853 .03346 L .11919 .02341 L .12036 .0094 L .12095 .00402 L s .12095 .00402 m .12148 0 L s .13564 0 m .13592 8e-05 L .13653 .00022 L .13684 .00028 L .13718 .00033 L .13745 .00037 L .13774 .0004 L .13805 .00042 L .13833 .00044 L .13862 .00045 L .13888 .00045 L .13913 .00045 L .13939 .00045 L .13966 .00044 L .13996 .00043 L .14024 .00041 L .14049 .0004 L .14171 .00027 L .14288 .00012 L .14321 7e-05 L .14338 4e-05 L .14355 2e-05 L s .14355 2e-05 m .14371 0 L s .14371 0 m .14387 0 L .14417 0 L .14474 1e-05 L .14535 1e-05 L .14586 1e-05 L .14616 1e-05 L .14643 1e-05 L .14671 1e-05 L .14697 1e-05 L .14721 1e-05 L .14747 1e-05 L .14775 1e-05 L .14805 1e-05 L .1483 1e-05 L .14858 1e-05 L .15106 1e-05 L .15166 0 L .15199 0 L .1523 0 L .15248 0 L .15267 0 L .15301 0 L .15367 0 L .15423 0 L .15455 0 L .15485 0 L .15516 0 L .15545 0 L .15561 0 L .15578 0 L .15609 0 L .15639 0 L .15666 0 L .15696 0 L .15725 0 L .15777 0 L .15833 0 L .15956 0 L .16016 0 L .16071 0 L .16101 0 L .16129 0 L .16158 0 L .16191 0 L .16224 0 L .16259 0 L .16292 0 L .16322 0 L .16347 0 L Mistroke .16375 0 L .16404 0 L .16432 0 L .16458 0 L .16486 0 L .16512 0 L .16536 0 L .16566 0 L .16594 0 L .16657 0 L .16771 0 L .16885 0 L .16915 0 L .16947 0 L .16978 0 L .17007 0 L .17063 0 L .17122 0 L .17172 0 L .172 0 L .17227 0 L .17256 0 L .17288 0 L .17304 0 L .17321 0 L .17353 0 L .17384 0 L .17413 0 L .17439 0 L .17468 0 L .17533 0 L .17603 0 L .17728 0 L .17789 0 L .17819 0 L .17847 0 L .17872 0 L .17899 0 L .17956 0 L .18202 0 L .18646 0 L .19654 0 L .20626 0 L .21561 0 L .22036 0 L .22556 0 L .22795 0 L .22927 0 L .22992 0 L .2302 0 L Mistroke .23052 0 L .23081 0 L .23108 0 L .23168 0 L .23294 0 L .23345 0 L .234 0 L .23428 0 L .23459 0 L .23488 0 L .23514 0 L .23545 0 L .23561 0 L .23578 0 L .23608 0 L .23637 0 L .23654 0 L .2367 0 L .23701 0 L .23734 0 L .2377 0 L .2383 0 L .23863 0 L .23895 0 L .23924 0 L .23956 0 L .24011 0 L .24125 0 L .24187 0 L .24246 0 L .24295 0 L .24321 0 L .24349 0 L .24379 0 L .24408 0 L .24436 0 L .24461 0 L .24492 0 L .2452 0 L .24546 0 L .24574 0 L .24605 0 L .24637 0 L .24696 0 L .24724 0 L .24755 0 L .24784 0 L .24811 0 L .24835 0 L .24862 0 L Mistroke .24915 0 L .2504 0 L .25109 0 L .25142 0 L .25174 0 L .25203 0 L .25234 0 L .25266 0 L .25284 0 L .253 0 L .25329 0 L .25355 0 L .25385 0 L .25415 0 L .25445 0 L .25478 0 L .25536 0 L .25594 0 L .25619 0 L .25647 0 L .25676 0 L .25704 0 L .25767 0 L .25894 0 L .25951 0 L .26013 0 L .26041 0 L .26072 0 L .261 0 L .26126 0 L .26154 0 L .26179 0 L .26207 0 L .26236 0 L .26261 0 L .26285 0 L .26311 0 L .26339 0 L .26401 0 L .26467 0 L .26495 0 L .26524 0 L .26541 0 L .26556 0 L .26586 0 L .26714 0 L .26782 0 L .26855 0 L .26888 0 L .26919 0 L Mistroke .2695 0 L .26978 0 L .27005 0 L .27033 0 L .27061 0 L .27093 0 L .27109 0 L .27125 0 L .27155 0 L .27187 0 L .27222 0 L .27285 0 L .27343 0 L .27371 0 L .27401 0 L .27427 0 L .27455 0 L .27576 0 L .27635 0 L .2769 0 L .27745 0 L .27795 0 L .27824 0 L .27854 0 L .27885 0 L .27903 0 L .27919 0 L .27937 0 L .27953 0 L .27984 0 L .28001 0 L .28017 0 L .28053 0 L .28085 0 L .28114 0 L .2817 0 L .28229 0 L .28246 0 L .28263 0 L .28294 0 L .28323 1e-05 L .28356 1e-05 L .28414 2e-05 L .28524 3e-05 L .28586 4e-05 L .2862 4e-05 L .28652 4e-05 L .28681 5e-05 L .28708 5e-05 L .28738 5e-05 L Mistroke .28754 5e-05 L .2877 5e-05 L .28798 5e-05 L .28823 5e-05 L .28853 5e-05 L .2888 4e-05 L .28906 4e-05 L .28929 4e-05 L .28982 3e-05 L .29036 3e-05 L .29095 1e-05 L .29125 0 L .29157 1e-05 L .29187 6e-05 L .29215 .00011 L .29331 .0003 L .29395 .00038 L .29426 .00041 L .29454 .00044 L .29481 .00045 L .29509 .00047 L .29537 .00047 L .29569 .00047 L .29595 .00047 L .29624 .00045 L .29651 .00043 L .29676 .0004 L .29707 .00036 L .29741 .0003 L .298 .00016 L Mfstroke .298 .00016 m .29853 0 L s .313 0 m .31342 .00462 L .31396 .01185 L .31526 .03534 L .31649 .06639 L .31711 .08536 L .31729 .09128 L .31745 .09706 L .31776 .11493 L .31894 .20067 L .32161 .4125 L .32398 .59718 L s .32398 .59718 m .32428 .61803 L s .34099 .61803 m .34103 .61782 L .3421 .60996 L .34326 .59921 L .34389 .5912 L .34455 .5798 L .34573 .55694 L .34815 .50059 L .35073 .42644 L .35323 .32728 L .35551 .20686 L .35767 .10359 L .35885 .05678 L .35996 .02179 L .36051 .00813 L .36082 .0017 L s .36082 .0017 m .36098 0 L s .36118 0 m .36142 .00454 L .36176 .0121 L .36237 .02855 L .3646 .11255 L .36964 .3813 L .37209 .50594 L .37441 .60296 L s .37441 .60296 m .37488 .61803 L s .38009 .61803 m .38419 .3906 L .38669 .23088 L .38809 .16656 L .38938 .1228 L .39177 .05655 L .39308 .0284 L .39429 .00711 L s .39429 .00711 m .3948 0 L s .40707 0 m .40729 .00013 L .40854 .00072 L .40964 .00113 L .41082 .00146 L .41147 .00159 L .41214 .00171 L .41271 .00178 L .41334 .00184 L .41369 .00186 L .41401 .00188 L .41431 .00189 L .41462 .0019 L .41479 .00191 L .41497 .00191 L .41516 .00191 L .41533 .00191 L .41565 .0019 L .41582 .0019 L .41599 .00189 L .41659 .00186 L .41693 .00184 L .41725 .00182 L .41844 .0017 L .4208 .0014 L .42144 .0013 L .42175 .00126 L .42204 .00122 L .42234 .00119 L .42266 .00117 L .42334 .00111 L .42575 .00092 L .42795 .00077 L .42912 .00071 L .42968 .00069 L .43021 .00067 L .43048 .00066 L .43077 .00066 L .43094 .00066 L .4311 .00067 L .4314 .00068 L .43265 .00073 L .4371 .00097 L .43829 .00103 L .43888 .00105 L .43914 .00106 L .43942 .00107 L .43973 .00106 L .44005 .00105 L .44072 .00103 L Mistroke .4419 .00097 L .44419 .00086 L .44636 .00076 L .44694 .00074 L .44755 .00072 L .44787 .00071 L .44805 .0007 L .44822 .00071 L .44852 .00071 L .44884 .00071 L .44941 .00072 L .45002 .00074 L .45109 .00077 L .45235 .00083 L .45352 .0009 L .45479 .00099 L .45546 .00105 L .45617 .00111 L .45647 .00114 L .45664 .00116 L .4568 .00117 L .45699 .0012 L .45716 .00123 L .4575 .00128 L .45872 .00148 L .46113 .00187 L .46235 .00206 L .4635 .00222 L .46453 .00234 L .46481 .00237 L .4651 .0024 L .46536 .00242 L .46564 .00242 L .46594 .00242 L .46622 .00241 L .46684 .00238 L .46797 .00231 L .47045 .00211 L .47262 .00194 L .47314 .0019 L .47371 .00187 L .47388 .00186 L .47403 .00185 L .47433 .00184 L .47461 .00183 L .47491 .00183 L .47523 .00182 L .47552 .00182 L .47568 .00182 L .47585 .00182 L Mistroke .47616 .00183 L .47646 .00183 L .47677 .00184 L .47704 .00185 L .47733 .00186 L .47788 .00189 L .47848 .00192 L .47955 .00202 L .4802 .0021 L .48091 .0022 L .48153 .0023 L .48219 .00242 L .48247 .00248 L .48278 .00255 L .48296 .0026 L .48312 .00266 L .48344 .00277 L .48459 .00323 L .48957 .0055 L .4942 .00734 L .50343 .00993 L .50598 .01052 L .50723 .01075 L .50778 .01085 L .50839 .01094 L .50865 .01097 L .50893 .01101 L .5092 .011 L .50944 .01099 L .51001 .01097 L .51055 .01094 L .51178 .01087 L .51289 .0108 L .51347 .01077 L .51409 .01074 L .51438 .01073 L .51468 .01072 L .51494 .01071 L .51522 .01071 L .51539 .01071 L .51555 .01071 L .51584 .01071 L .51616 .01071 L .51634 .01072 L .51651 .01072 L .51678 .01073 L .51709 .01075 L .51741 .01077 L .5177 .01081 L .51797 .01088 L Mistroke .51825 .01097 L .51882 .01115 L .51985 .01152 L .52216 .01251 L .53201 .01775 L .53656 .02054 L .53895 .02214 L .54148 .02362 L .54277 .02423 L .54312 .02438 L .5435 .02453 L .54368 .0246 L .54386 .02465 L .54401 .02467 L .54418 .02469 L .5445 .02473 L .54481 .02476 L .54512 .02478 L .54529 .02479 L .54547 .0248 L .54577 .02481 L .54609 .02481 L .54637 .02481 L .54667 .0248 L .54682 .02479 L .547 .02478 L .54731 .02476 L .54789 .02471 L .54857 .02462 L .5492 .02452 L .55033 .02428 L .55155 .02398 L .5539 .02317 L .5561 .02231 L .55869 .02137 L .55995 .021 L .5605 .02086 L .56079 .02079 L .5611 .02073 L .56141 .02071 L .56171 .02071 L .56198 .02071 L .56228 .02072 L .5626 .02073 L .56277 .02074 L .56294 .02075 L .56355 .02081 L .56389 .02085 L .5642 .02089 L .56492 .02102 L Mistroke .56622 .02132 L .56734 .02167 L .56858 .02213 L .57109 .0234 L .57578 .02664 L .58084 .03067 L .58336 .03262 L .5857 .0342 L .58631 .03456 L .58688 .03488 L .5872 .03504 L .58738 .0351 L .58754 .03514 L .58814 .03528 L .58882 .0354 L .58944 .03549 L .5901 .03556 L .59044 .03559 L .59082 .03561 L .59114 .03563 L .59143 .03564 L .5916 .03564 L .59177 .03565 L .59209 .03565 L .59239 .03565 L .59271 .03565 L .59298 .03565 L .59327 .03564 L .59362 .03563 L .59394 .03562 L .59466 .03559 L .59533 .03556 L .59563 .03555 L .59578 .03554 L .59595 .03554 L .59625 .03554 L .59653 .03555 L .59715 .03556 L .59782 .03558 L .59846 .0356 L .59905 .03563 L .59969 .03566 L .60083 .03574 L .60211 .03587 L .60332 .03603 L .60559 .03641 L .60686 .03668 L .60803 .037 L .60932 .03747 L .61067 .03811 L Mistroke .61185 .0388 L .61243 .03919 L .61297 .03958 L .61327 .03982 L .61359 .04024 L .61426 .04128 L .61543 .04317 L .61775 .04689 L .61987 .04989 L .62098 .05114 L .62153 .05166 L .62185 .05192 L .62214 .05196 L .62246 .05177 L .62276 .05157 L .62333 .05113 L .62459 .04989 L .6267 .04734 L .62902 .04431 L .62961 .04358 L .63024 .04285 L .63054 .04251 L .63083 .04229 L .63109 .04226 L .63137 .04223 L .63154 .04222 L .6317 .04222 L .632 .04222 L .63232 .04224 L .6325 .04226 L .63267 .04228 L .63325 .04237 L .63355 .04243 L .63387 .04251 L .63499 .04286 L .63618 .04336 L .63834 .04446 L .64349 .04638 L .64837 .04804 L .6505 .04907 L .6528 .05002 L .65344 .05023 L .65411 .05041 L .65473 .05055 L .65504 .05061 L .65531 .05065 L .65558 .05069 L .65586 .05072 L .65616 .05074 L .65644 .05075 L Mistroke .65675 .05075 L .65691 .05069 L .65708 .05061 L .65767 .05033 L .66015 .04879 L .66247 .047 L .66757 .04366 L .67699 .03785 L .687 .02934 L .68943 .02818 L .69076 .02755 L .69201 .0268 L .69444 .02481 L .69665 .02314 L .69778 .02239 L .69897 .02171 L .69947 .02147 L .69999 .02124 L .7003 .02113 L .70057 .02109 L .70085 .02105 L .70111 .02103 L .70139 .02101 L .70169 .021 L .70201 .021 L .70231 .02102 L .70259 .02104 L .70284 .02107 L .70314 .02112 L .70342 .02117 L .70404 .02133 L .70462 .02152 L .70593 .02211 L .70716 .02288 L .7078 .02336 L .70849 .02394 L .70974 .02541 L .7109 .02708 L .71541 .03448 L .71788 .0386 L .72023 .04225 L .72233 .04492 L .72352 .04607 L .72408 .04651 L .72462 .04685 L .72514 .04712 L .72541 .04723 L .72571 .04733 L .72601 .04741 L .72618 .04743 L Mistroke .72633 .04745 L .72661 .04725 L .72691 .04697 L .72935 .04386 L .73442 .0349 L .7369 .03162 L .73959 .02908 L .74083 .02815 L .74213 .02731 L .74267 .02702 L .74325 .02674 L .74342 .02666 L .74358 .02659 L .74388 .02651 L .74417 .02649 L .74448 .02648 L .74463 .02648 L .7448 .02648 L .7451 .02648 L .74542 .0265 L .7456 .02651 L .74577 .02652 L .74635 .02657 L .74698 .02663 L .74807 .02677 L .74925 .02691 L .7496 .02695 L .74997 .02698 L .7503 .027 L .75062 .02702 L .75092 .02703 L .75124 .02703 L .75141 .02703 L .75159 .02703 L .75175 .02702 L .75192 .02701 L .75224 .02699 L .75252 .02693 L .75269 .02681 L .75286 .02669 L .75317 .02645 L .75434 .02549 L .75907 .02101 L .76037 .01983 L .76071 .01953 L .76089 .01938 L .76108 .01921 L .76125 .01909 L .76144 .01902 L .76176 .01889 L Mistroke .76307 .01844 L .76427 .01813 L .76551 .0179 L .76665 .01773 L .76789 .0176 L .76853 .01755 L .7692 .0175 L .76951 .01748 L .7698 .01746 L .77007 .01742 L .77035 .01736 L .77142 .01717 L .77384 .01673 L .77856 .01598 L .78375 .01536 L .78612 .01515 L .78868 .01494 L .78991 .01486 L .79109 .01479 L .79214 .01474 L .79274 .01472 L .79329 .01471 L .79361 .0147 L .79378 .0147 L .79393 .0147 L .79422 .01469 L .79453 .01469 L .7947 .01469 L .79486 .01469 L .79517 .01469 L .79534 .0147 L .7955 .0147 L .79567 .0147 L .79586 .0147 L .79614 .01473 L .79641 .01477 L .79703 .01487 L .79827 .01507 L .7994 .01526 L .80061 .01544 L .80173 .01557 L .80228 .01563 L .80278 .01567 L .80306 .01568 L .80337 .0157 L .80368 .01571 L .80384 .01571 L .804 .01571 L .80428 .01572 L .80453 .01571 L Mistroke .80483 .01566 L .80511 .01559 L .80765 .01479 L .81276 .01263 L .82204 .00972 L .82471 .00859 L .82722 .00759 L .82947 .00683 L .83009 .00665 L .83043 .00657 L .83074 .00649 L .83101 .00648 L .8313 .00647 L .83162 .00646 L .83191 .00646 L .83219 .00646 L .8325 .00647 L .83265 .00647 L .83282 .00648 L .83313 .00649 L .83371 .00652 L .83425 .00656 L .83679 .00681 L .83792 .00694 L .83852 .00701 L .83885 .00705 L .83916 .00708 L .83945 .00711 L .83977 .00711 L .84006 .0071 L .84033 .0071 L .84085 .00709 L .84141 .00707 L .84261 .00702 L .84371 .00696 L .84617 .00678 L .84726 .00667 L .84845 .00654 L .85061 .00621 L .85308 .00584 L .8554 .00555 L .85597 .0055 L .85628 .00547 L .85657 .00545 L .85688 .00543 L .85705 .00544 L .85722 .00546 L .85782 .00551 L .8605 .00581 L .8617 .00594 L Mistroke .86298 .00606 L .86364 .0061 L .86402 .00612 L .8642 .00613 L .86438 .00614 L .86453 .00614 L .8647 .00615 L .865 .00615 L .86517 .00615 L .86535 .00615 L .86551 .00615 L .86567 .00612 L .86597 .00602 L .8663 .00591 L .86688 .00571 L .86818 .00522 L .87055 .00434 L .87174 .00395 L .87285 .00365 L .87347 .00352 L .8738 .00346 L .87398 .00343 L .87414 .00341 L .87444 .00346 L .87476 .00356 L .87532 .00376 L .87977 .00589 L .881 .00652 L .88215 .00708 L .88248 .00722 L .88278 .00735 L .88306 .00744 L .88336 .0075 L .88399 .00759 L .88434 .00763 L .88467 .00766 L .88495 .00768 L .88521 .00769 L .88549 .00771 L .8858 .00771 L .8861 .00772 L .88626 .00772 L .88642 .00772 L .8867 .00771 L .887 .0077 L .88726 .00768 L .88753 .00766 L .88803 .00762 L .88861 .00754 L .88915 .00746 L Mistroke .8903 .00723 L .89093 .00707 L .89124 .00699 L .89153 .00691 L .8918 .0068 L .89208 .00667 L .89268 .00638 L .89373 .00584 L .89615 .00453 L .89875 .00314 L .89936 .00284 L .90002 .00253 L .90122 .00213 L .9024 .00185 L .90292 .00175 L .90349 .00166 L .90379 .00163 L .90407 .0016 L .90433 .00157 L .90461 .00155 L .90487 .00154 L .90511 .00154 L .90536 .00153 L .90563 .00153 L .90593 .00154 L .90625 .00156 L .90655 .00158 L .90683 .00161 L .90736 .00168 L .90792 .00177 L .9085 .0019 L .90882 .00198 L .90911 .00207 L .90936 .00221 L .90963 .00237 L .9102 .00271 L .91264 .00442 L .91495 .00618 L .91708 .00775 L .91828 .00843 L .91889 .00868 L .91956 .00892 L .92086 .00933 L .92157 .00951 L .92225 .00966 L .92288 .00977 L .92357 .00988 L .9242 .00995 L .92478 .01 L .92509 .01002 L Mistroke .92538 .01003 L .92564 .01004 L .92592 .01005 L .92623 .01005 L .92638 .01005 L .92655 .01002 L .92686 .00995 L .92714 .00988 L .92968 .00914 L .93093 .00879 L .93208 .00852 L .93262 .00841 L .93313 .00834 L .93341 .00831 L .93366 .00828 L .93394 .00826 L .93424 .00825 L .93452 .00825 L .93479 .00825 L .93507 .00826 L .93538 .00848 L .93658 .00949 L .93907 .01182 L .94038 .01304 L .94177 .0142 L .94298 .01504 L .94331 .01523 L .9435 .01533 L .94367 .01542 L .94383 .01549 L .94401 .01543 L .94431 .0153 L .94553 .01464 L .94666 .01385 L .94902 .01184 L .95026 .0107 L .95156 .0095 L .95212 .00901 L .95242 .00875 L .95271 .00856 L .95305 .0084 L .95336 .00827 L .95397 .00802 L .95502 .00766 L .95561 .0075 L .95617 .00737 L .9567 .00727 L .95698 .00723 L .95728 .0072 L .95759 .00717 L Mistroke .95789 .00715 L .95818 .00714 L .95845 .00714 L .95873 .00714 L .95899 .00715 L .95922 .00716 L .95947 .00719 L .95975 .00722 L .96004 .00726 L .96056 .00735 L .96085 .00741 L .96112 .00748 L .96144 .00762 L .96173 .00779 L .96283 .00846 L .96532 .01029 L .96764 .01218 L .96878 .0131 L .96928 .01349 L .96956 .01371 L .96983 .01391 L .97008 .01406 L .97036 .01418 L .97092 .01441 L .9721 .01486 L .97461 .01568 L .97619 .01616 L Mfstroke gsave .1627 .54936 -69.125 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (4) show 68.500 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (s) show 75.250 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .27381 .54936 -69.125 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (5) show 68.500 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (s) show 75.250 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .42063 .54936 -68.3438 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (1) show 68.500 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (p) show 73.688 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore [ ] 0 setdash .27381 .52876 m .32937 .39829 L s .42063 .52876 m .34127 .44636 L s .42063 .52876 m .37698 .41202 L s MathSubEnd P % End of sub-graphic 0 g gsave .00476 .74883 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (1.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 .87964 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (2.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 1.01044 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (3.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 1.14124 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (4.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .08428 .01038 -71.7188 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 69.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (10) show 80.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .23545 .01038 -68.9688 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 69.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (8) show 74.938 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .38662 .01038 -68.9688 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 69.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (6) show 74.938 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .53779 .01038 -68.9688 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 69.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (4) show 74.938 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .68896 .01038 -68.9688 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 69.438 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (2) show 74.938 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .84014 .01038 -65.75 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (0) show 68.500 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 .16023 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (1.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 .29103 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (2.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 .42183 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (3.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .00476 .55263 -78.75 -9.59375 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (4.0) show 76.750 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave -0.11905 .91234 -107.781 -9.6875 Mabsadd m 1 1 Mabs scale currentpoint translate 102.094 9.6875 translate 90 rotate -102.094 -9.6875 translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.375 translate 1 -1 scale 63.000 12.312 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (LDOS) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 92.812 12.312 moveto (@) show 96.125 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (states) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 122.625 12.312 moveto (\220) show 125.750 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (eV) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 137.875 12.312 moveto (D) show 141.188 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave .5 -0.05886 -86.2812 -15.1875 Mabsadd m 1 1 Mabs scale currentpoint translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.1875 translate 1 -1 scale 63.000 12.125 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (E) show 69.625 12.125 moveto %%IncludeResource: font Math1 %%IncludeFont: Math1 /Math1 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (-) show 76.062 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (E) show 82.688 13.688 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 7.125 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (F) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 90.812 12.125 moveto (@) show 94.125 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (eV) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 106.250 12.125 moveto (D) show 109.562 12.125 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore gsave -0.11905 .32373 -107.781 -9.6875 Mabsadd m 1 1 Mabs scale currentpoint translate 102.094 9.6875 translate 90 rotate -102.094 -9.6875 translate /MISOfy { /newfontname exch def /oldfontname exch def oldfontname findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding ISOLatin1Encoding def currentdict end newfontname exch definefont pop } def 0 19.375 translate 1 -1 scale 63.000 12.312 moveto %%IncludeResource: font Helvetica %%IncludeFont: Helvetica %%BeginResource: font Helvetica-MISO %%BeginFont: Helvetica-MISO /Helvetica /Helvetica-MISO MISOfy %%EndFont %%EndResource %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 63.000 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (LDOS) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 92.812 12.312 moveto (@) show 96.125 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (states) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 122.625 12.312 moveto (\220) show 125.750 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor (eV) show %%IncludeResource: font Math2 %%IncludeFont: Math2 /Math2 findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 137.875 12.312 moveto (D) show 141.188 12.312 moveto %%IncludeResource: font Helvetica-MISO %%IncludeFont: Helvetica-MISO /Helvetica-MISO findfont 10.000 scalefont [1 0 0 -1 0 0 ] makefont setfont 0.000 0.000 0.000 setrgbcolor 0.000 0.000 rmoveto 1.000 setlinewidth grestore 0 0 m 1 0 L 1 1.23607 L 0 1.23607 L closepath newpath % End of Graphics MathPictureEnd %%PSTrailer end grestore %%EPS Trailer %%Trailer %%EOF %%EndDocument @endspecial -150 2131 a Fq(FIG.)36 b(4:)54 b(LDOS)35 b(analysis)h(of)h(CO)e(adsorb)r(ed)h(at)g(the)f(bridge)h(site)-150 2218 y(E)50 b(on)h(Pd\(210\).)109 b(Upp)r(er)49 b(panel:)84 b(Lo)r(cal)52 b Fh(d)p Fq(-band)d(densit)n(y)g(of)-150 2305 y(states)d(of)h(the)e(top-most)f(Pd)i(atom)f(b)r(efore)i (\(dashed\))e(and)g(af-)-150 2393 y(ter)f(\(solid\))h(CO)g(adsorption.) 91 b(The)45 b Fh(d)p Fq(-band)e(cen)n(ter)h(is)h(shifted)-150 2480 y(from)38 b Fa(\000)p Fq(1)p Fh(:)p Fq(26)i(eV)e(to)h Fa(\000)p Fq(1)p Fh(:)p Fq(82)h(eV)e(up)r(on)g(CO)h(adsorption.)74 b(Lo)n(w)n(er)-150 2567 y(panel:)44 b(Lo)r(cal)32 b(DOS)d(\(summed)f(o) n(v)n(er)i(all)h(orbitals\))h(at)e(the)g(carb)r(on)-150 2654 y(\(solid\))25 b(and)f(o)n(xygen)f(atom)h(\(dashed\))g(with)g(a)h (pro)t(jection)g(radius)f(of)-150 2741 y Fh(r)f Fq(=)e(1)p Fh(:)p Fq(058)187 2728 y(\027)187 2741 y(A)h(\(2)i(b)r(ohr)o(\).)34 b(The)23 b(resonan)n(t)g(lev)n(els)h(are)f(lab)r(eled)h(accord-)-150 2829 y(ing)31 b(to)f(the)g(orbitals)h(they)f(originate)h(from)f(in)h (the)e(free)i(gas-phase)-150 2916 y(CO)21 b(molecule)f(as)h(rev)n (ealed)g(b)n(y)f(an)g(analysis)i(of)f(the)f(orbital-resolv)n(ed)-150 3003 y(DOS.)26 b(The)h(p)r(eak)g(at)g Fa(\000)p Fq(6)p Fh(:)p Fq(6)h(eV)e(exhibits)h(a)g(double-p)r(eak)g(structure)-150 3090 y(with)f(b)r(oth)f(5)p Fh(\033)k Fq(and)c(1)p Fh(\031)k Fq(con)n(tributions.)-150 3582 y Fs(to)e(the)h(reduced)g(corrugation)d (in)j(the)g(adsorption)e(energies.)-67 3790 y(This)33 b(in)n(teraction)f(picture)g(is)h(also)f(capable)g(of)h(accoun)n(ting) -150 3885 y(for)42 b(the)g(fact)g(that)h(CO)f(alw)n(a)n(ys)e(adsorbs)g (with)j(the)f(carb)r(on)-150 3981 y(atom)36 b(to)n(w)n(ards)f(the)i (surface)f([47)o(].)65 b(On)36 b(Pd\(210\),)i(DFT)f(cal-)-150 4076 y(culations)d(with)h(the)g(o)n(xygen)e(p)r(oin)n(ting)h(to)n(w)n (ards)e(the)j(surface)-150 4172 y(giv)n(es)25 b(a)g(roughly)g(non-b)r (onding)g(scenario)f(yielding)i(no)f(net)i(en-)-150 4267 y(ergy)34 b(gain)h(in)h(con)n(trast)e(to)h(the)h(large)e(adsorption)g (energy)g(of)-150 4363 y(1)p Fm(:)p Fs(88)22 b(eV)i(for)f(carb)r (on-terminated)f(b)r(onding.)36 b(In)24 b(the)g(describ)r(ed)-150 4458 y(\014nal)k(electronic)g(structure)g(after)f(the)i(metal)g Fm(d)p Fs(-band)f(in)n(terac-)-150 4554 y(tion)e(is)g(tak)n(en)g(in)n (to)g(accoun)n(t,)g(b)r(oth)g(the)h(in)n(teractions)e(of)h(the)h Fm(\033)-150 4649 y Fs(and)k(the)g Fm(\031)j Fs(orbitals)29 b(result)i(in)g(a)f(net)h(c)n(harge)e(transfer)g(to)i(the)-150 4745 y(atom)26 b(not)h(b)r(onding)g(to)g(the)g(surface.)36 b(As)27 b(the)g(o)n(xygen)e(atom)i(is)-150 4840 y(more)33 b(electronegativ)n(e,)h(adsorption)f(with)i(the)g(carb)r(on)e(atom)-150 4936 y(to)n(w)n(ards)c(the)j(surface)e(yields)h(a)g(m)n(uc)n(h)g (larger)e(adsorption)h(en-)-150 5031 y(ergy)-7 b(.)35 b(In)27 b(addition,)f(the)h(5)p Fm(\033)i Fs(orbital)c(is)h(mainly)g (lo)r(cated)g(at)g(the)-150 5127 y(carb)r(on)32 b(atom)h([5,)i(11)o(,)g (12)o(])e(whic)n(h)g(leads)g(to)g(a)g(larger)f(o)n(v)n(erlap)-150 5222 y(with)i(the)h(Pd)e(surface)g(for)h(the)g(carb)r(on)f(end)h(do)n (wn)g(and)f(th)n(us)-150 5318 y(to)27 b(a)h(stronger)d(in)n(teraction)i (compared)f(to)i(the)g(situation)f(with)-150 5413 y(the)h(o)n(xygen)e (atom)h(do)n(wn.)2220 -83 y Fo(B.)88 b(Coadsorption)31 b(of)f(H)g(and)f(CO)h(on)g(Pd\(210\))2125 142 y Fs(The)g(adsorption)g (energies)f(of)h(CO)g(on)h(Pd\(210\))e(are)h(signif-)2042 238 y(ican)n(tly)i(larger)f(than)i(those)f(of)h(h)n(ydrogen)e(on)h (Pd\(210\).)51 b(It)33 b(is)2042 333 y(th)n(us)27 b(v)n(ery)f(lik)n (ely)g(that)h(an)n(y)g(coadsorption)e(of)i(carb)r(on)f(mono)n(x-)2042 429 y(ide)d(and)g(h)n(ydrogen)f(will)h(b)r(e)g(dominated)g(b)n(y)g(the) h(CO)e(molecule.)2042 524 y(Nev)n(ertheless,)45 b(due)e(to)f(the)h (rather)f(op)r(en)g(structure)g(of)h(the)2042 620 y(\(210\))e(surface,) k(atomic)d(or)f(ev)n(en)h(molecular)f(h)n(ydrogen)g(ad-)2042 715 y(sorption)j(migh)n(t)h(still)g(b)r(e)g(p)r(ossible.)89 b(On)45 b(a)f(sp)r(ecially)h(pre-)2042 811 y(pared)23 b(Ni\(100\))g(surface)h(co)n(v)n(ered)e(with)i(h)n(ydrogen)e(and)i (carb)r(on)2042 906 y(mono)n(xide,)e(for)g(instance,)i(a)e(structural)f (transformation)g(up)r(on)2042 1002 y(heating)36 b(and)h(the)h (formation)e(of)h(c)n(hemisorb)r(ed)f(H)3711 1014 y Fk(2)3786 1002 y Fs(is)h(found)2042 1097 y([50)o(].)48 b(Ho)n(w)n(ev)n(er,)30 b(coadsorption)f(exp)r(erimen)n(ts)i(of)h(CO)f(and)g(H)4047 1109 y Fk(2)2042 1193 y Fs(sho)n(w)n(ed)26 b(a)h(strong)g(inhibition)h (of)g(h)n(ydrogen)e(adsorption)g([45)o(].)2125 1300 y(The)19 b(computed)g(atomic)g(h)n(ydrogen)e(adsorption)h(energies)g(for)2042 1396 y(one)30 b(h)n(ydrogen)f(atom)g(p)r(er)i(surface)e(unit)i(cell)g (in)f(the)h(presence)2042 1491 y(of)h(CO)f(at)h(di\013eren)n(t)g(sites) f(are)g(listed)h(in)g(T)-7 b(able)32 b(IV.)50 b(In)32 b(addi-)2042 1587 y(tion,)k(the)e(atomic)g(h)n(ydrogen)f(adsorption)g (energies)g(on)h(clean)2042 1682 y(Pd\(210\))39 b(are)g(included)i(as)f (a)g(reference)g([23)o(].)75 b(The)41 b(atomic)2042 1777 y(H)23 b(adsorption)e(energies)h(w)n(ere)g(computed)h(with)g(resp)r (ect)g(to)g(the)2042 1873 y(theoretical)29 b(binding)i(energy)e(of)h(H) 3185 1885 y Fk(2)3253 1873 y Fs(in)h(the)g(P)-7 b(A)e(W)30 b(pseudop)r(o-)2042 1968 y(ten)n(tial)40 b(appro)n(ximation.)71 b(Note)40 b(that)g(the)g(bridge)g(site)f(C)h(is)2042 2064 y(no)33 b(stable)h(atomic)f(h)n(ydrogen)f(adsorption)g(site,)k (the)e(H)g(atom)2042 2159 y(rather)26 b(relaxes)g(to)n(w)n(ards)g(the)i (quasi-threefold)f(C')g(site.)2125 2267 y(The)33 b(o)n(v)n(erall)e (trend)j(is)f(a)g(signi\014can)n(t)f(reduction)h(of)h(atomic)2042 2362 y(h)n(ydrogen)23 b(adsorption)h(energies)g(at)h(all)g(sites)f(due) i(to)f(the)g(pres-)2042 2458 y(ence)35 b(of)h(CO)g(on)f(Pd\(210\),)i (in)f(agreemen)n(t)e(with)j(the)f(exp)r(eri-)2042 2807 y Fq(T)-6 b(ABLE)20 b(IV:)f(A)n(tomic)h(h)n(ydrogen)f(adsorption)h (energies)h(in)f(eV/atom)2042 2895 y(on)e(clean)h([23)q(])f(and)g(CO)g (preco)n(v)n(ered)g(Pd\(210\).)32 b(The)19 b(co)n(v)n(erage)g(corre-) 2042 2982 y(sp)r(onds)j(to)g(one)g(H)f(atom)h(and)f(one)h(CO)g (molecule)g(p)r(er)g(\(210\))h(surface)2042 3069 y(unit)30 b(cell.)49 b(If)31 b(the)f(adsorption)h(site)g(is)g(not)f(stable,)j (the)d(relaxation)2042 3156 y(path)25 b(of)h(the)g(adsorbate)g(is)g (indicated.)p 2227 3265 1673 4 v 2227 3282 V 3171 3362 a Fh(E)3228 3371 y Fe(ad)3321 3362 y Fq(\(eV\))p 2744 3392 1156 4 v 2243 3469 a(CO-p)r(os)34 b(H-p)r(os)131 b(Fixed)26 b(slab)191 b(Relaxed)26 b(slab)p 2227 3498 1673 4 v 2351 3579 a({)211 b(A)356 b({)490 b(0.45)2351 3685 y({)213 b(B)358 b({)490 b(0.52)2351 3792 y({)170 b(C)2614 3760 y Fe(\()p Ff(\003)p Fe(\))3014 3792 y Fq({)490 b(0.44)2351 3899 y({)202 b(C')347 b({)490 b(0.51)p 2227 3928 V 2344 4009 a(E)204 b(A)307 b(0.09)442 b(0.12)2344 4115 y(E)195 b(C')298 b(0.22)442 b(0.31)2344 4222 y(E)186 b(C")290 b(0.19)442 b(0.27)2344 4328 y(E)206 b(B)121 b(H-p)r(os:)34 b(B)26 b Fa(!)g Fq(C')67 b(H-p)r(os:)34 b(B)26 b Fa(!)f Fq(C')p 2227 4358 V 2343 4438 a(C)202 b(A)307 b(0.13)442 b(0.22)2343 4545 y(C)204 b(B)309 b(0.24)442 b(0.30)2343 4652 y(C)184 b(C")94 b(H-p)r(os:)34 b(C")26 b Fa(!)g Fq(B)49 b(H-p)r(os:)34 b(C")27 b Fa(!)e Fq(B)2343 4758 y(C)205 b(E)134 b(H-p)r(os:)35 b(E)25 b Fa(!)h Fq(B)91 b(H-p)r(os:)34 b(E)26 b Fa(!)f Fq(B)p 2227 4788 V 2343 4868 a(B)203 b(A)307 b(0.16)442 b(0.22)2343 4975 y(B)204 b(C)309 b(0.04)442 b(0.08)2343 5081 y(B)185 b(C")86 b(CO-p)r(os:)34 b(B)26 b Fa(!)g Fq(E)33 b(CO-p)r(os:)i(B)26 b Fa(!)f Fq(E)2343 5188 y(B)206 b(E)133 b(H-p)r(os:)34 b(E)26 b Fa(!)f Fq(A)87 b(H-p)r(os:)35 b(E)25 b Fa(!)h Fq(A)p 2227 5217 V 2227 5234 V 2057 5280 a Fe(\()p Ff(\003)p Fe(\))2167 5311 y Fq(This)g(site)g(is)h(not)e(stable)h(for)h(h)n (ydrogen)e(adsorption)h(\(see)g(text\))p eop %%Page: 6 6 6 5 bop 4043 -299 a Fs(6)-150 -83 y(men)n(tal)20 b(results)g([45)o(].) 35 b(F)-7 b(or)20 b(CO)g(adsorb)r(ed)f(on)h(the)h(energetically)-150 12 y(most)i(fa)n(v)n(orable)e(site)i(E,)f(the)i(threefold)e(co)r (ordinated)g(site)h(C')h(is)-150 108 y(the)e(only)e(one)h(to)g(remain)g (somewhat)f(reactiv)n(e)g(with)i(resp)r(ect)f(to)-150 203 y(h)n(ydrogen)h(adsorption.)35 b(Due)24 b(to)g(the)h(adsorb)r(ed)e (CO)h(molecule,)-150 299 y(the)33 b(mirror)e(symmetry)h(along)g([1)947 281 y(\026)947 299 y(2)o(0])g(and)h(th)n(us)g(the)g(degener-)-150 394 y(acy)21 b(of)h(sites)g(C')g(and)f(C")h(is)g(remo)n(v)n(ed:)32 b(The)22 b(adsorption)f(energy)-150 490 y(at)28 b(site)f(C")g(is)h (sligh)n(tly)f(reduced)g(in)h(comparison)e(to)i(site)f(C')h(as)-150 585 y(the)22 b(distance)f(of)h(the)f(h)n(ydrogen)f(atom)h(to)h(the)g (neigh)n(b)r(oring)e(CO)-150 681 y(molecules)32 b(is)h(shorter.)52 b(A)34 b(h)n(ydrogen)d(atoms)h(exp)r(eriences)h(an)-150 776 y(ev)n(en)c(larger)f(repulsion)i(at)f(site)h(A)h(since)e(it)i(is)f (rather)e(close)i(to)-150 872 y(the)e(adsorb)r(ed)f(CO)g(molecule.)37 b(A)n(t)28 b(the)g(step)f(site)h(B,)g(the)g(most)-150 967 y(reactiv)n(e)36 b(one)i(on)f(the)h(clean)f(\(210\))g(surface,)j (atomic)d(h)n(ydro-)-150 1063 y(gen)29 b(is)f(no)h(longer)f(stable)g (as)h(the)g(h)n(ydrogen)e(is)i(pushed)g(to)g(the)-150 1158 y(neigh)n(b)r(oring)g(C')i(site)g(instead.)46 b(This)31 b(can)f(b)r(e)h(understo)r(o)r(d)g(b)n(y)-150 1254 y(lo)r(oking)h(at)i (the)f(disso)r(ciation)g(of)g(form)n(yl,)h(HCO,)f(on)g(a)g(metal)-150 1349 y(surface)22 b([51)o(].)36 b(Once)23 b(the)g(carb)r(on-b)r(onded)f (h)n(ydrogen)g(\(starting)-150 1445 y(from)k(a)f(gas-phase)f(b)r(ond)i (length)h(of)f(appro)n(ximately)e(1)p Fm(:)p Fs(1)1716 1430 y(\027)1716 1445 y(A\))j(is)-150 1540 y(sligh)n(tly)32 b(separated)f(from)h(the)g(carb)r(on)g(atom,)h(b)r(oth)g(b)r(eing)f(in) -150 1636 y(con)n(tact)27 b(with)i(the)f(metal)g(surface,)g(the)g(h)n (ydrogen)f(is)h(strongly)-150 1731 y(rep)r(elled)j(and)g(separates)f (itself)i(from)e(the)i(remaining)e(CO.)h(In)-150 1826 y(this)f(con)n(text,)f(it)h(is)f(clear)f(that)i(the)f(h)n(ydrogen)f (molecule)h(tries)-150 1922 y(to)20 b(maximize)g(its)g(distance)g(to)g (all)f(neigh)n(b)r(oring)g(CO)h(molecules.)-67 2035 y(Site)35 b(C)g(is)g(energetically)f(almost)g(degenerate)f(with)j(site)f(E)-150 2131 y(with)42 b(regard)d(to)i(the)h(CO)f(adsorption.)76 b(According)40 b(to)h(T)-7 b(a-)-150 2226 y(ble)28 b(IV,)h(the)f(CO)f (induced)i(reduction)e(in)i(the)f(h)n(ydrogen)e(bind-)-150 2322 y(ing)k(energies)f(is)h(also)f(similar.)44 b(A)n(t)30 b(site)g(A,)h(the)f(h)n(ydrogen)f(ad-)-150 2417 y(sorption)39 b(energy)f(is)i(less)f(a\013ected)h(b)n(y)f(CO)g(on)h(site)g(C)f(than) -150 2513 y(on)33 b(site)g(E)f(b)r(ecause)g(of)h(the)h(larger)d(CO-H)h (distance.)52 b(Hydro-)-150 2608 y(gen)40 b(placed)f(b)r(oth)i(on)f (site)g(C")f(and)h(on)g(site)g(E)g(is)f(unstable)-150 2704 y(and)24 b(pushed)g(to)g(site)g(B.)g(Note)g(that)g(h)n(ydrogen)f (usually)g(prefers)-150 2799 y(high-co)r(ordinated)j(sites)h(on)g(Pd)g (surfaces)f(and)h(that)g(therefore)-150 2895 y(the)d(bridge)g(site)g(E) f(is)h(also)f(an)h(unstable)f(h)n(ydrogen)g(adsorption)-150 2990 y(site)28 b(on)f(clean)g(Pd\(210\).)-67 3104 y(Finally)k(w)n(e)f (address)f(the)j(coadsorption)c(of)j(CO)f(and)h(H)g(for)-150 3199 y(CO)39 b(lo)r(cated)h(at)g(the)g(step)g(site)g(B.)g(F)-7 b(or)39 b(this)h(con\014guration,)-150 3295 y(h)n(ydrogen)27 b(can)h(only)g(adsorb)f(on)h(site)g(A)h(with)g(an)f(appreciable)-150 3390 y(binding)21 b(energy)-7 b(.)33 b(Site)21 b(C)f(is)g(no)g(longer)f (unstable)i(for)e(H)i(adsorp-)-150 3486 y(tion)30 b(as)f(on)h(the)g (clean)f(surface)g(due)h(to)g(the)g(repulsion)f(caused)-150 3581 y(b)n(y)39 b(the)i(CO)e(molecules)g(whic)n(h)h(are)f(lo)r(cated)g (symmetrically)-150 3676 y(at)e(b)r(oth)g(adjacen)n(t)f(B)h(sites.)64 b(Ho)n(w)n(ev)n(er,)37 b(this)g(repulsion)g(also)-150 3772 y(leads)22 b(to)h(a)f(signi\014can)n(t)g(lo)n(w)n(ering)f(of)i (the)g(atomic)f(h)n(ydrogen)f(ad-)-150 3867 y(sorption)29 b(energies.)45 b(In)n(terestingly)-7 b(,)30 b(for)g(h)n(ydrogen)f(lo)r (cated)i(at)-150 3963 y(site)20 b(C",)h(the)f(CO)g(adsorption)f(site)i (B)f(is)h(no)f(longer)f(metastable,)-150 4058 y(i.e.)45 b(no)30 b(lo)r(cal)g(energy)f(minim)n(um.)45 b(No)n(w)30 b(it)h(is)f(not)g(the)h(h)n(ydro-)-150 4154 y(gen)39 b(atom)h(that)g(is)f(displaced)h(up)r(on)g(energy)e(minimisation,)-150 4249 y(but)e(rather)f(the)h(CO)f(molecule)h(that)g(is)f(shifted)h(to)n (w)n(ards)e(its)-150 4345 y(most)d(fa)n(v)n(orable)e(adsorption)h(site) h(E.)g(This)g(is)h(a)e(consequence)-150 4440 y(of)f(the)g(relativ)n (ely)e(small)h(corrugation)f(of)h(the)i(CO)e(adsorption)-150 4536 y(energies)20 b(on)h(Pd\(210\).)34 b(An)21 b(H)h(atom)f(placed)g (on)g(site)h(E)e(is)i(again)-150 4631 y(unstable)28 b(and)f(rather)g (adsorbs)e(on)j(site)f(A.)-67 4745 y(With)e(resp)r(ect)f(to)g(the)h (mec)n(hanism)f(of)g(the)g(p)r(oisoning)g(of)g(the)-150 4840 y(h)n(ydrogen)f(adsorption)h(b)n(y)h(preadsorb)r(ed)e(CO)i(on)f (Pd\(210\),)h(w)n(e)-150 4936 y(note)32 b(that)h(b)r(oth)g(atomic)e(h)n (ydrogen)g(and)h(CO)g(lead)g(to)g(an)g(in-)-150 5031 y(crease)27 b(of)h(the)h(w)n(ork)e(function)i(up)r(on)g(adsorption.)38 b(Th)n(us)28 b(they)-150 5127 y(should)c(exp)r(erience)g(a)g(m)n(utual) h(dip)r(ole-dip)r(ole)f(repulsion)g(when)-150 5222 y(they)35 b(are)f(coadsorb)r(ed.)56 b(In)35 b(the)g(discussion)f(ab)r(o)n(v)n(e,) h(w)n(e)g(ha)n(v)n(e)-150 5318 y(seen)e(that)h(the)g(reduction)g(in)f (the)h(h)n(ydrogen)e(adsorption)h(en-)-150 5413 y(ergies)c(caused)h(b)n (y)g(the)h(presence)f(of)g(CO)h(correlates)d(with)j(the)2042 -83 y(CO-H)j(distance)h(whic)n(h)g(is)g(indicativ)n(e)g(of)g(a)f (direct)h(repulsiv)n(e)2042 12 y(in)n(teraction.)2125 126 y(Ho)n(w)n(ev)n(er,)59 b(the)c(increase)f(of)g(the)h(w)n(ork)f (function)h(up)r(on)2042 221 y(atomic)61 b(h)n(ydrogen)g(adsorption)g (is)h(rather)f(small,)70 b(ab)r(out)2042 317 y(0.2)35 b(eV)i([22)o(].)64 b(Besides,)38 b(w)n(e)e(note)h(that)f(atomic)g(h)n (ydrogen)f(is)2042 412 y(adsorb)r(ed)25 b(m)n(uc)n(h)h(closer)g(to)g (the)h(surface)e(than)i(CO.)f(A)n(t)h(site)f(B,)2042 508 y(the)c(h)n(ydrogen)e(atom)h(is)g(lo)r(cated)h(at)f(ab)r(out)h(the) g(same)f(heigh)n(t)g(as)2042 603 y(the)28 b(upp)r(ermost)g(Pd)f(la)n(y) n(er)f(while)i(at)f(the)i(other)e(h)n(ydrogen)f(ad-)2042 699 y(sorption)e(sites)g(\(A,)i(C')f(and)g(C"\))g(it)g(is)g(ev)n(en)f (0)p Fm(:)p Fs(2)13 b Fn(\000)g Fs(0)p Fm(:)p Fs(8)3789 684 y(\027)3789 699 y(A)26 b(b)r(elo)n(w)2042 794 y(the)j(upp)r(ermost) g(Pd)f(la)n(y)n(er.)39 b(In)29 b(con)n(trast,)f(the)h(cen)n(ter)f(of)h (mass)2042 890 y(of)d(the)g(adsorb)r(ed)e(CO)i(molecule)f(is)h(lo)r (cated)f(ab)r(out)h(2)3788 875 y(\027)3788 890 y(A)h(ab)r(o)n(v)n(e) 2042 985 y(the)f(top)g(Pd)g(la)n(y)n(er.)34 b(Th)n(us)26 b(the)g(in\015uence)g(of)g(the)g(dip)r(ole-dip)r(ole)2042 1081 y(in)n(teraction)34 b(on)h(the)g(h)n(ydrogen)f(adsorption)g (energies)f(should)2042 1176 y(b)r(e)27 b(limited.)38 b(As)27 b(far)f(as)h(the)g(coadsorption)e(of)i(CO)g(with)g(w)n(ater) 2042 1272 y(on)f(Pd/Au)g(o)n(v)n(erla)n(y)n(ers)d(is)j(concerned,)g (also)f(a)h(relativ)n(ely)f(w)n(eak)2042 1367 y(dip)r(ole-dip)r(ole)h (in)n(teraction)f(b)r(et)n(w)n(een)h(CO)f(and)h(H)3641 1379 y Fk(2)3679 1367 y Fs(O)f(has)h(b)r(een)2042 1463 y(found)i(in)g(recen)n(t)f(DFT)h(calculations)e([52)o(].)2125 1576 y(Apart)c(from)f(the)i(direct)e(in)n(teraction)g(b)r(et)n(w)n(een) h(the)h(coadsor-)2042 1672 y(bates,)g(the)g(CO-induced)f(mo)r (di\014cation)g(of)h(the)g(substrate)e(den-)2042 1767 y(sit)n(y)32 b(of)g(states)f(can)h(also)f(lead)h(to)g(signi\014can)n(t) f(c)n(hanges)f(in)j(the)2042 1862 y(h)n(ydrogen)j(adsorption)g (energies.)65 b(This)38 b(indirect)f(substrate-)2042 1958 y(mediated)32 b(mec)n(hanism)f(has)g(for)g(example)h(b)r(een)g (discussed)f(in)2042 2053 y(the)45 b(case)e(of)i(the)g(p)r(oisoning)e (of)i(h)n(ydrogen)e(disso)r(ciation)g(at)2042 2149 y(Pd\(100\))30 b(b)n(y)h(adsorb)r(ed)f(sulfur)h([53)o(,)h(54)o(].)48 b(The)31 b(c)n(hange)f(in)i(the)2042 2244 y(adsorption)k(energies)g (can)h(b)r(e)h(understo)r(o)r(d)f(in)h(terms)f(of)h(the)2042 2340 y Fm(d)p Fs(-band)32 b(mo)r(del)h([55)o(].)53 b(According)32 b(to)g(the)i Fm(d)p Fs(-band)e(mo)r(del,)i(an)2042 2435 y(energetic)i(do)n(wnshift)h(of)g(the)g(p)r(osition)g(of)g(the)g(lo)r (cal)f Fm(d)p Fs(-band)2042 2531 y(cen)n(ter)g(leads)h(to)g(smaller)f (c)n(hemical)g(binding)i(at)f(the)g(partic-)2042 2626 y(ular)31 b(surface.)49 b(Analogously)30 b(to)h(the)i(situation)e(of)h (a)f(Pd\(210\))2042 2722 y(surface)19 b(pre-co)n(v)n(ered)f(with)j(h)n (ydrogen)e([23)o(],)k(the)d Fm(d)p Fs(-band)h(cen)n(ter)2042 2817 y(is)29 b(reduced)h(with)g(resp)r(ect)g(to)f(its)h(v)-5 b(alue)30 b(on)g(the)g(clean)f(surface)2042 2913 y(up)r(on)j(CO)g (adsorption.)50 b(The)33 b Fm(d)p Fs(-band)f(cen)n(ter)g(of)g(the)h (top)f(Pd)2042 3008 y(atom)d(shifts)i(from)e Fm(")2716 3020 y Fd(d)2781 3008 y Fs(=)e Fn(\000)p Fs(1)p Fm(:)p Fs(26)h(eV)i(to)g Fm(")3387 3020 y Fd(d)3452 3008 y Fs(=)c Fn(\000)p Fs(1)p Fm(:)p Fs(82)j(eV.)h(Due)2042 3104 y(to)25 b(the)g(signi\014can)n(t)f(in)n(teraction)h(of)g(the)g(CO)g(molecule)f (with)i(its)2042 3199 y(neigh)n(b)r(oring)k(Pd)i(atoms,)g(this)g(shift) h(is)e(m)n(uc)n(h)h(larger)e(than)i(in)2042 3295 y(the)26 b(case)f(of)h(a)f(monola)n(y)n(er)f(of)i(atomic)f(h)n(ydrogen.)35 b(This)25 b(strong)2042 3390 y(do)n(wn-shift)i(th)n(us)g(explains)f (the)i(rather)e(large)g(decrease)f(in)j(the)2042 3486 y(h)n(ydrogen)e(binding)i(energies)e(on)h(the)h(CO-co)n(v)n(ered)d (surface.)2125 3599 y(On)c(clean)g(Pd\(210\),)h(a)f(co)r(existence)g (of)h(atomic)f(and)h(molecu-)2042 3694 y(lar)g(h)n(ydrogen)f (adsorption)h(states)h(has)f(b)r(een)i(found)f([22)o(].)36 b(DFT)2042 3790 y(calculations)25 b(ha)n(v)n(e)g(demonstrated)g(that)h (atomic)g(h)n(ydrogen)e(at)2042 3885 y(site)e(B)h(hinders)f(the)h (disso)r(ciation)e(of)i(additional)f(H)3679 3897 y Fk(2)3739 3885 y Fs(ab)r(o)n(v)n(e)f(the)2042 3981 y(top)26 b(Pd)g(atom)f(\(site) i(D,)f(see)g(Fig.)g(1\).)36 b(Th)n(us)26 b(the)h(H)3670 3993 y Fk(2)3733 3981 y Fs(molecular)2042 4076 y(adsorption)g(state)i (b)r(ecomes)f(metastable)h(with)g(a)f(binding)h(en-)2042 4172 y(ergy)d(of)h(0.27)f(eV)i(p)r(er)f(H)2827 4184 y Fk(2)2892 4172 y Fs(molecule.)37 b(On)27 b(the)h(CO)f(preco)n(v)n(ered) 2042 4267 y(surface,)21 b(H)2401 4279 y Fk(2)2459 4267 y Fs(molecular)f(adsorption)f(is)h(no)h(longer)e(exothermic.)2042 4363 y(F)-7 b(or)27 b(CO)h(adsorb)r(ed)f(at)h(site)g(E,)g(the)h(H)3267 4375 y Fk(2)3333 4363 y Fs(adsorption)d(energy)h(at)2042 4458 y(the)e(top)g(Pd)g(atom)f(is)h(no)n(w)g(ev)n(en)f(sligh)n(tly)h (negativ)n(e)e(\()p Fn(\000)p Fs(0)p Fm(:)p Fs(01)h(eV)2042 4554 y(p)r(er)34 b(H)2256 4566 y Fk(2)2328 4554 y Fs(molecule\))g(with) g(resp)r(ect)g(to)g(the)h(gas)e(phase)h(H)3902 4566 y Fk(2)3973 4554 y Fs(en-)2042 4649 y(ergy)29 b(,)j(although)e(it)h(is)f (still)h(a)f(metastable)g(site)h(separated)e(b)n(y)2042 4745 y(a)36 b(barrier)g(from)g(the)i(v)-5 b(acuum.)65 b(Note)37 b(that)g(the)g(H)3741 4757 y Fk(2)3816 4745 y Fs(adsorp-)2042 4840 y(tion)j(on)g(h)n(ydrogen)e(co)n(v)n(ered)h (Pd\(210\))f(leads)i(to)g(a)g(decrease)2042 4936 y(of)35 b(the)h(w)n(ork)e(function;)40 b(hence)35 b(there)g(should)h(b)r(e)f (an)g(attrac-)2042 5031 y(tiv)n(e)e(dip)r(ole-dip)r(ole)g(in)n (teraction)g(b)r(et)n(w)n(een)g(adsorb)r(ed)f(H)3879 5043 y Fk(2)3950 5031 y Fs(and)2042 5127 y(CO.)d(The)g(fact)h(that)f(H) 2800 5139 y Fk(2)2867 5127 y Fs(molecular)f(adsorption)g(is)h(no)g (longer)2042 5222 y(exothermic)38 b(on)h(CO-co)n(v)n(ered)d(Pd\(210\))i (con\014rms)g(that)h(it)g(is)2042 5318 y(predominan)n(tly)22 b(the)i(CO-induced)f(do)n(wnshift)g(of)g(the)h(lo)r(cal)e(Pd)2042 5413 y Fm(d)p Fs(-band)35 b(cen)n(ter)g(whic)n(h)g(is)g(resp)r(onsible) g(for)g(the)g(reduction)g(of)p eop %%Page: 7 7 7 6 bop 4043 -299 a Fs(7)-150 -83 y(the)28 b(h)n(ydrogen)e(adsorption)g (energies.)439 193 y Fo(IV.)88 b(CONCLUSIONS)-67 407 y Fs(W)-7 b(e)30 b(ha)n(v)n(e)f(p)r(erformed)h(densit)n(y)f(functional) h(theory)g(calcula-)-150 502 y(tions)21 b(to)g(study)g(the)h (adsorption)d(of)i(CO)g(and)g(the)g(coadsorption)-150 598 y(of)32 b(CO)g(and)g(h)n(ydrogen)f(on)h(the)g(\(210\))g(surface)f (of)i(palladium.)-150 693 y(W)-7 b(e)36 b(found)f(that)g(the)h(v)-5 b(ariation)34 b(of)h(the)h(CO)e(binding)i(energy)-150 789 y(is)26 b(comparably)e(small)i(across)d(di\013eren)n(t)j (adsorption)f(sites)h(and)-150 884 y(that)35 b(b)r(onding)f(of)h(CO)f (is)g(a)g(v)n(ery)f(lo)r(cal)h(pro)r(cess.)56 b(As)35 b(on)f(the)-150 980 y(Pd\(100\))e(surface,)j(CO)e(prefers)g(to)g (adsorb)f(in)i(a)f(bridge)g(con-)-150 1075 y(\014guration)h(on)g (Pd\(210\))g(with)h(the)g(t)n(w)n(o)f(inequiv)-5 b(alen)n(t)35 b(bridge)-150 1171 y(sites)g(b)r(eing)g(energetically)f(practically)g (degenerate.)58 b(A)n(t)35 b(the)-150 1266 y(bridge)42 b(site)h(on)g(the)g(\(100\))f(terrace,)j(CO)e(adsorbs)e(inclined)-150 1361 y(with)35 b(resp)r(ect)f(to)g(the)g(surface)g(normal.)55 b(An)35 b(analysis)e(of)h(the)-150 1457 y(LDOS)k(yielded)h(a)f(v)n(ery) f(similar)h(picture)g(to)g(the)h(one)f(found)2042 -83 y(on)d(a)g(\015at)g(\(100\))g(surface.)59 b(A)n(tomic)35 b(adsorption)f(energies)g(on)2042 12 y(a)j(CO-preco)n(v)n(ered)d (surface)j(are)f(signi\014can)n(tly)h(reduced,)i(and)2042 108 y(molecular)e(H)2493 120 y Fk(2)2569 108 y Fs(adsorption)h(b)r (ecomes)g(completely)g(inhibited)2042 203 y(in)31 b(con)n(trast)f(to)h (the)g(H-preco)n(v)n(ered)d(Pd\(210\))i(surface.)46 b(Apart)2042 299 y(from)22 b(direct)g(electrostatic)f(repulsion,)i(the)g(p)r (oisoning)e(e\013ect)i(of)2042 394 y(CO)g(is)g(a)g(consequence)g(of)h (the)f(strong)g(mo)r(di\014cation)g(of)h(the)f(Pd)2042 490 y Fm(d)p Fs(-band)k(up)r(on)h(CO)f(adsorption.)2716 766 y Fo(Ac)n(kno)n(wledgmen)n(ts)2125 980 y Fs(Financial)f(supp)r(ort) g(b)n(y)g(the)g(Deutsc)n(he)h(F)-7 b(orsc)n(h)n(ungsgemein-)2042 1075 y(sc)n(haft)41 b(through)g(pro)5 b(ject)41 b(GR)i(1503/11-1)37 b(is)42 b(gratefully)f(ac-)2042 1171 y(kno)n(wledged.)33 b(W)-7 b(e)21 b(also)f(thank)h(P)-7 b(.)21 b(K.)f(Sc)n(hmidt)i(and)e (K.)h(Christ-)2042 1266 y(mann)29 b(\(F)-7 b(reie)29 b(Univ)n(ersit\177)-42 b(at)28 b(Berlin\))h(for)f(sharing)g(their)h (results)2042 1361 y(with)g(us)g(prior)e(to)i(publication)g(and)f(for)g (man)n(y)h(useful)g(discus-)2042 1457 y(sions.)p 948 1675 2039 5 v 1203 1676 1529 7 v 1458 1677 1020 9 v 1712 1678 510 11 v -112 1923 a Fq([1])35 b(C.)j(B.)h(Duk)n(e,)h(editor,)74 b Fr(Surfac)l(e)39 b(Scienc)l(e:)58 b(The)39 b(\014rst)h(thirty)3 2010 y(ye)l(ars)p Fq(,)27 b(v)n(olume)e(299/300)j(of)f Fr(Surf.)g(Sci.)p Fq(,)e(1994.)-112 2097 y([2])35 b(A.)25 b(Gro\031,)36 b(Surf.)25 b(Sci.)h Fo(500)h Fq(\(2002\))g(347.)-112 2184 y([3])35 b(E.)30 b(Christo\013ersen,)j(P)-6 b(.)31 b(Liu,)g(A.)g(Ruban,)f(H.)g(L.)h(Skriv)n(er,)g(and)3 2272 y(J.)26 b(K.)g(N\034rsk)n(o)n(v,)34 b(J.)26 b(Catal.)h Fo(199)g Fq(\(2001\))f(123.)-112 2359 y([4])35 b(G.)26 b(Blyholder,)35 b(J.)26 b(Ph)n(ys.)g(Chem.)f Fo(68)h Fq(\(1964\))h(2772.)-112 2446 y([5])35 b(P)-6 b(.)25 b(Hu,)h(D.)f(A.)h(King,)g(M.-H.)f(Lee,)i(and)e(M.)h(C.)h(P)n(a)n(yne,) 34 b(Chem.)3 2533 y(Ph)n(ys.)25 b(Lett.)h Fo(246)g Fq(\(1995\))h(73.) -112 2620 y([6])35 b(H.)21 b(Aiza)n(w)n(a)i(and)e(S.)g(Tsuneyuki,)28 b(Surf.)22 b(Sci.)g Fo(399)g Fq(\(1998\))h(L364.)-112 2707 y([7])35 b(H.)25 b(Conrad,)i(G.)f(Ertl,)h(J.)g(Ko)r(c)n(h,)f(and)f (E.)h(E.)h(Latta,)35 b(Surf.)26 b(Sci.)3 2795 y Fo(43)g Fq(\(1974\))h(462.)-112 2882 y([8])35 b(A.)j(M.)h(Bradsha)n(w)h(and)e (F.)h(M.)h(Ho\013mann,)74 b(Surf.)39 b(Sci.)g Fo(72)3 2969 y Fq(\(1978\))27 b(513.)-112 3056 y([9])35 b(T.)20 b(E.)f(Madey)-6 b(,)21 b(J.)f(T.)f(Y)-6 b(ates,)21 b(Jr.,)h(A.)d(M.)g (Bradsha)n(w,)j(and)d(F.)h(M.)3 3143 y(Ho\013mann,)33 b(Surf.)25 b(Sci.)h Fo(89)g Fq(\(1979\))h(370.)-150 3230 y([10])35 b(R.)53 b(J.)i(Behm,)60 b(K.)54 b(Christmann,)60 b(G.)54 b(Ertl,)62 b(and)53 b(M.)h(A.)3 3318 y(V)-6 b(an)25 b(Ho)n(v)n(e,)33 b(J.)27 b(Chem.)e(Ph)n(ys.)g Fo(73)h Fq(\(1980\))h(2984.)-150 3405 y([11])35 b(A.)23 b(Eic)n(hler)g(and)g (J.)h(Hafner,)31 b(Ph)n(ys.)23 b(Rev.)g(B)g Fo(57)h Fq(\(1998\))g (10110.)-150 3492 y([12])35 b(F.)25 b(Delb)r(ecq)f(and)g(P)-6 b(.)24 b(Sautet,)33 b(Ph)n(ys.)24 b(Rev.)g(B)h Fo(59)g Fq(\(1999\))g(5142.)-150 3579 y([13])35 b(K.)30 b(Honk)l(ala,)h(P)-6 b(.)30 b(Piril\177)-38 b(a,)33 b(and)d(K.)g(Laasonen,)49 b(Surf.)30 b(Sci.)h Fo(489)3 3666 y Fq(\(2001\))c(72.)-150 3754 y([14])35 b(M.)26 b(K.)g(Rose,)h(T.)g(Mitsui,)g(J.)g(Dunph)n(y)-6 b(,)24 b(A.)i(Borg,)i(D.)e(F.)g(Ogle-)3 3841 y(tree,)i(M.)g(Salmeron,)g (and)f(P)-6 b(.)28 b(Sautet,)40 b(Surf.)27 b(Sci.)h Fo(512)g Fq(\(2002\))3 3928 y(48.)-150 4015 y([15])35 b(M.)23 b(Kittel,)h(R.)e(T)-6 b(erb)r(org,)25 b(M.)e(P)n(olcik,)h(A.)f(M.)g (Bradsha)n(w,)i(R.)d(L.)3 4102 y(T)-6 b(o)r(omes,)34 b(D.)f(P)-6 b(.)32 b(W)-6 b(o)r(o)r(dru\013,)34 b(and)e(E.)h(Roten)n(b) r(erg,)55 b(Surf.)33 b(Sci.)3 4189 y Fo(511)26 b Fq(\(2002\))h(34.)-150 4277 y([16])35 b(M.)22 b(Hirsim\177)-38 b(aki)20 b(and)h(M.)h(V)-6 b(alden,)28 b(J.)21 b(Chem.)g(Ph)n(ys.)g Fo(114)h Fq(\(2001\))3 4364 y(2345.)-150 4451 y([17])35 b(H.)28 b(S.)h(Kato,)g(H.)g(Okuy)n (ama,)e(J.)j(Y)-6 b(oshin)n(ub)r(o,)29 b(and)f(M.)h(Ka)n(w)n(ai,)3 4538 y(Surf.)c(Sci.)h Fo(513)h Fq(\(2002\))g(239.)-150 4625 y([18])35 b(R.)d(D.)g(Ramsier,)i(K.-W.)f(Lee,)h(and)e(J.)i(T.)f(Y) -6 b(ates,)34 b(Jr.,)57 b(Surf.)3 4712 y(Sci.)26 b Fo(322)g Fq(\(1995\))h(243.)-150 4800 y([19])35 b(S.)24 b(Katsuki)g(and)f(H.)h (T)-6 b(ak)n(eta,)33 b(Solid)24 b(State)g(Comm.)g Fo(39)g Fq(\(1981\))3 4887 y(711.)-150 4974 y([20])35 b(A.)18 b(Roudgar)g(and)g(A.)g(Gro\031,)25 b(Ph)n(ys.)18 b(Rev.)g(B)g Fo(67)h Fq(\(2003\))h(033409.)-150 5061 y([21])35 b(A.)k(Roudgar)h(and) g(A.)f(Gro\031,)81 b(J.)41 b(Electronal.)g(Chem.)f Fo(548)3 5148 y Fq(\(2003\))27 b(121.)-150 5235 y([22])35 b(P)-6 b(.)38 b(K.)g(Sc)n(hmidt,)i(K.)e(Christmann,)k(G.)c(Kresse,)43 b(J.)c(Hafner,)3 5323 y(M.)34 b(Lisc)n(hk)l(a,)j(and)c(A.)h(Gro\031,)62 b(Ph)n(ys.)34 b(Rev.)g(Lett.)g Fo(87)g Fq(\(2001\))3 5410 y(096103.)2042 1923 y([23])g(M.)22 b(Lisc)n(hk)l(a)e(and)h(A.)f (Gro\031,)29 b(Ph)n(ys.)20 b(Rev.)g(B)h Fo(65)g Fq(\(2002\))h(075420.) 2042 2010 y([24])34 b(K.)26 b(Christmann,)34 b(Surf.)26 b(Sci.)g(Rep.)f Fo(9)h Fq(\(1988\))h(1.)2042 2097 y([25])34 b(K.)g(D.)g(Rendulic,)h(G.)g(Anger,)g(and)f(A.)f(Winkler,)61 b(Surf.)34 b(Sci.)2194 2184 y Fo(208)27 b Fq(\(1989\))g(404.)2042 2272 y([26])34 b(K.)40 b(D.)f(Rendulic)f(and)h(A.)g(Winkler,)78 b(Surf.)39 b(Sci.)h Fo(299/300)2194 2359 y Fq(\(1994\))27 b(261.)2042 2446 y([27])34 b(A.)23 b(Gro\031,)i(S.)e(Wilk)n(e,)h(and)f (M.)g(Sc)n(he\017er,)30 b(Ph)n(ys.)23 b(Rev.)g(Lett.)g Fo(75)2194 2533 y Fq(\(1995\))k(2718.)2042 2620 y([28])34 b(S.)24 b(Wilk)n(e)g(and)g(M.)h(Sc)n(he\017er,)31 b(Ph)n(ys.)24 b(Rev.)f(B)i Fo(53)f Fq(\(1996\))h(4926.)2042 2707 y([29])34 b(A.)26 b(Gro\031,)35 b(Appl.)26 b(Ph)n(ys.)f(A)g Fo(67)h Fq(\(1998\))h(627.)2042 2795 y([30])34 b(W.)54 b(Dong,)61 b(V.)53 b(Leden)n(tu,)59 b(P)-6 b(.)54 b(Sautet,)60 b(A.)53 b(Eic)n(hler,)61 b(and)2194 2882 y(J.)27 b(Hafner,)35 b(Surf.)25 b(Sci.)h Fo(411)h Fq(\(1998\))f(123.)2042 2969 y([31])34 b(C.)28 b(Cresp)r(os,)h(H.)e(F.)h(Busnengo,)g(W.)f (Dong,)h(and)e(A.)h(Salin,)39 b(J.)2194 3056 y(Chem.)26 b(Ph)n(ys.)f Fo(114)h Fq(\(2001\))h(10954.)2042 3143 y([32])34 b(H.)d(F.)g(Busnengo,)i(E.)e(Pijp)r(er,)j(M.)d(F.)g(Somers,)h (G.)g(J.)f(Kro)r(es,)2194 3230 y(A.)23 b(Salin,)g(R.)f(A.)h(Olsen,)g (D.)f(Lemoine,)h(and)f(W.)h(Dong,)30 b(Chem.)2194 3318 y(Ph)n(ys.)c(Lett.)g Fo(356)g Fq(\(2002\))h(515.)2042 3405 y([33])34 b(M.)20 b(A.)e(Di)h(Cesare,)j(H.)d(F.)g(Busnengo,)i(W.)e (Dong,)h(and)f(A.)f(Salin,)2194 3492 y(J.)27 b(Chem.)e(Ph)n(ys.)h Fo(118)g Fq(\(2003\))h(11226.)2042 3579 y([34])34 b(M.)39 b(Lisc)n(hk)l(a)f(and)g(A.)f(Gro\031,)76 b(Hydrogen)37 b(on)h(palladium:)59 b(a)2194 3666 y(mo)r(del)24 b(system)f(for)i(the)f (in)n(teraction)g(of)h(atoms)f(and)g(molecules)2194 3754 y(with)i(metal)e(surfaces,)35 b(in)25 b Fr(R)l(e)l(c)l(ent)j (Developments)h(in)d(V)-6 b(acuum)2194 3841 y(Scienc)l(e)35 b(and)f(T)-6 b(e)l(chnolo)l(gy)p Fq(,)35 b(edited)d(b)n(y)f(J.)i(Dabro) n(wski,)h(pages)2194 3928 y(111{132,)29 b(Researc)n(h)d(Signp)r(ost,)g (Kerala)h(\(India\),)e(2003.)2042 4015 y([35])34 b(T.)g(Mitsui,)j(M.)c (K.)h(Rose,)h(E.)f(F)-6 b(omin,)35 b(D.)e(F.)g(Ogletree,)j(and)2194 4102 y(M.)27 b(Salmeron,)34 b(Nature)25 b Fo(422)h Fq(\(2003\))h(705.) 2042 4189 y([36])34 b(G.)d(Kresse)g(and)e(J.)i(F)-6 b(urthm)r(\177)-41 b(uller,)48 b(Ph)n(ys.)30 b(Rev.)f(B)h Fo(54)h Fq(\(1996\))2194 4277 y(11169.)2042 4364 y([37])j(G.)h(Kresse)g(and)e(J.)i(F)-6 b(urthm)r(\177)-41 b(uller,)61 b(Comput.)33 b(Mater.)i(Sci.)g Fo(6)2194 4451 y Fq(\(1996\))27 b(15.)2042 4538 y([38])34 b(J.)25 b(P)-6 b(.)23 b(P)n(erdew,)i(J.)f(A.)f(Chev)l(ary)-6 b(,)23 b(S.)h(H.)f(V)-6 b(osk)n(o,)23 b(K.)h(A.)f(Jac)n(kson,)2194 4625 y(M.)g(R.)e(P)n(ederson,)i(D.)f(J.)g(Singh,)g(and)f(C.)i (Fiolhais,)30 b(Ph)n(ys.)22 b(Rev.)2194 4712 y(B)k Fo(46)g Fq(\(1992\))h(6671.)2042 4800 y([39])34 b(P)-6 b(.)26 b(E.)g(Bl\177)-38 b(oc)n(hl,)36 b(Ph)n(ys.)25 b(Rev.)h(B)g Fo(50)g Fq(\(1994\))h(17953.)2042 4887 y([40])34 b(G.)24 b(Kresse)g(and)e(D.)h(Joub)r(ert,)31 b(Ph)n(ys.)23 b(Rev.)f(B)i Fo(59)f Fq(\(1999\))h(1758.)2042 4974 y([41])34 b(H.)22 b(J.)h(Monkhorst)f(and)f(J.)i(D.)e(P)n(ac)n(k,)29 b(Ph)n(ys.)22 b(Rev.)f(B)i Fo(13)f Fq(\(1976\))2194 5061 y(5188.)2042 5148 y([42])34 b(M.)22 b(Methfessel)g(and)f(A.)f(T.)i(P)n(axton,)27 b(Ph)n(ys.)21 b(Rev.)f(B)h Fo(40)g Fq(\(1989\))2194 5235 y(3616.)2042 5323 y([43])34 b(G.)54 b(Herzb)r(erg)f(and)f(K.)h(P)-6 b(.)53 b(Hub)r(er,)121 b Fr(Mole)l(cular)53 b(Sp)l(e)l(ctr)l(a)2194 5410 y(and)e(Mole)l(cular)f(Structur)l(e.)i(IV.)c(Constants)k(of)d (Diatomic)p eop %%Page: 8 8 8 7 bop 4043 -299 a Fs(8)3 -83 y Fr(Mole)l(cules)p Fq(,)35 b(V)-6 b(an)25 b(Nostrand)g(Reinhold,)h(1979.)-150 4 y([44])35 b(F.)d(W.)g(Kutzler)g(and)g(G.)g(S.)g(P)n(ain)n(ter,)55 b(Ph)n(ys.)32 b(Rev.)g(Lett.)g Fo(59)3 91 y Fq(\(1987\))27 b(1285.)-150 178 y([45])35 b(P)-6 b(.)42 b(K.)f(Sc)n(hmidt,)85 b Fr(We)l(chselwirkung)43 b(von)g(Wassersto\013)i(mit)3 266 y(einer)g(Pd\(210\)-)h(und)g(Ni\(210\)-Ob)l(er\015\177)-39 b(ache)p Fq(,)98 b(PhD)43 b(thesis,)3 353 y(F)-6 b(reie)26 b(Univ)n(ersit\177)-38 b(at)25 b(Berlin,)i(2002.)-150 440 y([46])35 b(E.)e(Christo\013ersen,)k(P)-6 b(.)33 b(Stoltze,)j(and)c(J.)i(K.)f(N\034rsk)n(o)n(v,)58 b(Surf.)3 527 y(Sci.)26 b Fo(505)g Fq(\(2002\))h(200.)-150 614 y([47])35 b(A.)22 b(F\177)-38 b(ohlisc)n(h,)25 b(M.)e(Nyb)r(erg,)g(P)-6 b(.)23 b(Bennic)n(h,)g(L.)g(T)-6 b(riguero,)25 b(J.)e(Has-)3 702 y(selstr\177)-38 b(om,)26 b(O.)f(Karis,)i(L.)e(G.)h(M.)g(P)n (ettersson,)h(and)e(A.)g(Nilsson,)3 789 y(J.)h(Chem.)f(Ph)n(ys.)h Fo(112)g Fq(\(2000\))h(1946.)-150 876 y([48])35 b(A.)51 b(F\177)-38 b(ohlisc)n(h,)60 b(M.)53 b(Nyb)r(erg,)58 b(J.)53 b(Hasselstr\177)-38 b(om,)59 b(O.)52 b(Karis,)3 963 y(L.)32 b(G.)g(M.)h(P)n(ettersson,)h(and)d(A.)h(Nilsson,)55 b(Ph)n(ys.)32 b(Rev.)f(Lett.)2194 -83 y Fo(85)26 b Fq(\(2000\))h(3309.) 2042 4 y([49])34 b(G.)22 b(Kresse,)h(A.)e(Gil,)j(and)d(P)-6 b(.)21 b(Sautet,)28 b(Ph)n(ys.)21 b(Rev.)g(B)g Fo(68)h Fq(\(2003\))2194 91 y(073401.)2042 178 y([50])34 b(L.)28 b(W)-6 b(esterlund,)27 b(L.)g(J\177)-38 b(onsson,)29 b(and)e(S.)g(Andersson,)38 b(Surf.)28 b(Sci.)2194 266 y Fo(187)f Fq(\(1987\))g(L669.)2042 353 y([51])34 b(J.)c(Greeley)g(and) f(M.)h(Ma)n(vrik)l(akis,)47 b(J.)30 b(Am.)e(Chem.)h(So)r(c.)g Fo(124)2194 440 y Fq(\(2002\))e(7193.)2042 527 y([52])34 b(A.)26 b(Roudgar)g(and)f(A.)g(Gro\031,)36 b(subm.)24 b(to)i(Surf.)g(Sci.)2042 614 y([53])34 b(S.)26 b(Wilk)n(e)g(and)f(M.)h (Sc)n(he\017er,)34 b(Surf.)26 b(Sci.)g Fo(329)h Fq(\(1995\))f(L605.) 2042 702 y([54])34 b(C.)28 b(M.)g(W)-6 b(ei,)27 b(A.)g(Gro\031,)i(and)d (M.)i(Sc)n(he\017er,)38 b(Ph)n(ys.)27 b(Rev.)f(B)i Fo(57)2194 789 y Fq(\(1998\))f(15572.)2042 876 y([55])34 b(B.)21 b(Hammer)d(and)i(J.)h(K.)f(N\034rsk)n(o)n(v,)25 b(Surf.)20 b(Sci.)h Fo(343)f Fq(\(1995\))i(211.)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF